NPASS Compound

Natural Product: NPC305586

Natural Product ID	NPC305586
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	VDNGQXUEDLDBAA-SWFCRFJGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10865670
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 118124 0 0 0 0 0 0 0 0999 V2000 -6.4430 -3.2725 -2.9270 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3105 -2.3973 -2.0175 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1822 -3.2165 -1.1117 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4663 -3.6814 0.1294 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7286 -2.4765 0.7115 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.7889 -1.9827 -0.3654 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5823 -1.4244 -1.3777 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8610 -1.0650 0.1145 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5714 -1.4830 -0.1118 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7722 -1.6269 1.1535 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5122 -2.4228 0.9201 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8684 -3.6106 0.2814 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5850 -0.4296 1.7742 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9201 0.5291 1.0784 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3963 0.7328 -0.3386 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8089 -0.5523 -1.0217 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7678 -1.1787 -1.6704 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4889 1.5586 -0.3013 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3869 2.7497 -0.9635 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3227 2.9789 -2.0790 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2930 4.4753 -2.4326 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9173 5.2706 -1.2844 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6332 4.4467 -0.0375 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6504 5.3173 1.1830 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3756 3.8510 -0.1162 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2927 5.2564 -1.4959 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0138 4.9104 -2.7049 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9005 2.3065 -3.2181 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5453 0.3462 1.1884 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0923 1.3814 1.8594 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8698 1.0123 3.0556 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2912 0.6332 2.9031 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7029 0.2299 1.5230 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2164 -1.1827 1.2922 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0377 1.0813 0.4808 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4320 0.9340 -0.7590 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4937 -0.0201 -1.1870 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3682 -0.4978 -0.0770 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7898 -0.3053 -0.4505 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3183 -1.1832 -1.5576 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7975 -0.8877 -1.3447 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0354 -0.6191 -0.0734 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3202 -0.2890 0.5068 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3479 -0.0594 1.7705 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5811 -0.1907 -0.1930 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5254 -0.4430 -1.5497 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7666 -0.3322 -2.1647 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7347 -0.7494 0.6409 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6053 -2.2037 1.0095 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5355 0.1724 1.7861 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0991 -0.0219 2.2779 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1409 0.3128 1.1955 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0056 2.0566 0.8705 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0999 -2.7960 1.8892 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5598 -4.6844 -0.1333 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3628 -2.5723 -0.7720 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7009 -2.6204 -3.4158 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9981 -4.1096 -2.3600 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1018 -3.6736 -3.7410 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0095 -1.8653 -2.7277 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4658 -4.1465 -1.6852 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2319 -3.9652 0.8858 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4528 -1.6552 0.9122 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2505 -2.8360 -0.8189 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6120 -2.4641 -0.6270 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4050 -2.2569 1.8470 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1161 -2.7197 1.9182 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7659 -1.9247 0.3031 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7003 -3.9995 0.5974 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1175 1.5134 1.6030 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5361 1.1225 -0.9107 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5433 -0.2478 -1.8248 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9304 -1.3296 -2.6179 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3432 2.7500 -1.4135 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3898 2.7797 -1.8436 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9197 4.6984 -3.3190 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5825 6.3003 -1.2300 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3667 3.6323 0.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1355 6.2768 0.9071 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1760 4.7867 1.9897 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6392 5.5828 1.5552 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6978 5.9483 -0.9162 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3385 4.6899 -2.0430 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9377 2.5091 -3.3234 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6433 2.1691 2.1712 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3062 0.1618 3.5549 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7732 1.8375 3.8178 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9137 1.5052 3.2448 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5130 -0.1691 3.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8083 -1.3560 0.2934 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3743 -1.3617 2.0090 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9772 -1.9360 1.6005 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9703 1.5308 -1.5248 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9836 -0.8584 -1.7343 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0955 0.5043 -1.9710 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2027 -1.5807 0.0611 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0284 0.7343 -0.6871 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1016 -2.2358 -1.3944 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9908 -0.8848 -2.5586 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4533 -0.9265 -2.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0332 0.8332 -0.1014 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3742 -0.8568 0.2769 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6688 -0.5417 -3.2344 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4160 -1.1198 -1.6822 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1929 0.6673 -1.9418 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5921 -2.5668 1.1567 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2426 -2.3313 1.9356 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0997 -2.8572 0.2614 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6212 1.2099 1.4449 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2106 -0.0098 2.6607 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9936 -1.0371 2.6870 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9870 0.7360 3.0820 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3812 1.3758 0.8871 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4938 2.9049 1.4364 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4555 2.4468 -0.0121 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3622 -3.7094 2.1985 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7710 -4.6869 0.4458 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7136 -3.0524 0.0437 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 15 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 22 26 1 0 21 27 1 0 20 28 1 0 14 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 6 33 35 1 0 35 36 2 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 43 45 1 0 45 46 1 0 46 47 1 0 42 48 1 0 48 49 1 1 48 50 1 0 50 51 1 0 51 52 1 0 35 53 1 0 5 54 1 0 4 55 1 0 3 56 1 0 7 2 1 0 16 9 1 0 25 19 1 0 53 30 1 0 52 33 1 0 52 38 1 0 48 39 1 0 1 57 1 0 1 58 1 0 1 59 1 0 2 60 1 6 3 61 1 6 4 62 1 1 5 63 1 1 6 64 1 6 9 65 1 6 10 66 1 1 11 67 1 0 11 68 1 0 12 69 1 0 14 70 1 1 15 71 1 6 16 72 1 6 17 73 1 0 19 74 1 6 20 75 1 1 21 76 1 6 22 77 1 1 23 78 1 1 24 79 1 0 24 80 1 0 24 81 1 0 26 82 1 0 27 83 1 0 28 84 1 0 30 85 1 1 31 86 1 0 31 87 1 0 32 88 1 0 32 89 1 0 34 90 1 0 34 91 1 0 34 92 1 0 36 93 1 0 37 94 1 0 37 95 1 0 38 96 1 1 39 97 1 6 40 98 1 0 40 99 1 0 41100 1 0 45101 1 0 45102 1 0 47103 1 0 47104 1 0 47105 1 0 49106 1 0 49107 1 0 49108 1 0 50109 1 0 50110 1 0 51111 1 0 51112 1 0 52113 1 6 53114 1 0 53115 1 0 54116 1 0 55117 1 0 56118 1 0 M END

Standard InCHIKey	VDNGQXUEDLDBAA-SWFCRFJGSA-N
Standard InCHI	InChI=1S/C40H62O16/c1-17-27(43)29(45)31(47)36(51-17)55-34-26(15-41)54-38(35(33(34)49)56-37-32(48)30(46)28(44)18(2)52-37)53-20-10-12-39(3)19(14-20)6-7-21-22-8-9-24(25(42)16-50-5)40(22,4)13-11-23(21)39/h6,9,17-18,20-23,26-38,41,43-49H,7-8,10-16H2,1-5H3/t17-,18-,20-,21-,22-,23-,26+,27-,28-,29+,30+,31+,32+,33-,34+,35+,36-,37-,38+,39-,40-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@@H](CO)O[C@H]([C@@H]([C@H]1O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC=C(C(=O)COC)[C@@]4(C)CC[C@H]23)C1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	798.4	Volume:	773.235 ? Van der Waals volume.
Dense:	1.033	LogP:	1.396 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.049 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.851 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	39.0
TPSA:	243.52 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	8.0	Rings:	7.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.131	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.911	Fsp³:	0.875
MCE-18:	134.587 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.68	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.267	Promiscuous compounds:	0.165

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.22	MDCK Permeability:	-5.246
Pgp-inhibitor:	0.0	Pgp-substrate:	0.864
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.033
20% Bioavailability (F20%):	0.025	30% Bioavailability (F30%):	0.222
50% Bioavailability (F50%):	0.991

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.028
Plasma Protein Binding (PPB):	60.595%	Volume Distribution (VD):	-0.374
Fu:	35.401% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.002
BSEP inhibitor:	0.203

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.98	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.782
HLM stability:	0.575 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.358

Half-life (T1/2):

2.812

ADMET: Toxicity

hERG Blockers:	0.045	hERG Blockers (10um):	0.163
Human Hepatotoxicity (H-HT):	0.218	Drug-induced Liver Injury (DILI):	0.652
AMES Toxicity:	0.834	Rat Oral Acute Toxicity:	0.007
Maximum Recommended Daily Dose:	0.008	Skin Sensitization:	0.998
Carcinogencity:	0.041	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.996
Hematotoxicity:	0.218	Drug-induced Nephrotoxicity:	0.585
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.226
A549 Cytotoxicity:	0.395	Hek293 Cytotoxicity:	0.434
BCF:	1.303 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.461 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.869 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.075 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO15886	Lepidium campestre	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO127	Phragmites australis	Species	Poaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7802	Dacrycarpus vieillardii	Species	Podocarpaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC305586 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	19429
0.1-0.2	26365
0.2-0.3	3218
0.3-0.4	733
0.4-0.5	54
0.5-0.6	32
0.6-0.7	25
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8974	High Similarity	NPC165439
0.6632	Remote Similarity	NPC94272
0.65	Remote Similarity	NPC124677
0.6465	Remote Similarity	NPC470433
0.6465	Remote Similarity	NPC46190
0.6465	Remote Similarity	NPC171073
0.6436	Remote Similarity	NPC475182
0.64	Remote Similarity	NPC248746
0.6337	Remote Similarity	NPC42171
0.63	Remote Similarity	NPC265275
0.6286	Remote Similarity	NPC194207
0.6286	Remote Similarity	NPC22779
0.6275	Remote Similarity	NPC480555
0.6275	Remote Similarity	NPC150372
0.6238	Remote Similarity	NPC122819
0.6214	Remote Similarity	NPC73243
0.6214	Remote Similarity	NPC244086
0.6214	Remote Similarity	NPC84956
0.6095	Remote Similarity	NPC486386
0.6095	Remote Similarity	NPC247037
0.6095	Remote Similarity	NPC269297
0.6095	Remote Similarity	NPC222202
0.6038	Remote Similarity	NPC475333
0.6038	Remote Similarity	NPC224098
0.6038	Remote Similarity	NPC208383
0.6	Remote Similarity	NPC232054
0.5981	Remote Similarity	NPC254255
0.5926	Remote Similarity	NPC249265
0.5926	Remote Similarity	NPC480554
0.5909	Remote Similarity	NPC287885
0.5872	Remote Similarity	NPC23808
0.5872	Remote Similarity	NPC87998
0.5818	Remote Similarity	NPC480553
0.5766	Remote Similarity	NPC308140
0.5741	Remote Similarity	NPC13193
0.5644	Remote Similarity	NPC306991
0.5638	Remote Similarity	NPC486114
0.5565	Remote Similarity	NPC480556
0.5517	Remote Similarity	NPC224314
0.5294	Remote Similarity	NPC600456
0.5283	Remote Similarity	NPC40440
0.5283	Remote Similarity	NPC486388
0.5238	Remote Similarity	NPC305423
0.5238	Remote Similarity	NPC113044
0.5238	Remote Similarity	NPC283829
0.5238	Remote Similarity	NPC470748
0.5238	Remote Similarity	NPC161676
0.5192	Remote Similarity	NPC470432
0.5192	Remote Similarity	NPC230507
0.5179	Remote Similarity	NPC32361
0.514	Remote Similarity	NPC98696
0.5094	Remote Similarity	NPC600116
0.5093	Remote Similarity	NPC602423
0.5048	Remote Similarity	NPC15249
0.5048	Remote Similarity	NPC25455
0.5045	Remote Similarity	NPC102016
0.5045	Remote Similarity	NPC95051
0.5044	Remote Similarity	NPC309278

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC305586 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6868
0.1-0.2	2167
0.2-0.3	101
0.3-0.4	12
0.4-0.5	1
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6238	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data