Molecular Weight:   | 189.04 |
Volume:   | 155.512 |
LogP:   | -2.802 |
LogD:   | -1.35 |
LogS:   | -1.461 |
# Rotatable Bonds:   | 3 |
TPSA:   | 131.32 |
# H-Bond Aceptor:   | 8 |
# H-Bond Donor:   | 4 |
# Rings:   | 1 |
# Heavy Atoms:   | 8 |
QED Drug-Likeness Score:   | 0.483 |
Synthetic Accessibility Score:   | 3.579 |
Fsp3:   | 0.4 |
Lipinski Rule-of-5:   | Accepted |
Pfizer Rule:   | Accepted |
GSK Rule:   | Accepted |
BMS Rule:   | 0 |
Golden Triangle Rule:   | Rejected |
Chelating Alert:   | 0 |
PAINS Alert:   | 0 |
Caco-2 Permeability:   | -6.037 |
MDCK Permeability:   | 0.008420012891292572 |
Pgp-inhibitor:   | 0.0 |
Pgp-substrate:   | 0.073 |
Human Intestinal Absorption (HIA):   | 0.046 |
20% Bioavailability (F20%):   | 0.004 |
30% Bioavailability (F30%):   | 0.004 |
Blood-Brain-Barrier Penetration (BBB):   | 0.316 |
Plasma Protein Binding (PPB):   | 8.049633026123047% |
Volume Distribution (VD):   | 0.33 |
Pgp-substrate:   | 81.37393188476562% |
CYP1A2-inhibitor:   | 0.008 |
CYP1A2-substrate:   | 0.06 |
CYP2C19-inhibitor:   | 0.048 |
CYP2C19-substrate:   | 0.041 |
CYP2C9-inhibitor:   | 0.018 |
CYP2C9-substrate:   | 0.046 |
CYP2D6-inhibitor:   | 0.018 |
CYP2D6-substrate:   | 0.084 |
CYP3A4-inhibitor:   | 0.007 |
CYP3A4-substrate:   | 0.018 |
Clearance (CL):   | 5.638 |
Half-life (T1/2):   | 0.914 |
hERG Blockers:   | 0.005 |
Human Hepatotoxicity (H-HT):   | 0.358 |
Drug-inuced Liver Injury (DILI):   | 0.965 |
AMES Toxicity:   | 0.026 |
Rat Oral Acute Toxicity:   | 0.016 |
Maximum Recommended Daily Dose:   | 0.003 |
Skin Sensitization:   | 0.445 |
Carcinogencity:   | 0.15 |
Eye Corrosion:   | 0.003 |
Eye Irritation:   | 0.046 |
Respiratory Toxicity:   | 0.042 |
Natural Product ID:   | NPC273037 |
Common Name*:   | Quisqualate |
IUPAC Name:   | (2S)-2-amino-3-(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)propanoic acid |
Synonyms:   | Quisqualate; quisqualic acid |
Standard InCHIKey:   | ASNFTDCKZKHJSW-REOHCLBHSA-N |
Standard InCHI:   | InChI=1S/C5H7N3O5/c6-2(3(9)10)1-8-4(11)7-5(12)13-8/h2H,1,6H2,(H,9,10)(H,7,11,12)/t2-/m0/s1 |
SMILES:   | OC(=O)[C@H](Cn1oc(=O)nc1O)N |
Synthetic Gene Cluster:   | n.a. |
ChEMBL Identifier:   | CHEMBL279956 |
PubChem CID:   |
40539 6971145 |
Chemical Classification**:   |
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
---|---|---|---|---|---|---|---|---|
NPO20379 | Schistocerca gregaria | Species | Acrididae | Eukaryota | n.a. | n.a. | n.a. |
PMID[12770022] |
NPO29775.1 | Quisqualis indica var. villosa | Varieties | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO21451 | Thalictrum simplex | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO29775 | Quisqualis indica | Species | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO29680 | Quisqualis fructus | Species | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO21137 | Combretum indicum | Species | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO21451 | Thalictrum simplex | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO21137.1 | Quisqualis indica var. villosa | Varieties | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO29775 | Quisqualis indica | Species | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO21137 | Combretum indicum | Species | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
NPO19413 | Chrysanthemoides incana | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO21119 | Euphorbia fidjiana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO19723 | Anaptychia hypoleuca | Species | Physciaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO21137 | Combretum indicum | Species | Combretaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO15701 | Cascarilla magnifolia | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
NPO21451 | Thalictrum simplex | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO13572 | Apis florea | Species | Apidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO20379 | Schistocerca gregaria | Species | Acrididae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Organism ID | NP ID | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
---|
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
---|---|---|---|---|---|---|---|---|
NPT3080 | Individual Protein | Metabotropic glutamate receptor 1 | Rattus norvegicus | EC50 ratio | = | 0.02 | n.a. | PMID[491813] |
NPT3081 | Individual Protein | Metabotropic glutamate receptor 2 | Rattus norvegicus | EC50 ratio | > | 90.0 | n.a. | PMID[491813] |
NPT1259 | Individual Protein | Metabotropic glutamate receptor 1 | Homo sapiens | EC50 | = | 200.0 | nM | PMID[491814] |
NPT1259 | Individual Protein | Metabotropic glutamate receptor 1 | Homo sapiens | Ki | = | 1100.0 | nM | PMID[491815] |
NPT4563 | Individual Protein | Metabotropic glutamate receptor 2 | Homo sapiens | Ki | > | 1000000.0 | nM | PMID[491815] |
NPT4562 | Individual Protein | Metabotropic glutamate receptor 3 | Homo sapiens | Ki | = | 40000.0 | nM | PMID[491815] |
NPT4565 | Individual Protein | Metabotropic glutamate receptor 4 | Homo sapiens | Ki | = | 1000000.0 | nM | PMID[491815] |
NPT3549 | Individual Protein | Metabotropic glutamate receptor 5 | Homo sapiens | Ki | = | 55.0 | nM | PMID[491815] |
NPT3757 | Individual Protein | Metabotropic glutamate receptor 6 | Homo sapiens | Ki | = | 1000000.0 | nM | PMID[491815] |
NPT3080 | Individual Protein | Metabotropic glutamate receptor 1 | Rattus norvegicus | EC50 | = | 200.0 | nM | PMID[491823] |
NPT3080 | Individual Protein | Metabotropic glutamate receptor 1 | Rattus norvegicus | EC50 | = | 700.0 | nM | PMID[491823] |
NPT3080 | Individual Protein | Metabotropic glutamate receptor 1 | Rattus norvegicus | EC50 | = | 2500.0 | nM | PMID[491823] |
NPT3080 | Individual Protein | Metabotropic glutamate receptor 1 | Rattus norvegicus | EC50 | = | 16400.0 | nM | PMID[491823] |
NPT3080 | Individual Protein | Metabotropic glutamate receptor 1 | Rattus norvegicus | EC50 | = | 750.0 | nM | PMID[491823] |
NPT3081 | Individual Protein | Metabotropic glutamate receptor 2 | Rattus norvegicus | EC50 | > | 500000.0 | nM | PMID[491823] |
NPT3081 | Individual Protein | Metabotropic glutamate receptor 2 | Rattus norvegicus | EC50 | > | 1000000.0 | nM | PMID[491823] |
NPT4563 | Individual Protein | Metabotropic glutamate receptor 2 | Homo sapiens | EC50 | > | 1000000.0 | nM | PMID[491823] |
NPT4572 | Individual Protein | Metabotropic glutamate receptor 3 | Rattus norvegicus | EC50 | = | 40000.0 | nM | PMID[491823] |
NPT3082 | Individual Protein | Metabotropic glutamate receptor 4 | Rattus norvegicus | EC50 | > | 100000.0 | nM | PMID[491823] |
NPT3082 | Individual Protein | Metabotropic glutamate receptor 4 | Rattus norvegicus | EC50 | = | 129000.0 | nM | PMID[491823] |
NPT4565 | Individual Protein | Metabotropic glutamate receptor 4 | Homo sapiens | EC50 | > | 500000.0 | nM | PMID[491823] |
NPT4570 | Individual Protein | Metabotropic glutamate receptor 5 | Rattus norvegicus | EC50 | = | 300.0 | nM | PMID[491823] |
NPT4570 | Individual Protein | Metabotropic glutamate receptor 5 | Rattus norvegicus | EC50 | = | 200.0 | nM | PMID[491823] |
NPT3549 | Individual Protein | Metabotropic glutamate receptor 5 | Homo sapiens | EC50 | = | 150.0 | nM | PMID[491823] |
NPT4573 | Individual Protein | Metabotropic glutamate receptor 6 | Rattus norvegicus | EC50 | = | 1000000.0 | nM | PMID[491823] |
NPT4574 | Individual Protein | Metabotropic glutamate receptor 7 | Rattus norvegicus | EC50 | > | 1000000.0 | nM | PMID[491823] |
NPT4566 | Individual Protein | Metabotropic glutamate receptor 7 | Homo sapiens | EC50 | > | 1000000.0 | nM | PMID[491823] |
NPT4575 | Individual Protein | Metabotropic glutamate receptor 8 | Mus musculus | EC50 | > | 100000.0 | nM | PMID[491823] |
NPT1259 | Individual Protein | Metabotropic glutamate receptor 1 | Homo sapiens | Ratio | = | 0.045 | n.a. | PMID[491824] |
NPT3080 | Individual Protein | Metabotropic glutamate receptor 1 | Rattus norvegicus | Ki | = | 10.0 | nM | PMID[491824] |
NPT4563 | Individual Protein | Metabotropic glutamate receptor 2 | Homo sapiens | Ratio | = | 108.0 | n.a. | PMID[491824] |
NPT4563 | Individual Protein | Metabotropic glutamate receptor 2 | Homo sapiens | Ki | = | 113000.0 | nM | PMID[491824] |
NPT4565 | Individual Protein | Metabotropic glutamate receptor 4 | Homo sapiens | Ratio | = | 593.0 | n.a. | PMID[491824] |
NPT4565 | Individual Protein | Metabotropic glutamate receptor 4 | Homo sapiens | Ki | = | 112000.0 | nM | PMID[491824] |
NPT4576 | Individual Protein | Glutamate carboxypeptidase II | Homo sapiens | IC50 | = | 9500.0 | nM | PMID[491826] |
NPT3748 | Individual Protein | Glutamate receptor ionotropic kainate 1 | Rattus norvegicus | Ki | = | 171.0 | nM | PMID[491827] |
NPT3748 | Individual Protein | Glutamate receptor ionotropic kainate 1 | Rattus norvegicus | Ki | = | 169.82 | nM | PMID[491827] |
NPT3738 | Individual Protein | Glutamate receptor ionotropic kainate 2 | Rattus norvegicus | Ki | = | 134.0 | nM | PMID[491827] |
NPT3738 | Individual Protein | Glutamate receptor ionotropic kainate 2 | Rattus norvegicus | Ki | = | 131.83 | nM | PMID[491827] |
NPT3756 | Individual Protein | Glutamate receptor ionotropic kainate 3 | Rattus norvegicus | Ki | = | 1670.0 | nM | PMID[491827] |
NPT3756 | Individual Protein | Glutamate receptor ionotropic kainate 3 | Rattus norvegicus | Ki | = | 1380.38 | nM | PMID[491827] |
NPT5463 | Individual Protein | Cystine/glutamate transporter | Homo sapiens | IC50 | = | 5000.0 | nM | PMID[491828] |
NPT163 | Individual Protein | Nuclear factor NF-kappa-B p105 subunit | Homo sapiens | Potency | = | 10.0 | nM | PMID[491830] |
NPT48 | Individual Protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 19952.6 | nM | PMID[491831] |
NPT48 | Individual Protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 10000.0 | nM | PMID[491830] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | = | 3.5 | nM | PMID[491831] |
NPT53 | Individual Protein | "4'-phosphopantetheinyl transferase ffp" | Bacillus subtilis | Potency | = | 89125.1 | nM | PMID[491830] |
NPT53 | Individual Protein | "4'-phosphopantetheinyl transferase ffp" | Bacillus subtilis | Potency | = | 44668.4 | nM | PMID[491832] |
NPT54 | Individual Protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 5011.9 | nM | PMID[491831] |
NPT282 | Individual Protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 12589.3 | nM | PMID[491830] |
NPT58 | Individual Protein | Bloom syndrome protein | Homo sapiens | Potency | = | 2.8 | nM | PMID[491831] |
NPT109 | Individual Protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 1000.0 | nM | PMID[491830] |
NPT532 | Individual Protein | Lysine-specific demethylase 4A | Homo sapiens | Potency | n.a. | 3981.1 | nM | PMID[491833] |
NPT5 | Individual Protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 10000.0 | nM | PMID[491834] |
NPT5 | Individual Protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 10000.0 | nM | PMID[491831] |
NPT135 | Individual Protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 31622.8 | nM | PMID[491834] |
NPT109 | Individual Protein | Cytochrome P450 3A4 | Homo sapiens | AC50 | = | 1000.0 | nM | PMID[491830] |
NPT208 | Individual Protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 39810.72 | nM | PMID[491830] |
NPT199 | Individual Protein | DNA polymerase kappa | Homo sapiens | Potency | n.a. | 1000.0 | nM | PMID[491830] |
NPT71 | Cell Line | HEK293 | Homo sapiens | Potency | n.a. | 32629.4 | nM | PMID[491834] |
NPT71 | Cell Line | HEK293 | Homo sapiens | Potency | n.a. | 5623.4 | nM | PMID[491831] |
NPT444 | Individual Protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 2993.5 | nM | PMID[491834] |
NPT66 | Individual Protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 23.15 | % | PMID[491835] |
NPT104 | Individual Protein | Cerebroside-sulfatase | Homo sapiens | Potency | n.a. | 23934.1 | nM | PMID[491834] |
NPT49 | Individual Protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 35481.3 | nM | PMID[491830] |
NPT4570 | Individual Protein | Metabotropic glutamate receptor 5 | Rattus norvegicus | EC80 | = | 100.0 | nM | PMID[491836] |
NPT3549 | Individual Protein | Metabotropic glutamate receptor 5 | Homo sapiens | EC50 | = | 630.0 | nM | PMID[491839] |
NPT2 | Others | Unspecified | "" | Activity | = | 104.0 | % | PMID[491812] |
NPT5636 | Protein Complex | Glutamate receptor ionotropic, AMPA | Mus musculus | IC50 | = | 80.0 | nM | PMID[491816] |
NPT2 | Others | Unspecified | "" | IC50 | = | 25.0 | nM | PMID[491816] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EC50 | = | 7300.0 | nM | PMID[491816] |
NPT2 | Others | Unspecified | "" | IC50 | = | 7000.0 | nM | PMID[491817] |
NPT2 | Others | Unspecified | "" | IC50 | = | 4000.0 | nM | PMID[491817] |
NPT2 | Others | Unspecified | "" | IC50 | = | 26000.0 | nM | PMID[491817] |
NPT2 | Others | Unspecified | "" | IC50 | > | 10000.0 | nM | PMID[491817] |
NPT2 | Others | Unspecified | "" | IC50 | = | 40.0 | nM | PMID[491817] |
NPT2 | Others | Unspecified | "" | IC50 | = | 1900.0 | nM | PMID[491817] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EC50 | = | 100.0 | nM | PMID[491818] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Emax | = | 240.0 | % | PMID[491818] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EC50 | = | 320.0 | nM | PMID[491818] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Emax | = | 524.0 | % | PMID[491818] |
NPT1496 | Protein Complex | Glutamate NMDA receptor | Rattus norvegicus | IC50 | > | 100000.0 | nM | PMID[491819] |
NPT3739 | Protein Complex | Glutamate receptor ionotropic, AMPA | Rattus norvegicus | IC50 | = | 1300.0 | nM | PMID[491819] |
NPT3740 | Protein Complex | Glutamate receptor ionotropic, kainate | Rattus norvegicus | IC50 | = | 150.0 | nM | PMID[491819] |
NPT35 | Others | n.a. | "" | pKa | = | 4.2 | n.a. | PMID[491820] |
NPT2 | Others | Unspecified | "" | IC50 | = | 480.0 | nM | PMID[491820] |
NPT3739 | Protein Complex | Glutamate receptor ionotropic, AMPA | Rattus norvegicus | IC50 | = | 7000.0 | nM | PMID[491821] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | > | 10000000.0 | nM | PMID[491821] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 40000.0 | nM | PMID[491821] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 1900000.0 | nM | PMID[491821] |
NPT2 | Others | Unspecified | "" | EC50 | = | 900.0 | nM | PMID[491822] |
NPT2 | Others | Unspecified | "" | EC50 | = | 100000.0 | nM | PMID[491822] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 3900.0 | nM | PMID[491825] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 2900.0 | nM | PMID[491825] |
NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Sensitisation | = | 1.3 | n.a. | PMID[491825] |
NPT197 | Protein-Protein Interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 39810.7 | nM | PMID[491830] |
NPT2 | Others | Unspecified | "" | Potency | = | 5623.4 | nM | PMID[491831] |
NPT794 | Individual Protein | Endonuclease 4 | Escherichia coli K-12 | Potency | = | 44668.4 | nM | PMID[491831] |
NPT94 | Individual Protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 8912.5 | nM | PMID[491830] |
NPT2 | Others | Unspecified | "" | Potency | = | 6309.6 | nM | PMID[491831] |
NPT95 | Individual Protein | Muscarinic acetylcholine receptor M1 | Rattus norvegicus | Potency | = | 17.8 | nM | PMID[491830] |
NPT2 | Others | Unspecified | "" | Potency | = | 11.2 | nM | PMID[491831] |
NPT800 | Individual Protein | M-phase phosphoprotein 8 | Homo sapiens | Potency | n.a. | 794.3 | nM | PMID[491831] |
NPT7 | Individual Protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 4744.4 | nM | PMID[491834] |
NPT7 | Individual Protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 707.9 | nM | PMID[491834] |
NPT698 | Individual Protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 946.6 | nM | PMID[491832] |
NPT7 | Individual Protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 1000.0 | nM | PMID[491834] |
NPT67 | Individual Protein | Cholinesterase | Equus caballus | Inhibition | = | 2.65 | % | PMID[491835] |
NPT2 | Others | Unspecified | "" | Potency | n.a. | 2511.9 | nM | PMID[491830] |
NPT21123 | SINGLE PROTEIN | Amino acid transporter | Rattus norvegicus | Inhibition | >= | 25.0 | % | PMID[491837] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 5.52 | % | PMID[491838] |
NPT20556 | SINGLE PROTEIN | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 12.76 | % | PMID[491840] |
NPT20556 | SINGLE PROTEIN | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 5.012 | % | PMID[491841] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.05 | % | PMID[491842] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.11 | % | PMID[491843] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC273037 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Natural Product ID |
---|---|---|
0.7667 | Intermediate Similarity | NPC10915 |
0.678 | Remote Similarity | NPC316168 |
0.6716 | Remote Similarity | NPC322206 |
0.6316 | Remote Similarity | NPC237525 |
0.6316 | Remote Similarity | NPC326212 |
0.6154 | Remote Similarity | NPC60672 |
0.6154 | Remote Similarity | NPC322091 |
0.6111 | Remote Similarity | NPC327985 |
0.6066 | Remote Similarity | NPC297220 |
0.6061 | Remote Similarity | NPC327831 |
0.6 | Remote Similarity | NPC118429 |
0.5946 | Remote Similarity | NPC81647 |
0.5902 | Remote Similarity | NPC208793 |
0.5902 | Remote Similarity | NPC285322 |
0.5897 | Remote Similarity | NPC192521 |
0.589 | Remote Similarity | NPC325534 |
0.5846 | Remote Similarity | NPC202525 |
0.5833 | Remote Similarity | NPC226453 |
0.5833 | Remote Similarity | NPC103130 |
0.5758 | Remote Similarity | NPC245768 |
0.5758 | Remote Similarity | NPC329495 |
0.5753 | Remote Similarity | NPC278881 |
0.5738 | Remote Similarity | NPC198301 |
0.5714 | Remote Similarity | NPC136159 |
0.5676 | Remote Similarity | NPC193559 |
0.5625 | Remote Similarity | NPC153370 |
0.5614 | Remote Similarity | NPC116709 |
0.5614 | Remote Similarity | NPC21290 |
0.5614 | Remote Similarity | NPC272614 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC273037 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Drug ID | Developmental Stage |
---|---|---|---|
0.678 | Remote Similarity | NPD8208 | Clinical (unspecified phase) |
0.678 | Remote Similarity | NPD8209 | Phase 2 |
0.6133 | Remote Similarity | NPD5382 | Phase 2 |
0.6 | Remote Similarity | NPD9014 | Approved |
0.5902 | Remote Similarity | NPD8610 | Approved |
0.589 | Remote Similarity | NPD8952 | Approved |
0.5833 | Remote Similarity | NPD9045 | Approved |
0.5833 | Remote Similarity | NPD9046 | Phase 3 |
0.5833 | Remote Similarity | NPD9048 | Approved |
0.5833 | Remote Similarity | NPD9047 | Approved |
0.5735 | Remote Similarity | NPD8864 | Clinical (unspecified phase) |
0.5735 | Remote Similarity | NPD8949 | Discontinued |
0.5625 | Remote Similarity | NPD8614 | Approved |
0.5614 | Remote Similarity | NPD8211 | Approved |
0.5614 | Remote Similarity | NPD8210 | Phase 3 |
0.56 | Remote Similarity | NPD9233 | Phase 3 |
0.56 | Remote Similarity | NPD9232 | Phase 2 |
0.56 | Remote Similarity | NPD9231 | Phase 3 |
Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.