NPASS Compound

Natural Product: NPC10054

Natural Product ID	NPC10054
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	XTDZKFZZAQRWGE-YCQLJQLHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	6325313
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 164171 0 0 0 0 0 0 0 0999 V2000 5.9762 -6.7773 1.9516 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1555 -5.2987 2.2124 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0716 -4.5990 2.4619 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9643 -3.1506 2.7432 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9730 -2.3833 1.9472 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0325 -2.2151 0.4885 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0059 -3.6200 -0.1391 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8581 -1.4410 -0.0611 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6267 -0.0822 0.4422 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5066 0.3638 -0.5317 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9761 -0.8790 -1.1602 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6997 -1.0613 -2.5039 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5388 -2.0208 -0.2705 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6620 -2.3467 0.8569 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8255 -2.2143 0.6712 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2361 -0.9914 -0.0918 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7230 -0.7889 -0.1623 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4613 -1.9835 -0.7017 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2289 -0.5343 1.2399 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1095 0.6322 1.4281 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0586 0.9741 0.3082 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4307 0.8853 -1.0325 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2714 0.2108 -2.0480 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3309 2.3535 -1.5214 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9922 0.4337 -0.9764 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4064 0.3429 -2.3330 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8806 0.3119 -2.1366 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4894 -0.9533 -1.3757 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7336 -2.1425 -2.2830 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1378 0.1203 0.4171 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3102 0.7002 0.8375 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3777 0.5072 -0.1944 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0070 -0.8943 -0.1278 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1199 -1.3780 1.2763 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9983 -0.1777 2.1887 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2282 -0.6687 3.6237 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9952 0.3889 4.5154 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6900 0.2569 2.1070 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2697 -2.1115 1.4642 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2991 -1.7433 -0.9648 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3898 1.4718 -0.0930 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5888 2.1693 -1.2733 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3242 3.6415 -1.1015 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6062 4.4622 -1.2627 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.6864 3.7644 -0.5030 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.8799 2.3603 -1.0235 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8471 1.9195 -1.8230 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4472 3.7184 0.8591 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9858 4.5133 -2.6030 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7316 3.8989 0.1126 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8004 -3.7473 1.0965 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1599 -1.6473 0.1041 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4141 -1.9386 0.0855 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0765 -2.1862 -1.2647 C 0 0 1 0 0 0 0 0 0 0 0 0 7.5868 -0.8562 -1.7658 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4987 -0.1978 -0.7933 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8402 -0.1411 0.5699 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8551 0.9770 0.5477 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5139 2.1584 0.2184 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4436 2.5834 1.1225 C 0 0 1 0 0 0 0 0 0 0 0 0 9.8188 2.8509 0.5523 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7737 3.9009 -0.5318 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2556 5.1742 0.1440 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8876 4.8034 0.7011 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1890 6.0407 1.2473 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9657 3.8073 1.6403 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1418 6.2068 -0.7787 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0440 4.1955 -0.9809 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5903 3.4171 1.6031 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3190 -1.3318 0.9305 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7026 -0.8797 -0.7528 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5605 -0.0443 -2.2514 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1794 -3.0264 -1.1448 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5567 -4.8329 2.2008 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7089 -7.0604 1.1544 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9724 -6.8986 1.5126 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1513 -7.3079 2.8924 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0782 -5.1208 2.5098 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6970 -3.0411 3.8639 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9955 -2.7058 2.7465 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9790 -2.9013 2.2580 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9380 -1.3633 2.4770 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4956 -4.3640 0.4834 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3541 -3.6068 -1.0760 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9689 -3.9729 -0.4799 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2241 -1.2442 -1.1539 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4676 0.6117 0.4286 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1544 -0.0051 1.4405 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7816 0.9974 -0.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0549 1.0069 -1.2830 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9822 -0.9774 -3.3497 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1686 -2.0364 -2.6165 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4460 -0.2694 -2.6968 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4962 -2.9016 -0.9849 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9543 -1.8625 1.8042 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2439 -3.1569 0.2208 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2700 -2.1522 1.6815 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8509 -0.1164 0.5136 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1198 -2.9229 -0.2447 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5373 -2.0575 -1.7810 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5273 -1.8933 -0.3232 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8297 -1.4397 1.5620 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3413 -0.4381 1.9481 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6322 0.5904 2.4019 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4270 1.5332 1.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4802 1.9975 0.5626 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9551 0.9244 -2.6017 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7165 -0.2978 -2.8564 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9541 -0.5437 -1.6175 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2205 2.4014 -2.6081 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5068 2.7983 -0.9441 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2545 2.9133 -1.2137 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4402 1.2756 -0.4516 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5929 1.2345 -2.9490 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6549 -0.5491 -2.9025 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6428 1.2192 -1.5744 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4574 0.3869 -3.1335 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3344 -2.9466 -1.8111 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1438 -1.8411 -3.2756 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2256 -2.6804 -2.5548 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1142 1.8054 0.9437 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0024 0.5889 -1.2305 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0167 -0.7917 -0.5783 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2172 -2.0100 1.4771 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7645 0.5827 2.0208 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2788 -0.9527 3.7118 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5630 -1.5263 3.8231 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5497 1.1518 4.1640 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0091 -1.5865 1.9080 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2353 -2.6534 -0.6206 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8661 1.7834 -2.0199 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6481 4.0184 -1.9151 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4870 5.4771 -0.8634 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6347 4.3620 -0.6381 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0631 1.6659 -0.1921 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8171 2.3575 -1.6520 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8386 2.8700 1.2017 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1631 5.4573 -2.8655 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1431 3.2757 0.7900 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5246 -3.8998 2.0100 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4551 -3.0221 0.4914 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3636 -2.5523 -2.0217 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2218 -1.0876 -2.6811 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7058 0.8315 -1.1930 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6315 0.0996 1.3453 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4118 1.1388 1.5594 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0428 0.8363 -0.1834 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5300 1.9240 2.0209 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3144 1.9419 0.1737 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0829 3.6362 -1.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9446 5.4843 0.9427 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2843 4.4425 -0.1558 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1209 5.9377 1.0709 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5792 6.9336 0.7220 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4585 6.1109 2.3220 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9479 6.2807 -1.3485 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7345 3.5441 -0.7113 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0992 2.6880 2.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0483 -0.9072 0.1924 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8604 -0.6428 -2.6204 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9654 -3.9373 -1.5125 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6890 -3.7993 2.5721 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8915 -4.8287 1.1303 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2201 -5.4749 2.8242 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 21 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 43 50 1 0 14 51 1 0 6 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 64 66 1 0 63 67 1 0 62 68 1 0 61 69 1 0 57 70 1 0 56 71 1 0 55 72 1 0 54 73 1 0 2 74 1 0 13 8 1 0 28 16 1 0 38 31 1 0 47 42 1 0 70 53 1 0 28 11 1 0 66 60 1 0 25 17 1 0 1 75 1 0 1 76 1 0 1 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 5 81 1 0 5 82 1 0 7 83 1 0 7 84 1 0 7 85 1 0 8 86 1 0 9 87 1 0 9 88 1 0 10 89 1 0 10 90 1 0 12 91 1 0 12 92 1 0 12 93 1 0 13 94 1 0 14 95 1 0 15 96 1 0 15 97 1 0 16 98 1 0 18 99 1 0 18100 1 0 18101 1 0 19102 1 0 19103 1 0 20104 1 0 20105 1 0 21106 1 0 23107 1 0 23108 1 0 23109 1 0 24110 1 0 24111 1 0 24112 1 0 25113 1 0 26114 1 0 26115 1 0 27116 1 0 27117 1 0 29118 1 0 29119 1 0 29120 1 0 31121 1 1 32122 1 6 33123 1 6 34124 1 1 35125 1 6 36126 1 0 36127 1 0 37128 1 0 39129 1 0 40130 1 0 42131 1 6 43132 1 6 44133 1 1 45134 1 1 46135 1 0 46136 1 0 48137 1 0 49138 1 0 50139 1 0 51140 1 0 53141 1 1 54142 1 6 55143 1 6 56144 1 6 57145 1 1 58146 1 0 58147 1 0 60148 1 1 61149 1 6 62150 1 6 63151 1 1 64152 1 6 65153 1 0 65154 1 0 65155 1 0 67156 1 0 68157 1 0 69158 1 0 71159 1 0 72160 1 0 73161 1 0 74162 1 0 74163 1 0 74164 1 0 M END

Standard InCHIKey	XTDZKFZZAQRWGE-YCQLJQLHSA-N
Standard InCHI	InChI=1S/C53H90O21/c1-23(2)11-10-15-53(9,74-47-43(66)39(62)37(60)29(71-47)22-68-45-42(65)38(61)34(57)24(3)69-45)25-12-17-52(8)33(25)26(55)19-31-50(6)16-14-32(49(4,5)30(50)13-18-51(31,52)7)72-48-44(40(63)36(59)28(20-54)70-48)73-46-41(64)35(58)27(56)21-67-46/h11,24-48,54-66H,10,12-22H2,1-9H3/t24-,25?,26?,27+,28+,29+,30?,31?,32?,33?,34-,35-,36+,37+,38+,39-,40-,41+,42+,43+,44+,45+,46+,47-,48-,50?,51?,52?,53?/m0/s1
SMILES	CC(=CCCC(C)(C1CCC2(C)C1C(CC1C3(C)CCC(C(C)(C)C3CCC21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O1)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1062.6	Volume:	1038.75 ? Van der Waals volume.
Dense:	1.023	LogP:	1.878 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.738 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.721 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	45.0
TPSA:	336.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	13.0	Rings:	8.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.077	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.806	Fsp³:	0.962
MCE-18:	176.25 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.605	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.134 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.144	Promiscuous compounds:	0.036

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.157	MDCK Permeability:	-5.007
Pgp-inhibitor:	0.0	Pgp-substrate:	0.275
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.035
20% Bioavailability (F20%):	0.0	30% Bioavailability (F30%):	0.3
50% Bioavailability (F50%):	0.99

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.926
Plasma Protein Binding (PPB):	49.601%	Volume Distribution (VD):	-0.346
Fu:	28.654% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.998
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.009
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.007
HLM stability:	0.094 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.453

Half-life (T1/2):

4.863

ADMET: Toxicity

hERG Blockers:	0.014	hERG Blockers (10um):	0.082
Human Hepatotoxicity (H-HT):	0.359	Drug-induced Liver Injury (DILI):	0.134
AMES Toxicity:	0.51	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	0.998
Carcinogencity:	0.0	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.033	Drug-induced Nephrotoxicity:	0.732
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.234
A549 Cytotoxicity:	0.209	Hek293 Cytotoxicity:	0.131
BCF:	1.976 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.745 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.115 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.359 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	Stems	n.a.	n.a.	PMID[20104880]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22342101]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	aerial parts	n.a.	n.a.	PMID[25895106]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12934	Gynostemma pentaphyllum	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC10054 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23224
0.1-0.2	22453
0.2-0.3	2969
0.3-0.4	838
0.4-0.5	301
0.5-0.6	28
0.6-0.7	19
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	3
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9341	High Similarity	NPC159005
0.913	High Similarity	NPC14946
0.913	High Similarity	NPC63368
0.8791	High Similarity	NPC208650
0.8602	High Similarity	NPC220427
0.8081	Intermediate Similarity	NPC135369
0.7912	Intermediate Similarity	NPC208477
0.7879	Intermediate Similarity	NPC246124
0.7826	Intermediate Similarity	NPC69737
0.7619	Intermediate Similarity	NPC146868
0.7547	Intermediate Similarity	NPC488294
0.75	Intermediate Similarity	NPC488293
0.7429	Intermediate Similarity	NPC241381
0.7143	Intermediate Similarity	NPC488291
0.7048	Intermediate Similarity	NPC6931
0.6939	Remote Similarity	NPC269627
0.6848	Remote Similarity	NPC31907
0.6735	Remote Similarity	NPC181467
0.6729	Remote Similarity	NPC180183
0.67	Remote Similarity	NPC194842
0.6636	Remote Similarity	NPC472718
0.6635	Remote Similarity	NPC65167
0.6571	Remote Similarity	NPC160816
0.6518	Remote Similarity	NPC488292
0.6381	Remote Similarity	NPC472988
0.6381	Remote Similarity	NPC38217
0.6364	Remote Similarity	NPC472716
0.6228	Remote Similarity	NPC146652
0.619	Remote Similarity	NPC234160
0.6132	Remote Similarity	NPC208594
0.61	Remote Similarity	NPC312553
0.6075	Remote Similarity	NPC476360
0.6075	Remote Similarity	NPC476361
0.6019	Remote Similarity	NPC131479
0.596	Remote Similarity	NPC157659
0.5941	Remote Similarity	NPC8039
0.5941	Remote Similarity	NPC120123
0.5905	Remote Similarity	NPC152584
0.5865	Remote Similarity	NPC213190
0.5833	Remote Similarity	NPC66654
0.5755	Remote Similarity	NPC127801
0.5743	Remote Similarity	NPC159036
0.569	Remote Similarity	NPC610948
0.5429	Remote Similarity	NPC472987
0.541	Remote Similarity	NPC606950
0.5385	Remote Similarity	NPC472897
0.5385	Remote Similarity	NPC472896
0.5351	Remote Similarity	NPC305418
0.5345	Remote Similarity	NPC607354
0.5278	Remote Similarity	NPC207845
0.5259	Remote Similarity	NPC148603
0.5229	Remote Similarity	NPC472719
0.5182	Remote Similarity	NPC472715
0.5167	Remote Similarity	NPC481079
0.5149	Remote Similarity	NPC234287
0.5146	Remote Similarity	NPC160734
0.514	Remote Similarity	NPC16573
0.5135	Remote Similarity	NPC210759
0.5124	Remote Similarity	NPC609433
0.507	Remote Similarity	NPC329893
0.5048	Remote Similarity	NPC114874
0.5043	Remote Similarity	NPC323231

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC10054 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7696
0.1-0.2	1402
0.2-0.3	48
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data