NPASS Compound

Natural Product: NPC85290

Natural Product ID	NPC85290
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ILTQYWVUOPDTOL-DBWGAYEVSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	21671980
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 80 84 0 0 0 0 0 0 0 0999 V2000 -6.0801 1.1000 -0.7435 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8110 1.5638 -0.1045 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9057 3.0915 0.0335 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5990 1.0387 1.2906 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6096 -0.4475 1.2169 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6865 -1.0539 0.1923 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7867 -1.9981 0.9569 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3787 -2.0777 0.5290 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7155 -0.7374 0.3674 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6060 -0.0994 1.7235 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5585 0.0155 -0.5833 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0028 0.9221 -1.4072 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4245 1.1918 -1.3944 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8621 2.0515 -2.1733 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2494 0.4514 -0.4829 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7363 0.3991 -0.7008 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1846 -0.6609 -1.6773 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3127 1.6821 -1.2009 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8057 1.6340 -1.1715 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4488 1.1775 0.0762 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6714 0.2875 0.9663 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7635 0.8932 2.3918 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5129 -0.9915 1.1518 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2862 -0.0151 0.6598 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9051 -1.4858 0.8243 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4956 -1.7972 0.5943 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6745 -0.9311 -0.2670 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3706 -1.4934 -1.6490 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7028 0.6148 -0.2913 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0311 -0.1330 -0.7369 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5739 1.2591 -0.8731 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5673 -1.9747 -0.6325 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7879 -2.1115 -0.3950 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0404 -2.7049 -1.6912 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7695 0.5894 -0.0429 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8133 0.4558 -1.6134 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6618 1.9519 -1.1866 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8805 3.4191 0.3672 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5716 3.3235 0.8887 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2080 3.5698 -0.8978 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4205 1.3665 1.9268 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6121 1.3826 1.6330 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6917 -0.7452 1.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3986 -0.8081 2.2689 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7919 -1.7696 2.0665 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1779 -3.0627 0.9596 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3209 -2.7114 -0.3770 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8481 -2.6581 1.3186 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1460 -0.6865 2.5248 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0918 0.9000 1.7178 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4259 -0.0299 2.1216 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6220 1.4892 -2.1208 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1299 1.0001 0.5104 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8173 -1.6626 -1.5067 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0763 -0.2881 -2.7221 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3068 -0.7318 -1.5438 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9183 2.5773 -0.6947 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0894 1.7112 -2.3148 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1842 1.0249 -2.0471 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1460 2.6786 -1.4572 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7849 2.1175 0.6191 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6840 0.1187 3.1534 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6109 1.5723 2.4773 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8338 1.5236 2.4762 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6232 -1.5714 0.2442 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2123 -1.5459 2.0506 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5445 -0.5903 1.3898 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6354 0.4925 1.4396 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6302 -2.1565 0.2745 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1875 -1.7024 1.9027 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9944 -1.9095 1.6032 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4338 -2.8471 0.1734 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6281 -2.5709 -1.7351 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7364 -1.4787 -1.8867 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7813 -0.8647 -2.4679 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7157 0.3227 -1.2146 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0930 -0.5644 -1.7900 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8171 2.0464 -0.5665 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7914 1.5509 -1.9452 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5960 -2.8893 -2.5325 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 1 9 11 1 0 11 12 2 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 1 0 16 17 1 6 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 20 29 1 0 11 30 1 0 30 31 1 0 6 32 1 6 32 33 2 0 32 34 1 0 31 2 1 0 30 6 1 0 27 9 1 0 27 15 1 0 24 16 1 0 1 35 1 0 1 36 1 0 1 37 1 0 3 38 1 0 3 39 1 0 3 40 1 0 4 41 1 0 4 42 1 0 5 43 1 0 5 44 1 0 7 45 1 0 7 46 1 0 8 47 1 0 8 48 1 0 10 49 1 0 10 50 1 0 10 51 1 0 12 52 1 0 15 53 1 1 17 54 1 0 17 55 1 0 17 56 1 0 18 57 1 0 18 58 1 0 19 59 1 0 19 60 1 0 20 61 1 1 22 62 1 0 22 63 1 0 22 64 1 0 23 65 1 0 23 66 1 0 23 67 1 0 24 68 1 1 25 69 1 0 25 70 1 0 26 71 1 0 26 72 1 0 28 73 1 0 28 74 1 0 28 75 1 0 29 76 1 0 30 77 1 6 31 78 1 0 31 79 1 0 34 80 1 0 M END

Standard InCHIKey	ILTQYWVUOPDTOL-DBWGAYEVSA-N
Standard InCHI	InChI=1S/C30H46O4/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)17-25)16-20(31)23-27(5)10-9-22(32)26(3,4)21(27)8-11-29(23,28)7/h16,19,21-23,32H,8-15,17H2,1-7H3,(H,33,34)/t19-,21-,22-,23+,27-,28+,29+,30-/m0/s1
SMILES	CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@@]34C)O)[C@@H]2C1)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	470.34	Volume:	511.905 ? Van der Waals volume.
Dense:	0.919	LogP:	3.001 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.748 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.255 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	28.0
TPSA:	74.6 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.464	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.66	Fsp³:	0.867
MCE-18:	107.143 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.539	Fluc inhibitor:	0.007 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.083 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.321	Promiscuous compounds:	0.284

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.502	MDCK Permeability:	-5.109
Pgp-inhibitor:	0.016	Pgp-substrate:	0.014
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.038
20% Bioavailability (F20%):	0.752	30% Bioavailability (F30%):	0.227
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.224	MRP1:	0.975
Plasma Protein Binding (PPB):	96.916%	Volume Distribution (VD):	-0.417
Fu:	3.893% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.978	BCRP inhibitor:	0.019
BSEP inhibitor:	0.91

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.595	CYP2C19-substrate:	0.007
CYP2C9-inhibitor:	0.39	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.615 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.823

Half-life (T1/2):

0.725

ADMET: Toxicity

hERG Blockers:	0.044	hERG Blockers (10um):	0.062
Human Hepatotoxicity (H-HT):	0.884	Drug-induced Liver Injury (DILI):	0.778
AMES Toxicity:	0.331	Rat Oral Acute Toxicity:	0.459
Maximum Recommended Daily Dose:	0.598	Skin Sensitization:	0.94
Carcinogencity:	0.929	Eye Corrosion:	0.023
Eye Irritation:	0.809	Respiratory Toxicity:	0.93
Drug-induced Neurotoxicity:	0.192	Ototoxicity:	0.593
Hematotoxicity:	0.595	Drug-induced Nephrotoxicity:	0.943
Genotoxicity:	0.763	RPMI-8226 Immunitoxicity:	0.042
A549 Cytotoxicity:	0.119	Hek293 Cytotoxicity:	0.116
BCF:	1.184 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.866 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.507 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.794 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19352.1	Paeonia obovata var. japonica	Varieties	Paeoniaceae	Eukaryota	n.a.	seed	n.a.	PMID[23497864]
NPO19352.1	Paeonia obovata var. japonica	Varieties	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19352.1	Paeonia obovata var. japonica	Varieties	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC85290 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18285
0.1-0.2	26330
0.2-0.3	4183
0.3-0.4	742
0.4-0.5	226
0.5-0.6	53
0.6-0.7	18
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7576	Intermediate Similarity	NPC139570
0.7463	Intermediate Similarity	NPC610635
0.7385	Intermediate Similarity	NPC480946
0.7385	Intermediate Similarity	NPC130577
0.7385	Intermediate Similarity	NPC142415
0.7385	Intermediate Similarity	NPC102683
0.7101	Intermediate Similarity	NPC481316
0.6857	Remote Similarity	NPC608622
0.6714	Remote Similarity	NPC4036
0.6714	Remote Similarity	NPC65120
0.6714	Remote Similarity	NPC145067
0.6714	Remote Similarity	NPC233455
0.6714	Remote Similarity	NPC91010
0.6714	Remote Similarity	NPC158030
0.6618	Remote Similarity	NPC198664
0.6338	Remote Similarity	NPC298554
0.6286	Remote Similarity	NPC270768
0.6286	Remote Similarity	NPC59263
0.6286	Remote Similarity	NPC182797
0.6286	Remote Similarity	NPC210106
0.6286	Remote Similarity	NPC52169
0.6286	Remote Similarity	NPC488562
0.6133	Remote Similarity	NPC474727
0.6056	Remote Similarity	NPC64872
0.6056	Remote Similarity	NPC25906
0.5915	Remote Similarity	NPC214756
0.5857	Remote Similarity	NPC161751
0.5857	Remote Similarity	NPC474972
0.5857	Remote Similarity	NPC600543
0.5833	Remote Similarity	NPC84319
0.5833	Remote Similarity	NPC52021
0.5833	Remote Similarity	NPC599947
0.5797	Remote Similarity	NPC602872
0.5753	Remote Similarity	NPC158141
0.5694	Remote Similarity	NPC187722
0.5676	Remote Similarity	NPC228784
0.5676	Remote Similarity	NPC324341
0.5676	Remote Similarity	NPC293564
0.5676	Remote Similarity	NPC601810
0.5616	Remote Similarity	NPC282616
0.5616	Remote Similarity	NPC275809
0.5616	Remote Similarity	NPC51700
0.5616	Remote Similarity	NPC88716
0.5616	Remote Similarity	NPC68160
0.5556	Remote Similarity	NPC479748
0.5541	Remote Similarity	NPC130278
0.5479	Remote Similarity	NPC295643
0.5467	Remote Similarity	NPC202728
0.5467	Remote Similarity	NPC158059
0.5467	Remote Similarity	NPC29765
0.5405	Remote Similarity	NPC121798
0.5405	Remote Similarity	NPC234346
0.5405	Remote Similarity	NPC606443
0.5402	Remote Similarity	NPC18982
0.5341	Remote Similarity	NPC475627
0.5333	Remote Similarity	NPC231063
0.5333	Remote Similarity	NPC282395
0.5333	Remote Similarity	NPC110308
0.5325	Remote Similarity	NPC607666
0.5325	Remote Similarity	NPC608261
0.5325	Remote Similarity	NPC611078
0.527	Remote Similarity	NPC272075
0.5263	Remote Similarity	NPC291028
0.5256	Remote Similarity	NPC117663
0.5244	Remote Similarity	NPC603645
0.52	Remote Similarity	NPC301244
0.5195	Remote Similarity	NPC474963
0.5139	Remote Similarity	NPC604575
0.5132	Remote Similarity	NPC106112
0.5132	Remote Similarity	NPC261935
0.5132	Remote Similarity	NPC481360
0.5132	Remote Similarity	NPC481314
0.5068	Remote Similarity	NPC72638
0.5067	Remote Similarity	NPC274330
0.5065	Remote Similarity	NPC200752
0.5065	Remote Similarity	NPC120840
0.5063	Remote Similarity	NPC471966
0.5062	Remote Similarity	NPC481320

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC85290 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5785
0.1-0.2	3262
0.2-0.3	91
0.3-0.4	7
0.4-0.5	4
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6714	Remote Similarity	NPD7515	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data