Natural Product: NPC599805| Natural Product ID | NPC599805 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| VGGGPCQERPFHOB-RDBSUJKOSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL29292 |
| PubChem CID | n.a. |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | VGGGPCQERPFHOB-RDBSUJKOSA-N |
| Standard InCHI | InChI=1S/C16H24N2O4/c1-10(2)8-13(16(21)22)18-15(20)14(19)12(17)9-11-6-4-3-5-7-11/h3-7,10,12-14,19H,8-9,17H2,1-2H3,(H,18,20)(H,21,22)/t12-,13+,14+/m1/s1 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)O |
  Calculated Properties| Molecular Weight:   | 308.17 | Volume:   | 320.708 Van der Waals volume.
|
| Dense:   | 0.961 | LogP:   | -0.184 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 1.058 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -1.359 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 9.0 | Rigid Bonds:   | 8.0 |
| TPSA:   | 112.65 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 6.0 |
| H-Bond Donor:   | 5.0 | Rings:   | 1.0 |
| Heavy Atoms:   | 6.0 |
| QED Drug-Likeness Score:   | 0.559 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.938 | Fsp3:   | 0.5 |
| MCE-18:   | 20.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.529 | Fluc inhibitor:   | 0.004 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.03 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.359 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.007 | Promiscuous compounds:   | 0.024 |
| Caco-2 Permeability:   | -5.828 | MDCK Permeability:   | -4.763 |
| Pgp-inhibitor:   | 0.0 | Pgp-substrate:   | 0.719 |
| PAMPA:   |
0.943 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.003 |
| 20% Bioavailability (F20%):   | 0.141 | 30% Bioavailability (F30%):   | 0.58 |
| 50% Bioavailability (F50%):   | 0.72 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.003 | MRP1:   | 0.172 |
| Plasma Protein Binding (PPB):   | 65.768% | Volume Distribution (VD):   | -0.357 |
| Fu: |
35.001% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.054 |
| OATP1B3 inhibitor:   | 0.774 | BCRP inhibitor:   | 0.0 |
| BSEP inhibitor:   | 0.099 |
| CYP1A2-inhibitor:   | 0.0 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.0 | CYP2C19-substrate:   | 0.0 |
| CYP2C9-inhibitor:   | 0.001 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.66 | CYP2D6-substrate:   | 0.0 |
| CYP3A4-inhibitor:   | 0.0 | CYP3A4-substrate:   | 0.0 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.0 |
| HLM stability:   |
0.0 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 3.759 | Half-life (T1/2):   | 1.815 |
| hERG Blockers:   | 0.143 | hERG Blockers (10um):   | 0.053 |
| Human Hepatotoxicity (H-HT):   | 0.91 | Drug-induced Liver Injury (DILI):   | 0.582 |
| AMES Toxicity:   | 0.083 | Rat Oral Acute Toxicity:   | 0.565 |
| Maximum Recommended Daily Dose:   | 0.767 | Skin Sensitization:   | 0.993 |
| Carcinogencity:   | 0.004 | Eye Corrosion:   | 0.001 |
| Eye Irritation:   | 0.229 | Respiratory Toxicity:   | 0.723 |
| Drug-induced Neurotoxicity:   | 0.775 | Ototoxicity:   | 0.776 |
| Hematotoxicity:   | 0.061 | Drug-induced Nephrotoxicity:   | 0.955 |
| Genotoxicity:   | 0.895 | RPMI-8226 Immunitoxicity:   | 0.069 |
| A549 Cytotoxicity:   | 0.019 | Hek293 Cytotoxicity:   | 0.016 |
| BCF:   |
0.248 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.0 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.308 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
3.483 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO53436 | Streptomyces HCCB10043 | Genus | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18459 | Streptomyces olivoreticuli | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO60815 | Streptomyces olivoreticuli ATCC 31159 | Genus | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO59671 | Streptomyces olivoreticuli MD976-C7 | Genus | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO63310 | Streptomyces sp. HCCB10043 | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18459 | Streptomyces olivoreticuli | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 8199.5 | nM | PubChem BioAssay data set |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | Ki | = | 7800.0 | nM | PMID[3184126] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 54700.0 | nM | PMID[30737134] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 1640.0 | nM | PMID[24755524] |
| NPT1592 | Individual protein | Dipeptidyl peptidase IV | Homo sapiens | IC50 | > | 100.0 | ug.mL-1 | PMID[9464355] |
| NPT234 | Individual protein | C-C chemokine receptor type 2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 4000.0 | nM | PMID[18674901] |
| NPT245 | Individual protein | Dopamine D4 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT233 | Individual protein | Carbonic anhydrase II | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT235 | Individual protein | C-C chemokine receptor type 4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | IC50 | n.a. | n.a. | nM | PMID[15582436] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 34350.0 | nM | PMID[29202398] |
| NPT104 | Individual protein | Cerebroside-sulfatase | Homo sapiens | Potency | n.a. | 849.2 | nM | PubChem BioAssay data set |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[22901392] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3800.0 | nM | PMID[19454370] |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT219 | Individual protein | Alpha-1a adrenergic receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT265 | Individual protein | Muscarinic acetylcholine receptor M4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 2100.0 | nM | PMID[20347318] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 5120.0 | nM | PMID[27322756] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 5870.0 | nM | PMID[21194957] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 4180.0 | nM | PMID[20637634] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | Ki | = | 2100.0 | nM | PMID[28728898] |
| NPT220 | Individual protein | Alpha-1b adrenergic receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 2500.0 | nM | PMID[23860593] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 8900.0 | nM | PMID[22901392] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT286 | Individual protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT221 | Individual protein | Alpha-1d adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT275 | Individual protein | Progesterone receptor | Bos taurus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT278 | Individual protein | Cathepsin G | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT293 | Individual protein | Serotonin 4 (5-HT4) receptor | Cavia porcellus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | = | 20000.0 | nM | PMID[37468498] |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT296 | Individual protein | Sigma opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 266.0 | nM | PMID[32551007] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 40000.0 | nM | PMID[22607877] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3400.0 | nM | PMID[26629857] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3600.0 | nM | PMID[19782572] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT293 | Individual protein | Serotonin 4 (5-HT4) receptor | Cavia porcellus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT221 | Individual protein | Alpha-1d adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT229 | Individual protein | Angiotensin II type 2 (AT-2) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT245 | Individual protein | Dopamine D4 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT266 | Individual protein | Muscarinic acetylcholine receptor M5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT274 | Individual protein | Platelet activating factor receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT266 | Individual protein | Muscarinic acetylcholine receptor M5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT269 | Individual protein | Nitric-oxide synthase, brain | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT269 | Individual protein | Nitric-oxide synthase, brain | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT273 | Individual protein | Phosphodiesterase 5A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT275 | Individual protein | Progesterone receptor | Bos taurus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT289 | Individual protein | Serotonin 1b (5-HT1b) receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 9400.0 | nM | PMID[30737134] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 1300.0 | nM | PMID[23510562] |
| NPT298 | Individual protein | Neurokinin 2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Delta TM | = | 0.15 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT288 | Individual protein | Serotonin 1a (5-HT1a) receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT237 | Individual protein | Interleukin-8 receptor A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT240 | Individual protein | Cytochrome P450 2A6 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | Ki | = | 3500.0 | nM | PMID[24055078] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | Potency | n.a. | 12995.3 | nM | PubChem BioAssay data set |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 10100.0 | nM | PMID[28065501] |
| NPT294 | Individual protein | Serotonin 6 (5-HT6) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT260 | Individual protein | Melanocortin receptor 5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 8100.0 | nM | PMID[22607877] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | Inhibition | = | 85.0 | % | PMID[12930151] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3800.0 | nM | PMID[19969464] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | Delta Tm | = | 5.1 | degrees C | PMID[27651294] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 2100.0 | nM | PMID[18524593] |
| NPT1432 | Individual protein | Serine/threonine-protein kinase Aurora-A | Homo sapiens | Delta TM | = | -0.07 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | Ki | = | 2370.0 | nM | PMID[31251594] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 4000.0 | nM | DOI[10.1016/S0960-894X(01)80464-9] |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 300.0 | nM | PMID[27651294] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT287 | Individual protein | Leukocyte common antigen | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2729 | Individual protein | Tyrosine-protein kinase ABL | Homo sapiens | Delta TM | = | -0.05 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 54700.0 | nM | PMID[29859750] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | Kd | = | 2050.0 | nM | PMID[27651294] |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[26386821] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT253 | Individual protein | HMG-CoA reductase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT265 | Individual protein | Muscarinic acetylcholine receptor M4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT279 | Individual protein | Leukocyte elastase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT182 | Individual protein | Protein kinase C alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT284 | Individual protein | Serine/threonine protein phosphatase 2B catalytic subunit, alpha isoform | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT274 | Individual protein | Platelet activating factor receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT255 | Individual protein | Leukotriene C4 synthase | Cavia porcellus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3400.0 | nM | PMID[23453219] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 19400.0 | nM | DOI[10.1016/S0960-894X(01)80519-9] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT296 | Individual protein | Sigma opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 5580.0 | nM | PMID[23860593] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT283 | Individual protein | MAP kinase p38 alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 2400.0 | nM | PMID[17433673] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1240 | Individual protein | Solute carrier family 15 member 1 | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[8531138] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | Ki | = | 320.0 | nM | PMID[27651294] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | Kd | = | 4630.0 | nM | PMID[27651294] |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT229 | Individual protein | Angiotensin II type 2 (AT-2) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT240 | Individual protein | Cytochrome P450 2A6 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[26386821] |
| NPT1592 | Individual protein | Dipeptidyl peptidase IV | Homo sapiens | IC50 | > | 100.0 | ug.mL-1 | PMID[10098663] |
| NPT1592 | Individual protein | Dipeptidyl peptidase IV | Homo sapiens | IC50 | > | 324300.0 | nM | PMID[10098663] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3640.0 | nM | PMID[34917257] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT257 | Individual protein | Arachidonate 15-lipoxygenase | Oryctolagus cuniculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | Inhibition | = | 77.6 | % | PMID[28803047] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 800.0 | nM | PMID[28803047] |
| NPT260 | Individual protein | Melanocortin receptor 5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT279 | Individual protein | Leukocyte elastase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT255 | Individual protein | Leukotriene C4 synthase | Cavia porcellus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT257 | Individual protein | Arachidonate 15-lipoxygenase | Oryctolagus cuniculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3100.0 | nM | PMID[19299146] |
| NPT287 | Individual protein | Leukocyte common antigen | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 5550.0 | nM | PMID[21911297] |
| NPT219 | Individual protein | Alpha-1a adrenergic receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | Ki | = | 0.5 | nM | PMID[22796349] |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3000.0 | nM | PMID[19423354] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 40000.0 | nM | PMID[23528299] |
| NPT1240 | Individual protein | Solute carrier family 15 member 1 | Rattus norvegicus | Ki | = | 1500000.0 | nM | PMID[11007306] |
| NPT1241 | Individual protein | Oligopeptide transporter, kidney isoform | Rattus norvegicus | Ki | = | 18000.0 | nM | PMID[11007306] |
| NPT1240 | Individual protein | Solute carrier family 15 member 1 | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[9190878] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 29670.0 | nM | PMID[23510562] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | Ki | = | 3730.0 | nM | PMID[22901392] |
| NPT1237 | Individual protein | Oligopeptide transporter small intestine isoform | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[20190787] |
| NPT1037 | Individual protein | Solute carrier family 15 member 2 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[20190787] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 5.0 | nM | PMID[3897541] |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT276 | Individual protein | Angiotensin-converting enzyme | Oryctolagus cuniculus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 8100.0 | nM | PMID[23528299] |
| NPT297 | Individual protein | Neurokinin 1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT298 | Individual protein | Neurokinin 2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 2400.0 | nM | PMID[19683842] |
| NPT253 | Individual protein | HMG-CoA reductase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT278 | Individual protein | Cathepsin G | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT273 | Individual protein | Phosphodiesterase 5A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1584 | Individual protein | Cytosol aminopeptidase | Sus scrofa | IC50 | = | 5200.0 | nM | PMID[27624521] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 13100.0 | nM | PMID[19329328] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 16000.0 | nM | PMID[24900417] |
| NPT234 | Individual protein | C-C chemokine receptor type 2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 20120.0 | nM | PMID[23453219] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 40650.0 | nM | PMID[27670098] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 17340.0 | nM | PMID[27670098] |
| NPT256 | Individual protein | Cysteinyl leukotriene receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT284 | Individual protein | Serine/threonine protein phosphatase 2B catalytic subunit, alpha isoform | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT289 | Individual protein | Serotonin 1b (5-HT1b) receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2816 | Individual protein | Bromodomain-containing protein 4 | Homo sapiens | Delta TM | = | -0.66 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 2450.0 | nM | PMID[29202398] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3700.0 | nM | PMID[27670098] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 20120.0 | nM | PMID[26629857] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 9400.0 | nM | PMID[29859750] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT286 | Individual protein | Receptor protein-tyrosine kinase erbB-2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 2700.0 | nM | PMID[17070058] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT288 | Individual protein | Serotonin 1a (5-HT1a) receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 9400.0 | nM | PMID[32791404] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1371 | Individual protein | Cyclin-dependent kinase 2 | Homo sapiens | Delta TM | = | 1.32 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 2400.0 | nM | PMID[20129718] |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 16270.0 | nM | PMID[29202398] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 14900.0 | nM | PMID[29630364] |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT301 | Individual protein | Vascular endothelial growth factor receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2719 | Individual protein | Voltage-gated L-type calcium channel alpha-1C subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 6900.0 | nM | PMID[26386821] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 18010.0 | nM | PMID[28065501] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT220 | Individual protein | Alpha-1b adrenergic receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT233 | Individual protein | Carbonic anhydrase II | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT236 | Individual protein | C-C chemokine receptor type 5 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT297 | Individual protein | Neurokinin 1 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 35500.0 | nM | PMID[30737134] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 17290.0 | nM | PMID[27322756] |
| NPT256 | Individual protein | Cysteinyl leukotriene receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT276 | Individual protein | Angiotensin-converting enzyme | Oryctolagus cuniculus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT14 | Individual protein | Tyrosine-protein kinase FYN | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT3266 | Individual protein | Casein kinase I delta | Homo sapiens | Delta TM | = | 0.13 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 4200.0 | nM | PMID[23220644] |
| NPT237 | Individual protein | Interleukin-8 receptor A | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT241 | Individual protein | Cytochrome P450 2E1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[31126854] |
| NPT3227 | Individual protein | Fibroblast growth factor receptor 3 | Homo sapiens | Delta TM | = | 0.78 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | Inhibition | <= | 48.6 | % | PMID[36450011] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | > | 100.0 | ug.mL-1 | PMID[10098663] |
| NPT1584 | Individual protein | Cytosol aminopeptidase | Sus scrofa | IC50 | = | 11200.0 | nM | PMID[27624521] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 13100.0 | nM | PMID[19339187] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | Delta Tm | = | 5.2 | degrees C | PMID[27651294] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3172 | Individual protein | Phospholipase A2 group IIA | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[23220644] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3100.0 | nM | PMID[18996018] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | > | 471600.0 | nM | PMID[10098663] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 9100.0 | nM | PMID[24900417] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1241 | Individual protein | Oligopeptide transporter, kidney isoform | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[8639691] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT235 | Individual protein | C-C chemokine receptor type 4 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT236 | Individual protein | C-C chemokine receptor type 5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT241 | Individual protein | Cytochrome P450 2E1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | Kd | = | 5150.0 | nM | PMID[27651294] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 3900.0 | nM | PMID[15582436] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT13 | Individual protein | Tyrosine-protein kinase LCK | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2520 | Individual protein | Leukotriene A4 hydrolase | Homo sapiens | IC50 | = | 500.0 | nM | PMID[21292493] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[21292493] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 0.81 | ug.mL-1 | PMID[9464355] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 35500.0 | nM | PMID[29859750] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 3700.0 | nM | PMID[21802307] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 22890.0 | nM | PMID[21802307] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 2700.0 | nM | PMID[12873488] |
| NPT1553 | Individual protein | Aminopeptidase N | Sus scrofa | IC50 | = | 8500.0 | nM | PMID[18571419] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2761 | Individual protein | Phosphodiesterase 4A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2553 | Individual protein | Aminopeptidase N | Homo sapiens | IC50 | = | 29670.0 | nM | PMID[21911297] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5897 | Individual protein | Cystinyl aminopeptidase | Rattus norvegicus | Ki | = | 4400.0 | nM | PMID[2566685] |
| NPT3968 | Individual protein | Leucine aminopeptidase | Homo sapiens | Ki | = | 0.6 | nM | PMID[12801228] |
| NPT479 | Individual protein | Aminopeptidase B | Rattus norvegicus | Ki | = | 60.0 | nM | PMID[3184126] |
| NPT5897 | Individual protein | Cystinyl aminopeptidase | Rattus norvegicus | Ki | = | 20.0 | nM | PMID[2566685] |
| NPT3968 | Individual protein | Leucine aminopeptidase | Homo sapiens | Ki | = | 20.0 | nM | PMID[3184126] |
| NPT479 | Individual protein | Aminopeptidase B | Rattus norvegicus | Ki | = | 14.0 | nM | PMID[2566685] |
| NPT28363 | Single protein | Interleukin-1 receptor antagonist protein | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[35833347] |
| NPT5927 | Individual protein | Aminopeptidase B | Homo sapiens | IC50 | = | 160000.0 | nM | PMID[27096037] |
| NPT479 | Individual protein | Aminopeptidase B | Rattus norvegicus | IC50 | = | 0.05 | ug.mL-1 | PMID[850237] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 31.8 | % | PMID[22541068] |
| NPT3968 | Individual protein | Leucine aminopeptidase | Homo sapiens | IC50 | = | 11200.0 | nM | PMID[15582436] |
| NPT50 | Individual protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT803 | Individual protein | Flap endonuclease 1 | Homo sapiens | Potency | n.a. | 8436.8 | nM | PubChem BioAssay data set |
| NPT479 | Individual protein | Aminopeptidase B | Rattus norvegicus | IC50 | = | 6000.0 | nM | PMID[1347791] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT68 | Individual protein | Aldose reductase | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT4852 | Individual protein | Puromycin-sensitive aminopeptidase | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[28803047] |
| NPT5924 | Individual protein | Cytosol aminopeptidase | Bos taurus | IC50 | = | 0.5 | nM | PMID[21292493] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 17.76 | % | Identification of inhibitors of SARS-Cov2 M-Pro enzymatic activity using a small molecule repurposing screen |
| NPT69 | Individual protein | Matrix metalloproteinase-1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT98 | Individual protein | HERG | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT5924 | Individual protein | Cytosol aminopeptidase | Bos taurus | Ki | = | 500.0 | nM | PMID[22796349] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 0.45 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT69 | Individual protein | Matrix metalloproteinase-1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29498 | Single protein | Interleukin-8 receptor B | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 11.61 | % | Identification of inhibitors of SARS-Cov2 M-Pro enzymatic activity using a small molecule repurposing screen |
| NPT68 | Individual protein | Aldose reductase | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT29498 | Single protein | Interleukin-8 receptor B | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 10.9 | % | PMID[22541068] |
| NPT98 | Individual protein | HERG | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT3903 | Individual protein | Endoplasmic reticulum aminopeptidase 2 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[35833347] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 20.76 | % | Identification of inhibitors of SARS-Cov2 M-Pro enzymatic activity using a small molecule repurposing screen |
| NPT3903 | Individual protein | Endoplasmic reticulum aminopeptidase 2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[33359953] |
| NPT4015 | Individual protein | Matrix metalloproteinase 14 | Homo sapiens | IC50 | n.a. | n.a. | nM | PMID[15582436] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 2.33 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Delta TM | = | 0.33 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT5921 | Individual protein | Zinc aminopeptidase | Plasmodium falciparum FcB1/Columbia | Ki | = | 190.0 | nM | PMID[21366301] |
| NPT5921 | Individual protein | Zinc aminopeptidase | Plasmodium falciparum FcB1/Columbia | IC50 | = | 284.0 | nM | PMID[12873488] |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | Inhibition | = | 20.7 | % | PMID[22541068] |
| NPT478 | Individual protein | Ataxin-2 | Homo sapiens | Potency | n.a. | 398.1 | nM | PubChem BioAssay data set |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30010 | Single protein | Calcitonin receptor | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 162000.0 | nM | PMID[19454370] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 156000.0 | nM | PMID[23528299] |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT29442 | Protein complex group | Glycine receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28550 | Single protein | Vasoactive intestinal polypeptide receptor 1 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30010 | Single protein | Calcitonin receptor | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28398 | Single protein | Insulin receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 9500.0 | nM | PMID[18571419] |
| NPT5920 | Individual protein | Bacterial leucyl aminopeptidase | Vibrio proteolyticus | Ki | = | 1.6 | nM | PMID[24055078] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | n.a. | n.a. | nM | PMID[15582436] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 253200.0 | nM | PMID[19969464] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 40500.0 | nM | PMID[19339187] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 162000.0 | nM | PMID[18996018] |
| NPT5922 | Individual protein | Aminopeptidase B | Mus musculus | IC50 | = | 6000.0 | nM | DOI[10.1016/S0960-894X(01)80519-9] |
| NPT3904 | Individual protein | Endoplasmic reticulum aminopeptidase 1 | Homo sapiens | IC50 | = | 50000.0 | nM | PMID[27437077] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 162000.0 | nM | PMID[19782572] |
| NPT62 | Individual protein | 6-phospho-1-fructokinase | Trypanosoma brucei | Potency | n.a. | 8492.1 | nM | PubChem BioAssay data set |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 156000.0 | nM | PMID[22607877] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 163480.0 | nM | PMID[21911297] |
| NPT29442 | Protein complex group | Glycine receptor | Rattus norvegicus | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[24755524] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 156980.0 | nM | PMID[20637634] |
| NPT4744 | Individual protein | M17 leucyl aminopeptidase | Plasmodium falciparum 3D7 | Inhibition | = | 93.0 | % | PMID[18458130] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 21960.0 | nM | PMID[18467109] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[26386821] |
| NPT5925 | Individual protein | Aminopeptidase N | Mus musculus | Ki | = | 3030.0 | nM | PMID[24900417] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 3400.0 | nM | PMID[17433673] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 40500.0 | nM | PMID[19329328] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT5923 | Individual protein | Aminopeptidase N | Rattus norvegicus | IC50 | = | 19400.0 | nM | PMID[1347791] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[26386821] |
| NPT28550 | Single protein | Vasoactive intestinal polypeptide receptor 1 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT3904 | Individual protein | Endoplasmic reticulum aminopeptidase 1 | Homo sapiens | IC50 | = | 45000.0 | nM | PMID[35833347] |
| NPT28927 | Single protein | Peregrin | Homo sapiens | Delta TM | = | -2.93 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT24040 | Single protein | Transcription intermediary factor 1-alpha | Homo sapiens | Delta TM | = | -0.82 | C | Tm Shift (DSF) assay results for EUbOPEN Chemogenomics Library |
| NPT4744 | Individual protein | M17 leucyl aminopeptidase | Plasmodium falciparum 3D7 | Inhibition | = | 33.0 | % | PMID[18458130] |
| NPT4744 | Individual protein | M17 leucyl aminopeptidase | Plasmodium falciparum 3D7 | Inhibition | = | 98.0 | % | PMID[18458130] |
| NPT5925 | Individual protein | Aminopeptidase N | Mus musculus | IC50 | = | 23200.0 | nM | PMID[24900417] |
| NPT4744 | Individual protein | M17 leucyl aminopeptidase | Plasmodium falciparum 3D7 | Inhibition | = | 6.0 | % | PMID[18458130] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 276000.0 | nM | PMID[24900417] |
| NPT4744 | Individual protein | M17 leucyl aminopeptidase | Plasmodium falciparum 3D7 | Inhibition | = | 47.0 | % | PMID[18458130] |
| NPT28398 | Single protein | Insulin receptor | Rattus norvegicus | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | IC50 | = | 120400.0 | nM | PMID[21802307] |
| NPT670 | Individual protein | Thrombin | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1357 | Cell line | H22 | Mus musculus | TGI | = | 45.37 | % | PMID[20129718] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[29202398] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1650000.0 | nM | PMID[19423354] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29202398] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[31126854] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[29859750] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1650000.0 | nM | PMID[18996018] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[23664876] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[24900417] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 245000.0 | nM | PMID[22206607] |
| NPT1357 | Cell line | H22 | Mus musculus | Activity | = | 60.25 | % | PMID[19683842] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1130000.0 | nM | PMID[20637634] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[29202398] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Ratio IC50 | = | 1.83 | n.a. | PMID[28065501] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 0.0 | % | PMID[29202398] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 3.59 | % | PMID[29202398] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 245000.0 | nM | PMID[19683842] |
| NPT196 | Cell line | AGS | Homo sapiens | IC50 | > | 200000.0 | nM | PMID[34917257] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[30737134] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT519 | Cell line | SH-SY5Y | Homo sapiens | Potency | n.a. | 398.1 | nM | PubChem BioAssay data set |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 7.1 | % | PMID[27670098] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 8590000.0 | nM | PMID[20637634] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[30737134] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 753180.0 | nM | PMID[21911297] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 920000.0 | nM | PMID[19299146] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT1357 | Cell line | H22 | Mus musculus | Inhibition | = | 75.9 | % | PMID[26629857] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 13.0 | % | PMID[29202398] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[32791404] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | IC50 | = | 22810.0 | nM | PMID[29202398] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[32791404] |
| NPT2711 | Cell line | BALB/3T3 | Mus musculus | GI | = | 37.7 | % | PMID[27624521] |
| NPT461 | Cell line | PANC-1 | Homo sapiens | Activity | > | 10.0 | % | PMID[20347318] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29202398] |
| NPT737 | Cell line | HUVEC | Homo sapiens | IC50 | > | 2000000.0 | nM | PMID[30737134] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[30737134] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 5080000.0 | nM | PMID[21802307] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 357610.0 | nM | PMID[29202398] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.55 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[22901392] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 33.3 | % | PMID[29202398] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 64.3 | % | PMID[29202398] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.42 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[32791404] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 142630.0 | nM | PMID[27670098] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 399400.0 | nM | PMID[22901392] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 135600.0 | nM | PMID[22901392] |
| NPT2015 | Cell line | U-266 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29202398] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[32791404] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 0.01 | % | PMID[29202398] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 512900.0 | nM | PMID[22901392] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 86400.0 | nM | PMID[22901392] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 2.14 | % | PMID[22901392] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[27253989] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 3.4 | % | PMID[27253989] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI | = | 63.8 | % | PMID[27624521] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 7.03 | % | PMID[22901392] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 2.38 | % | PMID[29202398] |
| NPT2015 | Cell line | U-266 | Homo sapiens | IC50 | = | 43480.0 | nM | PMID[29202398] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.94 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT737 | Cell line | HUVEC | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[23528299] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.49 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT2015 | Cell line | U-266 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[22901392] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 154900.0 | nM | PMID[22901392] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | Activity | > | 10.0 | % | PMID[20347318] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 315250.0 | nM | PMID[27322756] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[23453219] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[34917257] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 7.5 | % | PMID[27253989] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 50600.0 | nM | PMID[22901392] |
| NPT165 | Cell line | HeLa | Homo sapiens | Inhibition | = | 28.0 | % | PMID[28803047] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[32791404] |
| NPT1357 | Cell line | H22 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[30737134] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 541000.0 | nM | PMID[27253989] |
| NPT2678 | Cell line | NB-4 | Homo sapiens | IC50 | = | 220900.0 | nM | PMID[22901392] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 15.06 | % | PMID[22901392] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.89 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[30737134] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 11.0 | % | PMID[27670098] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[27322756] |
| NPT2341 | Cell line | NCI-H1975 | Homo sapiens | IC50 | > | 200000.0 | nM | PMID[34917257] |
| NPT116 | Cell line | HL-60 | Homo sapiens | EC50 | > | 100000.0 | nM | PMID[28803047] |
| NPT1357 | Cell line | H22 | Mus musculus | Activity | = | 64.0 | % | PMID[29859750] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.14 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 416650.0 | nM | PMID[27322756] |
| NPT4611 | Cell line | PLC-PRF-5 | Homo sapiens | Activity | = | 83.4 | % | PMID[29202398] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[22901392] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 200000.0 | nM | PMID[34917257] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[23176597] |
| NPT737 | Cell line | HUVEC | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[23428964] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | EC50 | > | 100000.0 | nM | PMID[28803047] |
| NPT1045 | Cell line | U2OS | Homo sapiens | Growth Rate | = | 0.82 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[22901392] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 8.54 | % | PMID[22901392] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 15930.0 | nM | PMID[29202398] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 44060.0 | nM | PMID[29202398] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29202398] |
| NPT886 | Cell line | NIH3T3 | Mus musculus | IC50 | > | 1000000.0 | nM | PMID[22901392] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 149600.0 | nM | PMID[27624521] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 9560.0 | nM | PMID[29202398] |
| NPT466 | Cell line | U-937 | Homo sapiens | IC50 | = | 142630.0 | nM | PMID[29202398] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT114 | Cell line | LoVo | Homo sapiens | GI | = | 54.8 | % | PMID[27624521] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | = | 77.91 | % | PMID[22901392] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.59 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 14520.0 | nM | PMID[29202398] |
| NPT5420 | Cell line | MCF10 | Homo sapiens | GI | = | 26.9 | % | PMID[27624521] |
| NPT81 | Cell line | A549 | Homo sapiens | GI | = | 48.0 | % | PMID[27624521] |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.98 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT2615 | Cell line | HEK-293T | Homo sapiens | Growth Rate | = | 0.92 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[27624521] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 50600.0 | nM | PMID[23510562] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 1340000.0 | nM | PMID[21802307] |
| NPT1357 | Cell line | H22 | Mus musculus | Inhibition | = | 45.37 | % | PMID[22206607] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 920000.0 | nM | PMID[19782572] |
| NPT466 | Cell line | U-937 | Homo sapiens | Cytotoxicity | > | 40.0 | % | PMID[12930151] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[17895246] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | n.a. | n.a. | n.a. | DrugMatrix in vitro pharmacology data |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | Screening of ~5500 FDA-approved drugs and clinical candidates for anti-SARS-CoV-2 activity |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | < | 160.0 | nM | PMID[28728898] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.12 | % | Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 7000.0 | nM | PMID[21396812] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | = | 1.2 | % | PMID[28728898] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | < | 310.0 | nM | PMID[28728898] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 50.0 | % | PMID[28728898] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | > | 500000.0 | nM | PMID[30737134] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[30737134] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 21000.0 | nM | PMID[28728898] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 29.0 | % | PMID[18458130] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 5100.0 | nM | PMID[17088482] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 3200.0 | nM | PMID[21366301] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.11 | % | Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 0.01 | ug.mL-1 | PMID[850237] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 29000.0 | nM | PMID[12873488] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 17580.0 | nM | PMID[29202398] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | > | 200000.0 | nM | PMID[20180535] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 478.0 | nM | PMID[33534577] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | Screening of ~5500 FDA-approved drugs and clinical candidates for anti-SARS-CoV-2 activity |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 5000.0 | nM | PMID[33534577] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 478.0 | nM | PMID[23176597] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 8.0 | nM | PMID[23176597] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 1800.0 | nM | PMID[17895246] |
| NPT24972 | Cell line | 3LL cell line | Mus musculus | Inhibition | = | 50.0 | % | PMID[24900417] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | > | 500000.0 | nM | PMID[29202398] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Activity | n.a. | n.a. | n.a. | PMID[17895246] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (malignant tumour) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 300.0 | nM | PMID[1347791] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (acute) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 37050.0 | nM | PMID[29202398] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Hit score | = | 0.1422 | n.a. | Identification of potential treatments for COVID-19 through artificial intelligence-enabled phenomic analysis of human cells infected with SARS-CoV-2 |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 1530.0 | nM | PMID[31251594] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 900.0 | nM | PMID[17895246] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 3300.0 | nM | PMID[28728898] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio Ki | > | 13.1 | n.a. | PMID[28728898] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | n.a. | n.a. | % | PMID[24900417] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 170.0 | nM | PMID[3184127] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 25.0 | nM | PMID[33534577] |
| NPT30075 | Cell line | KG-1 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27670098] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition index | = | 0.01222 | n.a. | In vitro screening of a FDA approved chemical library reveals potential inhibitors of SARS-CoV-2 replication |
| NPT28833 | No target | No relevant target | n.a. | Rf | = | 0.48 | n.a. | PMID[850237] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (comment) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Activity | = | 36.0 | % | PMID[28728898] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 1673.0 | nM | PMID[33534577] |
| NPT28833 | No target | No relevant target | n.a. | solubility | n.a. | n.a. | n.a. | PMID[19618939] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 1.6 | nM | PMID[33534577] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 0.71 | n.a. | PMID[17433673] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | n.a. | n.a. | n.a. | PMID[17088482] |
| NPT27870 | Cell line | HL60/MX2 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[27624521] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | n.a. | n.a. | n.a. | PMID[27624521] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio | = | 0.1 | n.a. | PMID[12873488] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 30.2 | n.a. | PMID[24900417] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.08 | % | Cytopathic SARS-Cov2 screening on VERO-E6 cells in a large repurposing effort |
| NPT28438 | Unchecked | Unchecked | n.a. | GI | = | 26.9 | % | PMID[27624521] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 15500.0 | nM | PMID[18467109] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 7000.0 | nM | PMID[30544037] |
| NPT30075 | Cell line | KG-1 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[27322756] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | n.a. | n.a. | % | PMID[30537832] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 1.62 | % | Identification of inhibitors of SARS-CoV-2 in-vitro cellular toxicity in human (Caco-2) cells using a large scale drug repurposing collection |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 478.2 | nM | PMID[33534577] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 623000.0 | nM | PMID[33534577] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 14870.0 | nM | PMID[33534577] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 97.0 | % | PMID[18458130] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 4410.0 | nM | PMID[21396812] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 42.6 | n.a. | PMID[19454370] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 32.5 | n.a. | PMID[21802307] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 1.6 | nM | PMID[21292493] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 25000.0 | nM | PMID[21396812] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (successful reintroduction) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (association with vascular disease) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (cytolytic) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (cirrhosis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (steatosis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (choleostasis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (chronic liver disease) | = | 0.0 | n.a. | PMID[15646539] |
| NPT28438 | Unchecked | Unchecked | n.a. | Hepatotoxicity (severe hepatitis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 332000.0 | nM | PMID[21194957] |
| NPT28895 | Protein family | Histone deacetylase 1/3/5/8 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[23860593] |
| NPT23300 | Cell line | PLC | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[30737134] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 36.2 | % | PMID[20129718] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 490000.0 | nM | PMID[22607877] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | n.a. | n.a. | % | PMID[22607877] |
| NPT177 | Tissue | Aorta | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[23528299] |
| NPT23300 | Cell line | PLC | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[29859750] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (mechanism) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 89510.0 | nM | PMID[28065501] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 620000.0 | nM | PMID[23453219] |
| NPT28895 | Protein family | Histone deacetylase 1/3/5/8 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[23453219] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 42540.0 | nM | PMID[28065501] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 631740.0 | nM | PMID[23510562] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 141890.0 | nM | PMID[21911297] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | n.a. | n.a. | n.a. | PMID[23528299] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 350000.0 | nM | PMID[23528299] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | n.a. | n.a. | n.a. | PMID[24900417] |
| NPT27866 | Cell line | B16-BL6 | Mus musculus | Inhibition | = | 50.0 | % | PMID[24900417] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (acute) | = | 0.0 | % | PMID[15646539] |
| NPT177 | Tissue | Aorta | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[27322756] |
| NPT173 | Organism | Klebsiella pneumoniae | Klebsiella pneumoniae | Inhibition | = | 12.45 | % | CO-ADD screening of NIH (USA) - Clinical Collection |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 74500.0 | nM | PMID[22901392] |
| NPT30138 | Protein family | Histone deacetylase | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[24755524] |
| NPT28797 | Organism | Cryptococcus neoformans | Cryptococcus neoformans | Inhibition | = | -0.18 | % | CO-ADD screening of NIH (USA) - Clinical Collection |
| NPT20 | Organism | Candida albicans | Candida albicans | Inhibition | = | 0.73 | % | CO-ADD screening of NIH (USA) - Clinical Collection |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 100.0 | ug.mL-1 | PMID[10098663] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 77820.0 | nM | PMID[28065501] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | n.a. | n.a. | % | PMID[26629857] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (animal toxicity known) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (benign tumour) | = | 0.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 2.4 | % | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (granulomatous hepatitis) | = | 0.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (moderate) | = | 1.0 | n.a. | PMID[15646539] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Hepatotoxicity (time to onset) | n.a. | n.a. | n.a. | PMID[15646539] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Inhibition | = | 8.9 | % | CO-ADD screening of NIH (USA) - Clinical Collection |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | 0.83 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT27732 | Protein-protein interaction | Plasminogen/Urokinase plasminogen activator surface receptor/Urokinase-type plasminogen activator | Mus musculus | Potency | n.a. | 16481.6 | nM | PubChem BioAssay data set |
| NPT20950 | Cell line | Erythrocyte | n.a. | Activity | n.a. | n.a. | n.a. | PMID[28728898] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | 0.91 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT2847 | Tissue | Thoracic aorta | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[29859750] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | -0.85 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT19 | Organism | Escherichia coli | Escherichia coli | GI | n.a. | n.a. | n.a. | PMID[30544037] |
| NPT29444 | Cell line | Fibroblast | Homo sapiens | Growth Rate | = | 0.72 | n.a. | EUbOPEN Chemogenomics Library - IncuCyte |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | Inhibition | = | 8.82 | % | CO-ADD screening of NIH (USA) - Clinical Collection |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Inhibition | = | -1.57 | % | CO-ADD screening of NIH (USA) - Clinical Collection |
| NPT2847 | Tissue | Thoracic aorta | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[30737134] |
| NPT30043 | Cell line | Vero | Chlorocebus sabaeus | CC50 | >= | 25000.0 | nM | PMID[28803047] |
| NPT747 | Organism | Acinetobacter baumannii | Acinetobacter baumannii | Inhibition | = | 16.7 | % | CO-ADD screening of NIH (USA) - Clinical Collection |
| NPT28345 | Cell line | ES-2 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[32791404] |
| NPT28638 | Cell line | Neutrophil | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[31751136] |
| NPT28544 | Protein family | Histone deacetylase (HDAC1 and HDAC2) | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[26629857] |
| NPT28544 | Protein family | Histone deacetylase (HDAC1 and HDAC2) | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[26386821] |
| NPT2849 | Organism | Plasmodium chabaudi | Plasmodium chabaudi | Activity | = | 34.0 | % | PMID[33534577] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | Change | = | 59.0 | % | PMID[1347791] |
| NPT32 | Organism | Mus musculus | Mus musculus | Change | = | 3.0 | % | PMID[1347791] |
| NPT32 | Organism | Mus musculus | Mus musculus | Change | = | -3.0 | % | PMID[1347791] |
| NPT32 | Organism | Mus musculus | Mus musculus | Change | = | 11.0 | % | PMID[1347791] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[28218840] |
| NPT32 | Organism | Mus musculus | Mus musculus | Change | = | 41.0 | % | PMID[1347791] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | n.a. | n.a. | % | PMID[28218840] |
| NPT32 | Organism | Mus musculus | Mus musculus | Change | = | 26.0 | % | PMID[1347791] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 387700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 1.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5820000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 36.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 61000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 94.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 140.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 57000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 60300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 310.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 99.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.0 | /100WBC | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 58000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 10.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1556.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 847.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.18 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 31330000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 17.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.1 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.71 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 87.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1144330.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 76.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 146.95 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5780000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 304.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 105.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 142.5 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 89.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 143.9 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Tissue Severity Score | n.a. | n.a. | n.a. | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 16100.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 14170.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 48.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 157.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 785.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 29330000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 58500.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 8.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 143.5 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 498.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 112.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.33 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1252670.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.53 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.17 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | VRT | = | 13.09 | hr2 | PMID[29202398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 177.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 85.83 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 390000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 13.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 61.53 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 110.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 143300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 58.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.61 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1655.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 163.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 105.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 144.27 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 122.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 23670000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 237.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 12244.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 403700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.6 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 401700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 61.37 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 141000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 168.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 13654.17 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 139700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 89.83 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.05 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.83 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 50.83 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 165.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 103.5 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.1 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 36.13 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 760.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 140700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 334.17 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 35.73 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 62200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 18.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 34.83 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 92.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 14.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 43000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 289.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5560000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.8 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5720000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 463.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 5.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.63 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1690.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 381.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.42 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1618.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 15830.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1223.17 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5700000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 15170.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 2.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 26500000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.2 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.55 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 91.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 8.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 118.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 121.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 55.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 92.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 272.17 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 82.17 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1430.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 88.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 13954.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 228.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 25670000.0 | nM | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 350.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 800.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 102.33 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 93.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 41800.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 53.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 100.0 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 475.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 612.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 12.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 308.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1463.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 150.27 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 156.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 35.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 42200.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 395300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1281170.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.17 | /100WBC | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 140300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 88.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 583.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 144.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 40000.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 277.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.13 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 15.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 391700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 13.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 15131.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 54.33 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.4 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 345.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 6.78 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 99.83 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 15800.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 1.17 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 155.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1312170.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 13539.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 2116.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 487.5 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 121.8 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 59.53 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.67 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5870000.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.9 | pg | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 633.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 60.93 | fL | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 244.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.0 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 28.67 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.6 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 96.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1420.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 129700.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 166.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 41300.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 2.0 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.67 | U.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 623.3 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1187670.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1976.7 | ug.mL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 86.33 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 108.67 | mEq.L-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 12669.0 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 1191.33 | cells.uL-1 | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 12.0 | % | DrugMatrix |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1238330.0 | cells.uL-1 | DrugMatrix |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Rattus norvegicus | Plasma | Drug metabolism | n.a. | n.a. | n.a. | PMID[29202398] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC599805 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC599805 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
