Natural Product: NPC212415| Natural Product ID | NPC212415 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Beta-Lapachone |
| IUPAC Name | 2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| Synonyms | Beta-Lapachone; Lapachone, Beta- |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL15192 |
| PubChem CID |
3885 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | QZPQTZZNNJUOLS-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C15H14O3/c1-15(2)8-7-11-13(17)12(16)9-5-3-4-6-10(9)14(11)18-15/h3-6H,7-8H2,1-2H3 |
| SMILES | O=C1C2=C(OC(CC2)(C)C)c2c(C1=O)cccc2 |
  Calculated Properties| Molecular Weight:   | 242.09 | Volume:   | 252.879 Van der Waals volume.
|
| Dense:   | 0.957 | LogP:   | 2.472 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.649 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -4.164 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 0.0 | Rigid Bonds:   | 18.0 |
| TPSA:   | 43.37 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 3.0 |
| H-Bond Donor:   | 0.0 | Rings:   | 3.0 |
| Heavy Atoms:   | 3.0 |
| QED Drug-Likeness Score:   | 0.657 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.624 | Fsp3:   | 0.333 |
| MCE-18:   | 41.4 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 1 |
| Colloidal aggregators:   | 0.084 | Fluc inhibitor:   | 0.18 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.391 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.443 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.706 | Promiscuous compounds:   | 0.119 |
| Caco-2 Permeability:   | -4.572 | MDCK Permeability:   | -4.5 |
| Pgp-inhibitor:   | 0.999 | Pgp-substrate:   | 0.0 |
| PAMPA:   |
0.325 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.787 |
| 20% Bioavailability (F20%):   | 0.067 | 30% Bioavailability (F30%):   | 0.93 |
| 50% Bioavailability (F50%):   | 0.829 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.006 | MRP1:   | 0.273 |
| Plasma Protein Binding (PPB):   | 98.442% | Volume Distribution (VD):   | 0.418 |
| Fu: |
1.38% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.989 |
| OATP1B3 inhibitor:   | 0.993 | BCRP inhibitor:   | 0.0 |
| BSEP inhibitor:   | 0.998 |
| CYP1A2-inhibitor:   | 0.04 | CYP1A2-substrate:   | 1.0 |
| CYP2C19-inhibitor:   | 0.013 | CYP2C19-substrate:   | 1.0 |
| CYP2C9-inhibitor:   | 0.0 | CYP2C9-substrate:   | 1.0 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.356 |
| CYP3A4-inhibitor:   | 0.0 | CYP3A4-substrate:   | 0.925 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 1.0 |
| HLM stability:   |
0.992 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 6.353 | Half-life (T1/2):   | 1.047 |
| hERG Blockers:   | 0.066 | hERG Blockers (10um):   | 0.433 |
| Human Hepatotoxicity (H-HT):   | 0.756 | Drug-induced Liver Injury (DILI):   | 0.619 |
| AMES Toxicity:   | 0.698 | Rat Oral Acute Toxicity:   | 0.341 |
| Maximum Recommended Daily Dose:   | 0.458 | Skin Sensitization:   | 0.956 |
| Carcinogencity:   | 0.869 | Eye Corrosion:   | 0.739 |
| Eye Irritation:   | 0.967 | Respiratory Toxicity:   | 0.331 |
| Drug-induced Neurotoxicity:   | 0.632 | Ototoxicity:   | 0.231 |
| Hematotoxicity:   | 0.663 | Drug-induced Nephrotoxicity:   | 0.76 |
| Genotoxicity:   | 0.597 | RPMI-8226 Immunitoxicity:   | 0.085 |
| A549 Cytotoxicity:   | 0.045 | Hek293 Cytotoxicity:   | 0.226 |
| BCF:   |
1.701 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
5.253 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
6.579 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
6.214 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO8246 | Lantana involucrata | Species | Verbenaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15217280] |
| NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17950604] |
| NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | bark | n.a. |
PMID[17950604] |
| NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | Brazilian | n.a. |
PMID[19674905] |
| NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32044231] |
| NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3751 | Orthantha lutea | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8246 | Lantana involucrata | Species | Verbenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18640 | Tectona grandis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18640 | Tectona grandis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO18640 | Tectona grandis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18640 | Tectona grandis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO8246 | Lantana involucrata | Species | Verbenaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18640 | Tectona grandis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3751 | Orthantha lutea | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12083 | Hydnellum zonatum | Species | Thelephoraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1418 | Individual protein | Anandamide amidohydrolase | Homo sapiens | Inhibition | = | 25.41 | % | PMID[19850474] |
| NPT163 | Individual protein | Nuclear factor NF-kappa-B p105 subunit | Homo sapiens | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Potency | = | 3981.1 | nM | PubChem BioAssay data set |
| NPT211 | Individual protein | Hypoxia-inducible factor 1 alpha | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT1416 | Individual protein | Neuropeptide S receptor | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 29092.9 | nM | PubChem BioAssay data set |
| NPT1619 | Individual protein | Galactokinase | Homo sapiens | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT105 | Individual protein | Muscleblind-like protein 1 | Homo sapiens | Potency | n.a. | 14125.4 | nM | PubChem BioAssay data set |
| NPT135 | Individual protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 79432.8 | nM | PubChem BioAssay data set |
| NPT105 | Individual protein | Muscleblind-like protein 1 | Homo sapiens | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT1139 | Individual protein | Arachidonate 15-lipoxygenase, type II | Homo sapiens | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 9200.0 | nM | PubChem BioAssay data set |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | AC50 | = | 31622.78 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | AC50 | = | 15848.93 | nM | PubChem BioAssay data set |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | AC50 | = | 3981.07 | nM | PubChem BioAssay data set |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | AC50 | = | 3981.07 | nM | PubChem BioAssay data set |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | AC50 | = | 15848.93 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT154 | Individual protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 14125.4 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 20596.2 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | Potency | n.a. | 461.1 | nM | PubChem BioAssay data set |
| NPT104 | Individual protein | Cerebroside-sulfatase | Homo sapiens | Potency | n.a. | 3380.8 | nM | PubChem BioAssay data set |
| NPT105 | Individual protein | Muscleblind-like protein 1 | Homo sapiens | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | Ki | = | 100.0 | nM | PMID[25970480] |
| NPT203 | Individual protein | Carboxylesterase 2 | Homo sapiens | Ki | = | 109.0 | nM | PMID[28112927] |
| NPT166 | Individual protein | Acyl coenzyme A:cholesterol acyltransferase | Homo sapiens | Ki | = | 1220.0 | nM | PMID[28112927] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Inhibition | = | 10.0 | % | PMID[28112927] |
| NPT166 | Individual protein | Acyl coenzyme A:cholesterol acyltransferase | Homo sapiens | Activity | = | 12.0 | % | PMID[28112927] |
| NPT203 | Individual protein | Carboxylesterase 2 | Homo sapiens | Activity | = | 6.0 | % | PMID[28112927] |
| NPT2936 | Individual protein | NADPH--cytochrome P450 reductase | Homo sapiens | Activity | = | 923.0 | micromol/min | PMID[28214631] |
| NPT2936 | Individual protein | NADPH--cytochrome P450 reductase | Homo sapiens | IC50 | = | 11000.0 | nM | PMID[28214631] |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | IC50 | = | 440.0 | nM | PMID[32055299] |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[32055299] |
| NPT1078 | Individual protein | Indoleamine 2,3-dioxygenase | Homo sapiens | IC50 | = | 440.0 | nM | PMID[33341650] |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 5.0 | nM | PubChem BioAssay data set |
| NPT537 | Individual protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 58047.9 | nM | PubChem BioAssay data set |
| NPT50 | Individual protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 5623.4 | nM | PubChem BioAssay data set |
| NPT796 | Individual protein | Peripheral myelin protein 22 | Homo sapiens | Potency | = | 37933.0 | nM | PubChem BioAssay data set |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT55 | Individual protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 1990.5 | nM | PubChem BioAssay data set |
| NPT55 | Individual protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 1581.1 | nM | PubChem BioAssay data set |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT501 | Individual protein | Alpha-galactosidase A | Homo sapiens | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT533 | Protein-protein interaction | Runt-related transcription factor 1/Core-binding factor subunit beta | Homo sapiens | Potency | n.a. | 17782.8 | nM | PubChem BioAssay data set |
| NPT533 | Protein-protein interaction | Runt-related transcription factor 1/Core-binding factor subunit beta | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT803 | Individual protein | Flap endonuclease 1 | Homo sapiens | Potency | n.a. | 21192.3 | nM | PubChem BioAssay data set |
| NPT803 | Individual protein | Flap endonuclease 1 | Homo sapiens | Potency | n.a. | 3548.1 | nM | PubChem BioAssay data set |
| NPT9 | Individual protein | DNA polymerase eta | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT4907 | Individual protein | Tyrosyl-DNA phosphodiesterase 2 | Homo sapiens | IC50 | = | 970.0 | nM | PMID[23859074] |
| NPT5220 | Individual protein | Mucosa-associated lymphoid tissue lymphoma translocation protein 1 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[26496175] |
| NPT5220 | Individual protein | Mucosa-associated lymphoid tissue lymphoma translocation protein 1 | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[26496175] |
| NPT21775 | Single protein | 60 kDa chaperonin | Escherichia coli (strain K12) | IC50 | > | 250000.0 | nM | PMID[30852084] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 3548.1 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 13091.8 | nM | PubChem BioAssay data set |
| NPT940 | Individual protein | Serine/threonine-protein kinase mTOR | Homo sapiens | Potency | = | 26121.6 | nM | PubChem BioAssay data set |
| NPT95 | Individual protein | Muscarinic acetylcholine receptor M1 | Rattus norvegicus | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT96 | Individual protein | Thrombopoietin | Homo sapiens | Potency | = | 1584.9 | nM | PubChem BioAssay data set |
| NPT95 | Individual protein | Muscarinic acetylcholine receptor M1 | Rattus norvegicus | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT800 | Individual protein | M-phase phosphoprotein 8 | Homo sapiens | Potency | n.a. | 26679.5 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 37685.8 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 18887.6 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | IC50 | = | 3000.0 | nM | DOI[10.1039/C1MD00199J] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Ki | = | 3550.0 | nM | PMID[21596573] |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 17782.8 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 25118.9 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT444 | Individual protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 8348.1 | nM | PubChem BioAssay data set |
| NPT698 | Individual protein | Regulator of G-protein signaling 4 | Homo sapiens | Potency | n.a. | 15003.0 | nM | PubChem BioAssay data set |
| NPT98 | Individual protein | HERG | Homo sapiens | Potency | n.a. | 15848.9 | nM | PubChem BioAssay data set |
| NPT444 | Individual protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 5011.9 | nM | PubChem BioAssay data set |
| NPT888 | Individual protein | 78 kDa glucose-regulated protein | Homo sapiens | Potency | n.a. | 14689.2 | nM | PubChem BioAssay data set |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | 11.21 | % | PMID[23062825] |
| NPT983 | Protein complex | Nuclear factor NF-kappa-B complex | Homo sapiens | IC50 | = | 4000.0 | nM | PMID[24775915] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Activity | = | 1146.0 | micromol/min | PMID[24874653] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Kcat/Km | = | 2.6 | 10'6/M/s | PMID[24874653] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | IC50 | = | 3400.0 | nM | PMID[27341379] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[27341379] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Activity | = | 1258.0 | micromol/min | PMID[28214631] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | IC50 | = | 3000.0 | nM | PMID[28214631] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Activity | = | 15.86 | nmol/mg | PMID[28710963] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Kcat/Km | = | 4.4 | 10'6/M/s | PMID[30508483] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Activity | = | 1155.0 | micromol/min | PMID[30508483] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Activity | = | 724.0 | micromol/min | PMID[30508483] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Ratio | = | 20.0 | n.a. | PMID[30508483] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -1.28 | % | DOI[10.6019/CHEMBL4495564] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -2.44 | % | DOI[10.6019/CHEMBL4495564] |
| NPT935 | Individual protein | Quinone reductase 1) | Homo sapiens | Activity | = | 1220.0 | micromol/min | PMID[32464425] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 2.13 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -1.55 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | IC50 | = | 610.0 | nM | PMID[35620927] |
| NPT46 | Individual protein | Thyroid hormone receptor beta-1 | Homo sapiens | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT46 | Individual protein | Thyroid hormone receptor beta-1 | Homo sapiens | Potency | = | 5011.9 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 7079.5 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 5011.9 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT583 | Individual protein | Inositol monophosphatase 1 | Rattus norvegicus | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT792 | Individual protein | Arachidonate 15-lipoxygenase | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT534 | Individual protein | Phosphoglycerate kinase, glycosomal | Trypanosoma brucei brucei | Potency | n.a. | 37933.0 | nM | PubChem BioAssay data set |
| NPT755 | Individual protein | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Homo sapiens | Potency | n.a. | 19011.5 | nM | PubChem BioAssay data set |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT8 | Individual protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 7943.3 | nM | PubChem BioAssay data set |
| NPT8 | Individual protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | -2.91 | % | PMID[23062825] |
| NPT920 | Individual protein | Alpha-synuclein | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT21773 | Single protein | Thiosulfate sulfurtransferase | Homo sapiens | IC50 | = | 120.0 | nM | PMID[30852084] |
| NPT47 | Individual protein | ATP-dependent DNA helicase Q1 | Homo sapiens | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT47 | Individual protein | ATP-dependent DNA helicase Q1 | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT53 | Individual protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 63095.7 | nM | PubChem BioAssay data set |
| NPT197 | Protein-protein interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 5011.9 | nM | PubChem BioAssay data set |
| NPT47 | Individual protein | ATP-dependent DNA helicase Q1 | Homo sapiens | Potency | = | 112201.8 | nM | PubChem BioAssay data set |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 14125.4 | nM | PubChem BioAssay data set |
| NPT62 | Individual protein | 6-phospho-1-fructokinase | Trypanosoma brucei | Potency | n.a. | 756.9 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 16353.5 | nM | PubChem BioAssay data set |
| NPT78 | Individual protein | Beta amyloid A4 protein | Homo sapiens | Potency | n.a. | 29092.9 | nM | PubChem BioAssay data set |
| NPT29665 | Single protein | Quinone reductase 1 | Homo sapiens | Activity | = | 1188.0 | micromol/min | PMID[33984806] |
| NPT29665 | Single protein | Quinone reductase 1 | Homo sapiens | Kcat/Km | = | 2.6 | 10^6/M/s | PMID[33984806] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | = | 1410.0 | nM | PMID[11448231] |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | = | 760.0 | nM | PMID[11448231] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | = | 1780.0 | nM | PMID[11448231] |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | = | 1540.0 | nM | PMID[11448231] |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | = | 310.0 | nM | PMID[11448231] |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | = | 1820.0 | nM | PMID[11448231] |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | = | 1450.0 | nM | PMID[11448231] |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | = | 1740.0 | nM | PMID[11448231] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | = | 21400.0 | nM | PMID[11448231] |
| NPT4461 | Cell line | Panel (Carcinoma cell lines) | Homo sapiens | MGM | = | 1.12 | n.a. | PMID[11448231] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 270.0 | nM | PMID[17249647] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 0.4 | ug.mL-1 | PMID[17827021] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 0.2 | ug.mL-1 | PMID[17827021] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 0.06 | ug.mL-1 | PMID[17827021] |
| NPT399 | Cell line | SF-295 | Homo sapiens | IC50 | = | 0.22 | ug.mL-1 | PMID[17827021] |
| NPT80 | Cell line | Raji | Homo sapiens | Activity | = | 50.0 | % | PMID[19674905] |
| NPT80 | Cell line | Raji | Homo sapiens | Activity | > | 80.0 | % | PMID[17950604] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 43.0 | % | PMID[17609380] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[15217280] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1800.0 | nM | PMID[15217280] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[15217280] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[15217280] |
| NPT309 | Cell line | 1A9 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[15217280] |
| NPT309 | Cell line | 1A9 | Homo sapiens | IC50 | > | 800.0 | nM | PMID[15217280] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[15217280] |
| NPT307 | Cell line | HOS | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[15217280] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | > | 5000.0 | nM | PMID[15217280] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | Inhibition | = | 42.0 | % | PMID[15217280] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 7.4 | nM | PMID[18829316] |
| NPT90 | Cell line | DU-145 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[18829316] |
| NPT941 | Cell line | HaCaT | Homo sapiens | IC50 | = | 700.0 | nM | PMID[10479319] |
| NPT941 | Cell line | HaCaT | Homo sapiens | Activity | = | 329.0 | mU | PMID[10479319] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | > | 20600.0 | nM | DOI[10.1039/C4MD00371C] |
| NPT399 | Cell line | SF-295 | Homo sapiens | IC50 | = | 910.0 | nM | DOI[10.1039/C4MD00371C] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 830.0 | nM | PMID[21115213] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 250.0 | nM | PMID[26142490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1650.0 | nM | DOI[10.1039/C4MD00371C] |
| NPT306 | Cell line | PC-3 | Homo sapiens | EC50 | = | 1130.0 | nM | PMID[19674905] |
| NPT81 | Cell line | A549 | Homo sapiens | EC50 | = | 4210.0 | nM | PMID[19674905] |
| NPT83 | Cell line | MCF7 | Homo sapiens | EC50 | = | 9960.0 | nM | PMID[19674905] |
| NPT179 | Cell line | A2780 | Homo sapiens | GI50 | = | 1100.0 | nM | PMID[20304655] |
| NPT1723 | Cell line | HBL-100 | Homo sapiens | GI50 | = | 690.0 | nM | PMID[20304655] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 810.0 | nM | PMID[20304655] |
| NPT1577 | Cell line | SW1573 | Homo sapiens | GI50 | = | 760.0 | nM | PMID[20304655] |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | = | 2300.0 | nM | PMID[20304655] |
| NPT1183 | Cell line | WiDr | Homo sapiens | GI50 | = | 2000.0 | nM | PMID[22560628] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | = | 2100.0 | nM | PMID[20378360] |
| NPT306 | Cell line | PC-3 | Homo sapiens | FC | = | 0.243 | n.a. | PMID[16680159] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Ratio | = | 61.36 | n.a. | PMID[21115213] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Ratio | = | 8.33 | n.a. | PMID[21115213] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | Ratio | = | 83.17 | n.a. | PMID[21115213] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | Ratio | = | 5.16 | n.a. | PMID[21115213] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | Ratio | = | 72.41 | n.a. | PMID[21115213] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | Ratio | = | 11.41 | n.a. | PMID[21115213] |
| NPT399 | Cell line | SF-295 | Homo sapiens | Ratio | = | 58.75 | n.a. | PMID[21115213] |
| NPT399 | Cell line | SF-295 | Homo sapiens | Ratio | = | 8.72 | n.a. | PMID[21115213] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Potency | n.a. | 3981.1 | nM | PubChem BioAssay data set |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 23099.9 | nM | PubChem BioAssay data set |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 510.5 | nM | PubChem BioAssay data set |
| NPT367 | Cell line | MDA-N | Homo sapiens | GI50 | n.a. | 200.45 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 496.59 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 426.58 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 492.04 | nM | PubChem BioAssay data set |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 3155.0 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 62.37 | nM | PubChem BioAssay data set |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | n.a. | 639.73 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 463.45 | nM | PubChem BioAssay data set |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 272.27 | nM | PubChem BioAssay data set |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 426.58 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 244.91 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 5420.01 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 234.42 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 707.95 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 647.14 | nM | PubChem BioAssay data set |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 247.17 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 337.29 | nM | PubChem BioAssay data set |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 398.11 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 571.48 | nM | PubChem BioAssay data set |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 506.99 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 881.05 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 214.78 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 2238.72 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 431.52 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 1358.31 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 605.34 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 316.23 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 946.24 | nM | PubChem BioAssay data set |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 283.79 | nM | PubChem BioAssay data set |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 683.91 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 138.36 | nM | PubChem BioAssay data set |
| NPT457 | Cell line | BT-549 | Homo sapiens | GI50 | n.a. | 721.11 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 1419.06 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 753.36 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 358.1 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 289.07 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 277.33 | nM | PubChem BioAssay data set |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 682.34 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 1721.87 | nM | PubChem BioAssay data set |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | n.a. | 847.23 | nM | PubChem BioAssay data set |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | n.a. | 454.99 | nM | PubChem BioAssay data set |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 1845.02 | nM | PubChem BioAssay data set |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | n.a. | 411.15 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 475.34 | nM | PubChem BioAssay data set |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 1032.76 | nM | PubChem BioAssay data set |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 2074.91 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 699.84 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 729.46 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 1199.5 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 93.76 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 907.82 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 2500.35 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 1348.96 | nM | PubChem BioAssay data set |
| NPT406 | Cell line | RXF 393 | Homo sapiens | GI50 | n.a. | 1409.29 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 1914.26 | nM | PubChem BioAssay data set |
| NPT1723 | Cell line | HBL-100 | Homo sapiens | GI50 | = | 380.0 | nM | PMID[22560628] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 1000.0 | nM | PMID[22560628] |
| NPT1577 | Cell line | SW1573 | Homo sapiens | GI50 | = | 840.0 | nM | PMID[22560628] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | = | 4600.0 | nM | PMID[22819765] |
| NPT15 | Cell line | Jurkat | Homo sapiens | GI50 | = | 6100.0 | nM | PMID[22819765] |
| NPT15 | Cell line | Jurkat | Homo sapiens | Activity | = | 51.0 | % | PMID[22819765] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 800.0 | nM | PMID[22819765] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | = | 600.0 | nM | PMID[22819765] |
| NPT114 | Cell line | LoVo | Homo sapiens | GI50 | = | 300.0 | nM | PMID[22819765] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[22819765] |
| NPT941 | Cell line | HaCaT | Homo sapiens | Activity | = | 268.0 | mU/ml | PMID[24964246] |
| NPT941 | Cell line | HaCaT | Homo sapiens | IC50 | = | 900.0 | nM | PMID[24964246] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 4060.0 | nM | PMID[23232148] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 470.0 | nM | PMID[23232148] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5700.0 | nM | PMID[24874653] |
| NPT2335 | Cell line | NCI-H596 | n.a. | IC50 | = | 23000.0 | nM | PMID[24874653] |
| NPT81 | Cell line | A549 | Homo sapiens | Ratio IC50 | = | 3.6 | n.a. | PMID[25677663] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 7000.0 | nM | PMID[25677663] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 25000.0 | nM | PMID[25677663] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1570.0 | nM | PMID[26142490] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 780.0 | nM | PMID[26142490] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 870.0 | nM | PMID[26142490] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 1650.0 | nM | PMID[26142490] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 1820.0 | nM | PMID[26142490] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[26142490] |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | IC50 | = | 1160.0 | nM | DOI[10.1039/C4MD00371C] |
| NPT399 | Cell line | SF-295 | Homo sapiens | IC50 | = | 950.0 | nM | PMID[26142490] |
| NPT927 | Cell line | PBMC | Homo sapiens | IC50 | > | 20630.0 | nM | PMID[26142490] |
| NPT616 | Cell line | MDCK | Canis lupus familiaris | IC50 | = | 13500.0 | nM | PMID[26142490] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 970.0 | nM | DOI[10.1039/C4MD00371C] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3700.0 | nM | PMID[26803578] |
| NPT81 | Cell line | A549 | Homo sapiens | TGI | = | 70.1 | % | PMID[26803578] |
| NPT81 | Cell line | A549 | Homo sapiens | T/C | = | 29.5 | % | PMID[26803578] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[26883150] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[26883150] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[26883150] |
| NPT114 | Cell line | LoVo | Homo sapiens | IC50 | = | 300.0 | nM | PMID[26883150] |
| NPT81 | Cell line | A549 | Homo sapiens | TGI | = | 70.7 | % | PMID[28214631] |
| NPT81 | Cell line | A549 | Homo sapiens | TGI | = | 78.5 | % | PMID[28710963] |
| NPT81 | Cell line | A549 | Homo sapiens | TGI | = | 84.9 | % | PMID[28710963] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 4300.0 | nM | PMID[30003778] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 1600.0 | nM | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 97.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 93.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 90.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 86.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 38.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 4.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 7.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 15.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 8.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 48.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 62.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 14.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 20.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 3.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 63.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 21.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 53.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 18.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 27.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 57.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 16.0 | % | PMID[30003778] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 24.0 | % | PMID[30003778] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | IC50 | > | 200.0 | ug.mL-1 | PMID[31378595] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3100.0 | nM | PMID[30508483] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 1390.0 | nM | PMID[32044231] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 710.0 | nM | PMID[32044231] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1960.0 | nM | PMID[32044231] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 4170.0 | nM | PMID[32464425] |
| NPT65 | Cell line | HepG2 | Homo sapiens | GI50 | = | 2830.0 | nM | PMID[32464425] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 3320.0 | nM | PMID[32464425] |
| NPT65 | Cell line | HepG2 | Homo sapiens | GI50 | = | 6300.0 | nM | PMID[32464425] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 6000.0 | nM | PMID[32464425] |
| NPT65 | Cell line | HepG2 | Homo sapiens | GI50 | = | 6210.0 | nM | PMID[32464425] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 6190.0 | nM | PMID[32464425] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Inhibition | = | 67.34 | % | PMID[32464425] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 2830.0 | nM | PMID[32682198] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3320.0 | nM | PMID[32682198] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[32682198] |
| NPT65 | Cell line | HepG2 | Homo sapiens | TGI | = | 67.44 | % | PMID[32682198] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5700.0 | nM | PMID[33984806] |
| NPT6530 | Cell line | MOLM-13 | Homo sapiens | GI50 | = | 34500.0 | nM | PMID[35687347] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1960.0 | nM | PMID[37343498] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 69.1 | % | PMID[34303080] |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | = | 41000.0 | nM | PMID[35687347] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 3700.0 | nM | PMID[35033884] |
| NPT2299 | Cell line | CAL-51 | Homo sapiens | GI50 | = | 8300.0 | nM | PMID[35687347] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 67.7 | % | PMID[34303080] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 12900.0 | nM | PMID[35687347] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 relative | = | 2300.0 | nM | ECBD screening data for assay EOS300108 |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 29000.0 | nM | PMID[33984806] |
| NPT2427 | Cell line | HCC1954 | Homo sapiens | GI50 | = | 31800.0 | nM | PMID[35687347] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 1390.0 | nM | PMID[37343498] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 12200.0 | nM | PMID[35687347] |
| NPT1649 | Cell line | MV4-11 | Homo sapiens | GI50 | = | 70100.0 | nM | PMID[35687347] |
| NPT457 | Cell line | BT-549 | Homo sapiens | GI50 | = | 11400.0 | nM | PMID[35687347] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 16000.0 | nM | PMID[33984806] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | < | 3100.0 | nM | PMID[22795899] |
| NPT71 | Cell line | HEK293 | Homo sapiens | CC50 | > | 10000.0 | nM | DOI[10.6019/CHEMBL4296183] |
| NPT857 | Cell line | LLC-PK1 | Sus scrofa | CC50 | = | 2090.0 | nM | PMID[33333397] |
| NPT171 | Cell line | MRC5 | Homo sapiens | CC50 | = | 2090.0 | nM | PMID[33333397] |
| NPT65 | Cell line | HepG2 | Homo sapiens | CC50 | = | 2090.0 | nM | PMID[33333397] |
| NPT81 | Cell line | A549 | Homo sapiens | CC50 | = | 2090.0 | nM | PMID[33333397] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10000.0 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 3162.28 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12589.25 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 3981.07 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7943.28 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6309.57 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 10417.9 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 18526.0 | nM | PubChem BioAssay data set |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 1.86 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.3 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.29 | % | DOI[10.6019/CHEMBL4495565] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 4.7 | n.a. | PMID[33984806] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 46.0 | % | PMID[35436747] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 5.1 | n.a. | PMID[33984806] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 49.0 | % | PMID[35436747] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 20500.0 | nM | PMID[33333397] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 76.0 | % | PMID[35436747] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 35.0 | % | PMID[35436747] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[35580424] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 44.0 | % | PMID[35436747] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 100.0 | % | PMID[35436747] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 50.0 | % | PMID[35436747] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 55.0 | % | PMID[35436747] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 24700.0 | nM | PMID[18029184] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | Activity | = | 107.5 | % | PMID[18029184] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | Activity | = | 100.0 | % | PMID[18029184] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | Activity | = | 2.9 | % | PMID[18029184] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2200.0 | nM | PMID[15217280] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2000.0 | nM | PMID[15217280] |
| NPT1266 | Organism | Leptomonas seymouri | Leptomonas seymouri | IC50 | = | 400.0 | nM | PMID[18276039] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 391500.0 | nM | PMID[26118339] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | Activity | = | 91.3 | % | PMID[22795899] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | < | 3100.0 | nM | PMID[22795899] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 6000.0 | nM | PMID[22819765] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 400.0 | nM | PMID[22819765] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 600.0 | nM | PMID[22819765] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MBC | = | 80.7 | uM | DOI[10.1007/s00044-011-9788-9] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 20170.0 | nM | DOI[10.1007/s00044-011-9788-9] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1600.0 | nM | PMID[23353747] |
| NPT634 | Organism | Leishmania amazonensis | Leishmania amazonensis | IC50 | = | 1390.0 | nM | PMID[23535320] |
| NPT634 | Organism | Leishmania amazonensis | Leishmania amazonensis | IC50 | = | 2900.0 | nM | PMID[23535320] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 1130.0 | nM | PMID[23535320] |
| NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 670.0 | nM | PMID[23535320] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 950.0 | nM | PMID[26142490] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 4000.0 | nM | PMID[26496175] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 400.0 | nM | PMID[26883150] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 600.0 | nM | PMID[26883150] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 300.0 | nM | PMID[26883150] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | < | 10.0 | nM | PMID[26883150] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 391500.0 | nM | DOI[10.1039/C6MD00216A] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1570.0 | nM | PMID[27341379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 870.0 | nM | PMID[27341379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1650.0 | nM | PMID[27341379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 250.0 | nM | PMID[27341379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1160.0 | nM | PMID[27341379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 20630.0 | nM | PMID[27341379] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 25310.0 | nM | PMID[28094224] |
| NPT20 | Organism | Candida albicans | Candida albicans | MIC | > | 10000.0 | nM | DOI[10.6019/CHEMBL4296183] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | > | 10000.0 | nM | DOI[10.6019/CHEMBL4296183] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 1.56 | ug.mL-1 | PMID[31378595] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 3.12 | ug.mL-1 | PMID[31378595] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 6.25 | ug.mL-1 | PMID[31378595] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 100.0 | ug.mL-1 | PMID[31306817] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 61300.0 | nM | PMID[31306817] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | FIC | = | 0.25 | ug ml-1 | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | Activity | n.a. | n.a. | n.a. | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | = | 125.0 | ug.mL-1 | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | FICI | = | 0.31 | n.a. | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | = | 3.9 | ug.mL-1 | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | FIC | = | 0.06 | ug ml-1 | PMID[35436747] |
| NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 391500.0 | nM | PMID[33158575] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | = | 100.0 | ug.mL-1 | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | = | 25.0 | ug.mL-1 | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | FC | = | 3.0 | n.a. | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | FICI | = | 0.5 | n.a. | PMID[35436747] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | MIC | = | 6.25 | ug.mL-1 | PMID[35436747] |
| NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | Inhibition | = | 28.0 | % | PMID[14980653] |
| NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | Inhibition | = | 34.0 | % | PMID[14980653] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 4.7 | % | PMID[17950604] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 21.7 | % | PMID[17950604] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 50.4 | % | PMID[17950604] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 73.1 | % | PMID[17950604] |
| NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | IC50 | = | 210300.0 | nM | PMID[17950604] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 161400.0 | nM | DOI[10.1007/s00044-011-9788-9] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 161400.0 | nM | DOI[10.1007/s00044-011-9788-9] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 10000.0 | nM | DOI[10.6019/CHEMBL4296183] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | > | 10000.0 | nM | DOI[10.6019/CHEMBL4296183] |
| NPT21774 | Protein complex | HSP60/HSP10 | Homo sapiens | IC50 | = | 2100.0 | nM | PMID[30852084] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 11900.0 | nM | PMID[30508483] |
| NPT21742 | Cell line | L02 | Homo sapiens | GI50 | = | 4540.0 | nM | PMID[32464425] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 4540.0 | nM | PMID[32682198] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | MIC | = | 25.0 | ug.mL-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | MIC | = | 12.5 | ug.mL-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FIC | = | 1.0 | ug ml-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | MIC | = | 15.6 | ug.mL-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FIC | = | 0.5 | ug ml-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FC | = | 16.0 | n.a. | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | Activity | n.a. | n.a. | n.a. | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | MIC | > | 1000.0 | ug.mL-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FC | = | 5.0 | n.a. | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FC | = | 3.0 | n.a. | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | MIC | = | 31.25 | ug.mL-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | MIC | > | 200.0 | ug.mL-1 | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FICI | = | 2.0 | n.a. | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FIC | = | 0.125 | ug ml-1 | PMID[35436747] |
| NPT20950 | Cell line | Erythrocyte | n.a. | Activity | n.a. | n.a. | n.a. | PMID[35436747] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | = | 9600.0 | nM | PMID[33984806] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | Activity | = | 88.0 | % | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FICI | = | 0.625 | n.a. | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | Inhibition | = | 72.0 | % | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | Inhibition | = | 95.0 | % | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | Activity | = | 93.0 | % | PMID[35436747] |
| NPT29084 | Organism | Nakaseomyces glabratus | Nakaseomyces glabratus | FC | = | 1.6 | n.a. | PMID[35436747] |
| NPT5219 | Organism | Rauscher murine leukemia virus | Rauscher murine leukemia virus | MTD | = | 1250.0 | mg kg-1 | PMID[6205152] |
| NPT5219 | Organism | Rauscher murine leukemia virus | Rauscher murine leukemia virus | ED50 | < | 2.0 | mg ml-1 | PMID[6205152] |
| NPT1115 | Organism | Avian myeloblastosis virus | Avian myeloblastosis virus | ED50 | < | 2.0 | mg ml-1 | PMID[6205152] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 4.7 | % | PMID[19674905] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 21.7 | % | PMID[19674905] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 50.4 | % | PMID[19674905] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 73.1 | % | PMID[19674905] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 210300.0 | nM | PMID[19674905] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 29092.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 16353.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 12589.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 23778.1 | nM | PubChem BioAssay data set |
| NPT314 | Organism | Bacillus cereus | Bacillus cereus | MIC | = | 161400.0 | nM | DOI[10.1007/s00044-011-9788-9] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 10.0 | n.a. | PMID[23353747] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 0.57 | n.a. | PMID[23535320] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 0.27 | n.a. | PMID[23535320] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 0.7 | n.a. | PMID[23535320] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/IC50 | = | 1.14 | n.a. | PMID[23535320] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 28183.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 7079.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 23109.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 446.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2818.4 | nM | PubChem BioAssay data set |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 10000.0 | nM | DOI[10.6019/CHEMBL4296183] |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | IC50 | = | 590.0 | nM | PMID[30852084] |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | IC50 | = | 1300.0 | nM | PMID[30852084] |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | Inhibition | = | 77.0 | % | PMID[30852084] |
| NPT21772 | Protein complex | GroEL/GroES | Escherichia coli | Inhibition | = | 99.0 | % | PMID[30852084] |
| NPT23298 | Cell line | A549/TR | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[30508483] |
| NPT23298 | Cell line | A549/TR | Homo sapiens | IC50 | = | 11000.0 | nM | PMID[33984806] |
| NPT29324 | Cell line | NCI-H596 | Homo sapiens | IC50 | = | 27000.0 | nM | PMID[33984806] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | Lysis | = | 76.0 | % | DOI[10.1016/S0960-894X(97)00354-5] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| n.a. | n.a. | LogD | = | 2.8 | n.a. | PMID[35033884] |
| Homo sapiens | n.a. | CL | = | 114.0 | L/hr/m2 | PMID[33158575] |
| Homo sapiens | n.a. | F | = | 15.5 | % | PMID[33158575] |
| Homo sapiens | n.a. | T1/2 | = | 2.45 | hr | PMID[33158575] |
| Homo sapiens | n.a. | Vdss | = | 490.0 | L/m2 | PMID[33158575] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC212415 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC212415 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD1609 | Phase 2 |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
