Natural Product: NPC232727| Natural Product ID | NPC232727 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Harmine |
| IUPAC Name | 7-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL269538 |
| PubChem CID |
5280953 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | BXNJHAXVSOCGBA-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C13H12N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-7,15H,1-2H3 |
| SMILES | COc1ccc2c(c1)[nH]c1c2ccnc1C |
  Calculated Properties| Molecular Weight:   | 212.09 | Volume:   | 222.7 Van der Waals volume.
|
| Dense:   | 0.952 | LogP:   | 3.377 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.939 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -4.356 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 1.0 | Rigid Bonds:   | 15.0 |
| TPSA:   | 37.91 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 3.0 |
| H-Bond Donor:   | 1.0 | Rings:   | 3.0 |
| Heavy Atoms:   | 3.0 |
| QED Drug-Likeness Score:   | 0.673 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.13 | Fsp3:   | 0.154 |
| MCE-18:   | 15.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Accepted | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.348 | Fluc inhibitor:   | 0.521 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.919 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.312 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.026 | Promiscuous compounds:   | 0.877 |
| Caco-2 Permeability:   | -4.898 | MDCK Permeability:   | -4.679 |
| Pgp-inhibitor:   | 0.058 | Pgp-substrate:   | 0.215 |
| PAMPA:   |
0.128 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.002 |
| 20% Bioavailability (F20%):   | 0.033 | 30% Bioavailability (F30%):   | 0.033 |
| 50% Bioavailability (F50%):   | 0.224 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.235 | MRP1:   | 0.978 |
| Plasma Protein Binding (PPB):   | 93.159% | Volume Distribution (VD):   | 0.063 |
| Fu: |
5.429% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.994 |
| OATP1B3 inhibitor:   | 0.997 | BCRP inhibitor:   | 0.089 |
| BSEP inhibitor:   | 0.983 |
| CYP1A2-inhibitor:   | 0.97 | CYP1A2-substrate:   | 0.002 |
| CYP2C19-inhibitor:   | 0.999 | CYP2C19-substrate:   | 0.001 |
| CYP2C9-inhibitor:   | 0.999 | CYP2C9-substrate:   | 0.997 |
| CYP2D6-inhibitor:   | 0.995 | CYP2D6-substrate:   | 0.825 |
| CYP3A4-inhibitor:   | 0.644 | CYP3A4-substrate:   | 0.001 |
| CYP2B6-substrate:   | 0.046 | CYP2C8-inhibitor:   | 0.51 |
| HLM stability:   |
0.568 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 10.045 | Half-life (T1/2):   | 0.816 |
| hERG Blockers:   | 0.396 | hERG Blockers (10um):   | 0.566 |
| Human Hepatotoxicity (H-HT):   | 0.681 | Drug-induced Liver Injury (DILI):   | 0.918 |
| AMES Toxicity:   | 0.853 | Rat Oral Acute Toxicity:   | 0.723 |
| Maximum Recommended Daily Dose:   | 0.705 | Skin Sensitization:   | 0.273 |
| Carcinogencity:   | 0.87 | Eye Corrosion:   | 0.002 |
| Eye Irritation:   | 0.944 | Respiratory Toxicity:   | 0.937 |
| Drug-induced Neurotoxicity:   | 0.85 | Ototoxicity:   | 0.61 |
| Hematotoxicity:   | 0.606 | Drug-induced Nephrotoxicity:   | 0.874 |
| Genotoxicity:   | 0.494 | RPMI-8226 Immunitoxicity:   | 0.149 |
| A549 Cytotoxicity:   | 0.313 | Hek293 Cytotoxicity:   | 0.456 |
| BCF:   |
1.122 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.558 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.434 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.062 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | Fruits | n.a. | n.a. |
PMID[11141122] |
| NPO30753 | Symplocos setchuensis | Species | Symplocaceae | Eukaryota | n.a. | stem | n.a. |
PMID[11473435] |
| NPO30753 | Symplocos setchuensis | Species | Symplocaceae | Eukaryota | stems | n.a. | n.a. |
PMID[11473435] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[28128938] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38971075] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[6736972] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO31183 | Thalictrum foetidvm | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO2926 | Phallus rugulosus | Species | Phallaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1085 | Peganum harmala | Species | Nitrariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5736 | Banisteriopsis inebrians | Species | Malpighiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7395 | Tribulus terrestris | Species | Zygophyllaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3808 | Elaeagnus angustifolia | Species | Elaeagnaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1784 | Individual protein | Serotonin 5a (5-HT5a) receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Ki | = | 50000.0 | nM | PMID[8487254] |
| NPT1778 | Individual protein | Serotonin 2a (5-HT2a) receptor | Rattus norvegicus | Ki | = | 7790.0 | nM | PMID[14643338] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | Ki | = | 9340.0 | nM | PMID[14643338] |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | Ki | = | 1480.0 | nM | PMID[14643338] |
| NPT1785 | Individual protein | Serotonin 7 (5-HT7) receptor | Homo sapiens | Ki | = | 5500.0 | nM | PMID[14643338] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT1789 | Individual protein | Alpha-1b adrenergic receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | Ki | = | 2540.0 | nM | PMID[14643338] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | Ki | = | 1130.0 | nM | PMID[14643338] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | Ki | = | 810.0 | nM | PMID[14643338] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | Ki | = | 3260.0 | nM | PMID[14643338] |
| NPT1790 | Individual protein | Dopamine transporter | Bos taurus | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT1791 | Individual protein | Nischarin | Homo sapiens | Ki | = | 13800.0 | nM | PMID[14643338] |
| NPT1791 | Individual protein | Nischarin | Homo sapiens | Ki | = | 22.0 | nM | PMID[14643338] |
| NPT3240 | Individual protein | Cyclin-dependent kinase 5 | Homo sapiens | Inhibition | = | 68.0 | % | PMID[11909733] |
| NPT1371 | Individual protein | Cyclin-dependent kinase 2 | Homo sapiens | Inhibition | = | 62.0 | % | PMID[11909733] |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[11909733] |
| NPT3111 | Individual protein | Tyrosine-protein kinase Lyn | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[11909733] |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[11909733] |
| NPT156 | Individual protein | Sphingomyelin phosphodiesterase | Homo sapiens | Activity | = | 92.1 | % | PMID[18027916] |
| NPT3107 | Individual protein | Rho-associated protein kinase 2 | Homo sapiens | Activity | = | 80.0 | % | PMID[17850214] |
| NPT3106 | Individual protein | Ribosomal protein S6 kinase alpha 1 | Homo sapiens | Activity | = | 105.0 | % | PMID[17850214] |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Activity | = | 103.0 | % | PMID[17850214] |
| NPT1614 | Individual protein | MAP kinase p38 delta | Homo sapiens | Activity | = | 88.0 | % | PMID[17850214] |
| NPT1615 | Individual protein | MAP kinase p38 gamma | Homo sapiens | Activity | = | 80.0 | % | PMID[17850214] |
| NPT1695 | Individual protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Activity | = | 96.0 | % | PMID[17850214] |
| NPT1696 | Individual protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Activity | = | 92.0 | % | PMID[17850214] |
| NPT1697 | Individual protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT1699 | Individual protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Activity | = | 87.0 | % | PMID[17850214] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Activity | = | 86.0 | % | PMID[17850214] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Activity | = | 88.0 | % | PMID[17850214] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Activity | = | 64.0 | % | PMID[17850214] |
| NPT1703 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Activity | = | 80.0 | % | PMID[17850214] |
| NPT1430 | Individual protein | Serine/threonine-protein kinase AKT2 | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Activity | = | 82.0 | % | PMID[17850214] |
| NPT3455 | Individual protein | Protein kinase C zeta | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT3364 | Individual protein | Protein kinase C mu | Homo sapiens | Activity | = | 80.0 | % | PMID[17850214] |
| NPT3291 | Individual protein | Serine/threonine-protein kinase SRPK1 | Homo sapiens | Activity | = | 86.0 | % | PMID[17850214] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Activity | = | 104.0 | % | PMID[17850214] |
| NPT1611 | Individual protein | Ribosomal protein S6 kinase 1 | Homo sapiens | Activity | = | 93.0 | % | PMID[17850214] |
| NPT1448 | Individual protein | Serine/threonine-protein kinase Sgk1 | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT2626 | Individual protein | Myosin light chain kinase, smooth muscle | Homo sapiens | Activity | = | 87.0 | % | PMID[17850214] |
| NPT3266 | Individual protein | Casein kinase I delta | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[17850214] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 80.0 | nM | PMID[26048785] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[23237976] |
| NPT3460 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[23237976] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | IC50 | = | 4300.0 | nM | PMID[17850214] |
| NPT1433 | Individual protein | Serine/threonine-protein kinase Aurora-B | Homo sapiens | Activity | = | 81.0 | % | PMID[17850214] |
| NPT3206 | Individual protein | Serine/threonine-protein kinase Aurora-C | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT3344 | Individual protein | BR serine/threonine-protein kinase 2 | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT3232 | Individual protein | CaM kinase I alpha | Homo sapiens | Activity | = | 94.0 | % | PMID[17850214] |
| NPT3248 | Individual protein | CaM-kinase kinase alpha | Homo sapiens | Activity | = | 95.0 | % | PMID[17850214] |
| NPT1678 | Individual protein | CaM-kinase kinase beta | Homo sapiens | Activity | = | 81.0 | % | PMID[17850214] |
| NPT1608 | Individual protein | Serine/threonine-protein kinase Chk1 | Homo sapiens | Activity | = | 99.0 | % | PMID[17850214] |
| NPT1680 | Individual protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Activity | = | 100.0 | % | PMID[17850214] |
| NPT3266 | Individual protein | Casein kinase I delta | Homo sapiens | Activity | = | 60.0 | % | PMID[17850214] |
| NPT3113 | Individual protein | Tyrosine-protein kinase CSK | Homo sapiens | Activity | = | 86.0 | % | PMID[17850214] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Activity | = | 4.0 | % | PMID[17850214] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | Activity | = | 15.0 | % | PMID[17850214] |
| NPT3460 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Homo sapiens | Activity | = | 6.0 | % | PMID[17850214] |
| NPT1344 | Individual protein | Serine/threonine-protein kinase EEF2K | Homo sapiens | Activity | = | 104.0 | % | PMID[17850214] |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Activity | = | 95.0 | % | PMID[17850214] |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Activity | = | 95.0 | % | PMID[17850214] |
| NPT3363 | Individual protein | Mitogen-activated protein kinase 15 | Homo sapiens | Activity | = | 80.0 | % | PMID[17850214] |
| NPT3331 | Individual protein | Serine/threonine-protein kinase MST2 | Homo sapiens | Activity | = | 85.0 | % | PMID[17850214] |
| NPT1658 | Individual protein | Serine/threonine-protein kinase NEK2 | Homo sapiens | Activity | = | 94.0 | % | PMID[17850214] |
| NPT1657 | Individual protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Activity | = | 87.0 | % | PMID[17850214] |
| NPT3284 | Individual protein | Serine/threonine-protein kinase NEK7 | Homo sapiens | Activity | = | 108.0 | % | PMID[17850214] |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Activity | = | 100.0 | % | PMID[17850214] |
| NPT3432 | Individual protein | Homeodomain-interacting protein kinase 2 | Homo sapiens | Activity | = | 108.0 | % | PMID[17850214] |
| NPT3409 | Individual protein | Homeodomain-interacting protein kinase 3 | Homo sapiens | Activity | = | 87.0 | % | PMID[17850214] |
| NPT1427 | Individual protein | c-Jun N-terminal kinase 2 | Homo sapiens | Activity | = | 91.0 | % | PMID[17850214] |
| NPT3207 | Individual protein | c-Jun N-terminal kinase 3 | Homo sapiens | Activity | = | 91.0 | % | PMID[17850214] |
| NPT1441 | Individual protein | MAP kinase-activated protein kinase 2 | Homo sapiens | Activity | = | 110.0 | % | PMID[17850214] |
| NPT3461 | Individual protein | MAP kinase-activated protein kinase 3 | Homo sapiens | Activity | = | 98.0 | % | PMID[17850214] |
| NPT1426 | Individual protein | c-Jun N-terminal kinase 1 | Homo sapiens | Activity | = | 89.0 | % | PMID[17850214] |
| NPT3280 | Individual protein | Serine/threonine-protein kinase c-TAK1 | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT3282 | Individual protein | Maternal embryonic leucine zipper kinase | Homo sapiens | Activity | = | 8.0 | % | PMID[17850214] |
| NPT3283 | Individual protein | MAP kinase-interacting serine/threonine-protein kinase MNK1 | Homo sapiens | Activity | = | 82.0 | % | PMID[17850214] |
| NPT3213 | Individual protein | MAP kinase signal-integrating kinase 2 | Homo sapiens | Activity | = | 80.0 | % | PMID[17850214] |
| NPT1613 | Individual protein | Ribosomal protein S6 kinase alpha 5 | Homo sapiens | Activity | = | 83.0 | % | PMID[17850214] |
| NPT1612 | Individual protein | MAP kinase-activated protein kinase 5 | Homo sapiens | Activity | = | 90.0 | % | PMID[17850214] |
| NPT3357 | Individual protein | Protein kinase N2 | Homo sapiens | Activity | = | 86.0 | % | PMID[17850214] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Ki | = | 5.0 | nM | PMID[19969454] |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT149 | Individual protein | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT211 | Individual protein | Hypoxia-inducible factor 1 alpha | Homo sapiens | Potency | = | 6309.6 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 7943.3 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 5011.9 | nM | PubChem BioAssay data set |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Potency | = | 7943.3 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Ki | = | 16.9 | nM | PMID[21183355] |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 23109.3 | nM | PubChem BioAssay data set |
| NPT1139 | Individual protein | Arachidonate 15-lipoxygenase, type II | Homo sapiens | Potency | n.a. | 15848.9 | nM | PubChem BioAssay data set |
| NPT3231 | Individual protein | Dual specificity protein kinase CLK4 | Homo sapiens | Potency | n.a. | 67.1 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | AC50 | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 398.11 | nM | PubChem BioAssay data set |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | AC50 | = | 7943.28 | nM | PubChem BioAssay data set |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Ki | = | 17.0 | nM | PMID[21726069] |
| NPT135 | Individual protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 89125.1 | nM | PubChem BioAssay data set |
| NPT1681 | Individual protein | Dual specificty protein kinase CLK1 | Homo sapiens | AC50 | = | 11.6 | nM | PubChem BioAssay data set |
| NPT1681 | Individual protein | Dual specificty protein kinase CLK1 | Homo sapiens | AC50 | = | 23.0 | nM | PubChem BioAssay data set |
| NPT154 | Individual protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 30.0 | nM | PMID[22335895] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 690.0 | nM | PMID[22335895] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Inhibition | = | 23.75 | % | PMID[22425563] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[22998443] |
| NPT3459 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 4 | Homo sapiens | IC50 | = | 9500.0 | nM | PMID[22998443] |
| NPT3460 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[22998443] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[22998443] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 28.0 | nM | PMID[22998443] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 60.0 | nM | PMID[25248682] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 85.0 | nM | PMID[22998443] |
| NPT1681 | Individual protein | Dual specificty protein kinase CLK1 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[23237976] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Ki | = | 33.0 | nM | PMID[23642479] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | Ki | = | 166.0 | nM | PMID[23642479] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 33.0 | nM | PMID[25738750] |
| NPT3459 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 4 | Homo sapiens | IC50 | = | 74000.0 | nM | PMID[25738750] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 2000.0 | nM | PMID[25738750] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 166.0 | nM | PMID[25738750] |
| NPT1681 | Individual protein | Dual specificty protein kinase CLK1 | Homo sapiens | IC50 | = | 220.0 | nM | PMID[26896709] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 3000.0 | nM | PMID[26896709] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 180.0 | nM | PMID[26896709] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 130.0 | nM | PMID[26896709] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 400.0 | nM | PMID[26896709] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 29.0 | nM | PMID[27676471] |
| NPT3459 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 4 | Homo sapiens | IC50 | = | 80000.0 | nM | PMID[28206758] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 160.0 | nM | PMID[28206758] |
| NPT3460 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Homo sapiens | IC50 | = | 410.0 | nM | PMID[28206758] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 41.0 | nM | PMID[28408219] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 8.81 | nM | PMID[30059217] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 56.0 | nM | PMID[30059217] |
| NPT3323 | Individual protein | Cell division cycle 2-like protein kinase 6 | Homo sapiens | Activity | = | 83.0 | % | PMID[30059217] |
| NPT3346 | Individual protein | Cyclin-dependent kinase 7 | Homo sapiens | Activity | = | 21.0 | % | PMID[30059217] |
| NPT3324 | Individual protein | Cell division protein kinase 8 | Homo sapiens | Activity | = | 55.0 | % | PMID[30059217] |
| NPT3397 | Individual protein | Cyclin-dependent kinase-like 5 | Homo sapiens | Activity | = | 100.0 | % | PMID[30059217] |
| NPT3334 | Individual protein | Citron Rho-interacting kinase | Homo sapiens | Activity | = | 29.0 | % | PMID[30059217] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | Activity | = | 2.4 | % | PMID[30059217] |
| NPT3231 | Individual protein | Dual specificity protein kinase CLK4 | Homo sapiens | Activity | = | 13.0 | % | PMID[30059217] |
| NPT3168 | Individual protein | Casein kinase I alpha | Homo sapiens | Activity | = | 15.0 | % | PMID[32003560] |
| NPT3266 | Individual protein | Casein kinase I delta | Homo sapiens | Activity | = | 13.0 | % | PMID[30059217] |
| NPT3226 | Individual protein | Casein kinase I epsilon | Homo sapiens | Activity | = | 1.7 | % | PMID[32003560] |
| NPT1685 | Individual protein | Casein kinase I gamma 2 | Homo sapiens | Activity | = | 19.0 | % | PMID[30059217] |
| NPT1598 | Individual protein | Casein kinase II alpha | Homo sapiens | Activity | = | 11.0 | % | PMID[30059217] |
| NPT3273 | Individual protein | Casein kinase II alpha (prime) | Homo sapiens | Activity | = | 23.0 | % | PMID[30059217] |
| NPT1721 | Individual protein | Death-associated protein kinase 1 | Homo sapiens | Activity | = | 78.0 | % | PMID[30059217] |
| NPT3236 | Individual protein | Death-associated protein kinase 2 | Homo sapiens | Activity | = | 72.0 | % | PMID[30059217] |
| NPT1687 | Individual protein | Death-associated protein kinase 3 | Homo sapiens | Activity | = | 69.0 | % | PMID[30059217] |
| NPT3230 | Individual protein | Serine/threonine-protein kinase 17B | Homo sapiens | Activity | = | 73.0 | % | PMID[30059217] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Activity | = | 0.0 | % | PMID[32003560] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | Activity | = | 6.1 | % | PMID[32003560] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | Activity | = | 3.2 | % | PMID[30059217] |
| NPT3444 | Individual protein | Homeodomain-interacting protein kinase 1 | Homo sapiens | Activity | = | 21.0 | % | PMID[30059217] |
| NPT3432 | Individual protein | Homeodomain-interacting protein kinase 2 | Homo sapiens | Activity | = | 8.6 | % | PMID[32003560] |
| NPT3409 | Individual protein | Homeodomain-interacting protein kinase 3 | Homo sapiens | Activity | = | 9.4 | % | PMID[32003560] |
| NPT3386 | Individual protein | Interleukin-1 receptor-associated kinase 1 | Homo sapiens | Activity | = | 17.0 | % | PMID[30059217] |
| NPT3288 | Individual protein | Interleukin-1 receptor-associated kinase 3 | Homo sapiens | Activity | = | 15.0 | % | PMID[30059217] |
| NPT3393 | Individual protein | PI4-kinase beta subunit | Homo sapiens | Activity | = | 12.0 | % | PMID[30059217] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Activity | = | 45.0 | % | PMID[30059217] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Activity | = | 39.0 | % | PMID[30059217] |
| NPT3433 | Individual protein | Phosphatidylinositol-5-phosphate 4-kinase type-2 gamma | Homo sapiens | Activity | = | 36.0 | % | PMID[30059217] |
| NPT3374 | Individual protein | Ribosomal protein S6 kinase alpha 4 | Homo sapiens | Activity | = | 40.0 | % | PMID[30059217] |
| NPT3355 | Individual protein | TGF-beta receptor type II | Homo sapiens | Activity | = | 78.0 | % | PMID[30059217] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | FC | = | 2.0 | n.a. | PMID[30095246] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 700.0 | nM | PMID[29985601] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 48.0 | nM | PMID[29985601] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Inhibition | > | 60.0 | % | PMID[29985601] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 27.0 | nM | PMID[32003560] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Inhibition | = | 95.0 | % | PMID[32003560] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | Inhibition | = | 59.0 | % | PMID[32003560] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | Inhibition | = | 32.0 | % | PMID[32003560] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | Inhibition | = | 45.0 | % | PMID[32003560] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | Inhibition | = | 23.0 | % | PMID[32003560] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | Inhibition | = | 75.0 | % | PMID[32003560] |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | Inhibition | = | 37.0 | % | PMID[32003560] |
| NPT1785 | Individual protein | Serotonin 7 (5-HT7) receptor | Homo sapiens | Inhibition | = | 30.0 | % | PMID[32003560] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | Inhibition | = | 86.0 | % | PMID[32003560] |
| NPT1445 | Individual protein | PI3-kinase p110-gamma subunit | Homo sapiens | Activity | = | 49.0 | % | PMID[32003560] |
| NPT1422 | Individual protein | ATP-binding cassette sub-family G member 2 | Homo sapiens | IC50 | = | 5080.0 | nM | PMID[27280693] |
| NPT1422 | Individual protein | ATP-binding cassette sub-family G member 2 | Homo sapiens | GI50 | = | 1950.0 | nM | PMID[27280693] |
| NPT1422 | Individual protein | ATP-binding cassette sub-family G member 2 | Homo sapiens | GI50 | = | 1840.0 | nM | PMID[27280693] |
| NPT1422 | Individual protein | ATP-binding cassette sub-family G member 2 | Homo sapiens | GI50 | = | 1220.0 | nM | PMID[27280693] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 21.83 | nM | PMID[27766861] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 57.4 | nM | PMID[27766861] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 33.0 | nM | PMID[38033250] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 292.9 | nM | PMID[36876904] |
| NPT3460 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Homo sapiens | IC50 | = | 2857.0 | nM | PMID[36876904] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 33.0 | nM | PMID[30243157] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Kd | = | 13.4 | nM | PMID[36883902] |
| NPT3231 | Individual protein | Dual specificity protein kinase CLK4 | Homo sapiens | IC50 | = | 102.2 | nM | PMID[36876904] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | IC50 | = | 1152.0 | nM | PMID[36876904] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | = | 4.1 | nM | PMID[36244185] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[38033250] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 200.0 | nM | PMID[34342227] |
| NPT3323 | Individual protein | Cell division cycle 2-like protein kinase 6 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[35450378] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | = | 1.0 | nM | PMID[33528252] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | TIME | = | 0.01967 | hr | PMID[36876904] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Ki | = | 1.0 | nM | PMID[33528252] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[33528252] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[33528252] |
| NPT3346 | Individual protein | Cyclin-dependent kinase 7 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[33528252] |
| NPT3111 | Individual protein | Tyrosine-protein kinase Lyn | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[33528252] |
| NPT3347 | Individual protein | Cyclin-dependent kinase 9 | Homo sapiens | IC50 | = | 720.0 | nM | PMID[33528252] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | = | 4.1 | nM | PMID[36179486] |
| NPT1683 | Individual protein | Dual specificity protein kinase CLK3 | Homo sapiens | IC50 | = | 8811.0 | nM | PMID[36876904] |
| NPT1683 | Individual protein | Dual specificity protein kinase CLK3 | Homo sapiens | IC50 | = | 3000.0 | nM | PMID[33528252] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[33528252] |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | IC50 | > | 30000.0 | nM | PMID[33528252] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[36883902] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Kd | = | 5.474 | nM | PMID[36876904] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 61.7 | nM | PMID[36876904] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | < | 100.0 | nM | PMID[33682417] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[33528252] |
| NPT3324 | Individual protein | Cell division protein kinase 8 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[35450378] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 28.0 | nM | PMID[33528252] |
| NPT1371 | Individual protein | Cyclin-dependent kinase 2 | Homo sapiens | IC50 | = | 33000.0 | nM | PMID[33528252] |
| NPT3231 | Individual protein | Dual specificity protein kinase CLK4 | Homo sapiens | IC50 | = | 24.0 | nM | PMID[33528252] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 22.0 | nM | PMID[33528252] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 270.0 | nM | PMID[36883902] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[30243157] |
| NPT3107 | Individual protein | Rho-associated protein kinase 2 | Homo sapiens | IC50 | > | 40000.0 | nM | PMID[33528252] |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[33528252] |
| NPT3460 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 3 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[33528252] |
| NPT3459 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 4 | Homo sapiens | IC50 | = | 9500.0 | nM | PMID[33528252] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | IC50 | = | 4300.0 | nM | PMID[33528252] |
| NPT3459 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 4 | Homo sapiens | IC50 | = | 8356.0 | nM | PMID[36876904] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 150.0 | nM | PMID[33528252] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 12.0 | nM | PMID[34954592] |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[33528252] |
| NPT3226 | Individual protein | Casein kinase I epsilon | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[36876904] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 192.2 | nM | PMID[36876904] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 27.0 | nM | PMID[33682417] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 94.0 | nM | PMID[36876904] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 3166.0 | nM | PMID[36876904] |
| NPT1423 | Individual protein | Cyclin-dependent kinase 1 | Homo sapiens | IC50 | = | 17000.0 | nM | PMID[33528252] |
| NPT3240 | Individual protein | Cyclin-dependent kinase 5 | Homo sapiens | IC50 | = | 8000.0 | nM | PMID[33528252] |
| NPT3459 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 4 | Homo sapiens | IC50 | = | 80000.0 | nM | PMID[30243157] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 32.0 | nM | PMID[33975430] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | IC50 | = | 11300.0 | nM | PMID[30243157] |
| NPT3274 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | Homo sapiens | IC50 | = | 166.0 | nM | PMID[30243157] |
| NPT3399 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 2 | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[36800260] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | = | 4.1 | nM | PMID[36307034] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | = | 5.0 | nM | PMID[35863237] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 80.0 | nM | PMID[35863237] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | IC50 | = | 80.0 | nM | PMID[35450378] |
| NPT3114 | Individual protein | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | Homo sapiens | Tm | = | 10.5 | degrees C | PMID[36883902] |
| NPT1783 | Protein complex | Serotonin 3 (5-HT3) receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT1786 | Protein family | Dopamine receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT1509 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | IC50 | = | 21000.0 | nM | PMID[11909733] |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT582 | Individual protein | Monoamine oxidase B | Homo sapiens | Ki | = | 120800.0 | nM | PMID[21183355] |
| NPT803 | Individual protein | Flap endonuclease 1 | Homo sapiens | Potency | n.a. | 50118.7 | nM | PubChem BioAssay data set |
| NPT4093 | Individual protein | Serine/threonine-protein kinase haspin | Homo sapiens | IC50 | = | 590.0 | nM | PMID[22335895] |
| NPT5345 | Individual protein | Mitogen-activated protein kinase 1 | Rattus norvegicus | IC50 | > | 30000.0 | nM | PMID[22998443] |
| NPT5347 | Individual protein | Dual specificity protein kinase CLK2 | Mus musculus | IC50 | = | 280.0 | nM | PMID[22998443] |
| NPT1509 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | IC50 | = | 8000.0 | nM | PMID[25248682] |
| NPT1509 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[23237976] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 101.75 | % | PMID[23571415] |
| NPT3575 | Individual protein | Chitinase | Onchocerca volvulus | Ki | = | 3780.0 | nM | PMID[25815157] |
| NPT3575 | Individual protein | Chitinase | Onchocerca volvulus | IC50 | = | 7060.0 | nM | PMID[25815157] |
| NPT4093 | Individual protein | Serine/threonine-protein kinase haspin | Homo sapiens | Activity | = | 2.0 | % | PMID[32003560] |
| NPT29648 | Single protein | Dual specificity protein kinase CLK1 | Homo sapiens | TIME | = | 0.0165 | hr | PMID[36876904] |
| NPT4093 | Individual protein | Serine/threonine-protein kinase haspin | Homo sapiens | IC50 | = | 590.0 | nM | PMID[34332400] |
| NPT29648 | Single protein | Dual specificity protein kinase CLK1 | Homo sapiens | IC50 | = | 242.3 | nM | PMID[36876904] |
| NPT29648 | Single protein | Dual specificity protein kinase CLK1 | Homo sapiens | Kd | = | 12.11 | nM | PMID[36876904] |
| NPT592 | Individual protein | Rho-associated protein kinase 1 | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[33528252] |
| NPT29648 | Single protein | Dual specificity protein kinase CLK1 | Homo sapiens | IC50 | = | 298.9 | nM | PMID[36876904] |
| NPT29497 | Protein complex group | GABA-A receptor; anion channel | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[33528252] |
| NPT973 | Individual protein | Serotonin 1b (5-HT1b) receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT1787 | Protein family | Metabotropic glutamate receptor | Rattus norvegicus | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT1302 | Protein family | Muscarinic acetylcholine receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT3814 | Protein complex | Cyclin-dependent kinase 2/cyclin A | Homo sapiens | IC50 | = | 35000.0 | nM | PMID[11909733] |
| NPT3813 | Individual protein | Tyrosine-protein kinase SRC | Gallus gallus | Activity | = | 88.0 | % | PMID[17850214] |
| NPT3814 | Protein complex | Cyclin-dependent kinase 2/cyclin A | Homo sapiens | Activity | = | 86.0 | % | PMID[17850214] |
| NPT1609 | Protein complex | Casein kinase II | Homo sapiens | Activity | = | 68.0 | % | PMID[17850214] |
| NPT981 | Individual protein | Inhibitor of nuclear factor kappa B kinase beta subunit | Homo sapiens | Activity | = | 73.0 | % | PMID[17850214] |
| NPT491 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 1 | Homo sapiens | Activity | = | 73.0 | % | PMID[17850214] |
| NPT831 | Individual protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Activity | = | 97.0 | % | PMID[17850214] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 5623.4 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 56234.1 | nM | PubChem BioAssay data set |
| NPT676 | Individual protein | Glycogen synthase kinase-3 alpha | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[22998443] |
| NPT5346 | Individual protein | Dual specificity protein kinase CLK4 | Mus musculus | IC50 | = | 50.0 | nM | PMID[22998443] |
| NPT3931 | Individual protein | Dual specificity protein kinase CLK3 | Mus musculus | IC50 | > | 10000.0 | nM | PMID[22998443] |
| NPT3814 | Protein complex | Cyclin-dependent kinase 2/cyclin A | Homo sapiens | IC50 | > | 30000.0 | nM | PMID[22998443] |
| NPT3932 | Individual protein | Dual specificity protein kinase CLK1 | Mus musculus | IC50 | = | 72.0 | nM | PMID[22998443] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 105.32 | % | PMID[23571415] |
| NPT684 | Individual protein | Histone deacetylase 1 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[31120744] |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | IC50 | = | 13600.0 | nM | PMID[34995924] |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | 74.1 | % | PMID[34995924] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT316 | Protein family | Protein kinase C (PKC) | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[11909733] |
| NPT728 | Individual protein | Serine/threonine-protein kinase AKT | Homo sapiens | Activity | = | 101.0 | % | PMID[17850214] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Activity | = | 87.0 | % | PMID[17850214] |
| NPT3815 | Individual protein | Tyrosine-protein kinase LCK | Mus musculus | Activity | = | 81.0 | % | PMID[17850214] |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 3548.1 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | IC50 | = | 22890.0 | nM | PMID[22425563] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 74.1 | % | PMID[22425563] |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 10000.0 | nM | PubChem BioAssay data set |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[22998443] |
| NPT4092 | Protein complex | CDK9/cyclin T1 | Homo sapiens | IC50 | = | 720.0 | nM | PMID[22998443] |
| NPT4090 | Protein complex | Cyclin-dependent kinase 7/ cyclin H | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[22998443] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[32077280] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[36883902] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[36876904] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Kd | > | 10000.0 | nM | PMID[36876904] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | IC50 | = | 10100.0 | nM | PMID[34995924] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[36883902] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Tm | n.a. | n.a. | n.a. | PMID[36883902] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | IC50 | = | 350.0 | nM | PMID[33528252] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Inhibition | = | 29.0 | % | PMID[34098466] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[36876904] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Kd | = | 3560.0 | nM | PMID[36883902] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | IC50 | = | 32100.0 | nM | PMID[34098466] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | IC50 | = | 32100.0 | nM | PMID[34995924] |
| NPT974 | Individual protein | Serotonin 1d (5-HT1d) receptor | Homo sapiens | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT805 | Protein complex | GABA-A receptor; anion channel | Rattus norvegicus | Ki | > | 10000.0 | nM | PMID[14643338] |
| NPT1570 | Protein complex | Cyclin-dependent kinase 1/cyclin B | Homo sapiens | IC50 | = | 18000.0 | nM | PMID[11909733] |
| NPT991 | Individual protein | Trypanothione reductase | Trypanosoma cruzi | Inhibition | = | 11.0 | % | PMID[18558492] |
| NPT443 | Individual protein | Histone acetyltransferase GCN5 | Homo sapiens | Potency | n.a. | 15848.9 | nM | PubChem BioAssay data set |
| NPT84 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1A | Rattus norvegicus | IC50 | = | 34.0 | nM | PMID[22998443] |
| NPT84 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1A | Rattus norvegicus | IC50 | = | 56.0 | nM | PMID[22998443] |
| NPT84 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1A | Rattus norvegicus | IC50 | = | 29.0 | nM | PMID[23237976] |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT1572 | Protein family | Glycogen synthase kinase-3 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[25248682] |
| NPT664 | Protein family | Histone deacetylase | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[26555243] |
| NPT24177 | Single protein | Phosphatidylinositol 3-kinase catalytic subunit type 3 | Homo sapiens | Activity | = | 13.0 | % | PMID[32003560] |
| NPT1881 | Nucleic acid | Calf thymus DNA | Bos taurus | Activity | = | 320.0 | nm | PMID[30108831] |
| NPT84 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1A | Rattus norvegicus | Inhibition | = | 99.9 | % | PMID[34098466] |
| NPT84 | Individual protein | Dual specificity tyrosine-phosphorylation-regulated kinase 1A | Rattus norvegicus | Inhibition | = | 99.1 | % | PMID[34098466] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1759 | Cell line | FM3A | Mus musculus | EC50 | = | 18000.0 | nM | PMID[15026051] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 2.2 | ug ml-1 | PMID[10612592] |
| NPT81 | Cell line | A549 | Homo sapiens | ED50 | = | 2.4 | ug ml-1 | PMID[10612592] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | ED50 | = | 1.9 | ug ml-1 | PMID[10612592] |
| NPT83 | Cell line | MCF7 | Homo sapiens | ED50 | = | 10.5 | ug ml-1 | PMID[10612592] |
| NPT309 | Cell line | 1A9 | Homo sapiens | ED50 | = | 1.6 | ug ml-1 | PMID[10612592] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | ED50 | = | 18.5 | ug ml-1 | PMID[10612592] |
| NPT1535 | Cell line | U-87 MG | Homo sapiens | ED50 | = | 14.5 | ug ml-1 | PMID[10612592] |
| NPT2192 | Cell line | HEL | Homo sapiens | ED50 | = | 1.9 | ug ml-1 | PMID[10612592] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 3.7 | ug ml-1 | PMID[10612592] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 2.5 | ug ml-1 | PMID[10612592] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 4.3 | ug ml-1 | PMID[10612592] |
| NPT759 | Cell line | H9 | Homo sapiens | IC50 | = | 26400.0 | nM | PMID[11473435] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 60000.0 | nM | PMID[23291116] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 54000.0 | nM | PMID[23291116] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 68000.0 | nM | PMID[23291116] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 46000.0 | nM | PMID[23291116] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 72000.0 | nM | PMID[18462839] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 45000.0 | nM | PMID[22516283] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 46000.0 | nM | PMID[22202437] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 54000.0 | nM | PMID[22516283] |
| NPT744 | Cell line | IMR-32 | Homo sapiens | IC50 | = | 68000.0 | nM | PMID[22202437] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 32000.0 | nM | PMID[22365759] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 26000.0 | nM | PMID[22365759] |
| NPT744 | Cell line | IMR-32 | Homo sapiens | IC50 | = | 38000.0 | nM | PMID[22365759] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 14000.0 | nM | PMID[22749421] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 8000.0 | nM | PMID[22749421] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 32000.0 | nM | PMID[22749421] |
| NPT2337 | Cell line | OE33 | Homo sapiens | IC50 | = | 18000.0 | nM | PMID[22770529] |
| NPT5027 | Cell line | Hs 683 | Homo sapiens | IC50 | = | 37000.0 | nM | PMID[22770529] |
| NPT1125 | Cell line | T98G | Homo sapiens | IC50 | = | 24000.0 | nM | PMID[22770529] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 74600.0 | nM | PMID[23279863] |
| NPT1083 | Cell line | A-375 | Homo sapiens | IC50 | = | 72500.0 | nM | PMID[23279863] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 63200.0 | nM | PMID[23279863] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 57800.0 | nM | PMID[23279863] |
| NPT2307 | Cell line | 769-P | Homo sapiens | IC50 | = | 48900.0 | nM | PMID[23279863] |
| NPT114 | Cell line | LoVo | Homo sapiens | IC50 | = | 53200.0 | nM | PMID[26555243] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 85280.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 52560.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 70700.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 7550.0 | nM | PMID[28128938] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 12020.0 | nM | PMID[29129513] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 7760.0 | nM | PMID[29129513] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 16210.0 | nM | PMID[29129513] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 10780.0 | nM | PMID[29129513] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 55300.0 | nM | PMID[29288941] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 46700.0 | nM | PMID[30108831] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 51200.0 | nM | PMID[29288941] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 8000.0 | nM | PMID[30193214] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 47600.0 | nM | PMID[30851694] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 53600.0 | nM | PMID[31120744] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 43800.0 | nM | PMID[30851694] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 3520.0 | nM | PMID[31546197] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 3520.0 | nM | PMID[31546197] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 3520.0 | nM | PMID[31546197] |
| NPT2511 | Cell line | HGC-27 | Homo sapiens | IC50 | = | 3520.0 | nM | PMID[31546197] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | Activity | = | 36.1 | % | PMID[31120744] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[31812035] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 9660.0 | nM | PMID[31227365] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 9630.0 | nM | PMID[31227365] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5890.0 | nM | PMID[31227365] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 68330.0 | nM | PMID[27397495] |
| NPT515 | Cell line | SGC-7901 | Homo sapiens | IC50 | = | 40820.0 | nM | PMID[27397495] |
| NPT659 | Cell line | SMMC-7721 | Homo sapiens | IC50 | = | 59440.0 | nM | PMID[27397495] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 42250.0 | nM | PMID[27397495] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 41800.0 | nM | PMID[32787089] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 49960.0 | nM | PMID[32787089] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 20.9 | % | PMID[32787089] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 139.0 | % | PMID[35450378] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 141.0 | % | PMID[35450378] |
| NPT2411 | Cell line | NCI-H2228 | Homo sapiens | IC50 | = | 31060.0 | nM | PMID[34425477] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[33813152] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[33813152] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 93.0 | % | PMID[35450378] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 110.0 | % | PMID[35450378] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 133.0 | % | PMID[35450378] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 113.0 | % | PMID[35450378] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 17120.0 | nM | PMID[34425477] |
| NPT804 | Cell line | HT-22 | Mus musculus | IC50 | = | 56500.0 | nM | PMID[36876904] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 16940.0 | nM | PMID[33744443] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 15270.0 | nM | PMID[35341920] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 16800.0 | nM | PMID[35341920] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[35450378] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[34425477] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5230.0 | nM | PMID[35341920] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[37696205] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[33813152] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 82.0 | % | PMID[35450378] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[35551033] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 107.0 | % | PMID[35450378] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 21910.0 | nM | PMID[33744443] |
| NPT3722 | Cell line | 4T1 | Mus musculus | IC50 | n.a. | n.a. | n.a. | PMID[33813152] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 43800.0 | nM | PMID[35272009] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 15630.0 | nM | PMID[35341920] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 6940.0 | nM | PMID[35341920] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[34274829] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 90.0 | % | PMID[35450378] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35450378] |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[34710745] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 210.0 | % | PMID[35450378] |
| NPT1216 | Cell line | FaDu | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35450378] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 92.0 | % | PMID[35450378] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 64.0 | % | PMID[35450378] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | Activity | = | 143.0 | % | PMID[35450378] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 17100.0 | nM | PMID[33813152] |
| NPT1759 | Cell line | FM3A | Mus musculus | Selective toxicity | = | 0.82 | n.a. | PMID[15026051] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 22000.0 | nM | PMID[15026051] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 50.1 | nM | PMID[20349996] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 28.0 | nM | PMID[20349996] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 182.4 | nM | PMID[20349996] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Activity | >= | 70.0 | % | PMID[20349996] |
| NPT4348 | Organism | Brassica rapa subsp. campestris | Brassica rapa subsp. campestris | GI | = | 20.16 | % | PMID[22469592] |
| NPT4348 | Organism | Brassica rapa subsp. campestris | Brassica rapa subsp. campestris | GI | = | 53.71 | % | PMID[22469592] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 8250.0 | nM | PMID[31812035] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | > | 27700.0 | nM | PMID[31812035] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | > | 50.0 | n.a. | PMID[36876904] |
| NPT29281 | Protein complex | Cyclin-dependent kinase 1/cyclin B | Homo sapiens | IC50 | = | 17000.0 | nM | PMID[34332400] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 4.84 | n.a. | PMID[36876904] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 1.33 | n.a. | PMID[34995924] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 1.26 | n.a. | PMID[36876904] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | > | 27700.0 | nM | PMID[37696205] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | n.a. | n.a. | n.a. | PMID[35551033] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 5.0 | % | PMID[33682417] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 0.8 | % | PMID[33682417] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 8250.0 | nM | PMID[34274829] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 27777.8 | nM | PMID[35551033] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | > | 3.36 | n.a. | PMID[37696205] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | > | 27700.0 | nM | PMID[34274829] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 1.52 | n.a. | PMID[36876904] |
| NPT29853 | Organism | Bipolaris maydis | Bipolaris maydis | Activity | = | 22.7 | % | PMID[34954591] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 93.0 | % | PMID[33813152] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 8250.0 | nM | PMID[37696205] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 8250.0 | nM | PMID[35551033] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 130000.0 | nM | PMID[20329729] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 130000.0 | nM | PMID[21983333] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 32000.0 | nM | PMID[22770529] |
| NPT22078 | Protein family | Glycogen synthase kinase-3 | Sus scrofa | IC50 | = | 19000.0 | nM | PMID[22998443] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Imax | = | 40.31 | % | PMID[21060288] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 34.1 | % | PMID[23279863] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 15.3 | % | PMID[23279863] |
| NPT22078 | Protein family | Glycogen synthase kinase-3 | Sus scrofa | IC50 | > | 10000.0 | nM | PMID[27676471] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 30.8 | % | PMID[23291116] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 230.0 | nM | PMID[24980054] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 3700.0 | nM | PMID[24980054] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | = | 3700.0 | nM | PMID[24980054] |
| NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | = | 230.0 | nM | PMID[24980054] |
| NPT3576 | Organism | Onchocerca volvulus | Onchocerca volvulus | Inhibition | = | 57.0 | % | PMID[25815157] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 46700.0 | nM | PMID[26555243] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 42800.0 | nM | PMID[26555243] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 7200.0 | nM | PMID[26896709] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 70360.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 62450.0 | nM | DOI[10.1039/C5MD00581G] |
| NPT22078 | Protein family | Glycogen synthase kinase-3 | Sus scrofa | IC50 | < | 10000.0 | nM | PMID[28487075] |
| NPT24180 | Cell line | Pancreatic beta cells | n.a. | EC50 | = | 7480.0 | nM | PMID[32077280] |
| NPT24180 | Cell line | Pancreatic beta cells | n.a. | Efficacy | = | 60.0 | % | PMID[32077280] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | n.a. | n.a. | n.a. | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 27.75 | g | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 56.93 | % | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 54.4 | % | PMID[38069814] |
| NPT30106 | Protein family | cAMP-dependent protein kinase (PKA) | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[33528252] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 22.68 | g | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 24.77 | g | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 25.14 | g | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 51.2 | % | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 26.55 | g | PMID[38069814] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | = | 500.0 | ug.mL-1 | PMID[34954591] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 23.4 | g | PMID[38069814] |
| NPT30024 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[34332400] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 67.17 | % | PMID[38069814] |
| NPT30024 | Protein complex | Cyclin-dependent kinase 5/CDK5 activator 1 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[36876904] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 100.0 | % | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 55.97 | % | PMID[38069814] |
| NPT29946 | Organism | Echinococcus granulosus | Echinococcus granulosus | Activity | = | 46.13 | % | PMID[38069814] |
| NPT24 | Organism | Human immunodeficiency virus 1 | Human immunodeficiency virus 1 | EC50 | = | 520.0 | nM | PMID[11473435] |
| NPT117 | Organism | Echinochloa crus-galli | Echinochloa crus-galli | GI | = | 10.82 | % | PMID[22469592] |
| NPT117 | Organism | Echinochloa crus-galli | Echinochloa crus-galli | GI | = | 32.49 | % | PMID[22469592] |
| NPT1018 | Organism | Trypanosoma brucei | Trypanosoma brucei | IC50 | = | 74000.0 | nM | PMID[24980054] |
| NPT23193 | Cell line | Bel7402/5-FU | Homo sapiens | Activity | = | 17.12 | % | PMID[30851694] |
| NPT23193 | Cell line | Bel7402/5-FU | Homo sapiens | Activity | = | 6.24 | % | PMID[30851694] |
| NPT23193 | Cell line | Bel7402/5-FU | Homo sapiens | Activity | = | 2.68 | % | PMID[30851694] |
| NPT23193 | Cell line | Bel7402/5-FU | Homo sapiens | Activity | = | 73.96 | % | PMID[30851694] |
| NPT30135 | Protein family | Protein kinase C (PKC) | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[33528252] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 25090.0 | nM | PMID[35341920] |
| NPT2254 | Organism | Schistosoma mansoni | Schistosoma mansoni | In vitro activity | n.a. | n.a. | n.a. | Using ChEMBL to complement schistosome drug discovery |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 49.0 | nM | PMID[15013009] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 250000.0 | nM | PMID[11909733] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 85.0 | % | PMID[17850214] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 72.0 | % | PMID[17850214] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 281.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 50.0 | n.a. | PMID[22335895] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.3 | n.a. | PMID[22770529] |
| NPT2 | Others | Unspecified | n.a. | IC50 | >= | 10000.0 | nM | PMID[25248682] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 10000.0 | nM | PMID[25248682] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1800.0 | nM | PMID[22998443] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 18000.0 | nM | PMID[22998443] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1500.0 | nM | PMID[23237976] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 5011.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 12589.3 | nM | PubChem BioAssay data set |
| NPT471 | Organism | Trypanosoma brucei brucei | Trypanosoma brucei brucei | IC50 | = | 74000.0 | nM | PMID[24980054] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT24168 | Protein complex | Casein kinase I delta/epsilon | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[27474927] |
| NPT2 | Others | Unspecified | n.a. | IC50 | < | 10000.0 | nM | PMID[25248682] |
| NPT24179 | Cell line | MDCK-II | Canis lupus familiaris | GI50 | = | 2420.0 | nM | PMID[27280693] |
| NPT24179 | Cell line | MDCK-II | Canis lupus familiaris | GI50 | = | 2300.0 | nM | PMID[27280693] |
| NPT2705 | Organism | Alternaria solani | Alternaria solani | Activity | = | 15.7 | % | PMID[34954591] |
| NPT30076 | Protein complex | Cyclin-dependent kinase 2/cyclin A | Homo sapiens | IC50 | = | 33000.0 | nM | PMID[34332400] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 8.5 | % | PMID[23279863] |
| NPT32 | Organism | Mus musculus | Mus musculus | MED | = | 6.0 | mg kg-1 | PMID[32003560] |
| NPT32 | Organism | Mus musculus | Mus musculus | FC | = | 2.0 | n.a. | PMID[32003560] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[34098466] |
| NPT1327 | Organism | Lipaphis erysimi | Lipaphis erysimi | mortality | = | 49.62 | % | PMID[21060288] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Caenorhabditis elegans | n.a. | Drug uptake | = | 0.052 | nmol/mg | PMID[25815157] |
| n.a. | n.a. | permeability | = | 44.6 | 10^-6 cm/s | PMID[34098466] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Mus musculus | LD50 | = | 59.0 | mg.kg-1 | PMID[23291116] |
| - | Echinococcus granulosus | LC50 | = | 134930.0 | nM | PMID[38069814] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC232727 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.7551 | Intermediate Similarity | NPC122436 |
| 0.7551 | Intermediate Similarity | NPC479097 |
| 0.74 | Intermediate Similarity | NPC479095 |
| 0.74 | Intermediate Similarity | NPC260434 |
| 0.7255 | Intermediate Similarity | NPC146472 |
| 0.68 | Remote Similarity | NPC176538 |
| 0.6379 | Remote Similarity | NPC60621 |
| 0.6167 | Remote Similarity | NPC101350 |
| 0.5918 | Remote Similarity | NPC179787 |
| 0.5781 | Remote Similarity | NPC235685 |
| 0.5522 | Remote Similarity | NPC91868 |
| 0.5472 | Remote Similarity | NPC175899 |
| 0.5357 | Remote Similarity | NPC292958 |
| 0.5094 | Remote Similarity | NPC603809 |
| 0.5072 | Remote Similarity | NPC63971 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC232727 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| NPD |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
