Natural Product: NPC611978| Natural Product ID | NPC611978 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| URWAJWIAIPFPJE-YFMIWBNJSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL221886 |
| PubChem CID | n.a. |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | URWAJWIAIPFPJE-YFMIWBNJSA-N |
| Standard InCHI | InChI=1S/C19H37N5O7/c1-19(27)7-28-18(13(26)16(19)24-2)31-15-11(23)5-10(22)14(12(15)25)30-17-9(21)4-3-8(6-20)29-17/h3,9-18,24-27H,4-7,20-23H2,1-2H3/t9-,10+,11-,12+,13-,14-,15+,16-,17-,18-,19+/m1/s1 |
| SMILES | CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3OC(CN)=CC[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O |
  Calculated Properties
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO46069 | Micromonospora inyoensis | Species | Micromonosporaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO53618 | Streptomyces JP95 | Genus | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT253 | Individual protein | HMG-CoA reductase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT245 | Individual protein | Dopamine D4 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT288 | Individual protein | Serotonin 1a (5-HT1a) receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT257 | Individual protein | Arachidonate 15-lipoxygenase | Oryctolagus cuniculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT274 | Individual protein | Platelet activating factor receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT245 | Individual protein | Dopamine D4 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT288 | Individual protein | Serotonin 1a (5-HT1a) receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT279 | Individual protein | Leukocyte elastase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT255 | Individual protein | Leukotriene C4 synthase | Cavia porcellus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT256 | Individual protein | Cysteinyl leukotriene receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT266 | Individual protein | Muscarinic acetylcholine receptor M5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT235 | Individual protein | C-C chemokine receptor type 4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT273 | Individual protein | Phosphodiesterase 5A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT279 | Individual protein | Leukocyte elastase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT298 | Individual protein | Neurokinin 2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT240 | Individual protein | Cytochrome P450 2A6 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT220 | Individual protein | Alpha-1b adrenergic receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT229 | Individual protein | Angiotensin II type 2 (AT-2) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT287 | Individual protein | Leukocyte common antigen | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT284 | Individual protein | Serine/threonine protein phosphatase 2B catalytic subunit, alpha isoform | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT297 | Individual protein | Neurokinin 1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT221 | Individual protein | Alpha-1d adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT284 | Individual protein | Serine/threonine protein phosphatase 2B catalytic subunit, alpha isoform | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT276 | Individual protein | Angiotensin-converting enzyme | Oryctolagus cuniculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT255 | Individual protein | Leukotriene C4 synthase | Cavia porcellus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT233 | Individual protein | Carbonic anhydrase II | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT236 | Individual protein | C-C chemokine receptor type 5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT275 | Individual protein | Progesterone receptor | Bos taurus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT219 | Individual protein | Alpha-1a adrenergic receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT219 | Individual protein | Alpha-1a adrenergic receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT256 | Individual protein | Cysteinyl leukotriene receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT265 | Individual protein | Muscarinic acetylcholine receptor M4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT266 | Individual protein | Muscarinic acetylcholine receptor M5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT220 | Individual protein | Alpha-1b adrenergic receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT274 | Individual protein | Platelet activating factor receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT286 | Individual protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT237 | Individual protein | Interleukin-8 receptor A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT221 | Individual protein | Alpha-1d adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT260 | Individual protein | Melanocortin receptor 5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT269 | Individual protein | Nitric-oxide synthase, brain | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT257 | Individual protein | Arachidonate 15-lipoxygenase | Oryctolagus cuniculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT269 | Individual protein | Nitric-oxide synthase, brain | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT253 | Individual protein | HMG-CoA reductase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT273 | Individual protein | Phosphodiesterase 5A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT287 | Individual protein | Leukocyte common antigen | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT293 | Individual protein | Serotonin 4 (5-HT4) receptor | Cavia porcellus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT275 | Individual protein | Progesterone receptor | Bos taurus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT241 | Individual protein | Cytochrome P450 2E1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT278 | Individual protein | Cathepsin G | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT289 | Individual protein | Serotonin 1b (5-HT1b) receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT289 | Individual protein | Serotonin 1b (5-HT1b) receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT229 | Individual protein | Angiotensin II type 2 (AT-2) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT298 | Individual protein | Neurokinin 2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT293 | Individual protein | Serotonin 4 (5-HT4) receptor | Cavia porcellus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT296 | Individual protein | Sigma opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT286 | Individual protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT296 | Individual protein | Sigma opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT276 | Individual protein | Angiotensin-converting enzyme | Oryctolagus cuniculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT297 | Individual protein | Neurokinin 1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT233 | Individual protein | Carbonic anhydrase II | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT234 | Individual protein | C-C chemokine receptor type 2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT236 | Individual protein | C-C chemokine receptor type 5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT265 | Individual protein | Muscarinic acetylcholine receptor M4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT260 | Individual protein | Melanocortin receptor 5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT234 | Individual protein | C-C chemokine receptor type 2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT240 | Individual protein | Cytochrome P450 2A6 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT237 | Individual protein | Interleukin-8 receptor A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT241 | Individual protein | Cytochrome P450 2E1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT235 | Individual protein | C-C chemokine receptor type 4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT278 | Individual protein | Cathepsin G | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT69 | Individual protein | Matrix metalloproteinase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT68 | Individual protein | Aldose reductase | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT69 | Individual protein | Matrix metalloproteinase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29498 | Single protein | Interleukin-8 receptor B | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT98 | Individual protein | HERG | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT98 | Individual protein | HERG | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT68 | Individual protein | Aldose reductase | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29498 | Single protein | Interleukin-8 receptor B | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | 1.058 | % | PMID[38318365] |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29442 | Protein complex group | Glycine receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30010 | Single protein | Calcitonin receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30010 | Single protein | Calcitonin receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28550 | Single protein | Vasoactive intestinal polypeptide receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28398 | Single protein | Insulin receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28550 | Single protein | Vasoactive intestinal polypeptide receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29442 | Protein complex group | Glycine receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28398 | Single protein | Insulin receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28792 | Nucleic-acid | Nucleic Acid | n.a. | MIC | > | 100000.0 | nM | PMID[9457241] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1033 | Organism | Enterobacter cloacae | Enterobacter cloacae | MIC | > | 64.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1122 | Organism | Haemophilus influenzae | Haemophilus influenzae | MIC | = | 4.7 | ug.mL-1 | PMID[26617967] |
| NPT566 | Organism | Salmonella typhimurium | Salmonella enterica subsp. enterica serovar Typhimurium | MIC | = | 0.3 | ug.mL-1 | PMID[413921] |
| NPT1550 | Organism | Bacillus anthracis | Bacillus anthracis | MIC | <= | 0.25 | ug.mL-1 | PMID[26617967] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (comment) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT2895 | Organism | Providencia stuartii | Providencia stuartii | MIC | = | 64.0 | ug.mL-1 | PMID[20805391] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (malignant tumour) | = | 0.0 | n.a. | PMID[15646539] |
| NPT992 | Organism | Entamoeba histolytica | Entamoeba histolytica | Activity | n.a. | n.a. | n.a. | PMID[413921] |
| NPT172 | Organism | Proteus mirabilis | Proteus mirabilis | MIC | = | 0.3 | ug.mL-1 | PMID[413921] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (acute) | = | 0.0 | n.a. | PMID[15646539] |
| NPT1207 | Organism | Acinetobacter | Acinetobacter | MIC | = | 0.5 | ug.mL-1 | PMID[20805391] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (steatosis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (chronic liver disease) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (association with vascular disease) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (cytolytic) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (severe hepatitis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (cirrhosis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (choleostasis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (successful reintroduction) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 0.25 | ug.mL-1 | PMID[20805391] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 7.5 | ug.mL-1 | PMID[413921] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 0.3 | ug.mL-1 | PMID[413921] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (mechanism) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | n.a. | n.a. | n.a. | PMID[413921] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | < | 0.01 | ug.mL-1 | PMID[413921] |
| NPT3163 | Organism | Acinetobacter calcoaceticus | Acinetobacter calcoaceticus | MIC | = | 32.0 | ug.mL-1 | PMID[20805391] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC | > | 25.0 | ug.mL-1 | PMID[413921] |
| NPT2894 | Organism | Providencia rettgeri | Providencia rettgeri | MIC | = | 3.0 | ug.mL-1 | PMID[413921] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 17.5 | ug.mL-1 | PMID[413921] |
| NPT1228 | Organism | Streptococcus pyogenes | Streptococcus pyogenes | MIC | = | 3.0 | ug.mL-1 | PMID[413921] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | MIC | = | 4.7 | ug.mL-1 | PMID[26617967] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (acute) | = | 0.0 | % | PMID[15646539] |
| NPT564 | Organism | Listeria monocytogenes | Listeria monocytogenes | MIC | = | 2.3 | ug.mL-1 | PMID[26617967] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 0.25 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | MIC | = | 7.5 | ug.mL-1 | PMID[413921] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (animal toxicity known) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 2.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (granulomatous hepatitis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 5.7 | % | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (time to onset) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (benign tumour) | = | 0.0 | n.a. | PMID[15646539] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 64.0 | ug.mL-1 | PMID[20805391] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 0.5 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[17470660] |
| NPT1521 | Organism | Stenotrophomonas maltophilia | Stenotrophomonas maltophilia | MIC | = | 8.0 | ug.mL-1 | PMID[17088477] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.25 | ug.mL-1 | PMID[20805391] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | PMID[20805391] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | <= | 0.25 | ug.mL-1 | PMID[26617967] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 256.0 | ug.mL-1 | PMID[17875999] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.75 | ug.mL-1 | PMID[413921] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 7.5 | ug.mL-1 | PMID[413921] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.5 | ug.mL-1 | PMID[20805391] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 0.06 | ug.mL-1 | PMID[17875999] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.03 | ug.mL-1 | PMID[413921] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 2.0 | ug.mL-1 | PMID[19349516] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.0 | ug.mL-1 | PMID[20805391] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 17.5 | ug.mL-1 | PMID[413921] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.2 | ug.mL-1 | PMID[26617967] |
| NPT28513 | Organism | Mycolicibacterium smegmatis | Mycolicibacterium smegmatis | MIC | <= | 0.25 | ug.mL-1 | PMID[26617967] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | <= | 0.25 | ug.mL-1 | PMID[17470660] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 17.5 | ug.mL-1 | PMID[413921] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.13 | ug.mL-1 | PMID[17875999] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.5 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.25 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT5397 | Organism | Providencia | Providencia | MIC | = | 3.0 | ug.mL-1 | PMID[413921] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Inhibition | = | 100.0 | % | PMID[12643896] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 64.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 1.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 32.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 8.0 | ug.mL-1 | PMID[20145089] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 4.0 | ug.mL-1 | PMID[20145089] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.125 | ug.mL-1 | PMID[17088477] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 32.0 | ug.mL-1 | PMID[20805391] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 32.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 64.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Denaturation rate constant | = | 0.087 | min-1 | PMID[12643896] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Inhibition | = | 75.0 | % | PMID[12643896] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | IC50 | = | 7.0 | nM | PMID[12643896] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 0.3 | ug.mL-1 | PMID[413921] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.25 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.5 | ug.mL-1 | PMID[19349516] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.5 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 7.5 | ug.mL-1 | PMID[413921] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 32.0 | ug.mL-1 | PMID[19349516] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1.0 | ug.mL-1 | PMID[19349516] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 256.0 | ug.mL-1 | PMID[17875999] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 1.0 | ug.mL-1 | PMID[20805391] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 64.0 | ug.mL-1 | PMID[20805391] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 0.5 | ug.mL-1 | PMID[20805391] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64.0 | ug.mL-1 | PMID[20805391] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 0.25 | ug.mL-1 | PMID[20145089] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.25 | ug.mL-1 | PMID[20805391] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | MIC | = | 0.125 | ug.mL-1 | PMID[20805391] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 0.5 | ug.mL-1 | PMID[20805391] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | = | 0.3 | ug.mL-1 | PMID[413921] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 8.0 | ug.mL-1 | PMID[20805391] |
| NPT314 | Organism | Bacillus cereus | Bacillus cereus | MIC | = | 9.4 | ug.mL-1 | PMID[26617967] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 0.5 | ug.mL-1 | PMID[20805391] |
| NPT1248 | Organism | Serratia marcescens | Serratia marcescens | MIC | = | 8.0 | ug.mL-1 | PMID[20805391] |
| NPT1019 | Organism | Trichomonas vaginalis | Trichomonas vaginalis | Activity | n.a. | n.a. | n.a. | PMID[413921] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | = | 0.5 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | MIC | > | 64.0 | ug.mL-1 | DOI[10.1039/C5MD00429B] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 147.17 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 391.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1222.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.49 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 6.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 102.33 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 663.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 158.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 144.2 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.57 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 37.07 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 65.13 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Tissue Severity Score | n.a. | n.a. | n.a. | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 44.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 24000000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 133.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 241.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1451670.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 25.73 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 636.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 824.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 14.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 295.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 204.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 8.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 395300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 176.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.0 | /100WBC | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 394300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5470000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 35.6 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1550.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.97 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5310000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 933330.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 138.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 92.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 25.57 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 92.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 81.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 573.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 130.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 5.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 52.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 101.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1590.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 68.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 124.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 106.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 204.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 13836.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.2 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 14608.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 397300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 14970.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 55700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 16.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 15195.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.23 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 7.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1506.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 22330000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 32.23 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 104.67 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.9 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 36.3 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 64.3 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 43000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 65.3 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1387670.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 59700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 103.67 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1176000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 135.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 94.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 156.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 145.93 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 400700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 17930.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 136.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 606.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 126.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 61700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 81.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 83.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 412.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 71.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 117.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 0.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 5.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 140700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 250.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 147.67 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 12.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 15500.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 58.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5670000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 89.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1620.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 146.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 878.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 6.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 49.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 38300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 17130.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 136.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 146000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 1.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 60.53 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 16493.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 129300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 21330000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 7.01 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1130.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5650000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 144300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1060.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 363.67 | U.L-1 | DrugMatrix |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Homo sapiens | n.a. | CL | = | 1.0 | mL.min-1.kg-1 | PMID[19445515] |
| Homo sapiens | Kidney | CL_renal | = | 0.76 | mL.min-1.kg-1 | PMID[19445515] |
| Homo sapiens | n.a. | Fu | = | 0.15 | n.a. | PMID[18426954] |
| Homo sapiens | n.a. | CL | = | 1.0 | mL.min-1.kg-1 | PMID[18426954] |
| Homo sapiens | n.a. | Vdss | = | 0.19 | L.kg-1 | PMID[18426954] |
| Escherichia coli | n.a. | Uptake at C50 | = | 7.0 | n.a. | PMID[3543366] |
| Homo sapiens | n.a. | T1/2 | = | 2.4 | hr | PMID[18426954] |
| Homo sapiens | n.a. | MRT | = | 3.2 | hr | PMID[18426954] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Mus musculus | LD50 | = | 34.0 | mg.kg-1 | PMID[413921] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC611978 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.9 | High Similarity | NPC603234 |
| 0.6615 | Remote Similarity | NPC478575 |
| 0.6418 | Remote Similarity | NPC611696 |
| 0.6364 | Remote Similarity | NPC155631 |
| 0.6143 | Remote Similarity | NPC487424 |
| 0.6119 | Remote Similarity | NPC38701 |
| 0.6119 | Remote Similarity | NPC603866 |
| 0.6119 | Remote Similarity | NPC606016 |
| 0.597 | Remote Similarity | NPC605029 |
| 0.589 | Remote Similarity | NPC471628 |
| 0.5513 | Remote Similarity | NPC599803 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC611978 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD3731 | Phase 3 |
| 0.873 | High Similarity | NPD4831 | Phase 4 |
| 0.8088 | Intermediate Similarity | NPD4830 | Approved |
| 0.6418 | Remote Similarity | NPD4282 | Phase 2 |
| 0.6364 | Remote Similarity | NPD4837 | Approved |
| 0.6364 | Remote Similarity | NPD4838 | Approved |
| 0.6111 | Remote Similarity | NPD4832 | Approved |
| 0.589 | Remote Similarity | NPD4836 | Phase 4 |
| 0.5747 | Remote Similarity | NPD6436 | Phase 4 |
| 0.5513 | Remote Similarity | NPD4835 | Approved |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
