Drug Information| Drug ID:   | NPD9045 |
| Drug Name:   | Tidiacic Arginine |
| Molecular Formula:   | C6H14N4O2.C5H7NO4S |
| Canonical SMILES:   | OC(=O)C1SCC(N1)C(=O)O.NC(=N)NCCC[C@@H](C(=O)O)N |
| Standard InCHI:   | "InChI=1S/C6H14N4O2.C5H7NO4S/c7-4(5(11)12)2-1-3-10-6(8)9;7-4(8)2-1-11-3(6-2)5(9)10/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-3,6H,1H2,(H,7,8)(H,9,10)/t4-;/m0./s1" |
| Standard InCHIKey:   | LUCWYYXUZVULSK-WCCKRBBISA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9045Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6905 | NPC226453 |
| Remote Similarity | 0.6905 | NPC103130 |
| Remote Similarity | 0.6905 | NPC211895 |
| Remote Similarity | 0.6905 | NPC611844 |
| Remote Similarity | 0.587 | NPC278881 |
| Remote Similarity | 0.5745 | NPC38059 |
| Remote Similarity | 0.5745 | NPC608429 |
| Remote Similarity | 0.5625 | NPC478501 |
| Remote Similarity | 0.5625 | NPC611659 |
| Remote Similarity | 0.5106 | NPC118429 |
| Remote Similarity | 0.5106 | NPC120635 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 174.11 |
| ALogP   | -2.1807 |
| MLogP   | 1.46 |
| XLogP   | -2.924 |
| HDA   | 6 |
| HBD   | 5 |
| Rotatable Bonds   | 9 |
| TPSA   | 125.22 |
| RO5 Violation   | 0 |