Natural Product: NPC179787| Natural Product ID | NPC179787 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Harman |
| IUPAC Name | 1-methyl-9H-pyrido[3,4-b]indole |
| Synonyms | harman; Harmane |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL12014 |
| PubChem CID |
5281404 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | PSFDQSOCUJVVGF-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
| SMILES | Cc1c2c(ccn1)c1ccccc1[nH]2 |
  Calculated Properties| Molecular Weight:   | 182.08 | Volume:   | 196.614 Van der Waals volume.
|
| Dense:   | 0.926 | LogP:   | 3.335 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.907 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -3.842 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 0.0 | Rigid Bonds:   | 15.0 |
| TPSA:   | 28.68 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 2.0 |
| H-Bond Donor:   | 1.0 | Rings:   | 3.0 |
| Heavy Atoms:   | 2.0 |
| QED Drug-Likeness Score:   | 0.568 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.017 | Fsp3:   | 0.083 |
| MCE-18:   | 14.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Accepted | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Accepted | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.199 | Fluc inhibitor:   | 0.155 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.853 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.209 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.045 | Promiscuous compounds:   | 0.877 |
| Caco-2 Permeability:   | -4.701 | MDCK Permeability:   | -4.632 |
| Pgp-inhibitor:   | 0.021 | Pgp-substrate:   | 0.17 |
| PAMPA:   |
0.196 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.0 |
| 20% Bioavailability (F20%):   | 0.012 | 30% Bioavailability (F30%):   | 0.066 |
| 50% Bioavailability (F50%):   | 0.234 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.841 | MRP1:   | 0.983 |
| Plasma Protein Binding (PPB):   | 93.982% | Volume Distribution (VD):   | 0.063 |
| Fu: |
4.776% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.983 |
| OATP1B3 inhibitor:   | 0.984 | BCRP inhibitor:   | 0.017 |
| BSEP inhibitor:   | 0.974 |
| CYP1A2-inhibitor:   | 0.997 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.995 | CYP2C19-substrate:   | 0.005 |
| CYP2C9-inhibitor:   | 0.997 | CYP2C9-substrate:   | 0.999 |
| CYP2D6-inhibitor:   | 0.996 | CYP2D6-substrate:   | 0.768 |
| CYP3A4-inhibitor:   | 0.994 | CYP3A4-substrate:   | 0.005 |
| CYP2B6-substrate:   | 0.031 | CYP2C8-inhibitor:   | 0.626 |
| HLM stability:   |
0.704 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 9.082 | Half-life (T1/2):   | 1.271 |
| hERG Blockers:   | 0.25 | hERG Blockers (10um):   | 0.567 |
| Human Hepatotoxicity (H-HT):   | 0.68 | Drug-induced Liver Injury (DILI):   | 0.805 |
| AMES Toxicity:   | 0.805 | Rat Oral Acute Toxicity:   | 0.724 |
| Maximum Recommended Daily Dose:   | 0.604 | Skin Sensitization:   | 0.693 |
| Carcinogencity:   | 0.799 | Eye Corrosion:   | 0.018 |
| Eye Irritation:   | 0.977 | Respiratory Toxicity:   | 0.917 |
| Drug-induced Neurotoxicity:   | 0.768 | Ototoxicity:   | 0.452 |
| Hematotoxicity:   | 0.524 | Drug-induced Nephrotoxicity:   | 0.719 |
| Genotoxicity:   | 0.5 | RPMI-8226 Immunitoxicity:   | 0.087 |
| A549 Cytotoxicity:   | 0.196 | Hek293 Cytotoxicity:   | 0.364 |
| BCF:   |
1.414 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.676 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.371 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.241 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO13456 | Symplocos racemosa | Species | Symplocaceae | Eukaryota | n.a. | stem | n.a. | DOI[10.1016/j.phytol.2008.02.001] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10869194] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[11141122] |
| NPO30753 | Symplocos setchuensis | Species | Symplocaceae | Eukaryota | stems | n.a. | n.a. |
PMID[11473435] |
| NPO30753 | Symplocos setchuensis | Species | Symplocaceae | Eukaryota | n.a. | stem | n.a. |
PMID[11473435] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | fruit | n.a. |
PMID[12932131] |
| NPO25302 | Viola philippica | Species | Violaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[14519932] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | root | n.a. |
PMID[16078700] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | fruit | n.a. |
PMID[16417304] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | roots | n.a. | n.a. |
PMID[16989524] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | branch | n.a. |
PMID[17202693] |
| NPO2833 | Cribricellina cribraria | Species | Catenicellidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[1791472] |
| NPO25419 | Pterocella vesiculosa | Species | n.a. | n.a. | n.a. | New Zealand | n.a. |
PMID[18052329] |
| NPO25419 | Pterocella vesiculosa | Species | n.a. | n.a. | n.a. | Alderman Islands off the North Island of New Zealand | n.a. |
PMID[18052329] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | leaves | n.a. | n.a. |
PMID[18588343] |
| NPO25419 | Pterocella vesiculosa | Species | n.a. | n.a. | n.a. | New Zealand | n.a. |
PMID[19220033] |
| NPO25419 | Pterocella vesiculosa | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[19220033] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19331340] |
| NPO10540 | Passiflora incarnata | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[2026709] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[20460582] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21608987] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | rhizome | n.a. |
PMID[22863942] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23848163] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | aerial parts | n.a. | n.a. |
PMID[24042007] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | fruit | n.a. |
PMID[25172746] |
| NPO28287 | Magnaporthe oryzae | Species | Magnaporthaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26258762] |
| NPO22126 | Penicillium funiculosum | Species | Trichocomaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27359163] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27700077] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[28128938] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28225280] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31789520] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31804070] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37570937] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38358042] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38838926] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38971075] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[6736972] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8910532] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15308 | Stigma croci | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4567 | Senecio chrysocoma | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO318 | Glycosmis trichanthera | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16405 | Uncaria nervosa | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18714 | Rauvolfia verticillata | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1603 | Monostroma nitidum | Species | Monostromataceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6773 | Bryoria implexa | Species | Parmeliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO28287 | Magnaporthe oryzae | Species | Magnaporthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3641 | Polyporus tuberaster | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16391 | Protea neriifolia | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25302 | Viola philippica | Species | Violaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17761 | Ophiorrhiza japonica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1034 | Ophiorrhiza liukiuensis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7952 | Commelina communis | Species | Commelinaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4763 | Uncaria elliptica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10540 | Passiflora incarnata | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14694 | Sickingia williamsii | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16419 | Rumex chalepensis | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22126 | Penicillium funiculosum | Species | Trichocomaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13456 | Symplocos racemosa | Species | Symplocaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10315 | Cestrum parqui | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25419 | Pterocella vesiculosa | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2296 | Agaricus arvensis | Species | Agaricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | Bark | n.a. | n.a. | Database[FooDB] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | Fruit Juice | n.a. | n.a. | Database[FooDB] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | Pericarp | n.a. | n.a. | Database[FooDB] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | Resin, Exudate, Sap | n.a. | n.a. | Database[FooDB] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | Root | n.a. | n.a. | Database[FooDB] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | Root | n.a. | n.a. | Database[FooDB] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | Tissue Culture | n.a. | n.a. | Database[FooDB] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10088 | Uncaria attenuata | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO16405 | Uncaria nervosa | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO15308 | Stigma croci | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10540 | Passiflora incarnata | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4763 | Uncaria elliptica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO9455 | Uncaria orientalis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO1034 | Ophiorrhiza liukiuensis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO17761 | Ophiorrhiza japonica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO18714 | Rauvolfia verticillata | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO7952 | Commelina communis | Species | Commelinaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO27458 | Uncaria acida | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13456 | Symplocos racemosa | Species | Symplocaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO9077 | Uncaria lanosa | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10815 | Uncaria borneensis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO20945 | Uncaria callophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO20369 | Uncaria canescens | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO1898 | Uncaria barbata | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | Fruits | n.a. | Database[Phenol-Explorer] | |
| NPO27458 | Uncaria acida | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO20369 | Uncaria canescens | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9077 | Uncaria lanosa | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO15308 | Stigma croci | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7952 | Commelina communis | Species | Commelinaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9455 | Uncaria orientalis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO10088 | Uncaria attenuata | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO1034 | Ophiorrhiza liukiuensis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO20945 | Uncaria callophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO10540 | Passiflora incarnata | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13456 | Symplocos racemosa | Species | Symplocaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18714 | Rauvolfia verticillata | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4763 | Uncaria elliptica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO16405 | Uncaria nervosa | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO1898 | Uncaria barbata | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO17761 | Ophiorrhiza japonica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO10815 | Uncaria borneensis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO25302 | Viola philippica | Species | Violaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO1603 | Monostroma nitidum | Species | Monostromataceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO16419 | Rumex chalepensis | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO7952 | Commelina communis | Species | Commelinaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO25302 | Viola philippica | Species | Violaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO19160 | Klasea quinquefolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6773 | Bryoria implexa | Species | Parmeliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25302 | Viola philippica | Species | Violaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27260 | Polygala tenuifolia | Species | Polygalaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO15095 | Hippophae rhamnoides | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1603 | Monostroma nitidum | Species | Monostromataceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10540 | Passiflora incarnata | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4468 | Cuspidaria pterocarpa | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9282 | Stereocaulon colensoi | Species | Stereocaulaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO28287 | Magnaporthe oryzae | Species | Magnaporthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO907 | Dictyostelium purpureum | Species | n.a. | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3641 | Polyporus tuberaster | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14694 | Sickingia williamsii | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13608 | Plumbago zeylanica | Species | Plumbaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22126 | Penicillium funiculosum | Species | Trichocomaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6849 | Lomatia arborescens | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16391 | Protea neriifolia | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10315 | Cestrum parqui | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3254 | Fusarium caucasicum | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO11596 | Lomatia ilicifolia | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10815 | Uncaria borneensis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10334 | Andropogon polyneuros | Species | Poaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4763 | Uncaria elliptica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25419 | Pterocella vesiculosa | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO318 | Glycosmis trichanthera | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10856 | Passiflora edulis | Species | Passifloraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16501 | Capsicum annuum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2296 | Agaricus arvensis | Species | Agaricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16419 | Rumex chalepensis | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4567 | Senecio chrysocoma | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10499 | Haplopappus paucidentatus | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9077 | Uncaria lanosa | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20945 | Uncaria callophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9455 | Uncaria orientalis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16405 | Uncaria nervosa | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1034 | Ophiorrhiza liukiuensis | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17761 | Ophiorrhiza japonica | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13456 | Symplocos racemosa | Species | Symplocaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14112 | Uncaria rhynchophylla | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7952 | Commelina communis | Species | Commelinaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10088 | Uncaria attenuata | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20369 | Uncaria canescens | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2833 | Cribricellina cribraria | Species | Catenicellidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27458 | Uncaria acida | Species | Rubiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Ki | = | 86000.0 | nM | PMID[8487254] |
| NPT3240 | Individual protein | Cyclin-dependent kinase 5 | Homo sapiens | Inhibition | = | 65.0 | % | PMID[11909733] |
| NPT1371 | Individual protein | Cyclin-dependent kinase 2 | Homo sapiens | Inhibition | = | 47.0 | % | PMID[11909733] |
| NPT3107 | Individual protein | Rho-associated protein kinase 2 | Homo sapiens | Activity | = | 104.0 | % | PMID[17850214] |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT1614 | Individual protein | MAP kinase p38 delta | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT1615 | Individual protein | MAP kinase p38 gamma | Homo sapiens | Activity | = | 97.0 | % | PMID[17850214] |
| NPT1695 | Individual protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Activity | = | 103.0 | % | PMID[17850214] |
| NPT1696 | Individual protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Activity | = | 97.0 | % | PMID[17850214] |
| NPT1697 | Individual protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Activity | = | 105.0 | % | PMID[17850214] |
| NPT1699 | Individual protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Activity | = | 94.0 | % | PMID[17850214] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Activity | = | 85.0 | % | PMID[17850214] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Activity | = | 80.0 | % | PMID[17850214] |
| NPT1703 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Activity | = | 95.0 | % | PMID[17850214] |
| NPT1430 | Individual protein | Serine/threonine-protein kinase AKT2 | Homo sapiens | Activity | = | 91.0 | % | PMID[17850214] |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT3455 | Individual protein | Protein kinase C zeta | Homo sapiens | Activity | = | 89.0 | % | PMID[17850214] |
| NPT3291 | Individual protein | Serine/threonine-protein kinase SRPK1 | Homo sapiens | Activity | = | 81.0 | % | PMID[17850214] |
| NPT3106 | Individual protein | Ribosomal protein S6 kinase alpha 1 | Homo sapiens | Activity | = | 98.0 | % | PMID[17850214] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Activity | = | 94.0 | % | PMID[17850214] |
| NPT1611 | Individual protein | Ribosomal protein S6 kinase 1 | Homo sapiens | Activity | = | 94.0 | % | PMID[17850214] |
| NPT1448 | Individual protein | Serine/threonine-protein kinase Sgk1 | Homo sapiens | Activity | = | 86.0 | % | PMID[17850214] |
| NPT2626 | Individual protein | Myosin light chain kinase, smooth muscle | Homo sapiens | Activity | = | 100.0 | % | PMID[17850214] |
| NPT1433 | Individual protein | Serine/threonine-protein kinase Aurora-B | Homo sapiens | Activity | = | 106.0 | % | PMID[17850214] |
| NPT3206 | Individual protein | Serine/threonine-protein kinase Aurora-C | Homo sapiens | Activity | = | 87.0 | % | PMID[17850214] |
| NPT3344 | Individual protein | BR serine/threonine-protein kinase 2 | Homo sapiens | Activity | = | 101.0 | % | PMID[17850214] |
| NPT3232 | Individual protein | CaM kinase I alpha | Homo sapiens | Activity | = | 91.0 | % | PMID[17850214] |
| NPT3248 | Individual protein | CaM-kinase kinase alpha | Homo sapiens | Activity | = | 86.0 | % | PMID[17850214] |
| NPT1678 | Individual protein | CaM-kinase kinase beta | Homo sapiens | Activity | = | 93.0 | % | PMID[17850214] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Activity | = | 99.0 | % | PMID[17850214] |
| NPT1680 | Individual protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Activity | = | 92.0 | % | PMID[17850214] |
| NPT3266 | Individual protein | Casein kinase I delta | Homo sapiens | Activity | = | 99.0 | % | PMID[17850214] |
| NPT3113 | Individual protein | Tyrosine-protein kinase CSK | Homo sapiens | Activity | = | 81.0 | % | PMID[17850214] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Activity | = | 44.0 | % | PMID[17850214] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT3460 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Homo sapiens | Activity | = | 72.0 | % | PMID[17850214] |
| NPT1344 | Individual protein | Serine/threonine-protein kinase EEF2K | Homo sapiens | Activity | = | 101.0 | % | PMID[17850214] |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Activity | = | 107.0 | % | PMID[17850214] |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Activity | = | 95.0 | % | PMID[17850214] |
| NPT3363 | Individual protein | Mitogen-activated protein kinase 15 | Homo sapiens | Activity | = | 70.0 | % | PMID[17850214] |
| NPT3331 | Individual protein | Serine/threonine-protein kinase MST2 | Homo sapiens | Activity | = | 81.0 | % | PMID[17850214] |
| NPT1658 | Individual protein | Serine/threonine-protein kinase NEK2 | Homo sapiens | Activity | = | 79.0 | % | PMID[17850214] |
| NPT1657 | Individual protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT3284 | Individual protein | Serine/threonine-protein kinase NEK7 | Homo sapiens | Activity | = | 105.0 | % | PMID[17850214] |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Activity | = | 74.0 | % | PMID[17850214] |
| NPT3432 | Individual protein | Homeodomain-interacting protein kinase 2 | Homo sapiens | Activity | = | 104.0 | % | PMID[17850214] |
| NPT3409 | Individual protein | Homeodomain-interacting protein kinase 3 | Homo sapiens | Activity | = | 104.0 | % | PMID[17850214] |
| NPT1426 | Individual protein | c-Jun N-terminal kinase 1 | Homo sapiens | Activity | = | 92.0 | % | PMID[17850214] |
| NPT1427 | Individual protein | c-Jun N-terminal kinase 2 | Homo sapiens | Activity | = | 84.0 | % | PMID[17850214] |
| NPT3207 | Individual protein | c-Jun N-terminal kinase 3 | Homo sapiens | Activity | = | 89.0 | % | PMID[17850214] |
| NPT1441 | Individual protein | MAP kinase-activated protein kinase 2 | Homo sapiens | Activity | = | 109.0 | % | PMID[17850214] |
| NPT3461 | Individual protein | MAP kinase-activated protein kinase 3 | Homo sapiens | Activity | = | 104.0 | % | PMID[17850214] |
| NPT3280 | Individual protein | Serine/threonine-protein kinase c-TAK1 | Homo sapiens | Activity | = | 128.0 | % | PMID[17850214] |
| NPT3282 | Individual protein | Maternal embryonic leucine zipper kinase | Homo sapiens | Activity | = | 82.0 | % | PMID[17850214] |
| NPT3283 | Individual protein | MAP kinase-interacting serine/threonine-protein kinase MNK1 | Homo sapiens | Activity | = | 82.0 | % | PMID[17850214] |
| NPT3213 | Individual protein | MAP kinase signal-integrating kinase 2 | Homo sapiens | Activity | = | 112.0 | % | PMID[17850214] |
| NPT1613 | Individual protein | Ribosomal protein S6 kinase alpha 5 | Homo sapiens | Activity | = | 91.0 | % | PMID[17850214] |
| NPT3364 | Individual protein | Protein kinase C mu | Homo sapiens | Activity | = | 88.0 | % | PMID[17850214] |
| NPT1612 | Individual protein | MAP kinase-activated protein kinase 5 | Homo sapiens | Activity | = | 84.0 | % | PMID[17850214] |
| NPT3357 | Individual protein | Protein kinase N2 | Homo sapiens | Activity | = | 85.0 | % | PMID[17850214] |
| NPT163 | Individual protein | Nuclear factor NF-kappa-B p105 subunit | Homo sapiens | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT210 | Individual protein | Thyroid stimulating hormone receptor | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 100000.0 | nM | PubChem BioAssay data set |
| NPT150 | Individual protein | Anthrax lethal factor | Bacillus anthracis | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT1416 | Individual protein | Neuropeptide S receptor | Homo sapiens | Potency | = | 5011.9 | nM | PubChem BioAssay data set |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 3981.1 | nM | PubChem BioAssay data set |
| NPT1139 | Individual protein | Arachidonate 15-lipoxygenase, type II | Homo sapiens | Potency | n.a. | 15848.9 | nM | PubChem BioAssay data set |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | AC50 | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 1258.93 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | AC50 | = | 3981.07 | nM | PubChem BioAssay data set |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 630.96 | nM | PubChem BioAssay data set |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Inhibition | = | 43.54 | % | PMID[22425563] |
| NPT178 | Individual protein | Protein-tyrosine phosphatase 1B | Homo sapiens | Inhibition | = | 7.7 | % | PMID[25819098] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | > | 1800.0 | nM | PMID[33528252] |
| NPT2961 | Individual protein | Tryptophan 2,3-dioxygenase | Homo sapiens | Inhibition | = | 85.0 | % | PMID[35938398] |
| NPT2961 | Individual protein | Tryptophan 2,3-dioxygenase | Homo sapiens | IC50 | = | 6310.0 | nM | PMID[35938398] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | = | 29.0 | nM | PMID[33528252] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[33528252] |
| NPT143 | Individual protein | DNA topoisomerase I | Homo sapiens | ED50 | = | 23.8 | ug ml-1 | PMID[33684825] |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | Inhibition | = | 34.0 | % | PMID[35938398] |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 99.56 | % | PMID[23571415] |
| NPT3575 | Individual protein | Chitinase | Onchocerca volvulus | IC50 | = | 7330.0 | nM | PMID[25815157] |
| NPT29497 | Protein complex group | GABA-A receptor; anion channel | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[33528252] |
| NPT996 | Protein complex | GABA-A receptor; anion channel | Homo sapiens | IC50 | = | 12302.69 | nM | PMID[9435905] |
| NPT3813 | Individual protein | Tyrosine-protein kinase SRC | Gallus gallus | Activity | = | 83.0 | % | PMID[17850214] |
| NPT3814 | Protein complex | Cyclin-dependent kinase 2/cyclin A | Homo sapiens | Activity | = | 103.0 | % | PMID[17850214] |
| NPT1609 | Protein complex | Casein kinase II | Homo sapiens | Activity | = | 85.0 | % | PMID[17850214] |
| NPT981 | Individual protein | Inhibitor of nuclear factor kappa B kinase beta subunit | Homo sapiens | Activity | = | 76.0 | % | PMID[17850214] |
| NPT491 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 1 | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT831 | Individual protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Activity | = | 81.0 | % | PMID[17850214] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 7943.3 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT95 | Individual protein | Muscarinic acetylcholine receptor M1 | Rattus norvegicus | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 21192.3 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 56234.1 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 100000.0 | nM | PubChem BioAssay data set |
| NPT698 | Individual protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 15003.0 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 79432.8 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 81.51 | % | PMID[23571415] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 71.52 | % | DOI[10.6019/CHEMBL4495564] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -4.98 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -27.15 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT728 | Individual protein | Serine/threonine-protein kinase AKT | Homo sapiens | Activity | = | 104.0 | % | PMID[17850214] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Activity | = | 108.0 | % | PMID[17850214] |
| NPT3815 | Individual protein | Tyrosine-protein kinase LCK | Mus musculus | Activity | = | 93.0 | % | PMID[17850214] |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 562.3 | nM | PubChem BioAssay data set |
| NPT8 | Individual protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 100000.0 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | IC50 | = | 20910.0 | nM | PMID[22425563] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 83.19 | % | PMID[22425563] |
| NPT805 | Protein complex | GABA-A receptor; anion channel | Rattus norvegicus | IC50 | = | 12387.97 | nM | PMID[8411009] |
| NPT805 | Protein complex | GABA-A receptor; anion channel | Rattus norvegicus | Ki | = | 12400.0 | nM | PMID[6127411] |
| NPT805 | Protein complex | GABA-A receptor; anion channel | Rattus norvegicus | IC50 | = | 12400.0 | nM | PMID[2167977] |
| NPT991 | Individual protein | Trypanothione reductase | Trypanosoma cruzi | Inhibition | = | 10.0 | % | PMID[18558492] |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT62 | Individual protein | 6-phospho-1-fructokinase | Trypanosoma brucei | Potency | n.a. | 756.9 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 9196.2 | nM | PubChem BioAssay data set |
| NPT5016 | Individual protein | DNA repair and recombination protein RAD54-like | Homo sapiens | AC50 | n.a. | 58370.0 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 7079.5 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 44668.4 | nM | PubChem BioAssay data set |
| NPT1881 | Nucleic acid | Calf thymus DNA | Bos taurus | Tm | = | 65.0 | degrees C | PMID[27567367] |
| NPT1881 | Nucleic acid | Calf thymus DNA | Bos taurus | Delta Tm | = | 4.0 | degrees C | PMID[27567367] |
| NPT439 | Individual protein | Butyrylcholinesterase | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[33528252] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 8.9 | ug ml-1 | PMID[10612592] |
| NPT81 | Cell line | A549 | Homo sapiens | ED50 | = | 9.3 | ug ml-1 | PMID[10612592] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | ED50 | = | 8.0 | ug ml-1 | PMID[10612592] |
| NPT83 | Cell line | MCF7 | Homo sapiens | ED50 | = | 19.0 | ug ml-1 | PMID[10612592] |
| NPT309 | Cell line | 1A9 | Homo sapiens | ED50 | = | 6.1 | ug ml-1 | PMID[10612592] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | ED50 | > | 20.0 | ug ml-1 | PMID[10612592] |
| NPT1535 | Cell line | U-87 MG | Homo sapiens | ED50 | = | 19.0 | ug ml-1 | PMID[10612592] |
| NPT2192 | Cell line | HEL | Homo sapiens | ED50 | = | 9.8 | ug ml-1 | PMID[10612592] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 16.5 | ug ml-1 | PMID[10612592] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 17.5 | ug ml-1 | PMID[10612592] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 15.0 | ug ml-1 | PMID[10612592] |
| NPT759 | Cell line | H9 | Homo sapiens | IC50 | = | 111500.0 | nM | PMID[11473435] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 25.0 | ug.mL-1 | PMID[1791472] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 115000.0 | nM | PMID[18952426] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 151000.0 | nM | PMID[18952426] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 186000.0 | nM | PMID[18952426] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 215000.0 | nM | PMID[18952426] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | > | 12.5 | ug.mL-1 | PMID[19220033] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 121000.0 | nM | PMID[19781948] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Potency | n.a. | 2238.7 | nM | PubChem BioAssay data set |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 100000.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 100000.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 100000.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[28128938] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[28128938] |
| NPT515 | Cell line | SGC-7901 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[28128938] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7100.0 | nM | PMID[19781948] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12100.0 | nM | PMID[19781948] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12589.25 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10000.0 | nM | PMID[19734910] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.85 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.5 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT29853 | Organism | Bipolaris maydis | Bipolaris maydis | Activity | = | 36.4 | % | PMID[34954591] |
| NPT28471 | Organism | Trichophyton interdigitale | Trichophyton interdigitale | MIC | = | 200.0 | ug.mL-1 | PMID[34954591] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 7.5 | ug | PMID[1791472] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | = | 1.9 | ug | PMID[1791472] |
| NPT330 | Organism | Trichophyton mentagrophytes | Trichophyton mentagrophytes | MIC | = | 3.7 | ug | PMID[1791472] |
| NPT1223 | Organism | Amorphotheca resinae | Amorphotheca resinae | MIC | = | 15.0 | ug | PMID[1791472] |
| NPT330 | Organism | Trichophyton mentagrophytes | Trichophyton mentagrophytes | MID | = | 3.7 | ug ml-1 | PMID[19220033] |
| NPT20 | Organism | Candida albicans | Candida albicans | MID | = | 1.9 | ug ml-1 | PMID[19220033] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MID | = | 7.5 | ug ml-1 | PMID[19220033] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 130000.0 | nM | PMID[20329729] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 14400.0 | nM | PMID[19258267] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 130000.0 | nM | PMID[21983333] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 270.0 | nM | PMID[24980054] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 19200.0 | nM | PMID[24980054] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | = | 19200.0 | nM | PMID[24980054] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | = | 270.0 | nM | PMID[24980054] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 100000.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | = | 583000.0 | ug.mL-1 | PMID[34954591] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | = | 10700.0 | nM | PMID[11473435] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 60.0 | ug | PMID[1791472] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 60.0 | ug | PMID[1791472] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1000.0 | ug.mL-1 | PMID[30317023] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 27.0 | pg/microg/hr | PMID[17583514] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 20.0 | pg/microg/hr | PMID[17583514] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 37.0 | pg/microg/hr | PMID[17583514] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 36.0 | nM | PMID[17583514] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 54.0 | nM | PMID[17583514] |
| NPT2 | Others | Unspecified | n.a. | Ki | > | 12000.0 | nM | PMID[17583514] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 12302.69 | nM | DOI[10.1007/s00044-008-9111-6] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 102.0 | % | PMID[17850214] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 112.0 | % | PMID[17850214] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 1000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 16360.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2818.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 15848.9 | nM | PubChem BioAssay data set |
| NPT2705 | Organism | Alternaria solani | Alternaria solani | Activity | = | 68.4 | % | PMID[34954591] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC179787 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.7209 | Intermediate Similarity | NPC201380 |
| 0.7045 | Intermediate Similarity | NPC102755 |
| 0.7045 | Intermediate Similarity | NPC48938 |
| 0.6889 | Remote Similarity | NPC191415 |
| 0.6889 | Remote Similarity | NPC489495 |
| 0.6889 | Remote Similarity | NPC489494 |
| 0.6739 | Remote Similarity | NPC284678 |
| 0.6739 | Remote Similarity | NPC604932 |
| 0.6596 | Remote Similarity | NPC266249 |
| 0.6596 | Remote Similarity | NPC489496 |
| 0.6444 | Remote Similarity | NPC603809 |
| 0.617 | Remote Similarity | NPC175899 |
| 0.6078 | Remote Similarity | NPC123839 |
| 0.5918 | Remote Similarity | NPC232727 |
| 0.5918 | Remote Similarity | NPC176538 |
| 0.5849 | Remote Similarity | NPC489497 |
| 0.5849 | Remote Similarity | NPC62749 |
| 0.5682 | Remote Similarity | NPC63545 |
| 0.5636 | Remote Similarity | NPC116555 |
| 0.5636 | Remote Similarity | NPC470204 |
| 0.5636 | Remote Similarity | NPC240258 |
| 0.5536 | Remote Similarity | NPC470500 |
| 0.5536 | Remote Similarity | NPC205043 |
| 0.5439 | Remote Similarity | NPC27041 |
| 0.5439 | Remote Similarity | NPC470203 |
| 0.5439 | Remote Similarity | NPC608638 |
| 0.5385 | Remote Similarity | NPC44773 |
| 0.5345 | Remote Similarity | NPC470502 |
| 0.5294 | Remote Similarity | NPC141454 |
| 0.5254 | Remote Similarity | NPC174489 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC179787 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| NPD |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
