NPASS Compound

Natural Product: NPC602872

Natural Product ID	NPC602872
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UHBYXZSSQWLZHC-JZXKHQQSSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1570513
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 80 84 0 0 0 0 0 0 0 0999 V2000 -3.1807 1.7736 -1.9508 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3664 1.0989 -0.5589 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8120 1.3061 -0.2365 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9118 1.9986 1.1080 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6125 0.0270 -0.2392 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9730 -1.0564 0.5615 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5849 -1.3910 0.0671 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8540 -2.5679 -0.9170 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8325 -2.0245 1.1816 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3202 -2.0285 1.0927 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8752 -0.5951 0.8453 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6310 0.1976 1.9024 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4177 -0.3833 -0.5128 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5836 -0.3669 -1.5063 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8785 -0.5575 -1.3265 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5462 -0.3186 -2.3453 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3944 -1.0014 0.0044 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9136 -0.7784 0.0912 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3324 -1.6206 1.3198 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6144 -1.4296 -1.0669 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5473 -0.6313 -1.8741 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3285 0.2328 -0.9113 C 0 0 2 0 0 0 0 0 0 0 0 0 5.8239 -0.5298 0.1168 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3666 1.2494 -0.3748 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0294 2.1595 -1.5348 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2069 2.1432 0.5594 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1821 0.6581 0.3230 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0121 1.5921 0.1547 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7475 1.2049 0.8271 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5800 -0.3225 1.0120 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8951 -0.5337 2.4671 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8989 -0.2888 -0.6768 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7810 2.6864 -2.0089 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5043 1.0056 -2.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0976 1.9206 -2.1054 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7461 1.7968 0.0504 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3433 1.9906 -0.9491 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8093 2.6497 1.1690 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9869 2.6333 1.2018 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8641 1.2746 1.9470 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5937 0.2634 0.2283 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8356 -0.3233 -1.2626 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6523 -1.9353 0.5193 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8834 -0.7389 1.6324 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9003 -3.0787 -1.1416 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5853 -3.2698 -0.4581 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3464 -2.1372 -1.8132 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0803 -3.1328 1.2706 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1395 -1.6759 2.2086 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9525 -2.3473 2.0598 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0384 -2.7175 0.3005 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5709 -0.4340 2.8433 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7138 0.2302 1.7512 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3035 1.2232 2.0263 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0057 -0.2040 -2.5047 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2348 -2.0980 0.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9382 -1.0308 2.0295 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5202 -2.2121 1.7324 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0777 -2.4264 1.0163 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9024 -2.0578 -1.6779 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2817 -2.2849 -0.6882 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3242 -1.3212 -2.3145 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1579 -0.0629 -2.7312 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1251 0.7957 -1.4538 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5126 -1.1769 -0.1539 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0142 2.3150 -2.0730 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3564 1.7401 -2.2751 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7557 3.1816 -1.2011 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2781 1.6392 1.5424 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1737 2.3249 0.0844 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6828 3.1173 0.6480 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4606 0.7686 1.4185 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3489 2.5510 0.6732 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8744 1.9411 -0.8922 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6159 1.7398 1.8016 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1008 1.5995 0.1919 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8868 -0.1833 2.8052 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5829 -1.4746 2.9007 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2665 0.2600 2.9977 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0809 -0.5407 -1.7781 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 1 6 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 2 0 14 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 1 1 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 24 25 1 0 24 26 1 0 24 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 1 13 32 1 0 32 2 1 0 32 7 1 0 30 11 1 0 30 17 1 0 27 18 1 0 1 33 1 0 1 34 1 0 1 35 1 0 2 36 1 1 3 37 1 6 4 38 1 0 4 39 1 0 4 40 1 0 5 41 1 0 5 42 1 0 6 43 1 0 6 44 1 0 8 45 1 0 8 46 1 0 8 47 1 0 9 48 1 0 9 49 1 0 10 50 1 0 10 51 1 0 12 52 1 0 12 53 1 0 12 54 1 0 14 55 1 0 17 56 1 0 19 57 1 0 19 58 1 0 19 59 1 0 20 60 1 0 20 61 1 0 21 62 1 0 21 63 1 0 22 64 1 6 23 65 1 0 25 66 1 0 25 67 1 0 25 68 1 0 26 69 1 0 26 70 1 0 26 71 1 0 27 72 1 0 28 73 1 0 28 74 1 0 29 75 1 0 29 76 1 0 31 77 1 0 31 78 1 0 31 79 1 0 32 80 1 6 M END

Standard InCHIKey	UHBYXZSSQWLZHC-JZXKHQQSSA-N
Standard InCHI	InChI=1S/C30H48O2/c1-18-9-12-27(5)15-16-29(7)20(24(27)19(18)2)17-21(31)25-28(6)13-11-23(32)26(3,4)22(28)10-14-30(25,29)8/h17-19,22-25,32H,9-16H2,1-8H3/t18-,19+,22?,23+,24+,25?,27-,28+,29-,30-/m1/s1
SMILES	C[C@H]1[C@H](C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)C4[C@@]5(C)CC[C@H](O)C(C)(C)C5CC[C@]43C)[C@H]12

Calculated Properties

Physi-Chem Properties

Molecular Weight:	440.37	Volume:	496.961 ? Van der Waals volume.
Dense:	0.886	LogP:	4.965 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.987 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.518 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	0.0	Rigid Bonds:	27.0
TPSA:	37.3 ? Topological Polar Surface Area.	H-Bond Acceptor:	2.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	2.0

MedChem Properties

QED Drug-Likeness Score:	0.432	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.768	Fsp³:	0.9
MCE-18:	101.333 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.69	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.283 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.324	Promiscuous compounds:	0.305

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.407	MDCK Permeability:	-4.981
Pgp-inhibitor:	0.987	Pgp-substrate:	0.124
PAMPA:	0.719 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.775	30% Bioavailability (F30%):	0.162
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.98	MRP1:	0.992
Plasma Protein Binding (PPB):	97.2%	Volume Distribution (VD):	-0.171
Fu:	3.316% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.994	BCRP inhibitor:	0.454
BSEP inhibitor:	0.999

ADMET: Metabolism

CYP1A2-inhibitor:	0.131	CYP1A2-substrate:	0.453
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.844
CYP2C9-inhibitor:	0.013	CYP2C9-substrate:	0.004
CYP2D6-inhibitor:	0.005	CYP2D6-substrate:	0.465
CYP3A4-inhibitor:	0.991	CYP3A4-substrate:	0.997
CYP2B6-substrate:	0.001	CYP2C8-inhibitor:	0.886
HLM stability:	0.789 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

11.635

Half-life (T1/2):

0.21

ADMET: Toxicity

hERG Blockers:	0.1	hERG Blockers (10um):	0.374
Human Hepatotoxicity (H-HT):	0.773	Drug-induced Liver Injury (DILI):	0.139
AMES Toxicity:	0.312	Rat Oral Acute Toxicity:	0.523
Maximum Recommended Daily Dose:	0.751	Skin Sensitization:	0.659
Carcinogencity:	0.891	Eye Corrosion:	0.007
Eye Irritation:	0.641	Respiratory Toxicity:	0.791
Drug-induced Neurotoxicity:	0.23	Ototoxicity:	0.598
Hematotoxicity:	0.32	Drug-induced Nephrotoxicity:	0.513
Genotoxicity:	0.676	RPMI-8226 Immunitoxicity:	0.076
A549 Cytotoxicity:	0.411	Hek293 Cytotoxicity:	0.632
BCF:	2.579 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.576 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.57 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.36 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24195447]
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	Gum resin	n.a.	n.a.	PMID[26457560]
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO15315	Boswellia carterii	Species	Burseraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Potency	7
AC50	2

Activity Type	# Activity
Individual protein	4
Unchecked	3
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT10	Individual protein	Geminin	Homo sapiens	Potency	n.a.	1636.0	nM	PubChem BioAssay data set
NPT50	Individual protein	Tyrosyl-DNA phosphodiesterase 1	Homo sapiens	Potency	n.a.	29092.9	nM	PubChem BioAssay data set
NPT50	Individual protein	Tyrosyl-DNA phosphodiesterase 1	Homo sapiens	Potency	n.a.	23109.3	nM	PubChem BioAssay data set
NPT444	Individual protein	Ubiquitin carboxyl-terminal hydrolase 1	Homo sapiens	Potency	n.a.	316.2	nM	PubChem BioAssay data set

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT28438	Unchecked	Unchecked	n.a.	Potency	=	2059.6	nM	PubChem BioAssay data set
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Potency	n.a.	3696.4	nM	PubChem BioAssay data set
NPT28438	Unchecked	Unchecked	n.a.	AC50	=	4761.0	nM	PubChem BioAssay data set
NPT28438	Unchecked	Unchecked	n.a.	AC50	=	3666.0	nM	PubChem BioAssay data set
NPT6	Organism	Plasmodium falciparum	Plasmodium falciparum	Potency	n.a.	2616.9	nM	PubChem BioAssay data set

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC602872 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18780
0.1-0.2	25589
0.2-0.3	4759
0.3-0.4	615
0.4-0.5	85
0.5-0.6	12
0.6-0.7	14
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8167	Intermediate Similarity	NPC98874
0.8103	Intermediate Similarity	NPC479748
0.7966	Intermediate Similarity	NPC272075
0.6825	Remote Similarity	NPC295643
0.6724	Remote Similarity	NPC27765
0.6724	Remote Similarity	NPC122418
0.6724	Remote Similarity	NPC491014
0.6515	Remote Similarity	NPC148523
0.6418	Remote Similarity	NPC4036
0.6418	Remote Similarity	NPC65120
0.6418	Remote Similarity	NPC145067
0.6418	Remote Similarity	NPC233455
0.6418	Remote Similarity	NPC158030
0.6418	Remote Similarity	NPC610635
0.6308	Remote Similarity	NPC214756
0.6176	Remote Similarity	NPC310546
0.6	Remote Similarity	NPC471966
0.5938	Remote Similarity	NPC95594
0.5758	Remote Similarity	NPC40552
0.5758	Remote Similarity	NPC471898
0.5692	Remote Similarity	NPC292015
0.5672	Remote Similarity	NPC477579
0.5538	Remote Similarity	NPC40394
0.5493	Remote Similarity	NPC26413
0.5455	Remote Similarity	NPC274724
0.5152	Remote Similarity	NPC132478
0.5143	Remote Similarity	NPC304285
0.5077	Remote Similarity	NPC82477
0.5077	Remote Similarity	NPC190035

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC602872 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6842
0.1-0.2	2186
0.2-0.3	114
0.3-0.4	5
0.4-0.5	2
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6418	Remote Similarity	NPD7515	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data