NPASS Compound

Natural Product: NPC485607

Natural Product ID	NPC485607
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	XMLLJGHZPHTUKK-ZOODYHDESA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44584213
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 94100 0 0 0 0 0 0 0 0999 V2000 9.2209 0.1889 -1.5893 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1007 1.1731 -1.8388 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8208 1.9068 -0.5539 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0122 0.9524 0.3337 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6439 0.6967 -0.2260 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1733 -0.7151 -0.0448 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2366 -1.5955 0.5899 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0368 -0.6225 0.9025 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1060 0.8289 1.3872 C 0 0 2 0 0 0 0 0 0 0 0 0 2.6457 1.2585 1.5954 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8851 -0.0082 1.4269 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4459 0.1538 1.0127 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3326 0.7035 2.1817 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6832 0.1355 2.3420 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2930 -0.6234 1.4690 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6377 -1.1556 1.6938 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3720 -1.2714 0.3865 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6185 -1.9670 -0.6934 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1644 -2.1712 -0.4555 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5655 -0.9509 0.2165 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.7525 0.2201 -0.7386 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1456 -1.1503 0.6278 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6730 -1.9594 -0.3354 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1173 -2.0146 0.0667 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6648 -0.6560 0.2793 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5592 0.1584 -0.9606 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6984 0.0326 -0.0110 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0780 0.2001 0.0467 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4976 1.3529 0.9143 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6720 2.0307 0.2208 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6044 1.0295 -0.4165 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8702 0.0588 -1.2842 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3919 0.0010 -2.6931 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2066 1.2361 -3.2834 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5195 0.3736 -1.2830 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3414 0.3226 0.5208 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1509 2.8396 -0.7812 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8585 0.8840 2.1662 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7310 1.5366 0.3954 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6774 0.9794 -1.6472 N 0 0 0 0 0 0 0 0 0 0 0 0 6.8533 0.4687 -2.2979 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8467 -0.8218 -1.3567 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8231 0.0847 -2.5303 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8597 0.6112 -0.7813 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4261 1.8536 -2.6529 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7634 2.1290 -0.0154 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2993 2.8683 -0.6982 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9476 1.4586 1.3338 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6277 0.0664 0.4716 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8593 -1.2198 -0.9655 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7227 -2.5835 0.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5321 -1.2354 1.5968 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0720 -1.8184 -0.0761 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0533 -1.3330 1.7302 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6153 0.8579 2.3588 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5089 1.6108 2.6489 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3554 2.0872 0.9496 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9773 -0.6063 2.3412 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4070 0.9498 0.2340 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3312 1.8132 2.2012 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2318 0.4064 3.1127 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1971 0.3822 3.2747 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2541 -0.5209 2.3704 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5283 -2.1892 2.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3321 -1.8132 0.6408 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8548 -1.5037 -1.6965 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0750 -2.9981 -0.7948 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9669 -3.1033 0.0804 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6617 -2.2455 -1.4541 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8076 0.4704 -1.2904 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1764 1.0989 -0.2128 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4697 -0.0263 -1.5613 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1797 -1.7671 1.5769 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5141 -1.6863 -1.3990 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2872 -3.0205 -0.2573 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6841 -2.5016 -0.7594 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2296 -2.6689 0.9510 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2060 -0.3267 -1.7372 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5377 0.0747 -1.3537 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7790 1.2284 -0.8479 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5968 -0.7356 0.3929 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6489 2.0538 0.9914 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2248 2.5942 0.9938 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3058 1.6026 -1.0524 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9460 -0.9881 -0.8697 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4632 -0.2406 -2.7130 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8537 -0.8048 -3.2269 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6524 1.0929 -4.1040 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8936 -0.3247 0.0332 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7584 3.6245 -0.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2254 1.2444 2.8388 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4714 1.9603 -1.8729 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9212 -0.6192 -2.1487 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6948 0.6161 -3.3974 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 30 37 1 0 29 38 1 0 9 39 1 0 5 40 1 0 40 41 1 0 41 2 1 0 5 39 1 1 25 8 1 0 35 28 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 42 1 0 1 43 1 0 1 44 1 0 2 45 1 6 3 46 1 0 3 47 1 0 4 48 1 0 4 49 1 0 6 50 1 6 7 51 1 0 7 52 1 0 7 53 1 0 8 54 1 1 9 55 1 1 10 56 1 0 10 57 1 0 11 58 1 1 12 59 1 6 13 60 1 0 13 61 1 0 14 62 1 0 16 63 1 0 16 64 1 0 17 65 1 1 18 66 1 0 18 67 1 0 19 68 1 0 19 69 1 0 21 70 1 0 21 71 1 0 21 72 1 0 22 73 1 1 23 74 1 0 23 75 1 0 24 76 1 0 24 77 1 0 26 78 1 0 26 79 1 0 26 80 1 0 28 81 1 1 29 82 1 1 30 83 1 1 31 84 1 6 32 85 1 1 33 86 1 0 33 87 1 0 34 88 1 0 36 89 1 0 37 90 1 0 38 91 1 0 40 92 1 0 41 93 1 0 41 94 1 0 M END

Standard InCHIKey	XMLLJGHZPHTUKK-ZOODYHDESA-N
Standard InCHI	InChI=1S/C33H53NO7/c1-17-7-12-33(34-15-17)18(2)26-24(41-33)14-23-21-6-5-19-13-20(8-10-31(19,3)22(21)9-11-32(23,26)4)39-30-29(38)28(37)27(36)25(16-35)40-30/h5,17-18,20-30,34-38H,6-16H2,1-4H3/t17-,18+,20+,21-,22+,23+,24+,25-,26+,27-,28+,29-,30-,31+,32+,33+/m1/s1
SMILES	C[C@@H]1CC[C@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O2)NC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	575.38	Volume:	589.321 ? Van der Waals volume.
Dense:	0.976	LogP:	3.552 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.891 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.7 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	3.0	Rigid Bonds:	36.0
TPSA:	120.64 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	5.0	Rings:	7.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.326	GASA:	0.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.836	Fsp³:	0.939
MCE-18:	167.75 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.894	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.005	Promiscuous compounds:	0.016

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.702	MDCK Permeability:	-5.151
Pgp-inhibitor:	0.001	Pgp-substrate:	0.126
PAMPA:	0.537 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.007	30% Bioavailability (F30%):	0.488
50% Bioavailability (F50%):	0.989

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.853	MRP1:	0.189
Plasma Protein Binding (PPB):	68.608%	Volume Distribution (VD):	-0.269
Fu:	31.281% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.594
BSEP inhibitor:	0.363

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.021	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.002
CYP3A4-inhibitor:	0.982	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.902
HLM stability:	0.227 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.628

Half-life (T1/2):

1.577

ADMET: Toxicity

hERG Blockers:	0.125	hERG Blockers (10um):	0.285
Human Hepatotoxicity (H-HT):	0.517	Drug-induced Liver Injury (DILI):	0.802
AMES Toxicity:	0.834	Rat Oral Acute Toxicity:	0.17
Maximum Recommended Daily Dose:	0.454	Skin Sensitization:	0.999
Carcinogencity:	0.49	Eye Corrosion:	0.0
Eye Irritation:	0.008	Respiratory Toxicity:	0.247
Drug-induced Neurotoxicity:	0.021	Ototoxicity:	0.91
Hematotoxicity:	0.23	Drug-induced Nephrotoxicity:	0.546
Genotoxicity:	0.203	RPMI-8226 Immunitoxicity:	0.153
A549 Cytotoxicity:	0.875	Hek293 Cytotoxicity:	0.809
BCF:	2.175 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.62 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.749 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.296 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40349	Solanum umbelliferum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[8882430]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC485607 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22286
0.1-0.2	23442
0.2-0.3	3377
0.3-0.4	610
0.4-0.5	89
0.5-0.6	36
0.6-0.7	10
0.7-0.8	1
0.8-0.85	4
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8353	Intermediate Similarity	NPC15249
0.8353	Intermediate Similarity	NPC25455
0.8022	Intermediate Similarity	NPC150057
0.8022	Intermediate Similarity	NPC147753
0.7609	Intermediate Similarity	NPC122819
0.7	Intermediate Similarity	NPC485606
0.6796	Remote Similarity	NPC287885
0.675	Remote Similarity	NPC147835
0.675	Remote Similarity	NPC253645
0.675	Remote Similarity	NPC85001
0.675	Remote Similarity	NPC95920
0.6477	Remote Similarity	NPC296686
0.6333	Remote Similarity	NPC181845
0.6	Remote Similarity	NPC22140
0.6	Remote Similarity	NPC243728
0.6	Remote Similarity	NPC158088
0.5862	Remote Similarity	NPC282669
0.5816	Remote Similarity	NPC295980
0.5673	Remote Similarity	NPC6806
0.5577	Remote Similarity	NPC477809
0.5534	Remote Similarity	NPC98696
0.549	Remote Similarity	NPC14704
0.5446	Remote Similarity	NPC470432
0.5446	Remote Similarity	NPC230507
0.5446	Remote Similarity	NPC94272
0.534	Remote Similarity	NPC305423
0.534	Remote Similarity	NPC113044
0.534	Remote Similarity	NPC283829
0.534	Remote Similarity	NPC161676
0.5321	Remote Similarity	NPC475550
0.5278	Remote Similarity	NPC73243
0.5278	Remote Similarity	NPC244086
0.5278	Remote Similarity	NPC84956
0.5278	Remote Similarity	NPC102016
0.5278	Remote Similarity	NPC95051
0.5234	Remote Similarity	NPC300557
0.5185	Remote Similarity	NPC480555
0.5185	Remote Similarity	NPC150372
0.5182	Remote Similarity	NPC247037
0.5149	Remote Similarity	NPC297058
0.5104	Remote Similarity	NPC486114
0.5102	Remote Similarity	NPC272015
0.5088	Remote Similarity	NPC477811
0.5059	Remote Similarity	NPC155985
0.5059	Remote Similarity	NPC601115
0.5057	Remote Similarity	NPC207617
0.5057	Remote Similarity	NPC607440
0.5056	Remote Similarity	NPC473890
0.5047	Remote Similarity	NPC602423
0.5044	Remote Similarity	NPC218571
0.5044	Remote Similarity	NPC487615
0.5044	Remote Similarity	NPC249265

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC485607 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7231
0.1-0.2	1796
0.2-0.3	108
0.3-0.4	12
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8022	Intermediate Similarity	NPD8450	Suspended
0.7609	Intermediate Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data