Drug Information| Drug ID:   | NPD9048 |
| Drug Name:   | Arginine |
| Molecular Formula:   | C6H14N4O2 |
| Canonical SMILES:   | NC(=N)NCCC[C@@H](C(=O)O)N |
| Standard InCHI:   | "InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1" |
| Standard InCHIKey:   | ODKSFYDXXFIFQN-BYPYZUCNSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | TTD; DrugBank |
  Structural Similarity Between NPASS Natural Products and NPD9048Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC226453 |
| High Similarity | 1.0 | NPC103130 |
| High Similarity | 1.0 | NPC211895 |
| High Similarity | 1.0 | NPC611844 |
| Intermediate Similarity | 0.8182 | NPC278881 |
| Intermediate Similarity | 0.7941 | NPC38059 |
| Intermediate Similarity | 0.7941 | NPC608429 |
| Intermediate Similarity | 0.7714 | NPC478501 |
| Intermediate Similarity | 0.7714 | NPC611659 |
| Intermediate Similarity | 0.7059 | NPC118429 |
| Intermediate Similarity | 0.7059 | NPC120635 |
| Remote Similarity | 0.6429 | NPC588316 |
| Remote Similarity | 0.6316 | NPC327985 |
| Remote Similarity | 0.6316 | NPC133183 |
| Remote Similarity | 0.6316 | NPC603044 |
| Remote Similarity | 0.6279 | NPC479618 |
| Remote Similarity | 0.6279 | NPC603984 |
| Remote Similarity | 0.6129 | NPC282102 |
| Remote Similarity | 0.6129 | NPC292996 |
| Remote Similarity | 0.6053 | NPC240779 |
| Remote Similarity | 0.6053 | NPC53738 |
| Remote Similarity | 0.5946 | NPC598280 |
| Remote Similarity | 0.5714 | NPC108358 |
| Remote Similarity | 0.5714 | NPC331434 |
| Remote Similarity | 0.5714 | NPC602198 |
| Remote Similarity | 0.5641 | NPC478850 |
| Remote Similarity | 0.5641 | NPC609636 |
| Remote Similarity | 0.5556 | NPC6717 |
| Remote Similarity | 0.55 | NPC142284 |
| Remote Similarity | 0.5405 | NPC296427 |
| Remote Similarity | 0.5385 | NPC118990 |
| Remote Similarity | 0.5385 | NPC247535 |
| Remote Similarity | 0.5385 | NPC538726 |
| Remote Similarity | 0.5294 | NPC112889 |
| Remote Similarity | 0.5263 | NPC130012 |
| TTD   | DIB008457; DIB013388 |
| DrugBank   | DB00125 |
| ChEMBL   | CHEMBL1485 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA448478 |
| KEGG Drug   | D02982 |
| PubChem CID   | 0 |
| ChEBI   | 16467 |
| CAS Number   | 74-79-3 |
| Molecular Weight   | 174.11 |
| ALogP   | -2.1807 |
| MLogP   | 1.46 |
| XLogP   | -2.924 |
| HDA   | 6 |
| HBD   | 5 |
| Rotatable Bonds   | 9 |
| TPSA   | 125.22 |
| RO5 Violation   | 0 |