NPASS Compound

Natural Product: NPC536695

Natural Product ID	NPC536695
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-4,5-dihydroxy-6-methyl-3-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-2-[(1~{S},2~{S},4~{S},5'~{S},6~{S},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-piperidine]-16-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{S},6~{R})-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-4,5-dihydroxy-6-methyl-3-[(2~{S},3~{R},4~{S},5~{R})-3,4,5-trihydroxytetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-2-[(1~{S},2~{S},4~{S},5'~{S},6~{S},7~{S},8~{R},9~{S},12~{S},13~{R},16~{S})-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-piperidine]-16-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 151160 0 0 0 0 0 0 0 0999 V2000 13.8906 0.6937 0.4829 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8217 -0.3368 0.0937 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9966 -0.6050 1.3066 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7135 -1.2996 0.9611 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0575 -0.7750 -0.2701 C 0 0 2 0 0 0 0 0 0 0 0 0 10.9610 -0.7373 -1.3784 N 0 0 0 0 0 0 0 0 0 0 0 0 12.0151 0.2045 -1.0430 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4407 0.4602 -0.0998 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3881 0.2829 0.7567 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1778 1.1670 0.4135 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0819 0.2637 0.8316 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7016 0.6660 0.5113 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3582 1.9908 1.1031 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9518 2.3060 0.7339 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0426 1.3555 0.6016 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6622 1.7542 0.2304 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2201 1.2802 1.3889 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.2730 0.5528 0.8979 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4985 1.2041 1.0682 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3914 0.5156 1.7914 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3039 -0.3239 1.2696 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1468 -1.6987 1.9988 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0497 -2.6227 1.4975 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3517 -0.5327 -0.1741 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5834 -0.2620 -0.7997 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1439 -1.3535 -1.3806 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0246 -1.1523 -2.7884 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1422 -2.3977 -3.4250 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8383 -3.1222 -3.5486 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1857 -3.2462 -2.6953 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8384 -4.0975 -3.5832 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2279 -2.2633 -2.1706 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4185 -2.8638 -1.9052 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5892 -1.5204 -1.0082 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7997 -2.1865 0.1760 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5862 -1.4902 1.0991 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6836 -1.1482 2.1422 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3152 -0.4758 3.1723 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1364 -1.5421 3.9063 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7138 -0.9844 5.0520 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2420 -1.9231 2.9580 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9218 -3.0130 3.5097 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6414 -2.3777 1.6426 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7156 -2.5240 0.7612 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2146 0.0805 -0.9188 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0404 -0.6661 -0.8199 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0100 1.4812 -0.3693 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1470 2.2446 -0.3364 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8794 3.4235 -1.0561 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9954 4.5228 -0.2039 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5995 5.6614 -0.8594 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4204 6.3178 -0.1363 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2067 5.4729 -2.2869 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1447 6.7690 -2.8560 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2535 4.7309 -3.0857 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6021 4.1203 -4.1593 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8165 3.6350 -2.2077 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0771 2.4609 -2.9073 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5472 0.5820 2.4612 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4497 -0.5211 1.9813 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3252 -0.0830 0.8071 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8226 -0.8493 -0.3952 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7703 -0.3784 1.1015 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1246 -1.7676 0.6134 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5831 -2.0968 0.7861 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4709 -1.0393 0.1615 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3239 -0.9960 -1.3336 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9020 -1.1375 0.5269 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8266 -1.6519 -0.5399 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1016 -3.1071 -0.2635 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2902 1.1983 -0.4099 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4463 1.4371 1.1961 H 0 0 0 0 0 0 0 0 0 0 0 0 14.6718 0.1555 1.0575 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2972 -1.2909 -0.2267 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5944 -1.3178 1.9495 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7810 0.2742 1.9275 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9898 -1.2827 1.8019 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9635 -2.3721 0.7800 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4236 -0.4217 -2.2167 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4917 1.1278 -0.6600 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6650 0.4311 -1.9094 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6366 0.4573 1.8279 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2108 2.0431 1.0972 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1622 1.4873 -0.6255 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1535 0.0981 1.9264 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4554 0.7191 -0.5643 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3873 1.9906 2.2199 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9946 2.8129 0.6702 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6467 3.3589 0.5632 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6081 2.8770 0.1251 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3234 1.3763 -0.7460 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6493 2.2216 1.8304 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3086 2.1854 1.5760 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3145 0.0255 1.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1279 -2.0359 1.7647 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3739 -1.5577 3.0568 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6006 -3.4978 1.2940 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2287 -1.6594 -0.3549 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6033 -2.2986 -1.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5398 -2.2033 -4.4347 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7080 -3.6865 -4.4940 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7832 -3.8982 -2.7302 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9590 -2.4537 -3.4675 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7799 -3.8137 -1.8600 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9328 -5.0233 -3.2010 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3860 -1.4832 -2.9797 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8821 -3.0309 -2.7633 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1166 -0.5132 -0.9928 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9249 -0.5609 0.6068 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5717 -0.0219 3.8235 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0634 0.2222 2.7445 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5251 -2.4191 4.1145 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0086 -0.0612 4.7721 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9368 -1.0794 2.7548 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7908 -3.1918 3.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2036 -3.3918 1.7973 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9505 -3.4827 0.6480 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4295 0.2187 -2.0129 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4963 -0.5754 -1.6626 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1851 1.9433 -0.9477 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8443 3.4283 -1.4545 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4340 6.3913 -0.8343 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6801 6.2870 0.9453 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4844 5.7514 -0.2806 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2666 7.3302 -0.5247 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1812 5.0676 -2.4364 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3778 7.4704 -2.2293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0372 5.4288 -3.4431 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1966 4.0895 -4.9682 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7659 4.0569 -1.7817 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0308 2.2467 -2.7868 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2000 0.1193 3.1444 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1057 1.3131 3.1115 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1393 -0.7565 2.8350 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8843 -1.4315 1.7833 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3778 -0.6202 -1.3110 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7853 -1.9555 -0.2022 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7636 -0.5707 -0.5524 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9352 -0.3701 2.2005 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5469 -2.4884 1.2232 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7982 -1.8669 -0.4342 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8034 -3.0566 0.3239 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8305 -2.1476 1.8635 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9799 -0.2069 -1.7419 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2972 -0.7541 -1.6740 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5213 -2.0128 -1.7214 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0083 -1.7420 1.4691 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4833 -1.5584 -1.5630 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0564 -3.4546 -0.6836 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9573 -3.3804 0.8017 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2938 -3.6741 -0.8152 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 5 8 1 1 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 41 43 1 0 43 44 1 0 24 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 17 59 1 0 59 60 1 0 60 61 1 0 61 62 1 6 61 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 6 66 68 1 0 68 69 1 0 69 70 1 0 7 2 1 0 68 9 1 0 69 5 1 0 66 11 1 0 63 12 1 0 61 15 1 0 47 19 1 0 57 49 1 0 34 26 1 0 43 36 1 0 1 71 1 0 1 72 1 0 1 73 1 0 2 74 1 6 3 75 1 0 3 76 1 0 4 77 1 0 4 78 1 0 6 79 1 0 7 80 1 0 7 81 1 0 9 82 1 1 10 83 1 0 10 84 1 0 11 85 1 1 12 86 1 6 13 87 1 0 13 88 1 0 14 89 1 0 16 90 1 0 16 91 1 0 17 92 1 1 19 93 1 1 21 94 1 1 22 95 1 0 22 96 1 0 23 97 1 0 24 98 1 1 26 99 1 1 28100 1 6 29101 1 0 29102 1 0 29103 1 0 30104 1 1 31105 1 0 32106 1 6 33107 1 0 34108 1 1 36109 1 6 38110 1 0 38111 1 0 39112 1 1 40113 1 0 41114 1 6 42115 1 0 43116 1 1 44117 1 0 45118 1 6 46119 1 0 47120 1 6 49121 1 6 51122 1 6 52123 1 0 52124 1 0 52125 1 0 53126 1 1 54127 1 0 55128 1 6 56129 1 0 57130 1 1 58131 1 0 59132 1 0 59133 1 0 60134 1 0 60135 1 0 62136 1 0 62137 1 0 62138 1 0 63139 1 1 64140 1 0 64141 1 0 65142 1 0 65143 1 0 67144 1 0 67145 1 0 67146 1 0 68147 1 1 69148 1 6 70149 1 0 70150 1 0 70151 1 0 M END

Standard InCHIKey	RMXBEFPNQXHZDG-WLLMCFRPSA-N
Standard InCHI	InChI=1S/C50H81NO19/c1-20-9-14-50(51-17-20)21(2)32-30(70-50)16-28-26-8-7-24-15-25(10-12-48(24,5)27(26)11-13-49(28,32)6)65-47-43(69-45-39(60)36(57)33(54)22(3)63-45)40(61)41(31(18-52)66-47)67-46-42(37(58)34(55)23(4)64-46)68-44-38(59)35(56)29(53)19-62-44/h7,20-23,25-47,51-61H,8-19H2,1-6H3/t20-,21-,22-,23-,25-,26+,27-,28-,29+,30-,31+,32-,33-,34-,35-,36+,37+,38+,39+,40-,41+,42+,43+,44-,45-,46-,47+,48-,49-,50-/m0/s1
SMILES	C[C@H]1CC[C@]2(NC1)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O[C@@H]7OC[C@@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	999.54	Volume:	963.166 ? Van der Waals volume.
Dense:	1.038	LogP:	1.192 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.921 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.956 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	54.0
TPSA:	297.4 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	11.0	Rings:	10.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.127	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.173	Fsp³:	0.96
MCE-18:	257.061 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.76	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.021	Promiscuous compounds:	0.021

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.272	MDCK Permeability:	-5.013
Pgp-inhibitor:	0.0	Pgp-substrate:	0.949
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.008	30% Bioavailability (F30%):	0.668
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.016	MRP1:	0.046
Plasma Protein Binding (PPB):	60.646%	Volume Distribution (VD):	-0.372
Fu:	30.887% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.012
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.986	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.079
HLM stability:	0.049 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.25

Half-life (T1/2):

3.279

ADMET: Toxicity

hERG Blockers:	0.024	hERG Blockers (10um):	0.114
Human Hepatotoxicity (H-HT):	0.375	Drug-induced Liver Injury (DILI):	0.877
AMES Toxicity:	0.888	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.024	Skin Sensitization:	1.0
Carcinogencity:	0.017	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.005
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.307	Drug-induced Nephrotoxicity:	0.802
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.308
A549 Cytotoxicity:	0.879	Hek293 Cytotoxicity:	0.692
BCF:	1.804 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.53 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.785 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.12 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO48375	Solanum aculeastrum Dunal	Genus	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC536695 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24664
0.1-0.2	21957
0.2-0.3	2382
0.3-0.4	690
0.4-0.5	101
0.5-0.6	32
0.6-0.7	27
0.7-0.8	1
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8788	High Similarity	NPC122819
0.8241	Intermediate Similarity	NPC287885
0.7476	Intermediate Similarity	NPC15249
0.7476	Intermediate Similarity	NPC25455
0.7091	Intermediate Similarity	NPC150057
0.7091	Intermediate Similarity	NPC147753
0.6991	Remote Similarity	NPC475333
0.6991	Remote Similarity	NPC224098
0.6991	Remote Similarity	NPC208383
0.687	Remote Similarity	NPC249265
0.675	Remote Similarity	NPC480556
0.6639	Remote Similarity	NPC232054
0.6435	Remote Similarity	NPC73243
0.6435	Remote Similarity	NPC244086
0.6435	Remote Similarity	NPC84956
0.6372	Remote Similarity	NPC470433
0.6372	Remote Similarity	NPC46190
0.6372	Remote Similarity	NPC171073
0.6325	Remote Similarity	NPC247037
0.6316	Remote Similarity	NPC248746
0.6261	Remote Similarity	NPC42171
0.6218	Remote Similarity	NPC194207
0.6218	Remote Similarity	NPC22779
0.6216	Remote Similarity	NPC94272
0.6207	Remote Similarity	NPC480555
0.6207	Remote Similarity	NPC150372
0.6167	Remote Similarity	NPC480554
0.6116	Remote Similarity	NPC23808
0.6116	Remote Similarity	NPC87998
0.6068	Remote Similarity	NPC475182
0.6066	Remote Similarity	NPC480553
0.605	Remote Similarity	NPC269297
0.605	Remote Similarity	NPC222202
0.5906	Remote Similarity	NPC224314
0.5862	Remote Similarity	NPC98696
0.5772	Remote Similarity	NPC218571
0.5772	Remote Similarity	NPC487615
0.576	Remote Similarity	NPC308140
0.5741	Remote Similarity	NPC165439
0.569	Remote Similarity	NPC113044
0.569	Remote Similarity	NPC283829
0.569	Remote Similarity	NPC161676
0.5556	Remote Similarity	NPC305423
0.5534	Remote Similarity	NPC485606
0.5528	Remote Similarity	NPC486386
0.5484	Remote Similarity	NPC13193
0.5455	Remote Similarity	NPC6806
0.544	Remote Similarity	NPC254255
0.5417	Remote Similarity	NPC265275
0.5385	Remote Similarity	NPC470432
0.5385	Remote Similarity	NPC230507
0.5372	Remote Similarity	NPC477809
0.5366	Remote Similarity	NPC102016
0.5366	Remote Similarity	NPC95051
0.5238	Remote Similarity	NPC32361
0.5203	Remote Similarity	NPC124677
0.5192	Remote Similarity	NPC147835
0.5192	Remote Similarity	NPC253645
0.5192	Remote Similarity	NPC85001
0.5192	Remote Similarity	NPC95920
0.5167	Remote Similarity	NPC14704
0.5164	Remote Similarity	NPC602423
0.5118	Remote Similarity	NPC309278
0.5081	Remote Similarity	NPC471464
0.5081	Remote Similarity	NPC300557

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC536695 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7584
0.1-0.2	1506
0.2-0.3	54
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8788	High Similarity	NPD8449	Approved
0.7091	Intermediate Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data