Drug Information| Drug ID:   | NPD4831 |
| Drug Name:   | Netilmicin |
| Molecular Formula:   | C21H41N5O7 |
| Canonical SMILES:   | CCN[C@@H]1C[C@H](N)[C@H]([C@@H]([C@H]1O[C@H]1OC[C@]([C@@H]([C@H]1O)NC)(C)O)O)O[C@H]1OC(=CC[C@H]1N)CN |
| Standard InCHI:   | "InChI=1S/C21H41N5O7/c1-4-26-13-7-12(24)16(32-19-11(23)6-5-10(8-22)31-19)14(27)17(13)33-20-15(28)18(25-3)21(2,29)9-30-20/h5,11-20,25-29H,4,6-9,22-24H2,1-3H3/t11-,12+,13-,14+,15-,16-,17+,18-,19-,20-,21+/m1/s1" |
| Standard InCHIKey:   | CIDUJQMULVCIBT-MQDUPKMGSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4831Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.873 | NPC611978 |
| Intermediate Similarity | 0.791 | NPC603234 |
| Remote Similarity | 0.5833 | NPC478575 |
| Remote Similarity | 0.5833 | NPC603519 |
| Remote Similarity | 0.5679 | NPC582908 |
| Remote Similarity | 0.5676 | NPC611696 |
| Remote Similarity | 0.5616 | NPC155631 |
| Remote Similarity | 0.5616 | NPC56298 |
| Remote Similarity | 0.5616 | NPC512868 |
| Remote Similarity | 0.5616 | NPC604390 |
| Remote Similarity | 0.5556 | NPC560104 |
| Remote Similarity | 0.5455 | NPC487424 |
| Remote Similarity | 0.5455 | NPC606748 |
| Remote Similarity | 0.5405 | NPC38701 |
| Remote Similarity | 0.5405 | NPC522166 |
| Remote Similarity | 0.5405 | NPC528690 |
| Remote Similarity | 0.5405 | NPC539326 |
| Remote Similarity | 0.5405 | NPC603866 |
| Remote Similarity | 0.5405 | NPC606016 |
| Remote Similarity | 0.5405 | NPC609441 |
| Remote Similarity | 0.527 | NPC605029 |
| Remote Similarity | 0.525 | NPC471628 |
| Remote Similarity | 0.525 | NPC611641 |
| Remote Similarity | 0.5128 | NPC567476 |
| Molecular Weight   | 475.3 |
| ALogP   | -4.6052 |
| MLogP   | 2.45 |
| XLogP   | -2.815 |
| HDA   | 12 |
| HBD   | 8 |
| Rotatable Bonds   | 17 |
| TPSA   | 199.73 |
| RO5 Violation   | 2 |