NPASS drugs

Drug Information

Drug ID:	NPD8104
Drug Name:	Glecaprevir
Molecular Formula:	C38H46F4N6O9S
Canonical SMILES:	FC([C@@H]1C[C@]1(N=C([C@@H]1C[C@@H]2CN1C(=O)[C@@H](N=C(O)O[C@@H]1CCC[C@H]1OC/C=C/C(c1c(O2)nc2ccccc2n1)(F)F)C(C)(C)C)O)C(=NS(=O)(=O)C1(C)CC1)O)F
Standard InCHI:	InChI=1S/C38H46F4N6O9S/c1-35(2,3)28-32(50)48-19-20(17-24(48)30(49)46-37(18-21(37)29(39)40)33(51)47-58(53,54)36(4)14-15-36)56-31-27(43-22-9-5-6-10-23(22)44-31)38(41,42)13-8-16-55-25-11-7-12-26(25)57-34(52)45-28/h5-6,8-10,13,20-21,24-26,28-29H,7,11-12,14-19H2,1-4H3,(H,45,52)(H,46,49)(H,47,51)/b13-8+/t20-,21+,24+,25-,26-,28-,37-/m1/s1
Standard InCHIKey:	MLSQGNCUYAMAHD-ITNVBOSISA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD8104

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	281
0.1-0.2	2414
0.2-0.3	11106
0.3-0.4	12281
0.4-0.5	3005
0.5-0.6	1725
0.6-0.7	78
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6769	NPC471736
Remote Similarity	0.671	NPC308392
Remote Similarity	0.6652	NPC313421
Remote Similarity	0.6638	NPC475024
Remote Similarity	0.6548	NPC472434
Remote Similarity	0.6525	NPC472436
Remote Similarity	0.6509	NPC214827
Remote Similarity	0.6509	NPC314930
Remote Similarity	0.6473	NPC110741
Remote Similarity	0.6473	NPC472435
Remote Similarity	0.6453	NPC316403
Remote Similarity	0.6425	NPC118776
Remote Similarity	0.6364	NPC315804
Remote Similarity	0.6364	NPC313804
Remote Similarity	0.6352	NPC182507
Remote Similarity	0.6322	NPC197141
Remote Similarity	0.6275	NPC124300
Remote Similarity	0.6265	NPC310618
Remote Similarity	0.626	NPC477590
Remote Similarity	0.626	NPC477588
Remote Similarity	0.626	NPC477585
Remote Similarity	0.626	NPC477586
Remote Similarity	0.625	NPC291609
Remote Similarity	0.6235	NPC99891
Remote Similarity	0.6204	NPC128115
Remote Similarity	0.6192	NPC477548
Remote Similarity	0.6181	NPC477589
Remote Similarity	0.6181	NPC477587
Remote Similarity	0.6181	NPC184680
Remote Similarity	0.617	NPC470586
Remote Similarity	0.6157	NPC470785
Remote Similarity	0.6147	NPC226202
Remote Similarity	0.6144	NPC311357
Remote Similarity	0.613	NPC117244
Remote Similarity	0.613	NPC473763
Remote Similarity	0.613	NPC129909
Remote Similarity	0.6129	NPC475271
Remote Similarity	0.6122	NPC49195
Remote Similarity	0.612	NPC244536
Remote Similarity	0.612	NPC186351
Remote Similarity	0.6107	NPC315893
Remote Similarity	0.6107	NPC288349
Remote Similarity	0.6107	NPC313587
Remote Similarity	0.6107	NPC316110
Remote Similarity	0.6098	NPC52254
Remote Similarity	0.6094	NPC474183
Remote Similarity	0.6091	NPC1527
Remote Similarity	0.6078	NPC279401
Remote Similarity	0.6078	NPC79293
Remote Similarity	0.6076	NPC155143
Remote Similarity	0.6067	NPC472111
Remote Similarity	0.6066	NPC153452
Remote Similarity	0.6063	NPC323198
Remote Similarity	0.6063	NPC323752
Remote Similarity	0.6058	NPC469589
Remote Similarity	0.6057	NPC281049
Remote Similarity	0.6057	NPC303658
Remote Similarity	0.6057	NPC82070
Remote Similarity	0.6057	NPC174788
Remote Similarity	0.6043	NPC61435
Remote Similarity	0.604	NPC212766
Remote Similarity	0.604	NPC289423
Remote Similarity	0.6034	NPC475506
Remote Similarity	0.6031	NPC470784
Remote Similarity	0.6026	NPC311858
Remote Similarity	0.6024	NPC54803
Remote Similarity	0.6024	NPC321592
Remote Similarity	0.6017	NPC287208
Remote Similarity	0.6016	NPC24370
Remote Similarity	0.6016	NPC319232
Remote Similarity	0.6008	NPC95240
Remote Similarity	0.6008	NPC223409
Remote Similarity	0.6	NPC28848
Remote Similarity	0.6	NPC75179
Remote Similarity	0.6	NPC316224
Remote Similarity	0.6	NPC277350
Remote Similarity	0.6	NPC64216
Remote Similarity	0.6	NPC14325
Remote Similarity	0.5992	NPC304307
Remote Similarity	0.5992	NPC309919
Remote Similarity	0.5992	NPC124920
Remote Similarity	0.5992	NPC478158
Remote Similarity	0.5992	NPC34580
Remote Similarity	0.5992	NPC118559
Remote Similarity	0.5984	NPC90019
Remote Similarity	0.5968	NPC100547
Remote Similarity	0.596	NPC155444
Remote Similarity	0.596	NPC478141
Remote Similarity	0.5959	NPC316181
Remote Similarity	0.5959	NPC151781
Remote Similarity	0.5959	NPC74562
Remote Similarity	0.5951	NPC79386
Remote Similarity	0.5949	NPC100321
Remote Similarity	0.5949	NPC192674
Remote Similarity	0.5948	NPC472846
Remote Similarity	0.5946	NPC475816
Remote Similarity	0.5945	NPC322135
Remote Similarity	0.5939	NPC470003
Remote Similarity	0.5939	NPC316756
Remote Similarity	0.5938	NPC141053
Remote Similarity	0.5934	NPC475841
Remote Similarity	0.5934	NPC474145
Remote Similarity	0.5929	NPC261251
Remote Similarity	0.5927	NPC314270
Remote Similarity	0.5927	NPC469594
Remote Similarity	0.5925	NPC133609
Remote Similarity	0.5923	NPC243716
Remote Similarity	0.5923	NPC472097
Remote Similarity	0.5922	NPC14288
Remote Similarity	0.5921	NPC219963
Remote Similarity	0.5918	NPC472098
Remote Similarity	0.5918	NPC110602
Remote Similarity	0.5918	NPC31385
Remote Similarity	0.5918	NPC75726
Remote Similarity	0.5915	NPC57994
Remote Similarity	0.5915	NPC289299
Remote Similarity	0.5913	NPC20249
Remote Similarity	0.5912	NPC478013
Remote Similarity	0.5911	NPC476114
Remote Similarity	0.5907	NPC473640
Remote Similarity	0.5906	NPC194740
Remote Similarity	0.5902	NPC219664
Remote Similarity	0.5898	NPC89987
Remote Similarity	0.5894	NPC469592
Remote Similarity	0.5894	NPC471080
Remote Similarity	0.5891	NPC57453
Remote Similarity	0.5891	NPC272549
Remote Similarity	0.5889	NPC214142
Remote Similarity	0.5887	NPC305984
Remote Similarity	0.5887	NPC165964
Remote Similarity	0.5885	NPC24594
Remote Similarity	0.5885	NPC472122
Remote Similarity	0.5875	NPC220852
Remote Similarity	0.5875	NPC284888
Remote Similarity	0.587	NPC478157
Remote Similarity	0.587	NPC320394
Remote Similarity	0.5866	NPC476492
Remote Similarity	0.5865	NPC267928
Remote Similarity	0.5861	NPC162860
Remote Similarity	0.5861	NPC107077
Remote Similarity	0.5861	NPC223791
Remote Similarity	0.5859	NPC299035
Remote Similarity	0.5859	NPC211997
Remote Similarity	0.5859	NPC177432
Remote Similarity	0.5855	NPC127647
Remote Similarity	0.5854	NPC203168
Remote Similarity	0.5854	NPC75634
Remote Similarity	0.5853	NPC33064
Remote Similarity	0.5853	NPC245055
Remote Similarity	0.5852	NPC266551
Remote Similarity	0.5852	NPC161887
Remote Similarity	0.585	NPC477219
Remote Similarity	0.5846	NPC82472
Remote Similarity	0.5845	NPC315411
Remote Similarity	0.5844	NPC474905
Remote Similarity	0.5843	NPC189079
Remote Similarity	0.5843	NPC56109
Remote Similarity	0.5843	NPC191382
Remote Similarity	0.5841	NPC469938
Remote Similarity	0.584	NPC239954
Remote Similarity	0.5839	NPC315467
Remote Similarity	0.5837	NPC474192
Remote Similarity	0.5837	NPC168135
Remote Similarity	0.5837	NPC322800
Remote Similarity	0.5837	NPC477218
Remote Similarity	0.5837	NPC475720
Remote Similarity	0.5837	NPC213629
Remote Similarity	0.5833	NPC133261
Remote Similarity	0.583	NPC54744
Remote Similarity	0.583	NPC476287
Remote Similarity	0.5827	NPC37924
Remote Similarity	0.5827	NPC26543
Remote Similarity	0.5826	NPC472104
Remote Similarity	0.5826	NPC472259
Remote Similarity	0.5822	NPC258773
Remote Similarity	0.5821	NPC314882
Remote Similarity	0.582	NPC326363
Remote Similarity	0.5816	NPC18487
Remote Similarity	0.5815	NPC134586
Remote Similarity	0.5815	NPC258048
Remote Similarity	0.5814	NPC473105
Remote Similarity	0.5813	NPC320968
Remote Similarity	0.5808	NPC91179
Remote Similarity	0.5808	NPC472105
Remote Similarity	0.5808	NPC187827
Remote Similarity	0.5808	NPC285343
Remote Similarity	0.5806	NPC477979
Remote Similarity	0.5806	NPC274842
Remote Similarity	0.5806	NPC314176
Remote Similarity	0.5805	NPC473800
Remote Similarity	0.5805	NPC198673
Remote Similarity	0.5804	NPC315061
Remote Similarity	0.5804	NPC476832
Remote Similarity	0.5804	NPC110151
Remote Similarity	0.5804	NPC325683
Remote Similarity	0.5804	NPC476828
Remote Similarity	0.5803	NPC125181
Remote Similarity	0.5803	NPC314056
Remote Similarity	0.5803	NPC242872
Remote Similarity	0.5803	NPC263117

Drug Structure

NPD8104 OpenBabel08211713002D 61 67 0 0 1 0 0 0 0 0999 V2000 -4.5134 -5.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4364 -4.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7187 -4.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8502 0.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8019 1.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2529 1.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1591 -4.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9446 -1.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0582 0.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9603 0.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2434 -3.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6168 -4.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.6619 -1.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8502 1.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0591 -2.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2268 -1.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4027 -0.5961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5376 -2.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2082 -1.1535 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7085 0.0981 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7656 0.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2166 0.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9497 -2.1228 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7531 -3.2952 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3659 -3.6848 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7292 -0.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3174 -3.6066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4544 1.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0248 -2.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1803 -0.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9611 -3.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4726 -0.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3282 -3.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6853 -4.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.9817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4544 -0.8502 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2416 -0.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5061 1.3005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -3.1486 1.7406 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -8.0970 -0.4117 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -7.2625 1.0699 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -7.0219 -0.2305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.9240 -0.1886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.7902 -3.8863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2772 -1.8158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.9817 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.7598 -2.6774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.8476 -3.4177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1193 -3.6937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9817 -1.7004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2907 -4.9784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.9817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9817 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9928 -2.8009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6543 -0.8329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8731 -3.9277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.9228 -3.7471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4726 -2.5507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1216 -5.5013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 35 1 0 0 0 0 2 35 1 0 0 0 0 3 35 1 0 0 0 0 4 36 1 0 0 0 0 5 6 2 0 0 0 0 5 9 1 0 0 0 0 6 10 1 0 0 0 0 7 11 1 0 0 0 0 7 12 1 0 0 0 0 8 13 2 0 0 0 0 8 16 1 0 0 0 0 9 22 2 0 0 0 0 10 23 2 0 0 0 0 13 38 1 0 0 0 0 14 15 1 0 0 0 0 14 36 1 0 0 0 0 15 36 1 0 0 0 0 16 55 1 0 0 0 0 17 24 1 0 0 0 0 18 21 1 0 0 0 0 18 37 1 0 0 0 0 19 20 1 0 0 0 0 19 48 1 0 0 0 0 20 17 1 6 0 0 0 20 56 1 0 0 0 0 21 29 1 0 0 0 0 21 37 1 1 0 0 0 22 23 1 0 0 0 0 22 43 1 0 0 0 0 23 44 1 0 0 0 0 24 30 1 1 0 0 0 24 48 1 0 0 0 0 25 11 1 1 0 0 0 25 26 1 0 0 0 0 25 55 1 0 0 0 0 26 12 1 6 0 0 0 26 57 1 0 0 0 0 27 31 1 0 0 0 0 27 38 1 0 0 0 0 27 43 2 0 0 0 0 28 32 1 0 0 0 0 28 35 1 6 0 0 0 28 45 1 0 0 0 0 29 39 1 0 0 0 0 29 40 1 0 0 0 0 30 46 2 3 0 0 0 30 49 1 0 0 0 0 31 44 2 0 0 0 0 31 56 1 0 0 0 0 32 48 1 0 0 0 0 32 50 2 0 0 0 0 33 47 2 3 0 0 0 33 51 1 0 0 0 0 34 45 2 3 0 0 0 34 52 1 0 0 0 0 34 57 1 0 0 0 0 36 58 1 0 0 0 0 37 33 1 1 0 0 0 37 46 1 0 0 0 0 38 41 1 0 0 0 0 38 42 1 0 0 0 0 47 58 1 0 0 0 0 49 59 1 0 0 0 0 51 60 1 0 0 0 0 52 61 1 0 0 0 0 53 58 2 0 0 0 0 54 58 2 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	838.30
ALogP	-0.046
MLogP	3.44
XLogP	5.481
HDA	14
HBD	3
Rotatable Bonds	18
TPSA	214.07
RO5 Violation	2