NPASS Compound

Natural Product: NPC112886

Natural Product ID	NPC112886
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JSZSULSFHPSNTE-SJXKGZRTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	101639188
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 103109 0 0 0 0 0 0 0 0999 V2000 4.4828 0.4672 1.8800 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3375 0.9376 0.4751 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1273 0.0790 -0.5232 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2382 -0.2306 -1.7201 C 0 0 2 0 0 0 0 0 0 0 0 0 3.0233 -0.9650 -1.2168 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4384 -0.2063 -0.0581 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0131 1.0294 0.0347 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0537 -0.1754 -0.0850 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4443 -0.8337 0.9776 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3470 0.1992 1.7448 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1862 0.8833 0.6527 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1959 -0.0651 0.0621 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.1040 0.1957 -1.4703 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9417 -1.4798 0.3314 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7037 -2.1715 1.4303 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1046 -1.7065 1.6217 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4598 -0.9290 0.3271 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6175 0.2824 0.3949 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1538 1.4649 -0.3685 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5335 1.7131 0.2004 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4461 0.5835 -0.2007 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6943 0.7458 -1.6881 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7463 0.8169 0.5336 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7602 -0.0920 1.7096 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7014 -1.0932 1.4487 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9384 -0.7531 0.2039 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4224 -1.6493 -0.7874 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9567 0.7254 -0.3008 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8120 1.7211 -0.5885 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8870 1.2774 -1.4310 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8310 2.0164 -1.8513 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.6692 -0.0562 -1.6634 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5023 -0.4678 -0.9878 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4805 2.6349 0.0356 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5077 -1.8851 0.5622 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3795 -2.2680 -0.8416 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9651 -1.0152 -2.6057 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1827 0.8546 -0.9758 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3928 0.2802 -0.6656 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2090 0.0197 -1.9125 C 0 0 1 0 0 0 0 0 0 0 0 0 9.5737 0.6751 -1.6895 C 0 0 2 0 0 0 0 0 0 0 0 0 10.1278 0.1985 -0.3560 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1776 0.5198 0.7506 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7866 1.4617 1.7759 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9088 0.8870 2.3801 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0704 1.1674 0.2023 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3029 -1.1902 -0.4276 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4609 2.0649 -1.6265 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4104 -1.3291 -2.1582 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6267 0.8234 2.4603 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3907 0.9672 2.3185 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6671 -0.6196 1.9773 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7457 1.9601 0.4018 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4223 -0.8271 0.0011 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9701 0.7347 -2.1825 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2493 -1.0133 -2.0127 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6969 -0.7982 0.8724 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2026 -1.2666 1.6675 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9731 -0.2146 2.5511 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3117 1.0149 2.1307 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4343 1.1166 -0.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5660 1.8386 0.9852 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0973 -0.1536 -1.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9435 -0.2265 -2.0109 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1004 1.2880 -1.6640 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2382 -2.0446 -0.6177 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7482 -3.2634 1.1227 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1222 -2.2502 2.3948 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7702 -2.5715 1.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0830 -0.9824 2.4650 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1572 -1.6796 -0.4341 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5533 0.6881 1.4570 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1226 1.3321 -1.4531 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9331 2.6351 -0.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4155 1.7768 1.3037 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9836 1.4336 -2.1861 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7047 1.1551 -1.8950 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6113 -0.2237 -2.2162 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7651 1.8661 0.9773 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7779 -0.5853 1.7803 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6526 0.4292 2.6888 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1909 -2.1069 1.3909 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0746 -1.1697 2.3615 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5637 -2.5549 -0.3626 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6918 2.7283 -0.2238 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8277 -1.2059 -0.2245 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8536 -0.9179 -1.7383 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4930 3.2663 -0.7473 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4233 -2.7055 1.3245 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1287 -2.4220 -0.3677 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2795 -2.8816 -1.6070 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5557 -1.6626 -2.1122 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2577 -0.6798 -0.1307 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6998 0.4783 -2.7909 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2304 0.3705 -2.5053 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0868 0.7180 -0.1558 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8645 -0.3970 1.2891 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0540 2.3965 1.2657 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0758 1.6969 2.5870 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0223 -0.0105 2.0015 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1251 -1.4489 -0.9050 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8934 2.4343 -2.3532 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1684 -1.6055 -3.0791 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 6 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 23 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 19 34 1 0 14 35 1 0 5 36 1 0 4 37 1 0 3 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 42 47 1 0 41 48 1 0 40 49 1 0 7 2 1 0 35 9 1 0 46 39 1 0 18 12 1 0 26 21 1 0 33 28 1 0 26 17 1 0 1 50 1 0 1 51 1 0 1 52 1 0 2 53 1 1 3 54 1 1 4 55 1 6 5 56 1 6 6 57 1 1 9 58 1 1 10 59 1 0 10 60 1 0 11 61 1 0 11 62 1 0 13 63 1 0 13 64 1 0 13 65 1 0 14 66 1 6 15 67 1 0 15 68 1 0 16 69 1 0 16 70 1 0 17 71 1 6 18 72 1 1 19 73 1 6 20 74 1 0 20 75 1 0 22 76 1 0 22 77 1 0 22 78 1 0 23 79 1 1 24 80 1 0 24 81 1 0 25 82 1 0 25 83 1 0 27 84 1 0 29 85 1 0 33 86 1 0 33 87 1 0 34 88 1 0 35 89 1 0 35 90 1 0 36 91 1 0 37 92 1 0 39 93 1 1 40 94 1 6 41 95 1 6 42 96 1 1 43 97 1 1 44 98 1 0 44 99 1 0 45100 1 0 47101 1 0 48102 1 0 49103 1 0 M END

Standard InCHIKey	JSZSULSFHPSNTE-SJXKGZRTSA-N
Standard InCHI	InChI=1S/C35H54O14/c1-15-30(49-32-28(42)26(40)25(39)22(13-36)48-32)27(41)29(43)31(46-15)47-18-6-8-33(2)17(11-18)4-5-20-24(33)21(37)12-34(3)19(7-9-35(20,34)44)16-10-23(38)45-14-16/h10,15,17-22,24-32,36-37,39-44H,4-9,11-14H2,1-3H3/t15-,17+,18-,19+,20+,21+,22+,24+,25+,26-,27-,28+,29+,30-,31-,32-,33-,34+,35-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2[C@@H](C[C@]2(C)[C@H](CC[C@]32O)C2=CC(=O)OC2)O)C1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	698.35	Volume:	671.811 ? Van der Waals volume.
Dense:	1.04	LogP:	-0.366 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.431 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.053 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	38.0
TPSA:	225.06 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	8.0	Rings:	7.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.126	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.694	Fsp³:	0.914
MCE-18:	136.119 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.656	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.014 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.126	Promiscuous compounds:	0.319

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.603	MDCK Permeability:	-5.124
Pgp-inhibitor:	0.0	Pgp-substrate:	0.979
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.802
20% Bioavailability (F20%):	0.284	30% Bioavailability (F30%):	0.967
50% Bioavailability (F50%):	0.985

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.106	MRP1:	0.063
Plasma Protein Binding (PPB):	50.093%	Volume Distribution (VD):	-0.523
Fu:	49.315% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.072
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.383	CYP3A4-substrate:	0.04
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.032
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.793

Half-life (T1/2):

4.342

ADMET: Toxicity

hERG Blockers:	0.035	hERG Blockers (10um):	0.245
Human Hepatotoxicity (H-HT):	0.671	Drug-induced Liver Injury (DILI):	0.97
AMES Toxicity:	0.959	Rat Oral Acute Toxicity:	0.793
Maximum Recommended Daily Dose:	0.992	Skin Sensitization:	1.0
Carcinogencity:	0.602	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.866
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.976
Hematotoxicity:	0.861	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.999	RPMI-8226 Immunitoxicity:	0.84
A549 Cytotoxicity:	0.75	Hek293 Cytotoxicity:	0.935
BCF:	0.578 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.146 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.424 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.605 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO11308	Rohdea japonica	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO11308	Rohdea japonica	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO11308	Rohdea japonica	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO11308	Rohdea japonica	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC112886 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15325
0.1-0.2	29052
0.2-0.3	4288
0.3-0.4	973
0.4-0.5	88
0.5-0.6	72
0.6-0.7	45
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8452	Intermediate Similarity	NPC236973
0.7841	Intermediate Similarity	NPC264336
0.7816	Intermediate Similarity	NPC32177
0.7816	Intermediate Similarity	NPC469756
0.7816	Intermediate Similarity	NPC275901
0.7727	Intermediate Similarity	NPC188234
0.7556	Intermediate Similarity	NPC59288
0.75	Intermediate Similarity	NPC5311
0.7222	Intermediate Similarity	NPC40749
0.7174	Intermediate Similarity	NPC486143
0.7174	Intermediate Similarity	NPC486142
0.7174	Intermediate Similarity	NPC486149
0.6923	Remote Similarity	NPC30483
0.6923	Remote Similarity	NPC470897
0.6897	Remote Similarity	NPC77299
0.6897	Remote Similarity	NPC480906
0.6818	Remote Similarity	NPC480914
0.6774	Remote Similarity	NPC32793
0.6774	Remote Similarity	NPC116075
0.6768	Remote Similarity	NPC120390
0.6735	Remote Similarity	NPC486144
0.6735	Remote Similarity	NPC486145
0.6735	Remote Similarity	NPC486147
0.6735	Remote Similarity	NPC475590
0.6735	Remote Similarity	NPC486148
0.6703	Remote Similarity	NPC480907
0.6667	Remote Similarity	NPC99620
0.6667	Remote Similarity	NPC292467
0.6632	Remote Similarity	NPC125077
0.6632	Remote Similarity	NPC486135
0.6632	Remote Similarity	NPC208193
0.6632	Remote Similarity	NPC486137
0.66	Remote Similarity	NPC74259
0.6562	Remote Similarity	NPC232785
0.6562	Remote Similarity	NPC486139
0.6495	Remote Similarity	NPC486146
0.6444	Remote Similarity	NPC76572
0.6444	Remote Similarity	NPC193382
0.6421	Remote Similarity	NPC240070
0.625	Remote Similarity	NPC480910
0.625	Remote Similarity	NPC480909
0.6238	Remote Similarity	NPC486136
0.6214	Remote Similarity	NPC474908
0.619	Remote Similarity	NPC474423
0.6186	Remote Similarity	NPC231518
0.6186	Remote Similarity	NPC488944
0.6154	Remote Similarity	NPC469750
0.6117	Remote Similarity	NPC475419
0.6082	Remote Similarity	NPC486130
0.6058	Remote Similarity	NPC117445
0.6058	Remote Similarity	NPC308262
0.6058	Remote Similarity	NPC486134
0.6058	Remote Similarity	NPC486141
0.6044	Remote Similarity	NPC84987
0.602	Remote Similarity	NPC486127
0.6	Remote Similarity	NPC329986
0.6	Remote Similarity	NPC140092
0.5941	Remote Similarity	NPC486138
0.5941	Remote Similarity	NPC276838
0.5918	Remote Similarity	NPC475556
0.5918	Remote Similarity	NPC311706
0.5882	Remote Similarity	NPC475219
0.5859	Remote Similarity	NPC475629
0.5833	Remote Similarity	NPC72260
0.5825	Remote Similarity	NPC479360
0.5825	Remote Similarity	NPC479359
0.5825	Remote Similarity	NPC488943
0.5825	Remote Similarity	NPC488942
0.5789	Remote Similarity	NPC471353
0.5728	Remote Similarity	NPC486132
0.5728	Remote Similarity	NPC486131
0.57	Remote Similarity	NPC488941
0.57	Remote Similarity	NPC488940
0.5699	Remote Similarity	NPC196429
0.5684	Remote Similarity	NPC83287
0.5673	Remote Similarity	NPC486128
0.56	Remote Similarity	NPC479353
0.56	Remote Similarity	NPC479354
0.5591	Remote Similarity	NPC471633
0.5556	Remote Similarity	NPC486150
0.5529	Remote Similarity	NPC160583
0.5505	Remote Similarity	NPC488945
0.5505	Remote Similarity	NPC488946
0.5474	Remote Similarity	NPC157376
0.5474	Remote Similarity	NPC142066
0.5474	Remote Similarity	NPC603972
0.5464	Remote Similarity	NPC179412
0.5464	Remote Similarity	NPC471356
0.5463	Remote Similarity	NPC486140
0.5426	Remote Similarity	NPC99728
0.5426	Remote Similarity	NPC87250
0.5426	Remote Similarity	NPC244402
0.5426	Remote Similarity	NPC50305
0.5417	Remote Similarity	NPC199428
0.5417	Remote Similarity	NPC109448
0.5417	Remote Similarity	NPC310341
0.5413	Remote Similarity	NPC486133
0.5377	Remote Similarity	NPC488938
0.5377	Remote Similarity	NPC488937
0.534	Remote Similarity	NPC55532
0.5312	Remote Similarity	NPC17896
0.5312	Remote Similarity	NPC469755
0.5312	Remote Similarity	NPC284406
0.5312	Remote Similarity	NPC197707
0.5312	Remote Similarity	NPC251866
0.5312	Remote Similarity	NPC480915
0.53	Remote Similarity	NPC173555
0.5288	Remote Similarity	NPC469749
0.5283	Remote Similarity	NPC476221
0.5283	Remote Similarity	NPC477709
0.5283	Remote Similarity	NPC479357
0.5258	Remote Similarity	NPC84949
0.5258	Remote Similarity	NPC480562
0.5258	Remote Similarity	NPC74945
0.5258	Remote Similarity	NPC31354
0.5258	Remote Similarity	NPC69576
0.5238	Remote Similarity	NPC146857
0.5238	Remote Similarity	NPC488939
0.5182	Remote Similarity	NPC329675
0.5175	Remote Similarity	NPC486152
0.5152	Remote Similarity	NPC93883
0.5152	Remote Similarity	NPC305574
0.5102	Remote Similarity	NPC243196
0.5096	Remote Similarity	NPC610296
0.5094	Remote Similarity	NPC247190
0.5088	Remote Similarity	NPC286809
0.5052	Remote Similarity	NPC309034
0.5049	Remote Similarity	NPC27363
0.5044	Remote Similarity	NPC488947

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC112886 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6079
0.1-0.2	2965
0.2-0.3	81
0.3-0.4	11
0.4-0.5	5
0.5-0.6	8
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6186	Remote Similarity	NPD8033	Approved
0.5833	Remote Similarity	NPD8294	Phase 4
0.5684	Remote Similarity	NPD7327	Approved
0.5684	Remote Similarity	NPD7328	Phase 4
0.534	Remote Similarity	NPD8377	Phase 4
0.5312	Remote Similarity	NPD7319	Approved
0.53	Remote Similarity	NPD8296	Phase 4
0.5204	Remote Similarity	NPD8335	Phase 4
0.5152	Remote Similarity	NPD8380	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data