NPASS Compound

Natural Product: NPC150739

Natural Product ID	NPC150739
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NJUXRKMKOFXMRX-JJFYIABZSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	59806994
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 124129 0 0 0 0 0 0 0 0999 V2000 -10.9052 3.2797 -1.9708 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3897 3.4344 -2.0497 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6934 2.5787 -1.3889 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2153 2.4597 -1.2586 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7974 1.1499 -1.8225 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2204 0.1881 -1.1852 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8868 -1.0472 -1.9762 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8924 0.2321 0.2437 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5210 -1.0302 0.8476 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3831 -1.9245 1.2381 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2894 -0.9648 1.4966 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5564 -0.3647 2.8587 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4155 0.0619 0.4383 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6865 1.2656 0.9587 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2265 0.8856 0.9833 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8936 -0.4137 1.6055 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4744 -0.7925 1.2836 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0792 -1.5923 2.4778 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3620 0.4830 1.2665 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8023 0.2333 0.9840 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0577 -0.9097 0.0287 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8426 -1.1485 -0.8389 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5760 0.0044 -1.7413 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2394 -2.3205 -1.7523 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2866 -1.5985 0.0339 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5573 -1.8207 -0.7373 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6800 -2.2969 0.1512 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8802 -1.5318 1.4059 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8586 -2.5212 2.5849 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2118 -0.6924 -0.7261 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2025 -1.5918 -0.4561 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4928 -1.0196 0.0545 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1510 -2.1836 0.8206 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7529 -3.4842 0.2283 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3138 -3.4762 -1.1920 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4954 -3.4849 -2.1600 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3886 -4.5014 -1.8425 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4501 -2.4470 -1.5230 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8408 -4.1976 1.0410 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5241 -2.0028 0.8979 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3592 0.0878 0.8469 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1452 1.1376 0.3938 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3840 2.3898 0.0697 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3955 3.3933 -0.4974 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8149 2.9915 -0.2564 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0432 2.3066 1.0464 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3854 3.2752 2.1438 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3998 4.1140 1.7341 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0241 1.4428 1.4342 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3586 2.2741 -1.3460 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2265 3.5050 -1.8832 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4747 2.0943 -0.9474 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8340 2.2904 -0.0028 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8858 4.5078 -2.8843 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.1025 2.8247 -0.9736 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2976 2.6545 -2.7675 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3590 4.2814 -1.9398 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2383 1.7884 -0.8099 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9914 2.5881 -0.1944 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6905 3.2228 -1.8889 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0191 1.0178 -2.9307 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3391 -1.0160 -2.9966 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7837 -1.0978 -2.1621 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2735 -1.9523 -1.5078 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2395 1.1262 0.7634 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0874 -0.6752 1.7546 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2583 -1.5016 0.2019 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2091 -2.7592 0.5776 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7012 -2.3898 2.2230 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7810 0.2458 3.2833 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4908 0.2143 2.7802 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7916 -1.2402 3.5331 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9590 -0.2011 -0.5271 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0698 1.6889 1.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7322 1.6995 1.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8751 1.0084 -0.0580 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8937 -0.2327 2.7260 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2258 -2.6691 2.1594 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0708 -1.2542 2.7746 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5897 -1.5212 3.3543 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0056 1.2695 0.6270 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2952 0.8715 2.3261 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2431 1.1528 0.5023 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4161 0.0560 1.8883 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2263 -1.7967 0.6421 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4406 0.3529 -1.8399 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9499 -0.1744 -2.7924 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2204 0.8638 -1.3885 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6714 -3.1530 -1.2003 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3999 -2.6462 -2.3972 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9616 -1.8456 -2.4825 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0058 -2.6540 0.3414 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8821 -0.9983 -1.3629 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3662 -2.6747 -1.4360 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4932 -3.3911 0.3686 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5797 -2.3246 -0.5155 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0649 -3.2728 2.4711 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8145 -3.1097 2.4752 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9180 -2.0324 3.5542 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7984 -2.2681 0.3539 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1905 -0.7543 -0.7857 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7528 -2.1155 1.8520 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6801 -4.1386 0.2690 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7633 -4.4190 -1.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9632 -2.4862 -2.2444 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1434 -3.7227 -3.2003 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0811 -4.2079 -1.1992 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4698 -4.9154 0.4530 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8066 -1.5787 1.7383 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7013 0.8418 -0.5307 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8636 2.8204 0.9449 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1943 4.3911 -0.0347 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4114 3.9532 -0.2416 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9578 1.6546 0.9145 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7404 2.7564 3.0654 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4719 3.8306 2.4624 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0148 4.9709 1.4195 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3010 2.0971 -1.1045 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9663 3.1001 -2.3900 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1822 2.8672 -1.4579 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8621 1.9083 -0.9060 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1378 4.2323 -3.9628 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3795 5.4998 -2.6791 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7878 4.6324 -2.8365 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 21 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 44 51 1 0 43 52 1 0 14 53 1 0 2 54 1 0 13 8 1 0 28 16 1 0 38 31 1 0 49 42 1 0 28 11 1 0 25 17 1 0 1 55 1 0 1 56 1 0 1 57 1 0 3 58 1 0 4 59 1 0 4 60 1 0 5 61 1 0 7 62 1 0 7 63 1 0 7 64 1 0 8 65 1 0 9 66 1 0 9 67 1 0 10 68 1 0 10 69 1 0 12 70 1 0 12 71 1 0 12 72 1 0 13 73 1 0 14 74 1 0 15 75 1 0 15 76 1 0 16 77 1 0 18 78 1 0 18 79 1 0 18 80 1 0 19 81 1 0 19 82 1 0 20 83 1 0 20 84 1 0 21 85 1 0 23 86 1 0 23 87 1 0 23 88 1 0 24 89 1 0 24 90 1 0 24 91 1 0 25 92 1 0 26 93 1 0 26 94 1 0 27 95 1 0 27 96 1 0 29 97 1 0 29 98 1 0 29 99 1 0 31100 1 0 32101 1 0 33102 1 0 34103 1 0 35104 1 0 36105 1 0 36106 1 0 37107 1 0 39108 1 0 40109 1 0 42110 1 0 43111 1 0 44112 1 0 45113 1 0 46114 1 0 47115 1 0 47116 1 0 48117 1 0 50118 1 0 51119 1 0 52120 1 0 53121 1 0 54122 1 0 54123 1 0 54124 1 0 M END

Standard InCHIKey	NJUXRKMKOFXMRX-JJFYIABZSA-N
Standard InCHI	InChI=1S/C42H70O12/c1-21(2)10-9-11-22(3)23-12-16-42(8)30(23)24(45)18-28-40(6)15-14-29(39(4,5)27(40)13-17-41(28,42)7)53-38-36(34(49)32(47)26(20-44)52-38)54-37-35(50)33(48)31(46)25(19-43)51-37/h10-11,23-38,43-50H,9,12-20H2,1-8H3/b22-11-
SMILES	CC(=CC/C=C(/C)C1CCC2(C)C1C(CC1C3(C)CCC(C(C)(C)C3CCC21C)OC1C(C(C(C(CO)O1)O)O)OC1C(C(C(C(CO)O1)O)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	766.49	Volume:	783.859 ? Van der Waals volume.
Dense:	0.978	LogP:	3.269 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.208 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.047 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	34.0
TPSA:	198.76 ? Topological Polar Surface Area.	H-Bond Acceptor:	12.0
H-Bond Donor:	8.0	Rings:	6.0
Heavy Atoms:	12.0

MedChem Properties

QED Drug-Likeness Score:	0.126	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.832	Fsp³:	0.905
MCE-18:	128.4 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.092	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.06 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.102 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.198	Promiscuous compounds:	0.004

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.057	MDCK Permeability:	-5.161
Pgp-inhibitor:	0.0	Pgp-substrate:	0.192
PAMPA:	0.998 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.781
20% Bioavailability (F20%):	0.01	30% Bioavailability (F30%):	0.755
50% Bioavailability (F50%):	0.998

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.198	MRP1:	1.0
Plasma Protein Binding (PPB):	61.029%	Volume Distribution (VD):	-0.434
Fu:	26.636% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.036	BCRP inhibitor:	0.001
BSEP inhibitor:	0.306

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.781	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.968	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.001	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.004	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.463

Half-life (T1/2):

2.75

ADMET: Toxicity

hERG Blockers:	0.063	hERG Blockers (10um):	0.586
Human Hepatotoxicity (H-HT):	0.569	Drug-induced Liver Injury (DILI):	0.108
AMES Toxicity:	0.19	Rat Oral Acute Toxicity:	0.113
Maximum Recommended Daily Dose:	0.372	Skin Sensitization:	0.045
Carcinogencity:	0.085	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.016
Drug-induced Neurotoxicity:	0.324	Ototoxicity:	0.999
Hematotoxicity:	0.024	Drug-induced Nephrotoxicity:	0.028
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.042
A549 Cytotoxicity:	0.086	Hek293 Cytotoxicity:	0.64
BCF:	1.95 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.916 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.452 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.616 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 12877918]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12350149]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Flower buds	n.a.	n.a.	PMID[12880307]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Stems	n.a.	n.a.	PMID[17663584]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[18186611]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	leaves and stems	n.a.	n.a.	PMID[25442304]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Steamed Roots	n.a.	n.a.	PMID[26200131]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[28006911]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28202328]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC150739 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22822
0.1-0.2	22488
0.2-0.3	3394
0.3-0.4	874
0.4-0.5	220
0.5-0.6	29
0.6-0.7	21
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC159036
0.8592	High Similarity	NPC280825
0.8415	Intermediate Similarity	NPC234160
0.7975	Intermediate Similarity	NPC312553
0.7875	Intermediate Similarity	NPC472987
0.7368	Intermediate Similarity	NPC473198
0.7317	Intermediate Similarity	NPC8039
0.7317	Intermediate Similarity	NPC120123
0.7143	Intermediate Similarity	NPC208477
0.7089	Intermediate Similarity	NPC473200
0.6786	Remote Similarity	NPC472897
0.6786	Remote Similarity	NPC472896
0.675	Remote Similarity	NPC234287
0.6628	Remote Similarity	NPC16573
0.6522	Remote Similarity	NPC208650
0.6517	Remote Similarity	NPC288694
0.6383	Remote Similarity	NPC220427
0.6277	Remote Similarity	NPC472988
0.6277	Remote Similarity	NPC38217
0.6264	Remote Similarity	NPC194842
0.6186	Remote Similarity	NPC14946
0.6186	Remote Similarity	NPC63368
0.6145	Remote Similarity	NPC88000
0.6145	Remote Similarity	NPC4831
0.6145	Remote Similarity	NPC472023
0.6071	Remote Similarity	NPC7341
0.6067	Remote Similarity	NPC165033
0.6067	Remote Similarity	NPC273879
0.602	Remote Similarity	NPC159005
0.6	Remote Similarity	NPC135369
0.6	Remote Similarity	NPC31907
0.5978	Remote Similarity	NPC269627
0.5934	Remote Similarity	NPC181467
0.5769	Remote Similarity	NPC241381
0.573	Remote Similarity	NPC611039
0.5667	Remote Similarity	NPC252253
0.566	Remote Similarity	NPC488292
0.566	Remote Similarity	NPC146868
0.5604	Remote Similarity	NPC45959
0.5591	Remote Similarity	NPC139271
0.5591	Remote Similarity	NPC69737
0.5463	Remote Similarity	NPC488294
0.5417	Remote Similarity	NPC472715
0.5417	Remote Similarity	NPC276758
0.5368	Remote Similarity	NPC488574
0.5361	Remote Similarity	NPC164194
0.5349	Remote Similarity	NPC76486
0.531	Remote Similarity	NPC488291
0.5258	Remote Similarity	NPC236753
0.5258	Remote Similarity	NPC304011
0.5248	Remote Similarity	NPC65167
0.5222	Remote Similarity	NPC470312
0.5208	Remote Similarity	NPC488575
0.5204	Remote Similarity	NPC601606
0.5192	Remote Similarity	NPC246124
0.5169	Remote Similarity	NPC136816
0.5114	Remote Similarity	NPC91497
0.5052	Remote Similarity	NPC472252
0.5052	Remote Similarity	NPC245280
0.505	Remote Similarity	NPC25605

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC150739 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7675
0.1-0.2	1406
0.2-0.3	65
0.3-0.4	4
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data