NPASS drugs

Drug Information

Drug ID:	NPD7553
Drug Name:	Ro-09-1428
Molecular Formula:	C31H31N11O10S3
Canonical SMILES:	OCc1nc2n(n1)c(SCC1=C(C(=O)O)N3C(SC1)C(C3=O)N=C(/C(=N/OC(C(=NN=C(c1ccc(c(c1)O)O)O)O)(C)C)/c1csc(=N)[nH]1)O)cc(n2)C
Standard InCHI:	InChI=1S/C31H31N11O10S3/c1-12-6-19(42-30(33-12)35-18(8-43)39-42)53-9-14-10-54-26-21(25(48)41(26)22(14)27(49)50)36-24(47)20(15-11-55-29(32)34-15)40-52-31(2,3)28(51)38-37-23(46)13-4-5-16(44)17(45)7-13/h4-7,11,21,26,43-45H,8-10H2,1-3H3,(H2,32,34)(H,36,47)(H,37,46)(H,38,51)(H,49,50)/b40-20+
Standard InCHIKey:	CCOFMFVZORWSAE-KPRPFPDJSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD7553

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	422
0.1-0.2	3647
0.2-0.3	9569
0.3-0.4	12136
0.4-0.5	4157
0.5-0.6	901
0.6-0.7	58
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6882	NPC41982
Remote Similarity	0.6564	NPC478011
Remote Similarity	0.6541	NPC314176
Remote Similarity	0.6493	NPC314056
Remote Similarity	0.6477	NPC477633
Remote Similarity	0.6451	NPC478012
Remote Similarity	0.6434	NPC150447
Remote Similarity	0.6429	NPC477634
Remote Similarity	0.6426	NPC478013
Remote Similarity	0.6308	NPC143325
Remote Similarity	0.6292	NPC62995
Remote Similarity	0.6283	NPC250178
Remote Similarity	0.6246	NPC477630
Remote Similarity	0.6246	NPC478030
Remote Similarity	0.6246	NPC315467
Remote Similarity	0.6246	NPC477635
Remote Similarity	0.6237	NPC314882
Remote Similarity	0.6224	NPC478009
Remote Similarity	0.6218	NPC315822
Remote Similarity	0.6213	NPC478141
Remote Similarity	0.6209	NPC328924
Remote Similarity	0.6208	NPC79386
Remote Similarity	0.6206	NPC39092
Remote Similarity	0.6195	NPC313966
Remote Similarity	0.6195	NPC314254
Remote Similarity	0.618	NPC251036
Remote Similarity	0.6151	NPC477516
Remote Similarity	0.6151	NPC478006
Remote Similarity	0.6128	NPC14877
Remote Similarity	0.6128	NPC475350
Remote Similarity	0.6128	NPC145178
Remote Similarity	0.6123	NPC323244
Remote Similarity	0.6115	NPC478010
Remote Similarity	0.6111	NPC313587
Remote Similarity	0.6111	NPC315893
Remote Similarity	0.6111	NPC316110
Remote Similarity	0.6103	NPC308906
Remote Similarity	0.6097	NPC74562
Remote Similarity	0.6097	NPC151781
Remote Similarity	0.6097	NPC316181
Remote Similarity	0.6092	NPC295452
Remote Similarity	0.6092	NPC171393
Remote Similarity	0.609	NPC153400
Remote Similarity	0.6085	NPC272549
Remote Similarity	0.6081	NPC478007
Remote Similarity	0.6076	NPC51854
Remote Similarity	0.6064	NPC28945
Remote Similarity	0.6057	NPC160666
Remote Similarity	0.6051	NPC35761
Remote Similarity	0.6044	NPC136924
Remote Similarity	0.6042	NPC82472
Remote Similarity	0.6042	NPC9729
Remote Similarity	0.6036	NPC478008
Remote Similarity	0.6036	NPC475196
Remote Similarity	0.6022	NPC242923
Remote Similarity	0.6021	NPC472066
Remote Similarity	0.6021	NPC472067
Remote Similarity	0.6021	NPC472031
Remote Similarity	0.5986	NPC237978
Remote Similarity	0.5986	NPC74619
Remote Similarity	0.5985	NPC48317
Remote Similarity	0.5978	NPC46970
Remote Similarity	0.597	NPC478005
Remote Similarity	0.5958	NPC477806
Remote Similarity	0.5958	NPC477805
Remote Similarity	0.5958	NPC477796
Remote Similarity	0.5958	NPC477795
Remote Similarity	0.5957	NPC220852
Remote Similarity	0.5952	NPC472068
Remote Similarity	0.5951	NPC285343
Remote Similarity	0.5943	NPC179896
Remote Similarity	0.5934	NPC472789
Remote Similarity	0.5926	NPC140284
Remote Similarity	0.5926	NPC75609
Remote Similarity	0.5922	NPC54803
Remote Similarity	0.5922	NPC321592
Remote Similarity	0.589	NPC197881
Remote Similarity	0.589	NPC181081
Remote Similarity	0.5884	NPC473317
Remote Similarity	0.5882	NPC144114
Remote Similarity	0.588	NPC208898
Remote Similarity	0.5878	NPC280638
Remote Similarity	0.587	NPC313804
Remote Similarity	0.587	NPC315804
Remote Similarity	0.5869	NPC230805
Remote Similarity	0.5857	NPC214142
Remote Similarity	0.5851	NPC223409
Remote Similarity	0.5851	NPC95240
Remote Similarity	0.5843	NPC216507
Remote Similarity	0.5842	NPC130570
Remote Similarity	0.584	NPC315388
Remote Similarity	0.5839	NPC184225
Remote Similarity	0.5836	NPC261251
Remote Similarity	0.5836	NPC187145
Remote Similarity	0.5836	NPC244536
Remote Similarity	0.5821	NPC125597
Remote Similarity	0.582	NPC477891
Remote Similarity	0.5816	NPC100547
Remote Similarity	0.5806	NPC220851
Remote Similarity	0.5801	NPC319232
Remote Similarity	0.5801	NPC24370
Remote Similarity	0.5795	NPC322135
Remote Similarity	0.5791	NPC63109
Remote Similarity	0.578	NPC186351
Remote Similarity	0.578	NPC118559
Remote Similarity	0.578	NPC34580
Remote Similarity	0.578	NPC124920
Remote Similarity	0.578	NPC304307
Remote Similarity	0.5778	NPC115282
Remote Similarity	0.5775	NPC14288
Remote Similarity	0.5774	NPC208751
Remote Similarity	0.5766	NPC471603
Remote Similarity	0.5749	NPC470900
Remote Similarity	0.5749	NPC470901
Remote Similarity	0.574	NPC12100
Remote Similarity	0.5739	NPC326363
Remote Similarity	0.5735	NPC128115
Remote Similarity	0.5734	NPC323752
Remote Similarity	0.5734	NPC284888
Remote Similarity	0.5734	NPC323198
Remote Similarity	0.5724	NPC303374
Remote Similarity	0.572	NPC249662
Remote Similarity	0.5719	NPC315411
Remote Similarity	0.5719	NPC467439
Remote Similarity	0.5714	NPC325976
Remote Similarity	0.5714	NPC470003
Remote Similarity	0.5714	NPC17305
Remote Similarity	0.5709	NPC470784
Remote Similarity	0.5705	NPC473639
Remote Similarity	0.5704	NPC147983
Remote Similarity	0.5704	NPC177996
Remote Similarity	0.5699	NPC316403
Remote Similarity	0.5699	NPC89987
Remote Similarity	0.5694	NPC477549
Remote Similarity	0.5687	NPC188104
Remote Similarity	0.5685	NPC316224
Remote Similarity	0.5683	NPC315061
Remote Similarity	0.5669	NPC105758
Remote Similarity	0.5669	NPC476688
Remote Similarity	0.5669	NPC476686
Remote Similarity	0.5665	NPC329961
Remote Similarity	0.5665	NPC122427
Remote Similarity	0.5663	NPC469594
Remote Similarity	0.566	NPC33064
Remote Similarity	0.566	NPC245055
Remote Similarity	0.5652	NPC278874
Remote Similarity	0.5649	NPC471762
Remote Similarity	0.5647	NPC208060
Remote Similarity	0.5646	NPC75498
Remote Similarity	0.5641	NPC471155
Remote Similarity	0.5641	NPC470786
Remote Similarity	0.5639	NPC477638
Remote Similarity	0.5639	NPC477632
Remote Similarity	0.5625	NPC63279
Remote Similarity	0.5625	NPC470500
Remote Similarity	0.5623	NPC14812
Remote Similarity	0.5623	NPC473800
Remote Similarity	0.5623	NPC272174
Remote Similarity	0.562	NPC270241
Remote Similarity	0.5618	NPC64216
Remote Similarity	0.5614	NPC257851
Remote Similarity	0.5614	NPC107160
Remote Similarity	0.5614	NPC157931
Remote Similarity	0.5613	NPC192674
Remote Similarity	0.561	NPC21461
Remote Similarity	0.5606	NPC297642
Remote Similarity	0.5606	NPC158055
Remote Similarity	0.5606	NPC223223
Remote Similarity	0.5604	NPC225400
Remote Similarity	0.5603	NPC474896
Remote Similarity	0.5601	NPC470785

Drug Structure

NPD7553 OpenBabel08211712022D 64 69 0 0 1 0 0 0 0 0999 V2000 7.9282 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1895 2.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0694 1.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4507 5.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7095 6.5379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1962 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7777 6.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4937 3.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6749 -0.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0622 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4848 5.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8978 -0.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0024 7.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0365 6.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9937 3.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9319 -0.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2259 4.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0353 2.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2548 0.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1962 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7765 1.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8841 1.4348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.0622 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2561 0.7100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.9882 2.9781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2600 4.0884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.0012 3.1225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5870 2.1691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.2247 0.2247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.3301 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.9937 4.8147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2612 8.2110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3294 7.6933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9331 3.6402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3801 -2.1554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3282 3.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4836 1.1907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4641 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1.8660 -1.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -4.5136 -0.3082 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -4.5257 2.3684 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7115 1.5487 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9937 4.8147 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2271 8.4698 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5882 8.6593 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8990 3.8990 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3461 -1.8966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 3.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5870 4.5367 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 1 0 0 0 0 2 31 1 0 0 0 0 3 31 1 0 0 0 0 4 5 2 0 0 0 0 4 13 1 0 0 0 0 5 16 1 0 0 0 0 6 12 1 0 0 0 0 6 19 2 0 0 0 0 7 13 2 0 0 0 0 7 17 1 0 0 0 0 8 18 1 0 0 0 0 8 43 1 0 0 0 0 9 14 1 0 0 0 0 9 53 1 0 0 0 0 10 14 1 0 0 0 0 10 54 1 0 0 0 0 11 15 2 0 0 0 0 11 55 1 0 0 0 0 12 33 2 0 0 0 0 13 23 1 0 0 0 0 14 22 2 0 0 0 0 15 20 1 0 0 0 0 15 34 1 0 0 0 0 16 17 2 0 0 0 0 16 44 1 0 0 0 0 17 45 1 0 0 0 0 18 35 1 0 0 0 0 18 39 2 0 0 0 0 19 42 1 0 0 0 0 19 53 1 0 0 0 0 20 24 1 0 0 0 0 20 40 2 0 0 0 0 21 25 1 0 0 0 0 21 26 1 0 0 0 0 21 36 1 0 0 0 0 22 27 1 0 0 0 0 22 41 1 0 0 0 0 23 37 2 3 0 0 0 23 46 1 0 0 0 0 24 36 2 3 0 0 0 24 47 1 0 0 0 0 25 41 1 0 0 0 0 25 48 2 0 0 0 0 26 41 1 0 0 0 0 26 54 1 0 0 0 0 27 49 2 0 0 0 0 27 50 1 0 0 0 0 28 31 1 0 0 0 0 28 38 2 3 0 0 0 28 51 1 0 0 0 0 29 32 2 0 0 0 0 29 34 1 0 0 0 0 29 55 1 0 0 0 0 30 33 1 0 0 0 0 30 35 2 0 0 0 0 30 42 1 0 0 0 0 31 52 1 0 0 0 0 32 56 1 0 0 0 0 34 57 1 0 0 0 0 37 38 1 0 0 0 0 39 42 1 0 0 0 0 40 52 1 0 0 0 0 43 58 1 0 0 0 0 44 59 1 0 0 0 0 45 60 1 0 0 0 0 46 61 1 0 0 0 0 47 62 1 0 0 0 0 50 63 1 0 0 0 0 51 64 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB011626
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	813.14
ALogP	-0.5643
MLogP	2.23
XLogP	3.017
HDA	17
HBD	9
Rotatable Bonds	23
TPSA	392.52
RO5 Violation	3