Drug Information| Drug ID:   | NPD9231 |
| Drug Name:   | Tilarginine Acetate |
| Molecular Formula:   | C7H16N4O2.C2H4O2 |
| Canonical SMILES:   | CC(=O)O.CNC(=N)NCCC[C@@H](C(=O)O)N |
| Standard InCHI:   | "InChI=1S/C7H16N4O2.C2H4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13;1-2(3)4/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11);1H3,(H,3,4)/t5-;/m0./s1" |
| Standard InCHIKey:   | IKPNWIGTWUZCKM-JEDNCBNOSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD9231Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC478501 |
| High Similarity | 1.0 | NPC611659 |
| High Similarity | 0.9697 | NPC38059 |
| High Similarity | 0.9697 | NPC608429 |
| Intermediate Similarity | 0.7714 | NPC226453 |
| Intermediate Similarity | 0.7714 | NPC103130 |
| Intermediate Similarity | 0.7714 | NPC211895 |
| Intermediate Similarity | 0.7714 | NPC611844 |
| Intermediate Similarity | 0.7619 | NPC479618 |
| Intermediate Similarity | 0.7619 | NPC603984 |
| Remote Similarity | 0.6591 | NPC588316 |
| Remote Similarity | 0.641 | NPC278881 |
| Remote Similarity | 0.6316 | NPC118429 |
| Remote Similarity | 0.6316 | NPC120635 |
| Remote Similarity | 0.5714 | NPC327985 |
| Remote Similarity | 0.5714 | NPC142284 |
| Remote Similarity | 0.5714 | NPC133183 |
| Remote Similarity | 0.5714 | NPC603044 |
| Remote Similarity | 0.5652 | NPC609170 |
| Remote Similarity | 0.5476 | NPC53738 |
| Remote Similarity | 0.5429 | NPC282102 |
| Remote Similarity | 0.5429 | NPC292996 |
| Remote Similarity | 0.5217 | NPC108358 |
| Remote Similarity | 0.5217 | NPC331434 |
| Remote Similarity | 0.5217 | NPC602198 |
| Remote Similarity | 0.5116 | NPC478850 |
| Remote Similarity | 0.5116 | NPC609636 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 188.13 |
| ALogP   | -2.0784 |
| MLogP   | 1.57 |
| XLogP   | -2.461 |
| HDA   | 6 |
| HBD   | 5 |
| Rotatable Bonds   | 10 |
| TPSA   | 111.23 |
| RO5 Violation   | 0 |