Natural Product: NPC331654| Natural Product ID | NPC331654 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| FBOZXECLQNJBKD-ZDUSSCGKSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | n.a. |
| PubChem CID |
126941 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | FBOZXECLQNJBKD-ZDUSSCGKSA-N |
| Standard InCHI | InChI=1S/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/t13-/m0/s1 |
| SMILES | CN(Cc1cnc2c(c(N)[nH]c(=N)n2)n1)c1ccc(cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
  Calculated Properties| Molecular Weight:   | 454.17 | Volume:   | 431.731 Van der Waals volume.
|
| Dense:   | 1.052 | LogP:   | -1.62 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 0.752 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -4.439 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 10.0 | Rigid Bonds:   | 21.0 |
| TPSA:   | 211.27 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 13.0 |
| H-Bond Donor:   | 7.0 | Rings:   | 3.0 |
| Heavy Atoms:   | 13.0 |
| QED Drug-Likeness Score:   | 0.256 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 3.425 | Fsp3:   | 0.25 |
| MCE-18:   | 42.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Accepted |
| Pfizer Rule:   | Rejected | GSK Rule:   | Accepted |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.059 | Fluc inhibitor:   | 0.539 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.945 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.695 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.013 | Promiscuous compounds:   | 0.185 |
| Caco-2 Permeability:   | -5.958 | MDCK Permeability:   | -5.338 |
| Pgp-inhibitor:   | 0.0 | Pgp-substrate:   | 0.959 |
| PAMPA:   |
1.0 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.0 |
| 20% Bioavailability (F20%):   | 0.0 | 30% Bioavailability (F30%):   | 0.001 |
| 50% Bioavailability (F50%):   | 0.001 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.0 | MRP1:   | 0.993 |
| Plasma Protein Binding (PPB):   | 73.533% | Volume Distribution (VD):   | -0.47 |
| Fu: |
27.939% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.017 |
| OATP1B3 inhibitor:   | 0.91 | BCRP inhibitor:   | 0.0 |
| BSEP inhibitor:   | 0.001 |
| CYP1A2-inhibitor:   | 0.0 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.0 | CYP2C19-substrate:   | 0.0 |
| CYP2C9-inhibitor:   | 0.005 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.0 |
| CYP3A4-inhibitor:   | 0.0 | CYP3A4-substrate:   | 0.0 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.0 |
| HLM stability:   |
0.0 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 2.255 | Half-life (T1/2):   | 2.139 |
| hERG Blockers:   | 0.168 | hERG Blockers (10um):   | 0.106 |
| Human Hepatotoxicity (H-HT):   | 0.997 | Drug-induced Liver Injury (DILI):   | 0.993 |
| AMES Toxicity:   | 0.107 | Rat Oral Acute Toxicity:   | 0.85 |
| Maximum Recommended Daily Dose:   | 0.987 | Skin Sensitization:   | 0.96 |
| Carcinogencity:   | 0.428 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.002 | Respiratory Toxicity:   | 0.91 |
| Drug-induced Neurotoxicity:   | 0.462 | Ototoxicity:   | 0.967 |
| Hematotoxicity:   | 0.579 | Drug-induced Nephrotoxicity:   | 0.998 |
| Genotoxicity:   | 1.0 | RPMI-8226 Immunitoxicity:   | 0.698 |
| A549 Cytotoxicity:   | 0.052 | Hek293 Cytotoxicity:   | 0.902 |
| BCF:   |
-0.144 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
2.743 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.076 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
3.411 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[11087592] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[15730242] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | bark | n.a. |
PMID[1593281] |
| NPO40501 | Usnea longissima | Species | Parmeliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27186821] |
| NPO40313 | Quambalaria cyanescens | Species | Quambalariaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27571379] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30028612] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[8676130] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8946743] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40501 | Usnea longissima | Species | Parmeliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40313 | Quambalaria cyanescens | Species | Quambalariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7697 | Asimina triloba | Species | Annonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 0.82 | nM | PMID[8691451] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.2 | nM | PMID[6403710] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 66.0 | nM | PMID[11384244] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | = | 3600.0 | nM | PMID[11384244] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 26.0 | nM | PMID[7365749] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.00519 | nM | PMID[9857098] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 100000.0 | nM | PMID[3091834] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[2918496] |
| NPT2819 | Individual protein | Dihydrofolate reductase | Leishmania major | Ki | = | 0.1288 | nM | PMID[3599028] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.0012 | nM | PMID[7877140] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.11 | nM | PMID[7877140] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 3.9 | nM | PMID[1992121] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 24.0 | nM | PMID[1992122] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 190000.0 | nM | PMID[4009615] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[12408727] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[12570380] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 4.3 | nM | PMID[2738891] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.18 | nM | PMID[8568827] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.4 | nM | PMID[8568827] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 0.72 | nM | PMID[8568827] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 0.6 | nM | PMID[8568827] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 30.0 | nM | PMID[2296020] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 0.0012 | ug.mL-1 | PMID[2423690] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 25.0 | nM | PMID[1992118] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 24.0 | nM | PMID[1995880] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[11960504] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 2.0 | nM | PMID[11052790] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 75000.0 | nM | PMID[7108907] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 120000.0 | nM | PMID[3184124] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 2.7 | nM | PMID[1578484] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 3.8 | nM | PMID[3339615] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 2.7 | nM | PMID[3091832] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | = | 120000.0 | nM | PMID[3091832] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 170000.0 | nM | PMID[3091832] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[10956221] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 4.3 | nM | PMID[2704031] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 600000.0 | nM | PMID[3100797] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.038 | nM | PMID[10360757] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.179 | nM | PMID[10360757] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 720.0 | nM | PMID[8568828] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Inhibition | = | 0.0000000012 | % | PMID[6699882] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | Inhibition | = | 0.00015 | % | PMID[6699882] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | Inhibition | = | 0.00008 | % | PMID[6699882] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 86000.0 | nM | PMID[3121855] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 11.2 | nM | PMID[8035423] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 4.0 | nM | PMID[8164259] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | = | 170000.0 | nM | PMID[8164259] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 38.0 | nM | PMID[8691474] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 14.5 | nM | PMID[11052789] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 40000.0 | nM | PMID[6772788] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 7.9 | nM | PMID[6772788] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 40.0 | nM | PMID[7562910] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 0.7 | nM | PMID[7562910] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | = | 170000.0 | nM | PMID[7562910] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[16078850] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[16451071] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 9.0 | nM | PMID[15615522] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[15615538] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[16279780] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | = | 29000.0 | nM | PMID[16279780] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[17552508] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[17569517] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 35.0 | nM | PMID[17127067] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 9.0 | nM | PMID[17127067] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[18072727] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.0 | nM | PMID[18205293] |
| NPT2755 | Individual protein | Protein-arginine deiminase type-4 | Homo sapiens | IC50 | > | 10000000.0 | nM | PMID[17964793] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 4420.0 | nM | PMID[17532099] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[18800768] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 32.94 | nM | PMID[18555562] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | = | 29000.0 | nM | PMID[18605720] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[18605720] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[19719239] |
| NPT2621 | Individual protein | Pteridine reductase 1 | Leishmania major | Ki | = | 39.0 | nM | PMID[19916554] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.077 | nM | PMID[19748785] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[20056546] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | = | 29000.0 | nM | PMID[20056546] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 80.0 | nM | PMID[20350811] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[20092323] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | IC50 | > | 18000.0 | nM | PMID[21550809] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[21550809] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[22739090] |
| NPT1739 | Individual protein | Canalicular multispecific organic anion transporter 2 | Rattus norvegicus | Ki | = | 90000.0 | nM | PMID[11837698] |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | Activity | = | 82.0 | % | PMID[9188796] |
| NPT2850 | Individual protein | Multidrug resistance associated protein | Homo sapiens | Activity | < | 10.0 | % | PMID[12388190] |
| NPT1739 | Individual protein | Canalicular multispecific organic anion transporter 2 | Rattus norvegicus | Activity | = | 10.7 | % | PMID[10329726] |
| NPT1739 | Individual protein | Canalicular multispecific organic anion transporter 2 | Rattus norvegicus | Activity | = | 18.5 | % | PMID[10329726] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | Activity | = | 39.0 | % | PMID[12883481] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | Activity | = | 40.3 | % | PMID[11447229] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | Activity | = | 53.0 | % | PMID[14643890] |
| NPT2850 | Individual protein | Multidrug resistance associated protein | Homo sapiens | Ki | = | 1200000.0 | nM | PMID[11837698] |
| NPT304 | Individual protein | Canalicular multispecific organic anion transporter 1 | Rattus norvegicus | Ki | = | 236000.0 | nM | PMID[9270020] |
| NPT304 | Individual protein | Canalicular multispecific organic anion transporter 1 | Rattus norvegicus | Ki | = | 326000.0 | nM | PMID[9270020] |
| NPT304 | Individual protein | Canalicular multispecific organic anion transporter 1 | Rattus norvegicus | Ki | = | 462000.0 | nM | PMID[11465411] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC80 | = | 1.44 | uM | PMID[22734697] |
| NPT2621 | Individual protein | Pteridine reductase 1 | Leishmania major | Ki | = | 180.0 | nM | PMID[22946585] |
| NPT2926 | Individual protein | Thymidylate synthase | Homo sapiens | Ki | = | 600.0 | nM | PMID[22946585] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.00034 | nM | PMID[22946585] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.7 | nM | PMID[23627352] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Inhibition | = | 86.0 | % | PMID[23665106] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 2.1 | nM | PMID[23665106] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | <= | 0.004 | nM | PMID[24428639] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 3.0 | nM | DOI[10.1039/C3MD00013C] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.5 | nM | PMID[110934] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | = | 100000.0 | nM | PMID[109616] |
| NPT2924 | Individual protein | Thymidylate synthase | Lactobacillus casei | IC50 | > | 100000.0 | nM | PMID[409842] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[26670841] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.6 | nM | PMID[26617968] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 7.9 | nM | PMID[26994844] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[26979156] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.0034 | nM | PMID[27437079] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 4.6 | nM | PMID[27994750] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Inhibition | = | 89.7 | % | PMID[27886545] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Inhibition | = | 86.4 | % | PMID[27886545] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 6.67 | nM | PMID[27886545] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 30.9 | nM | PMID[28152430] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 22.0 | nM | PMID[28258797] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 7.9 | nM | PMID[28177228] |
| NPT1249 | Individual protein | Canalicular multispecific organic anion transporter 2 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Ki | = | 0.01 | nM | PMID[28477572] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 7.1 | nM | PMID[29274493] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 35.0 | nM | PMID[29691154] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 24.99 | nM | PMID[31200235] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[31447082] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 4.74 | nM | PMID[30624926] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | FC | = | 1.0 | n.a. | PMID[27397500] |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | FC | = | 1.0 | n.a. | PMID[27397500] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 1.97 | nM | PMID[30827867] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 6.0 | nM | PMID[32503687] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[32503687] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 83.0 | nM | PMID[32676149] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | Inhibition | = | 91.0 | % | PMID[32676149] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 5.0 | nM | PMID[33187806] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 3.0 | nM | PMID[33187806] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1647 | Individual protein | Vasopressin V2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 61.0 | nM | PMID[35964425] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2719 | Individual protein | Voltage-gated L-type calcium channel alpha-1C subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT2818 | Individual protein | Dihydrofolate reductase | Homo sapiens | IC50 | = | 88.0 | nM | PMID[37054758] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1814 | Individual protein | Glucagon receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | ID50 | = | 6.2 | nM | PMID[6811744] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | ID50 | = | 16.0 | nM | PMID[6811744] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.3 | nM | PMID[7490723] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | Ki | = | 0.008 | nM | PMID[7490723] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | ID50 | = | 11.0 | nM | PMID[6139480] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 8.0 | nM | PMID[6403710] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 4400.0 | nM | PMID[11384244] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 880.0 | nM | PMID[7490723] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 16.0 | nM | PMID[2447278] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 26.0 | nM | PMID[2447278] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 15.0 | nM | PMID[2447278] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | Ki | = | 0.004 | nM | PMID[6438320] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 10.0 | nM | PMID[3091834] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 1.3 | nM | PMID[8201595] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Ki | = | 0.021 | nM | PMID[3973902] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 6.0 | nM | PMID[12408727] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.1 | nM | PMID[12408727] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 22.0 | nM | PMID[12570380] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 7.0 | nM | PMID[12570380] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | ID50 | = | 0.021 | uM | PMID[6787199] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 0.0016 | ug.mL-1 | PMID[2423690] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 9.0 | nM | PMID[11960504] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 10.0 | nM | PMID[3712374] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 12.0 | nM | PMID[7108907] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 16.0 | nM | PMID[3184124] |
| NPT19413 | Single protein | GAR transformylase | Mus musculus | IC50 | > | 20000.0 | nM | PMID[3184124] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | < | 1.0 | nM | PMID[15081026] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.0 | nM | PMID[9089339] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 0.023 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 2.3 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 3.2 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 0.096 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 140.0 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 84.0 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 31.0 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 1700.0 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Kd | = | 1100.0 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Ki | = | 330.0 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Ki | = | 2400.0 | nM | PMID[3275776] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Ki | = | 170000.0 | nM | PMID[3275776] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 8.5 | nM | PMID[3091832] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 11.0 | nM | PMID[10956221] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 9.0 | nM | PMID[10956221] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 8.0 | nM | PMID[3100797] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | Inhibition | = | 0.00000001 | % | PMID[6699882] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.3 | nM | PMID[9301666] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 16.0 | nM | PMID[3121855] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 6.0 | nM | PMID[8164259] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.0 | nM | PMID[8164259] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.3 | nM | PMID[8691474] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 2.2 | nM | PMID[8691474] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 2.2 | nM | PMID[8691474] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 55.0 | nM | PMID[8691474] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 0.0000000000033 | ug.mL-1 | PMID[6793726] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.0 | nM | PMID[7783147] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.0 | nM | PMID[9554874] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 44.0 | nM | PMID[11052789] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 6.0 | nM | PMID[11052789] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 13.8 | nM | PMID[11052789] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 9.6 | nM | PMID[6772788] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 6.0 | nM | PMID[7562910] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 7.0 | nM | PMID[16078850] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 22.0 | nM | PMID[16078850] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 3.0 | nM | PMID[17125251] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 32.0 | nM | PMID[15615522] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 7.0 | nM | PMID[15615538] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 22.0 | nM | PMID[15615538] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 6.6 | nM | PMID[16279780] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 6.0 | nM | PMID[17569517] |
| NPT613 | Individual protein | Solute carrier family 22 member 1 | Homo sapiens | Inhibition | = | 26.3 | % | PMID[18788725] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 8.8 | nM | PMID[18800768] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 6.6 | nM | PMID[18605720] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 8.8 | nM | PMID[19719239] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 6.6 | nM | PMID[20056546] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 6.6 | nM | PMID[20092323] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 5.0 | nM | PMID[20580561] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 4.4 | nM | PMID[21550809] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | IC50 | = | 8.8 | nM | PMID[22739090] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 17.2 | % | PMID[22541068] |
| NPT17144 | Single protein | Dihydrofolate reductase | Pneumocystis carinii | IC50 | = | 1.3 | nM | PMID[23627352] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 3.0 | nM | PMID[109616] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 4.5 | nM | PMID[820858] |
| NPT27920 | Single protein | Dihydrofolate reductase | Lactobacillus casei | IC50 | = | 3.0 | nM | PMID[409842] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Activity | = | 12.0 | % | PMID[25618019] |
| NPT944 | Individual protein | Glucose transporter | Leishmania mexicana | Inhibition | = | -0.37 | % | DOI[10.6019/CHEMBL3433997] |
| NPT944 | Individual protein | Glucose transporter | Leishmania mexicana | Inhibition | = | 1.34 | % | DOI[10.6019/CHEMBL3433997] |
| NPT944 | Individual protein | Glucose transporter | Leishmania mexicana | Inhibition | = | 3.42 | % | DOI[10.6019/CHEMBL3433997] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[21965623] |
| NPT24902 | Single protein | Dihydrofolate reductase | Escherichia coli | Ki | = | 0.001 | nM | PMID[27437079] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 135000.0 | nM | PMID[20829430] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[22961681] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT30134 | Single protein | Gastric inhibitory polypeptide receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT5318 | Individual protein | Corticotropin releasing factor receptor 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28473 | Single protein | Serine hydroxymethyltransferase, cytosolic | Homo sapiens | Ki | > | 200000.0 | nM | PMID[37582241] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | ID50 | = | 2.7 | nM | PMID[6811744] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | ID50 | = | 2.0 | nM | PMID[6139480] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | ID50 | = | 9.0 | nM | PMID[6139480] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | ID50 | = | 32.0 | nM | PMID[6139480] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 35.0 | nM | PMID[2428979] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 6.6 | nM | PMID[8201595] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.006 | nM | PMID[2299633] |
| NPT3791 | Individual protein | Thymidylate synthase | Mus musculus | Ki | = | 45000.0 | nM | PMID[7086836] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 25.0 | nM | PMID[2898531] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 35.0 | nM | PMID[2871191] |
| NPT24900 | Single protein | Folylpoly-gamma-glutamate synthetase | Mus musculus | Ki | = | 166000.0 | nM | PMID[2871191] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.006 | nM | PMID[4020824] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00581 | nM | PMID[4020824] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | ID50 | = | 0.0068 | uM | PMID[6787199] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.0056 | nM | PMID[2296020] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 3900.0 | nM | PMID[2296020] |
| NPT4519 | Individual protein | Folate transporter 1 | Homo sapiens | Ki | = | 3500.0 | nM | PMID[10821704] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.0043 | nM | PMID[7057425] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00548 | nM | PMID[2423690] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00000000562 | nM | PMID[3373490] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 25.0 | nM | PMID[1995880] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.0032 | nM | PMID[7143361] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 2.0 | nM | PMID[11052790] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 2.5 | nM | PMID[12877583] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | ID50 | = | 0.05 | uM | PMID[6546949] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00442 | nM | PMID[3712374] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.006 | nM | PMID[7108907] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00545 | nM | PMID[3184124] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00575 | nM | PMID[8340923] |
| NPT3791 | Individual protein | Thymidylate synthase | Mus musculus | IC50 | = | 20000.0 | nM | PMID[3339615] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00482 | nM | PMID[8277497] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 73.0 | nM | PMID[8863812] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.006 | nM | PMID[1732549] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 3.0 | nM | PMID[9089339] |
| NPT3791 | Individual protein | Thymidylate synthase | Mus musculus | IC50 | = | 20000.0 | nM | PMID[2704031] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 25.0 | nM | PMID[3385730] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 50.0 | nM | PMID[6737432] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 20.0 | nM | PMID[3462394] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 2.5 | nM | PMID[9301666] |
| NPT476 | Individual protein | AICAR transformylase | Homo sapiens | IC50 | > | 20000.0 | nM | PMID[3121855] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 3.0 | nM | PMID[8164259] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 2.5 | nM | PMID[8691474] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 4.6 | nM | PMID[3968685] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 45.0 | nM | PMID[3968685] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00482 | nM | PMID[1501226] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 3.0 | nM | PMID[7783147] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.00528 | nM | PMID[1732551] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 3.0 | nM | PMID[9554874] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | IC50 | = | 25.0 | nM | PMID[3112397] |
| NPT4519 | Individual protein | Folate transporter 1 | Homo sapiens | Inhibition | = | 60.0 | % | PMID[18680275] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Activity | = | 130.0 | % | PMID[18457386] |
| NPT25183 | Single protein | Dihydrofolate reductase | Mus musculus | Ki | = | 0.003 | nM | PMID[19748785] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | Ki | = | 0.073 | nM | PMID[19748785] |
| NPT957 | Individual protein | Multidrug resistance-associated protein 7 | Homo sapiens | Activity | = | 74.0 | % | PMID[12527806] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 27.4 | % | PMID[22541068] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | = | 2.5 | nM | PMID[23627352] |
| NPT27633 | Single protein | Dihydrofolate reductase | Rattus norvegicus | IC50 | < | 1.0 | nM | PMID[850245] |
| NPT4519 | Individual protein | Folate transporter 1 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[25234128] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | FC | = | -0.2 | n.a. | PMID[21051535] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT5133 | Individual protein | High mobility group protein B1 | Homo sapiens | Kd | = | 24.0 | nM | PMID[29268019] |
| NPT5133 | Individual protein | High mobility group protein B1 | Homo sapiens | Kd | = | 500.0 | nM | PMID[29268019] |
| NPT4519 | Individual protein | Folate transporter 1 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[29425443] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 16.96 | % | DOI[10.6019/CHEMBL4495564] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -4.284 | % | DOI[10.6019/CHEMBL4495564] |
| NPT476 | Individual protein | AICAR transformylase | Homo sapiens | Ki | = | 880.0 | nM | PMID[33773393] |
| NPT19433 | Single protein | Methionine synthase | Homo sapiens | IC50 | = | 0.0 | nM | PMID[32058237] |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT476 | Individual protein | AICAR transformylase | Homo sapiens | Ki | > | 200000.0 | nM | PMID[37582241] |
| NPT4729 | Individual protein | Cholecystokinin B receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3735 | Individual protein | Neurotensin receptor 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3952 | Individual protein | Endothelin receptor ET-B | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT26536 | Single protein | Thymidylate synthase | Escherichia coli | IC50 | = | 1800.0 | nM | PMID[11384244] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 7943282.35 | nM | PMID[2404122] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 1.7 | nM | PMID[4009615] |
| NPT6232 | Individual protein | Dihydrofolate reductase | Gallus gallus | IC50 | = | 90.0 | nM | PMID[7069726] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 3.3 | nM | PMID[6585550] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | ID50 | = | 0.0000000048 | M | PMID[6948961] |
| NPT6232 | Individual protein | Dihydrofolate reductase | Gallus gallus | IC50 | = | 19.0 | nM | PMID[3712374] |
| NPT19416 | Single protein | GAR transformylase | Homo sapiens | IC50 | > | 20000.0 | nM | PMID[3121855] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 10.8 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 12.1 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 9.9 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 69.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 58.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 63.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 57.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 42.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 36.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 46.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 40.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 72.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 66.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 59.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 50.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 62.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 61.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 49.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 45.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 60.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 52.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 53.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 43.0 | ug.mL-1 | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 100.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 18.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 19.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 17.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 29.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 26.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 28.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 25.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 16.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 21.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 20.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 27.0 | n.a. | PMID[2810330] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | Ratio | = | 23.0 | n.a. | PMID[2810330] |
| NPT26536 | Single protein | Thymidylate synthase | Escherichia coli | IC50 | = | 90000.0 | nM | PMID[16279780] |
| NPT26536 | Single protein | Thymidylate synthase | Escherichia coli | IC50 | = | 90000.0 | nM | PMID[18605720] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 80.0 | nM | PMID[20350811] |
| NPT6065 | Individual protein | Dihydrofolate reductase | Bacillus anthracis | IC50 | = | 15.0 | nM | PMID[19364848] |
| NPT6065 | Individual protein | Dihydrofolate reductase | Bacillus anthracis | IC50 | = | 12.2 | nM | PMID[19364848] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 3.4 | nM | PMID[20036565] |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | Inhibition | = | -13.4 | % | PMID[22541068] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 80.0 | nM | PMID[23454532] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 80.0 | nM | PMID[23792351] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 80.0 | nM | PMID[24469112] |
| NPT17155 | Single protein | Dihydrofolate reductase | Staphylococcus aureus | Ki | <= | 0.004 | nM | PMID[24428639] |
| NPT19428 | Single protein | Dihydrofolate reductase | Enterococcus faecium | IC50 | = | 1.4 | nM | PMID[850245] |
| NPT19430 | Single protein | Proton-coupled folate transporter | Homo sapiens | IC50 | = | 120.5 | nM | PMID[25234128] |
| NPT28272 | Single protein | Folate receptor alpha | Homo sapiens | IC50 | = | 461.0 | nM | PMID[25234128] |
| NPT28272 | Single protein | Folate receptor alpha | Homo sapiens | IC50 | = | 114.0 | nM | PMID[25234128] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 8.0 | nM | PMID[25139568] |
| NPT943 | Individual protein | Hexose transporter 1 | Plasmodium falciparum | Inhibition | = | 2.33 | % | DOI[10.6019/CHEMBL3433997] |
| NPT943 | Individual protein | Hexose transporter 1 | Plasmodium falciparum | Inhibition | = | 2.91 | % | DOI[10.6019/CHEMBL3433997] |
| NPT943 | Individual protein | Hexose transporter 1 | Plasmodium falciparum | Inhibition | = | 0.06 | % | DOI[10.6019/CHEMBL3433997] |
| NPT712 | Individual protein | Bile salt export pump | Rattus norvegicus | IC50 | > | 1000000.0 | nM | PMID[21965623] |
| NPT6551 | Individual protein | Dihydrofolate reductase | Mycobacterium tuberculosis | IC50 | = | 8.25 | nM | PMID[26617968] |
| NPT17155 | Single protein | Dihydrofolate reductase | Staphylococcus aureus | Ki | = | 1.0 | nM | PMID[27437079] |
| NPT6236 | Individual protein | Dihydrofolate reductase | Bos taurus | IC50 | = | 8.0 | nM | PMID[27554444] |
| NPT6551 | Individual protein | Dihydrofolate reductase | Mycobacterium tuberculosis | IC50 | = | 35.0 | nM | PMID[29274493] |
| NPT26779 | Single protein | Dihydrofolate reductase | Plasmodium falciparum K1 | IC50 | = | 84.0 | nM | PMID[29111368] |
| NPT28272 | Single protein | Folate receptor alpha | Homo sapiens | IC50 | = | 114.0 | nM | PMID[29425443] |
| NPT28272 | Single protein | Folate receptor alpha | Homo sapiens | IC50 | = | 216.0 | nM | PMID[29425443] |
| NPT19430 | Single protein | Proton-coupled folate transporter | Homo sapiens | IC50 | = | 121.0 | nM | PMID[29425443] |
| NPT6551 | Individual protein | Dihydrofolate reductase | Mycobacterium tuberculosis | IC50 | = | 8.8 | nM | PMID[30827867] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | -7.834 | % | PMID[38318365] |
| NPT17155 | Single protein | Dihydrofolate reductase | Staphylococcus aureus | IC50 | = | 360.0 | nM | PMID[37360390] |
| NPT6127 | Individual protein | Bradykinin B1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT25297 | Single protein | Toll-like receptor 4 | Homo sapiens | IC50 | = | 1040.0 | nM | PMID[34390826] |
| NPT19416 | Single protein | GAR transformylase | Homo sapiens | Ki | > | 150000.0 | nM | PMID[37582241] |
| NPT17155 | Single protein | Dihydrofolate reductase | Staphylococcus aureus | IC50 | = | 190.0 | nM | PMID[38107183] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28448 | Single protein | Corticotropin releasing factor receptor 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT25297 | Single protein | Toll-like receptor 4 | Homo sapiens | IC50 | = | 1040.0 | nM | PMID[38070351] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28787 | Single protein | Voltage-gated N-type calcium channel alpha-1B subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 1100.0 | nM | PMID[11384244] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 22.0 | nM | PMID[12408727] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 11.0 | nM | PMID[11960504] |
| NPT24901 | Single protein | Folylpoly-gamma-glutamate synthetase | Homo sapiens | IC50 | = | 3200.0 | nM | PMID[8863812] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 14.0 | nM | PMID[9089339] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 22.0 | nM | PMID[10956221] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 1.4 | nM | PMID[9301666] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 14.0 | nM | PMID[8164259] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 14.0 | nM | PMID[8691474] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 22.0 | nM | PMID[8691474] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 14.0 | nM | PMID[7783147] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 14.0 | nM | PMID[9554874] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 22.0 | nM | PMID[11052789] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | Activity | = | 0.33 | n.a. | PMID[17269758] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 14000.0 | nM | PMID[17269758] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 11.0 | nM | PMID[16279780] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 18000.0 | nM | PMID[16279780] |
| NPT661 | Individual protein | Solute carrier family 22 member 6 | Mus musculus | Ki | = | 891250.94 | nM | PMID[17553798] |
| NPT661 | Individual protein | Solute carrier family 22 member 6 | Mus musculus | Ki | = | 901000.0 | nM | PMID[17553798] |
| NPT662 | Individual protein | Solute carrier family 22 member 20 | Mus musculus | Ki | = | 602559.59 | nM | PMID[17553798] |
| NPT662 | Individual protein | Solute carrier family 22 member 20 | Mus musculus | Ki | = | 597000.0 | nM | PMID[17553798] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 33.0 | nM | PMID[18800768] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 18000.0 | nM | PMID[18605720] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 11.0 | nM | PMID[18605720] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 33.0 | nM | PMID[19719239] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 11.0 | nM | PMID[20056546] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 18000.0 | nM | PMID[20056546] |
| NPT19423 | Single protein | Thymidylate synthase (EC 2.1.1.45) (TS) (TSase) | Escherichia coli | IC50 | > | 18000.0 | nM | PMID[21550809] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | > | 18000.0 | nM | PMID[21550809] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 22.0 | nM | PMID[21550809] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 33.0 | nM | PMID[22739090] |
| NPT877 | Individual protein | Solute carrier family 22 member 8 | Mus musculus | Activity | = | 48.4 | % | PMID[14762099] |
| NPT19427 | Single protein | Dihydrofolate reductase | Oryctolagus cuniculus | ID50 | = | 9.0 | 10'-9mol/L | PMID[565818] |
| NPT28271 | Single protein | Folate receptor beta | Homo sapiens | IC50 | = | 211.0 | nM | PMID[25234128] |
| NPT28271 | Single protein | Folate receptor beta | Homo sapiens | IC50 | = | 106.0 | nM | PMID[25234128] |
| NPT942 | Individual protein | Glucose transporter | Homo sapiens | Inhibition | = | 3.29 | % | DOI[10.6019/CHEMBL3433997] |
| NPT942 | Individual protein | Glucose transporter | Homo sapiens | Inhibition | = | 4.83 | % | DOI[10.6019/CHEMBL3433997] |
| NPT942 | Individual protein | Glucose transporter | Homo sapiens | Inhibition | = | 0.58 | % | DOI[10.6019/CHEMBL3433997] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 71.0 | nM | PMID[27994750] |
| NPT28271 | Single protein | Folate receptor beta | Homo sapiens | IC50 | = | 106.0 | nM | PMID[29425443] |
| NPT28271 | Single protein | Folate receptor beta | Homo sapiens | IC50 | = | 211.0 | nM | PMID[29425443] |
| NPT5829 | Individual protein | Dihydrofolate reductase | Toxoplasma gondii | IC50 | = | 78.3 | nM | PMID[30624926] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT29024 | Single protein | Bifunctional dihydrofolate reductase-thymidylate synthase | Trypanosoma cruzi | IC50 | = | 110.0 | nM | PMID[35189560] |
| NPT25143 | Single protein | Serine hydroxymethyltransferase, mitochondrial | Homo sapiens | Ki | = | 98000.0 | nM | PMID[37582241] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT2246 | Cell line | T-cells | n.a. | IC50 | = | 0.0061 | ug.mL-1 | PMID[9379448] |
| NPT4590 | Cell line | EL4 | Mus musculus | IC50 | = | 1570.0 | nM | PMID[9379448] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ED50 | = | 14.5 | nM | PMID[8691451] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 0.84 | nM | PMID[6403710] |
| NPT1317 | Cell line | CCRF S-180 | Mus musculus | IC50 | = | 5.4 | nM | PMID[6403710] |
| NPT1490 | Cell line | Ehrlich | Mus musculus | IC50 | = | 12.6 | nM | PMID[6403710] |
| NPT1948 | Cell line | A253 cell line | n.a. | EC50 | = | 19.0 | nM | PMID[11384244] |
| NPT1216 | Cell line | FaDu | Homo sapiens | EC50 | = | 17.0 | nM | PMID[11384244] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.0 | nM | PMID[11384244] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 600.0 | nM | PMID[11384244] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 1900.0 | nM | PMID[11384244] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 15.0 | nM | PMID[11384244] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | ED50 | = | 2.4 | nM | PMID[7365749] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 200.0 | nM | PMID[2428979] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 29.0 | nM | PMID[9857098] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 39.0 | nM | PMID[9857098] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[9857098] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 28.0 | nM | PMID[9857098] |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | IC50 | = | 33.0 | nM | PMID[9857098] |
| NPT385 | Cell line | SR | Homo sapiens | IC50 | = | 33.0 | nM | PMID[9857098] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 33.0 | nM | PMID[9857098] |
| NPT394 | Cell line | EKVX | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT372 | Cell line | HOP-92 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | IC50 | = | 43.0 | nM | PMID[9857098] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 28.0 | nM | PMID[9857098] |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | IC50 | = | 450.0 | nM | PMID[9857098] |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | IC50 | = | 26.0 | nM | PMID[9857098] |
| NPT375 | Cell line | Malme-3M | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT387 | Cell line | M14 | Homo sapiens | IC50 | = | 32.0 | nM | PMID[9857098] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | IC50 | = | 87.0 | nM | PMID[9857098] |
| NPT403 | Cell line | UACC-257 | Homo sapiens | IC50 | = | 790.0 | nM | PMID[9857098] |
| NPT398 | Cell line | UACC-62 | Homo sapiens | IC50 | = | 28.0 | nM | PMID[9857098] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 65.0 | nM | PMID[9857098] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[9857098] |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | IC50 | = | 980.0 | nM | PMID[9857098] |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | IC50 | = | 31.0 | nM | PMID[9857098] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 870.0 | nM | PMID[9857098] |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | IC50 | = | 110.0 | nM | PMID[9857098] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[9857098] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[9857098] |
| NPT386 | Cell line | KM12 | Homo sapiens | IC50 | = | 33.0 | nM | PMID[9857098] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 52.0 | nM | PMID[9857098] |
| NPT399 | Cell line | SF-295 | Homo sapiens | IC50 | = | 36.0 | nM | PMID[9857098] |
| NPT374 | Cell line | SF-539 | Homo sapiens | IC50 | = | 35.0 | nM | PMID[9857098] |
| NPT380 | Cell line | U-251 | Homo sapiens | IC50 | = | 63.0 | nM | PMID[9857098] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 27.0 | nM | PMID[9857098] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 45.0 | nM | PMID[9857098] |
| NPT401 | Cell line | 786-0 | Homo sapiens | IC50 | = | 33.0 | nM | PMID[9857098] |
| NPT376 | Cell line | A498 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT369 | Cell line | ACHN | Homo sapiens | IC50 | = | 40.0 | nM | PMID[9857098] |
| NPT406 | Cell line | RXF 393 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT384 | Cell line | TK-10 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 36.0 | nM | PMID[9857098] |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | IC50 | = | 78.0 | nM | PMID[9857098] |
| NPT402 | Cell line | Hs-578T | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT457 | Cell line | BT-549 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 12.0 | nM | DOI[10.1016/S0960-894X(96)00486-6] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 48.0 | nM | DOI[10.1016/S0960-894X(96)00486-6] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.5 | nM | PMID[3091834] |
| NPT137 | Cell line | L1210 | Mus musculus | Ki | = | 0.0032 | nM | PMID[3091834] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 9.0 | nM | PMID[2918496] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 18.0 | nM | PMID[6694171] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[6694171] |
| NPT1183 | Cell line | WiDr | Homo sapiens | IC50 | = | 25.0 | nM | PMID[6694171] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 0.1 | pM (10e6*cells)-1 | PMID[1375963] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 1.6 | pM (10e6*cells)-1 | PMID[1375963] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 0.4 | pM (10e6*cells)-1 | PMID[1375963] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 0.3 | pM (10e6*cells)-1 | PMID[1375963] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 0.6 | pM (10e6*cells)-1 | PMID[1375963] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 0.8 | pM (10e6*cells)-1 | PMID[1375963] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 4.1 | pM (10e6*cells)-1 | PMID[1375963] |
| NPT1842 | Cell line | W256 | Rattus norvegicus | ED50 | = | 0.02 | uM | PMID[6928967] |
| NPT1317 | Cell line | CCRF S-180 | Mus musculus | ED50 | = | 0.016 | uM | PMID[6928967] |
| NPT137 | Cell line | L1210 | Mus musculus | ED50 | = | 0.016 | uM | PMID[6928967] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 12.0 | nM | DOI[10.1016/S0960-894X(97)00071-1] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 9.0 | nM | PMID[1992122] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 23.0 | nM | PMID[8201595] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 223.0 | nM | PMID[8201595] |
| NPT730 | Cell line | MC-38 | Mus musculus | IC50 | = | 66.0 | nM | PMID[8201595] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 19.0 | nM | PMID[8201595] |
| NPT2980 | Cell line | Colon 26 | Mus musculus | IC50 | > | 40000.0 | nM | PMID[8201595] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 10.0 | nM | PMID[4009615] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 3.92 | nM | PMID[2299633] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 12.0 | nM | PMID[12408727] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 32.0 | nM | PMID[2898531] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 6600.0 | nM | PMID[2898531] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.6 | nM | PMID[2898531] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 13.7 | nM | PMID[12570380] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.0 | nM | PMID[2871191] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 3.28 | nM | PMID[4020824] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.7 | nM | PMID[4020824] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 5.0 | nM | PMID[2296020] |
| NPT1171 | Cell line | HEp-2 | Homo sapiens | ED50 | = | 0.0024 | uM | PMID[7057425] |
| NPT137 | Cell line | L1210 | Mus musculus | Ki | = | 3500.0 | nM | PMID[7057425] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 4.8 | nM | PMID[8632413] |
| NPT3792 | Cell line | 143B | Homo sapiens | IC50 | = | 8.8 | nM | PMID[8632413] |
| NPT1535 | Cell line | U-87 MG | Homo sapiens | IC50 | = | 22.0 | nM | PMID[8632413] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 31.0 | nM | PMID[8632413] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 9.5 | nM | PMID[8632413] |
| NPT933 | Cell line | U373 MG | Homo sapiens | IC50 | = | 12.0 | nM | PMID[8632413] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | = | 9.2 | nM | PMID[8632413] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.55 | nM | PMID[2423690] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 23.0 | nM | PMID[9022795] |
| NPT2414 | Cell line | SCC-25 | Homo sapiens | IC50 | = | 27.0 | nM | PMID[9022795] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 28.0 | nM | PMID[9022795] |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | IC50 | = | 43.0 | nM | PMID[9022795] |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | IC50 | = | 229.0 | nM | PMID[9022795] |
| NPT394 | Cell line | EKVX | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9022795] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[9022795] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[9022795] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 32.0 | nM | PMID[9022795] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 33.0 | nM | PMID[9022795] |
| NPT386 | Cell line | KM12 | Homo sapiens | IC50 | = | 42.0 | nM | PMID[9022795] |
| NPT374 | Cell line | SF-539 | Homo sapiens | IC50 | = | 35.0 | nM | PMID[9022795] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 52.0 | nM | PMID[9022795] |
| NPT392 | Cell line | SNB-75 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9022795] |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | IC50 | = | 26.0 | nM | PMID[9022795] |
| NPT398 | Cell line | UACC-62 | Homo sapiens | IC50 | = | 28.0 | nM | PMID[9022795] |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | IC50 | = | 87.0 | nM | PMID[9022795] |
| NPT375 | Cell line | Malme-3M | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9022795] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9022795] |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | IC50 | = | 31.0 | nM | PMID[9022795] |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[9022795] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 398.0 | nM | PMID[9022795] |
| NPT401 | Cell line | 786-0 | Homo sapiens | IC50 | = | 33.0 | nM | PMID[9022795] |
| NPT371 | Cell line | UO-31 | Homo sapiens | IC50 | = | 191.0 | nM | PMID[9022795] |
| NPT369 | Cell line | ACHN | Homo sapiens | IC50 | = | 40.0 | nM | PMID[9022795] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 36.0 | nM | PMID[9022795] |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | IC50 | = | 78.0 | nM | PMID[9022795] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 2.0 | nM | PMID[9022795] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 23.0 | nM | PMID[9022795] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.6 | nM | PMID[1992118] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 200000.0 | nM | PMID[1992118] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.5 | nM | PMID[3373490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | ED50 | = | 609.0 | uM | PMID[3373490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | ED50 | < | 0.05 | uM | PMID[3373490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | ED50 | << | 0.05 | uM | PMID[3373490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Inhibition | = | 34.2 | % | PMID[3373490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Inhibition | = | 64.0 | % | PMID[3373490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Inhibition | = | 87.7 | % | PMID[3373490] |
| NPT116 | Cell line | HL-60 | Homo sapiens | ED50 | = | 0.1 | uM | PMID[3373490] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.6 | nM | PMID[1995880] |
| NPT137 | Cell line | L1210 | Mus musculus | MIC50 | = | 2.71 | nM | PMID[7143361] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.5 | nM | PMID[11960504] |
| NPT7275 | Cell line | R1 | Mus musculus | EC50 | = | 1050.0 | nM | PMID[11960504] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 25.0 | nM | PMID[6585550] |
| NPT4777 | Cell line | Epidermoid carcinoma cell line | n.a. | ED50 | = | 0.001 | uM | PMID[6948961] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 0.004 | ug.mL-1 | PMID[11428931] |
| NPT137 | Cell line | L1210 | Mus musculus | MIC50 | = | 2.48 | nM | PMID[3712374] |
| NPT137 | Cell line | L1210 | Mus musculus | Ki | = | 5610.0 | nM | PMID[3712374] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.7 | nM | PMID[7108907] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.1 | nM | PMID[3184124] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 9.5 | nM | PMID[8340923] |
| NPT137 | Cell line | L1210 | Mus musculus | Ki | = | 3930.0 | nM | PMID[8277497] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 9.0 | nM | PMID[8277497] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 8.1 | nM | PMID[8277497] |
| NPT1317 | Cell line | CCRF S-180 | Mus musculus | IC50 | = | 10.0 | nM | PMID[8277497] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 7.0 | nM | PMID[8863812] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 1300.0 | nM | PMID[8863812] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[1895294] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 3.9 | nM | PMID[1732549] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.0 | nM | PMID[7473577] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 18.0 | nM | PMID[7473577] |
| NPT1216 | Cell line | FaDu | Homo sapiens | EC50 | = | 17.0 | nM | PMID[7473577] |
| NPT1948 | Cell line | A253 cell line | n.a. | EC50 | = | 3000.0 | nM | PMID[7473577] |
| NPT137 | Cell line | L1210 | Mus musculus | Inhibition | = | 95.0 | % | PMID[3091832] |
| NPT137 | Cell line | L1210 | Mus musculus | Inhibition | = | 98.0 | % | PMID[3091832] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 60000.0 | nM | PMID[3091832] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 20.0 | nM | PMID[9022805] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.4 | nM | PMID[10956221] |
| NPT1216 | Cell line | FaDu | Homo sapiens | EC50 | = | 11.3 | nM | PMID[10956221] |
| NPT1948 | Cell line | A253 cell line | n.a. | EC50 | = | 14.5 | nM | PMID[10956221] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.4 | nM | PMID[2704031] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 186000.0 | nM | PMID[2704031] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 5.0 | nM | PMID[3351853] |
| NPT137 | Cell line | L1210 | Mus musculus | EC50 | = | 3.2 | nM | PMID[6410066] |
| NPT2117 | Cell line | HuTu80 | Homo sapiens | EC50 | = | 4.5 | nM | PMID[6410066] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 32.0 | nM | PMID[3872941] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 6600.0 | nM | PMID[3872941] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.0 | nM | PMID[3872941] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 19000.0 | nM | PMID[3872941] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 220000.0 | nM | PMID[3872941] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 20.0 | nM | PMID[9022804] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.6 | nM | PMID[3385730] |
| NPT2062 | Cell line | SCC-15 | Homo sapiens | IC50 | = | 38.0 | nM | PMID[3385730] |
| NPT2062 | Cell line | SCC-15 | Homo sapiens | IC50 | = | 580.0 | nM | PMID[3385730] |
| NPT2414 | Cell line | SCC-25 | Homo sapiens | IC50 | = | 7.5 | nM | PMID[3385730] |
| NPT2414 | Cell line | SCC-25 | Homo sapiens | IC50 | = | 150.0 | nM | PMID[3385730] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 24.0 | nM | PMID[6737432] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ED50 | = | 13.7 | nM | PMID[8568828] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ED50 | = | 655.0 | nM | PMID[8568828] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ED50 | = | 2550.0 | nM | PMID[8568828] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ED50 | = | 15.5 | nM | PMID[8568828] |
| NPT2117 | Cell line | HuTu80 | Homo sapiens | IC50 | = | 9.0 | nM | PMID[3612694] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 18.0 | nM | PMID[3612694] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[3612694] |
| NPT1183 | Cell line | WiDr | Homo sapiens | IC50 | = | 25.0 | nM | PMID[3612694] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 30.0 | nM | PMID[3462394] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.0 | nM | PMID[3462394] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 220000.0 | nM | PMID[3462394] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 3.9 | nM | PMID[3121855] |
| NPT2414 | Cell line | SCC-25 | Homo sapiens | IC50 | = | 7.5 | nM | PMID[8035423] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 10.5 | nM | PMID[8035423] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 2550.0 | nM | PMID[8035423] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Ki | = | 4480.0 | nM | PMID[8035423] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Ki | = | 9740.0 | nM | PMID[8035423] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 16.0 | nM | PMID[8164259] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 2760.0 | nM | PMID[8164259] |
| NPT7275 | Cell line | R1 | Mus musculus | EC50 | = | 720.0 | nM | PMID[8164259] |
| NPT1216 | Cell line | FaDu | Homo sapiens | EC50 | = | 19.0 | nM | PMID[8164259] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 2.7 | nM | PMID[6793726] |
| NPT137 | Cell line | L1210 | Mus musculus | Ki | = | 3650.0 | nM | PMID[6793726] |
| NPT1490 | Cell line | Ehrlich | Mus musculus | Ki | = | 10100.0 | nM | PMID[6793726] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 1000.0 | nM | PMID[3968685] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 12.0 | nM | PMID[3968685] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | = | 25.0 | ug.mL-1 | PMID[2810330] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | = | 4.5 | ug.mL-1 | PMID[2810330] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | = | 3.3 | ug.mL-1 | PMID[2810330] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | = | 3.4 | ug.mL-1 | PMID[2810330] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | = | 3.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 109.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 117.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 119.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 115.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 118.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 112.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 108.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 120.0 | ug.mL-1 | PMID[2810330] |
| NPT2815 | Cell line | M21 | Homo sapiens | IC50 | = | 121.0 | ug.mL-1 | PMID[2810330] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 0.035 | ug.mL-1 | PMID[1847428] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 3.4 | nM | PMID[1501226] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.5 | nM | PMID[7783147] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 595.0 | nM | PMID[7783147] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 3100.0 | nM | PMID[7783147] |
| NPT1948 | Cell line | A253 cell line | n.a. | EC50 | = | 17.0 | nM | PMID[7783147] |
| NPT1216 | Cell line | FaDu | Homo sapiens | EC50 | = | 31.0 | nM | PMID[7783147] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 4.51 | nM | PMID[1732551] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.3 | nM | PMID[9554874] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 8.0 | nM | PMID[9554874] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 567.0 | nM | PMID[9554874] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 13.8 | nM | PMID[11052789] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 660.0 | nM | PMID[11052789] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 2030.0 | nM | PMID[11052789] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 15.5 | nM | PMID[11052789] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.0 | nM | PMID[7562910] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 18.0 | nM | PMID[7562910] |
| NPT1216 | Cell line | FaDu | Homo sapiens | EC50 | = | 17.0 | nM | PMID[7562910] |
| NPT1948 | Cell line | A253 cell line | n.a. | EC50 | = | 13.0 | nM | PMID[7562910] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 0.005 | nM | PMID[3112397] |
| NPT137 | Cell line | L1210 | Mus musculus | IC50 | = | 200.0 | nM | PMID[3112397] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 419000.0 | nM | PMID[15780632] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 10.0 | nM | PMID[15267250] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | > | 50000.0 | nM | PMID[15267250] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | = | 70.0 | nM | PMID[15267250] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | > | 50000.0 | nM | PMID[15267250] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 1500.0 | nM | PMID[16078850] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.5 | nM | PMID[16078850] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 13.0 | nM | PMID[16078850] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 620.0 | nM | PMID[16078850] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.0 | nM | PMID[16451071] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 17.0 | nM | PMID[16451071] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 10.0 | % | PMID[16451071] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 11.0 | % | PMID[16451071] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 101.0 | % | PMID[16451071] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 99.0 | % | PMID[16451071] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 44.0 | % | PMID[16451071] |
| NPT517 | Cell line | Panel NCI-60 (60 carcinoma cell lines) | Homo sapiens | GI50 | = | 5.55 | n.a. | PMID[16539384] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 17.5 | nM | PMID[15615522] |
| NPT7275 | Cell line | R1 | Mus musculus | EC50 | = | 680.0 | nM | PMID[15615522] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 16.5 | nM | PMID[15615522] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Inhibition | = | 10.0 | % | PMID[15615522] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 8.2 | nM | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 660.0 | nM | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 1500.0 | nM | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 7.9 | nM | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 13.0 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 11.0 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 16.0 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 15.5 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 74.5 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 12.5 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 13.5 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 73.5 | % | PMID[15615538] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 12.5 | nM | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 615.0 | nM | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 1500.0 | nM | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 14.5 | nM | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 12.0 | % | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 5.0 | % | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 90.0 | % | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 96.0 | % | PMID[16279780] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 95.0 | % | PMID[16279780] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 6.92 | nM | PMID[17497807] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 13.3 | nM | PMID[17552508] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 410.0 | nM | PMID[17552508] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 1950.0 | nM | PMID[17552508] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 15.7 | nM | PMID[17552508] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 11.0 | % | PMID[17552508] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 13.0 | % | PMID[17552508] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 14.0 | % | PMID[17552508] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | Activity | = | 74.0 | % | PMID[17552508] |
| NPT579 | Cell line | DLD-1 | Homo sapiens | IC50 | > | 60.0 | ug.mL-1 | PMID[17569517] |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | IC50 | = | 0.29 | ug.mL-1 | PMID[17569517] |
| NPT133 | Cell line | ZR-75-1 | Homo sapiens | IC50 | > | 60.0 | ug.mL-1 | PMID[17569517] |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | IC50 | = | 0.057 | ug.mL-1 | PMID[17569517] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 0.027 | ug.mL-1 | PMID[17569517] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | > | 60.0 | ug.mL-1 | PMID[17569517] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[17127067] |
| NPT5294 | Cell line | PPC-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[17127067] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[17127067] |
| NPT5294 | Cell line | PPC-1 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[17127067] |
| NPT1893 | Cell line | MEF | Mus musculus | IC50 | = | 120.0 | nM | PMID[17383876] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[11170674] |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | = | 2.512 | nM | PMID[17532099] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | = | 39.81 | nM | PMID[17532099] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.0 | nM | PMID[18680275] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20.0 | nM | PMID[18680275] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 21.0 | nM | PMID[18680275] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[18680275] |
| NPT2295 | Cell line | 5637 | Homo sapiens | IC50 | = | 16.0 | nM | PMID[19243173] |
| NPT4608 | Cell line | RT-4 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[19243173] |
| NPT2331 | Cell line | A-427 | Homo sapiens | IC50 | = | 5520.0 | nM | PMID[19243173] |
| NPT3123 | Cell line | DAN-G | Homo sapiens | IC50 | = | 77.0 | nM | PMID[19243173] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[19243173] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 210.0 | nM | PMID[18555562] |
| NPT547 | Cell line | BGC-823 | Homo sapiens | IC50 | = | 110.0 | nM | PMID[18555562] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 100.0 | nM | PMID[18555562] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | = | 82300.0 | nM | PMID[18555562] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 4400.0 | nM | PMID[2778449] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 66.0 | nM | PMID[2778449] |
| NPT168 | Cell line | P388 | Mus musculus | IZ | = | 40.0 | mm | PMID[2778449] |
| NPT168 | Cell line | P388 | Mus musculus | IZ | = | 27.5 | mm | PMID[2778449] |
| NPT80 | Cell line | Raji | Homo sapiens | IC50 | = | 40.0 | nM | PMID[18513976] |
| NPT168 | Cell line | P388 | Mus musculus | IC50 | = | 0.002 | ug.mL-1 | PMID[10579858] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 0.005 | ug.mL-1 | PMID[10579858] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 0.01 | ug.mL-1 | PMID[10579858] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | EC50 | = | 12.5 | nM | PMID[18605720] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Inhibition | = | 65.0 | % | PMID[20485427] |
| NPT65 | Cell line | HepG2 | Homo sapiens | Inhibition | = | 0.0 | % | PMID[20485427] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | EC50 | = | 1100.0 | nM | PMID[20674353] |
| NPT83 | Cell line | MCF7 | Homo sapiens | EC50 | = | 900.0 | nM | PMID[20674353] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | EC50 | = | 80000.0 | nM | PMID[20674353] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 5.0 | nM | PMID[20580561] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 1.0 | nM | PMID[20580561] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 0.16 | ug.mL-1 | PMID[20846760] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 0.23 | ug.mL-1 | PMID[20846760] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | IC50 | = | 0.32 | ug.mL-1 | PMID[20846760] |
| NPT306 | Cell line | PC-3 | Homo sapiens | TGI | > | 100000.0 | nM | PMID[21115210] |
| NPT111 | Cell line | K562 | Homo sapiens | TGI | > | 100000.0 | nM | PMID[21115210] |
| NPT139 | Cell line | HT-29 | Homo sapiens | TGI | > | 100000.0 | nM | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | TGI | > | 100000.0 | nM | PMID[21115210] |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | = | 100.0 | nM | PMID[21115210] |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | = | 30.0 | nM | PMID[21115210] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | = | 40.0 | nM | PMID[21115210] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 60.0 | nM | PMID[21115210] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 37.4 | nM | PMID[20036565] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 16.0 | % | PMID[20036565] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 77.3 | % | PMID[20036565] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 96.6 | % | PMID[20036565] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 14.3 | % | PMID[20036565] |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | = | 10250.0 | nM | PMID[21802949] |
| NPT15 | Cell line | Jurkat | Homo sapiens | GI50 | = | 1250.0 | nM | PMID[21802949] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.0 | nM | PMID[21879757] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20.0 | nM | PMID[21879757] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 21.0 | nM | PMID[21879757] |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[21879757] |
| NPT858 | Cell line | LNCaP | Homo sapiens | IC50 | = | 300.0 | nM | PMID[22480495] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 101.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 97.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 96.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 102.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 94.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 60.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 89.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 52.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 27.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 80.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Inhibition | = | 29.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Ratio | = | 0.98 | n.a. | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Ratio | = | 0.77 | n.a. | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Ratio | = | 0.76 | n.a. | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Activity | = | 140.0 | % | PMID[22480495] |
| NPT2103 | Cell line | MONO-MAC-6 | Homo sapiens | Ratio | = | 0.95 | n.a. | PMID[22480495] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 60.0 | nM | PMID[23124219] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20900.0 | nM | PMID[23124219] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 8.5 | nM | PMID[22243528] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 1270.0 | nM | DOI[10.1007/s00044-012-0260-2] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 2260.0 | nM | DOI[10.1007/s00044-012-0260-2] |
| NPT1723 | Cell line | HBL-100 | Homo sapiens | IC50 | = | 40.0 | nM | DOI[10.1007/s00044-012-0279-4] |
| NPT2268 | Cell line | DOK | Homo sapiens | IC50 | = | 7582.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1899 | Cell line | DSH1 | Homo sapiens | IC50 | = | 532.72 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1184 | Cell line | Daoy | Homo sapiens | IC50 | = | 12683.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 1010.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT394 | Cell line | EKVX | Homo sapiens | IC50 | = | 9129.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1901 | Cell line | EM-2 | Homo sapiens | IC50 | = | 57.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2269 | Cell line | EPLC-272H | Homo sapiens | IC50 | = | 5199.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1905 | Cell line | ES4 | Homo sapiens | IC50 | = | 79.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1903 | Cell line | ES5 | Homo sapiens | IC50 | = | 435.31 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1902 | Cell line | ES1 | Homo sapiens | IC50 | = | 16.39 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1904 | Cell line | ES3 | Homo sapiens | IC50 | = | 242.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2270 | Cell line | Detroit562 | Homo sapiens | IC50 | = | 6924.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2271 | Cell line | DoTc2-4510 | Homo sapiens | IC50 | = | 7058.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1908 | Cell line | EC-GI-10 | Homo sapiens | IC50 | = | 10625.59 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2272 | Cell line | EFM-19 | Homo sapiens | IC50 | = | 10592.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2273 | Cell line | EFO-21 | Homo sapiens | IC50 | = | 3016.66 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2274 | Cell line | EFO-27 | Homo sapiens | IC50 | = | 567.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2275 | Cell line | EGI-1 | Homo sapiens | IC50 | = | 19971.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT376 | Cell line | A498 | Homo sapiens | IC50 | = | 9373.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 11589.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2276 | Cell line | A673 | Homo sapiens | IC50 | = | 1605.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1081 | Cell line | BXPC-3 | Homo sapiens | IC50 | = | 4406.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2277 | Cell line | C-33-A | Homo sapiens | IC50 | = | 10685.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2278 | Cell line | COLO-741 | Homo sapiens | IC50 | = | 162.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2279 | Cell line | COLO-792 | Homo sapiens | IC50 | = | 16965.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1913 | Cell line | DJM-1 | Homo sapiens | IC50 | = | 20249.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2280 | Cell line | A704 | Homo sapiens | IC50 | = | 22814.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2281 | Cell line | ABC-1 | Homo sapiens | IC50 | = | 21149.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1911 | Cell line | C2BBe1 | Homo sapiens | IC50 | = | 996.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2282 | Cell line | C32 | Homo sapiens | IC50 | = | 2924.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1912 | Cell line | COLO-800 | Homo sapiens | IC50 | = | 123.72 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1914 | Cell line | COLO-824 | Homo sapiens | IC50 | = | 14289.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2283 | Cell line | DK-MG | Homo sapiens | IC50 | = | 17392.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT576 | Cell line | DMS-114 | Homo sapiens | IC50 | = | 9647.04 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT369 | Cell line | ACHN | Homo sapiens | IC50 | = | 85.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1916 | Cell line | ACN | Homo sapiens | IC50 | = | 16378.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2284 | Cell line | C3A | Homo sapiens | IC50 | = | 2988.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1452 | Cell line | C8166 | Homo sapiens | IC50 | = | 224.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1915 | Cell line | COLO-829 | Homo sapiens | IC50 | = | 1429.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2285 | Cell line | COR-L105 | Homo sapiens | IC50 | = | 16863.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1918 | Cell line | DMS-79 | Homo sapiens | IC50 | = | 628.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1919 | Cell line | DOHH-2 | Homo sapiens | IC50 | = | 21.56 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1920 | Cell line | ALL-PO | Homo sapiens | IC50 | = | 5.858 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | IC50 | = | 671.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2286 | Cell line | CAL-120 | Homo sapiens | IC50 | = | 10838.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2287 | Cell line | COR-L23 | Homo sapiens | IC50 | = | 121.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT572 | Cell line | DMS-273 | Homo sapiens | IC50 | = | 3705.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1924 | Cell line | AM-38 | Homo sapiens | IC50 | = | 603.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2288 | Cell line | AN3-CA | Homo sapiens | IC50 | = | 9489.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2289 | Cell line | CAL-12T | Homo sapiens | IC50 | = | 8430.14 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2290 | Cell line | CAL-27 | Homo sapiens | IC50 | = | 9644.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2291 | Cell line | CP50-MEL-B | Homo sapiens | IC50 | = | 12292.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1629 | Cell line | CWR22R | Homo sapiens | IC50 | = | 536.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1928 | Cell line | ATN-1 | Homo sapiens | IC50 | = | 3.924 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2292 | Cell line | CAL-33 | Homo sapiens | IC50 | = | 7677.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2293 | Cell line | CAL-39 | Homo sapiens | IC50 | = | 17407.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1930 | Cell line | CTB-1 | Homo sapiens | IC50 | = | 16.23 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2295 | Cell line | 5637 | Homo sapiens | IC50 | = | 293.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2296 | Cell line | AU565 | Homo sapiens | IC50 | = | 61.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2297 | Cell line | ASPC1 | Homo sapiens | IC50 | = | 266.22 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2298 | Cell line | BALL-1 | Homo sapiens | IC50 | = | 1186.96 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2299 | Cell line | CAL-51 | Homo sapiens | IC50 | = | 4532.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2300 | Cell line | CAL-54 | Homo sapiens | IC50 | = | 2791.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2301 | Cell line | CAL-62 | Homo sapiens | IC50 | = | 3175.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1932 | Cell line | CTV-1 | Homo sapiens | IC50 | = | 77.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1933 | Cell line | CW-2 | Homo sapiens | IC50 | = | 15777.17 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2302 | Cell line | 639-V | Homo sapiens | IC50 | = | 6323.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2303 | Cell line | 647-V | Homo sapiens | IC50 | = | 9307.22 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1931 | Cell line | BB30-HNC | Homo sapiens | IC50 | = | 94.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1934 | Cell line | BB49-HNC | Homo sapiens | IC50 | = | 10186.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2304 | Cell line | CAL-72 | Homo sapiens | IC50 | = | 415.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2305 | Cell line | CAL-85-1 | Homo sapiens | IC50 | = | 10940.48 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2306 | Cell line | Ca-Ski | Homo sapiens | IC50 | = | 373.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1031 | Cell line | Ca9-22 | Homo sapiens | IC50 | = | 3404.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1094 | Cell line | 697 | Homo sapiens | IC50 | = | 12.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2307 | Cell line | 769-P | Homo sapiens | IC50 | = | 45.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT401 | Cell line | 786-0 | Homo sapiens | IC50 | = | 643.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1935 | Cell line | BB65-RCC | Homo sapiens | IC50 | = | 7085.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2308 | Cell line | CAMA-1 | Homo sapiens | IC50 | = | 3937.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2309 | Cell line | CAPAN-1 | Homo sapiens | IC50 | = | 6096.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2310 | Cell line | CaR-1 | Homo sapiens | IC50 | = | 13216.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2311 | Cell line | Calu-3 | Homo sapiens | IC50 | = | 15299.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1939 | Cell line | 8-MG-BA | Homo sapiens | IC50 | = | 21805.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2312 | Cell line | 8305C | Homo sapiens | IC50 | = | 196.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2313 | Cell line | BCPAP | Homo sapiens | IC50 | = | 43.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1937 | Cell line | CAS-1 | Homo sapiens | IC50 | = | 16566.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | IC50 | = | 695.81 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1938 | Cell line | Calu-6 | Homo sapiens | IC50 | = | 552.72 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1313 | Cell line | Capan-2 | Homo sapiens | IC50 | = | 2282.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1215 | Cell line | 8505C | Homo sapiens | IC50 | = | 12212.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1941 | Cell line | A101D | Homo sapiens | IC50 | = | 14936.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1940 | Cell line | BE-13 | Homo sapiens | IC50 | = | 38.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2314 | Cell line | BEN | Homo sapiens | IC50 | = | 9704.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2315 | Cell line | BFTC-905 | Homo sapiens | IC50 | = | 9016.06 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2316 | Cell line | CFPAC-1 | Homo sapiens | IC50 | = | 689.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2317 | Cell line | ChaGo-K-1 | Homo sapiens | IC50 | = | 7738.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1944 | Cell line | D-247MG | Homo sapiens | IC50 | = | 15592.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2318 | Cell line | A172 | Homo sapiens | IC50 | = | 1895.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2319 | Cell line | A204 | Homo sapiens | IC50 | = | 1084.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2320 | Cell line | BFTC-909 | Homo sapiens | IC50 | = | 9208.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2321 | Cell line | BHT-101 | Homo sapiens | IC50 | = | 26644.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1943 | Cell line | CGTH-W-1 | Homo sapiens | IC50 | = | 31.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2322 | Cell line | CHL-1 | Homo sapiens | IC50 | = | 209.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1946 | Cell line | D-263MG | Homo sapiens | IC50 | = | 3983.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1383 | Cell line | A2058 | Homo sapiens | IC50 | = | 1987.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 54.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2323 | Cell line | BHY | Homo sapiens | IC50 | = | 5725.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2324 | Cell line | CHP-212 | Homo sapiens | IC50 | = | 7847.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1947 | Cell line | D283 Med | n.a. | IC50 | = | 7704.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1953 | Cell line | D-336MG | Homo sapiens | IC50 | = | 11889.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1954 | Cell line | D-392MG | Homo sapiens | IC50 | = | 158.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1955 | Cell line | A3-KAW | Homo sapiens | IC50 | = | 8.923 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1083 | Cell line | A-375 | Homo sapiens | IC50 | = | 9816.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2325 | Cell line | BPH-1 | Homo sapiens | IC50 | = | 772.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2326 | Cell line | BT-20 | Homo sapiens | IC50 | = | 1350.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1952 | Cell line | COLO-320-HSR | Homo sapiens | IC50 | = | 52.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1956 | Cell line | COLO-668 | Homo sapiens | IC50 | = | 498.56 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2327 | Cell line | D-423MG | Homo sapiens | IC50 | = | 23828.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1957 | Cell line | D-502MG | Homo sapiens | IC50 | = | 22946.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1958 | Cell line | A388 | Homo sapiens | IC50 | = | 1605.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1959 | Cell line | A4-Fuk | Homo sapiens | IC50 | = | 38.23 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT845 | Cell line | BT-474 | Homo sapiens | IC50 | = | 12541.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2328 | Cell line | COLO-678 | Homo sapiens | IC50 | = | 11979.96 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2329 | Cell line | COLO-679 | Homo sapiens | IC50 | = | 18583.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2330 | Cell line | D-566MG | Homo sapiens | IC50 | = | 21868.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2331 | Cell line | A-427 | Homo sapiens | IC50 | = | 16184.22 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT762 | Cell line | A-431 | Homo sapiens | IC50 | = | 2197.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1960 | Cell line | BV-173 | Homo sapiens | IC50 | = | 6.349 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1963 | Cell line | Becker | Homo sapiens | IC50 | = | 12792.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2332 | Cell line | COLO-680N | Homo sapiens | IC50 | = | 19598.22 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1964 | Cell line | COLO-684 | Homo sapiens | IC50 | = | 37.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1962 | Cell line | DB | Homo sapiens | IC50 | = | 21.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2333 | Cell line | DBTRG-05MG | Homo sapiens | IC50 | = | 171.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1965 | Cell line | DEL | Homo sapiens | IC50 | = | 3.119 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2334 | Cell line | NCI-H1793 | Homo sapiens | IC50 | = | 2340.4 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1966 | Cell line | NCI-H1838 | Homo sapiens | IC50 | = | 2711.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1967 | Cell line | NCI-H526 | Homo sapiens | IC50 | = | 0.6915 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2335 | Cell line | NCI-H596 | n.a. | IC50 | = | 833.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2336 | Cell line | OE19 | Homo sapiens | IC50 | = | 1544.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2337 | Cell line | OE33 | Homo sapiens | IC50 | = | 281.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1091 | Cell line | RPMI-7951 | Homo sapiens | IC50 | = | 1952.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | IC50 | = | 101.2 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT311 | Cell line | SK-LU-1 | Homo sapiens | IC50 | = | 7598.39 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT926 | Cell line | SK-MEL-1 | Homo sapiens | IC50 | = | 500.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1312 | Cell line | SW1990 | Homo sapiens | IC50 | = | 18063.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2338 | Cell line | SW48 | Homo sapiens | IC50 | = | 12952.45 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2339 | Cell line | TGBC24TKB | Homo sapiens | IC50 | = | 4585.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1971 | Cell line | GI-1 | Homo sapiens | IC50 | = | 19492.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2204 | Cell line | HH | Homo sapiens | IC50 | = | 31.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 24.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1973 | Cell line | IST-SL1 | Homo sapiens | IC50 | = | 390.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1975 | Cell line | KS-1 | Homo sapiens | IC50 | = | 10768.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2340 | Cell line | KU-19-19 | Homo sapiens | IC50 | = | 1077.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1976 | Cell line | LNCaP-Clone-FGC | Homo sapiens | IC50 | = | 9577.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1978 | Cell line | MFM-223 | Homo sapiens | IC50 | = | 6060.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2211 | Cell line | NB12 | Homo sapiens | IC50 | = | 19653.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1979 | Cell line | NB13 | Homo sapiens | IC50 | = | 5260.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2342 | Cell line | NCI-H630 | Homo sapiens | IC50 | = | 6518.61 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2343 | Cell line | NCI-H650 | Homo sapiens | IC50 | = | 807.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1968 | Cell line | OMC-1 | Homo sapiens | IC50 | = | 24621.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1984 | Cell line | ONS-76 | Homo sapiens | IC50 | = | 63.77 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1987 | Cell line | RPMI-8866 | Homo sapiens | IC50 | = | 19.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | IC50 | = | 17057.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2344 | Cell line | SK-MEL-24 | Homo sapiens | IC50 | = | 1056.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 541.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2345 | Cell line | SW626 | Homo sapiens | IC50 | = | 16469.27 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2346 | Cell line | TI-73 | Homo sapiens | IC50 | = | 11605.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT384 | Cell line | TK-10 | Homo sapiens | IC50 | = | 26849.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1972 | Cell line | GI-ME-N | Homo sapiens | IC50 | = | 147.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2347 | Cell line | GMS-10 | Homo sapiens | IC50 | = | 21842.66 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2348 | Cell line | HLE | Homo sapiens | IC50 | = | 7085.4 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2349 | Cell line | HMV-2 cell line | n.a. | IC50 | = | 1878.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2350 | Cell line | HN | Homo sapiens | IC50 | = | 6884.48 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1990 | Cell line | J-RT3-T3-5 | Homo sapiens | IC50 | = | 19.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1505 | Cell line | J82 | Homo sapiens | IC50 | = | 4099.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | IC50 | = | 201.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2351 | Cell line | MG-63 | Homo sapiens | IC50 | = | 197.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2352 | Cell line | MHH-ES-1 | Homo sapiens | IC50 | = | 107.01 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1980 | Cell line | NB14 | Homo sapiens | IC50 | = | 75.01 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1995 | Cell line | NB17 | Homo sapiens | IC50 | = | 16832.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2353 | Cell line | NCI-H1993 | Homo sapiens | IC50 | = | 23188.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2355 | Cell line | NCI-H2029 | Homo sapiens | IC50 | = | 25796.66 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2356 | Cell line | NCI-H661 | Homo sapiens | IC50 | = | 3562.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1997 | Cell line | OS-RC-2 | Homo sapiens | IC50 | = | 5320.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1998 | Cell line | RS4-11 | Homo sapiens | IC50 | = | 7.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2357 | Cell line | RT-112 | Homo sapiens | IC50 | = | 142.31 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | IC50 | = | 7394.01 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2358 | Cell line | SK-MEL3 | Homo sapiens | IC50 | = | 1055.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2359 | Cell line | SK-MEL-30 | Homo sapiens | IC50 | = | 3851.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1988 | Cell line | SW684 | Homo sapiens | IC50 | = | 9281.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2360 | Cell line | SW756 | Homo sapiens | IC50 | = | 13860.85 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2361 | Cell line | SW780 | Homo sapiens | IC50 | = | 116.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2362 | Cell line | TYK-nu | Homo sapiens | IC50 | = | 197.27 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2363 | Cell line | U-118-MG | Homo sapiens | IC50 | = | 4671.36 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1989 | Cell line | GOTO | Homo sapiens | IC50 | = | 2053.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2364 | Cell line | GP5d | Homo sapiens | IC50 | = | 9614.03 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2365 | Cell line | HO-1-N-1 | Homo sapiens | IC50 | = | 6174.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2001 | Cell line | JAR | Homo sapiens | IC50 | = | 188.36 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2366 | Cell line | JEG-3 | Homo sapiens | IC50 | = | 7031.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1992 | Cell line | KURAMOCHI | Homo sapiens | IC50 | = | 1886.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2367 | Cell line | KYSE-140 | Homo sapiens | IC50 | = | 1245.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2003 | Cell line | LS-1034 | Homo sapiens | IC50 | = | 6867.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2004 | Cell line | LS-123 | Homo sapiens | IC50 | = | 10289.17 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2005 | Cell line | MHH-NB-11 | Homo sapiens | IC50 | = | 409.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1996 | Cell line | NB5 | Homo sapiens | IC50 | = | 14227.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2007 | Cell line | NB6 | Homo sapiens | IC50 | = | 25876.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2368 | Cell line | NCI-H2030 | Homo sapiens | IC50 | = | 9183.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2369 | Cell line | NCI-H2052 | Homo sapiens | IC50 | = | 2509.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 810.02 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | IC50 | = | 4414.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2370 | Cell line | RVH-421 | Homo sapiens | IC50 | = | 23044.27 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT406 | Cell line | RXF 393 | Homo sapiens | IC50 | = | 13852.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1506 | Cell line | SK-MES-1 | Homo sapiens | IC50 | = | 5069.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2371 | Cell line | SW837 | Homo sapiens | IC50 | = | 4590.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2014 | Cell line | SW872 | Homo sapiens | IC50 | = | 4600.2 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1045 | Cell line | U2OS | Homo sapiens | IC50 | = | 182.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2015 | Cell line | U-266 | Homo sapiens | IC50 | = | 5528.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2016 | Cell line | ES6 | Homo sapiens | IC50 | = | 428.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2000 | Cell line | GR-ST | Homo sapiens | IC50 | = | 36.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2018 | Cell line | GT3TKB | Homo sapiens | IC50 | = | 10714.66 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2372 | Cell line | H-EMC-SS | Homo sapiens | IC50 | = | 20774.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT372 | Cell line | HOP-92 | Homo sapiens | IC50 | = | 16653.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT307 | Cell line | HOS | Homo sapiens | IC50 | = | 11007.14 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2019 | Cell line | JVM-2 | Homo sapiens | IC50 | = | 2180.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2020 | Cell line | JVM-3 | Homo sapiens | IC50 | = | 16.04 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2373 | Cell line | KYSE-150 cell line | n.a. | IC50 | = | 115.06 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2374 | Cell line | KYSE-180 | Homo sapiens | IC50 | = | 1212.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2021 | Cell line | LS-411N | Homo sapiens | IC50 | = | 117.59 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2006 | Cell line | MHH-PREB-1 | Homo sapiens | IC50 | = | 13.23 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | IC50 | = | 9125.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2375 | Cell line | MKN-1 | Homo sapiens | IC50 | = | 2246.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2008 | Cell line | NB69 | Homo sapiens | IC50 | = | 14732.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2023 | Cell line | NB7 | Homo sapiens | IC50 | = | 447.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2376 | Cell line | NBsusSR | Homo sapiens | IC50 | = | 29.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2377 | Cell line | NCI-H2087 | Homo sapiens | IC50 | = | 10166.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2024 | Cell line | NCI-H209 | Homo sapiens | IC50 | = | 365.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2378 | Cell line | NCI-H727 | Homo sapiens | IC50 | = | 1127.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2025 | Cell line | NCI-H747 | Homo sapiens | IC50 | = | 13077.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | IC50 | = | 14668.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | IC50 | = | 9990.71 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2379 | Cell line | P12-Ichikawa | Homo sapiens | IC50 | = | 41.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2026 | Cell line | Ramos-2G6-4C10 | Homo sapiens | IC50 | = | 26.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2380 | Cell line | SK-N-AS | Homo sapiens | IC50 | = | 1417.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2027 | Cell line | SK-N-DZ | Homo sapiens | IC50 | = | 743.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2381 | Cell line | SW900 | Homo sapiens | IC50 | = | 11239.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2382 | Cell line | SW948 | Homo sapiens | IC50 | = | 18626.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1535 | Cell line | U-87 MG | Homo sapiens | IC50 | = | 18560.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2017 | Cell line | ES7 | Homo sapiens | IC50 | = | 148.36 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2031 | Cell line | ES8 | Homo sapiens | IC50 | = | 521.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2891 | Cell line | H4 | Homo sapiens | IC50 | = | 11475.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2384 | Cell line | HPAF-II | Homo sapiens | IC50 | = | 6118.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT924 | Cell line | HSC-2 | Homo sapiens | IC50 | = | 398.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2385 | Cell line | HSC-3 | Homo sapiens | IC50 | = | 10283.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 4875.06 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2386 | Cell line | KYSE-270 | Homo sapiens | IC50 | = | 52.11 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2387 | Cell line | KYSE-410 | Homo sapiens | IC50 | = | 3639.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2022 | Cell line | LS-513 | Homo sapiens | IC50 | = | 4353.08 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2034 | Cell line | LU-134-A | Homo sapiens | IC50 | = | 88.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2388 | Cell line | LU-135 | Homo sapiens | IC50 | = | 2230.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1179 | Cell line | MKN-28 | Homo sapiens | IC50 | = | 1333.91 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1097 | Cell line | MKN-45 | Homo sapiens | IC50 | = | 872.29 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2389 | Cell line | NCI-H1048 | Homo sapiens | IC50 | = | 328.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2390 | Cell line | NCI-H2122 | Homo sapiens | IC50 | = | 151.43 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1082 | Cell line | NCI-H2126 | Homo sapiens | IC50 | = | 13715.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2391 | Cell line | NCI-H810 | Homo sapiens | IC50 | = | 14315.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2040 | Cell line | P30-OHK | Homo sapiens | IC50 | = | 43.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2392 | Cell line | S-117 | Homo sapiens | IC50 | = | 10816.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2393 | Cell line | SAS | Homo sapiens | IC50 | = | 3937.81 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2028 | Cell line | SK-N-FI | Homo sapiens | IC50 | = | 13184.17 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2043 | Cell line | SK-NEP-1 | Homo sapiens | IC50 | = | 4.819 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2029 | Cell line | SW 954 | Homo sapiens | IC50 | = | 213.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2044 | Cell line | SW 962 | Homo sapiens | IC50 | = | 12996.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT371 | Cell line | UO-31 | Homo sapiens | IC50 | = | 3643.4 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT380 | Cell line | U-251 | Homo sapiens | IC50 | = | 12192.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2383 | Cell line | ESS-1 | Homo sapiens | IC50 | = | 1026.91 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2045 | Cell line | ETK-1 | Homo sapiens | IC50 | = | 1395.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2032 | Cell line | HAL-01 | Homo sapiens | IC50 | = | 22.27 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2047 | Cell line | HC-1 | Homo sapiens | IC50 | = | 69.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2394 | Cell line | HSC-4 | Homo sapiens | IC50 | = | 6472.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2049 | Cell line | HT | Homo sapiens | IC50 | = | 133.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2051 | Cell line | K5 | Homo sapiens | IC50 | = | 59.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2395 | Cell line | KYSE-450 | Homo sapiens | IC50 | = | 334.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2396 | Cell line | KYSE-510 | Homo sapiens | IC50 | = | 91.72 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2397 | Cell line | KYSE-520 cell line | n.a. | IC50 | = | 4454.56 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2053 | Cell line | LU-139 | Homo sapiens | IC50 | = | 235.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2398 | Cell line | MKN-7 | Homo sapiens | IC50 | = | 12063.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2055 | Cell line | ML-2 | Homo sapiens | IC50 | = | 4.967 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2036 | Cell line | NCI-H1092 | Homo sapiens | IC50 | = | 922.04 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2057 | Cell line | NCI-H1155 | Homo sapiens | IC50 | = | 266.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2399 | Cell line | NCI-H2170 | Homo sapiens | IC50 | = | 7859.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2039 | Cell line | NCI-H82 | Homo sapiens | IC50 | = | 789.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2400 | Cell line | PA-1 | Homo sapiens | IC50 | = | 9897.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2401 | Cell line | PANC-03-27 | Homo sapiens | IC50 | = | 7927.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2402 | Cell line | PANC-08-13 | Homo sapiens | IC50 | = | 3886.13 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2042 | Cell line | SBC-1 | Homo sapiens | IC50 | = | 563.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2403 | Cell line | SBC-5 | Homo sapiens | IC50 | = | 69.36 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2063 | Cell line | SK-PN-DW | Homo sapiens | IC50 | = | 8356.61 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2404 | Cell line | SW982 | Homo sapiens | IC50 | = | 11016.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2405 | Cell line | SAOS-2 | Homo sapiens | IC50 | = | 2963.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT403 | Cell line | UACC-257 | Homo sapiens | IC50 | = | 19229.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT398 | Cell line | UACC-62 | Homo sapiens | IC50 | = | 17915.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2065 | Cell line | EW-1 | Homo sapiens | IC50 | = | 168.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2406 | Cell line | HCC1395 | Homo sapiens | IC50 | = | 23230.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2407 | Cell line | HCC1419 | Homo sapiens | IC50 | = | 13812.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | IC50 | = | 12992.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT658 | Cell line | HT1197 | Homo sapiens | IC50 | = | 2612.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2052 | Cell line | KALS-1 | Homo sapiens | IC50 | = | 9083.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2067 | Cell line | KARPAS-299 | Homo sapiens | IC50 | = | 493.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2408 | Cell line | KYSE-70 cell line | n.a. | IC50 | = | 6165.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2068 | Cell line | L-363 | Homo sapiens | IC50 | = | 14.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2069 | Cell line | Lu-65 | Homo sapiens | IC50 | = | 4077.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2409 | Cell line | LU-99A | Homo sapiens | IC50 | = | 273.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2056 | Cell line | MLMA | Homo sapiens | IC50 | = | 96.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2071 | Cell line | MMAC-SF | Homo sapiens | IC50 | = | 19553.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | IC50 | = | 250.03 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2073 | Cell line | NCI-H1304 | Homo sapiens | IC50 | = | 2408.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT465 | Cell line | NCI-N87 | Homo sapiens | IC50 | = | 6032.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT788 | Cell line | SNU1 | Homo sapiens | IC50 | = | 7.515 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2412 | Cell line | Panc1005 | Homo sapiens | IC50 | = | 4317.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2413 | Cell line | PC-14 | Homo sapiens | IC50 | = | 572.86 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2062 | Cell line | SCC-15 | Homo sapiens | IC50 | = | 805.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2414 | Cell line | SCC-25 | Homo sapiens | IC50 | = | 6594.15 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2078 | Cell line | SK-UT-1 | Homo sapiens | IC50 | = | 12169.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2415 | Cell line | SKG-IIIa | Homo sapiens | IC50 | = | 6786.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2245 | Cell line | SiHa | Homo sapiens | IC50 | = | 8502.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT550 | Cell line | T-24 | Homo sapiens | IC50 | = | 13954.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 24878.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2416 | Cell line | UACC-893 | Homo sapiens | IC50 | = | 1095.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2417 | Cell line | UMUC3 | Homo sapiens | IC50 | = | 7035.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2066 | Cell line | EW-11 | Homo sapiens | IC50 | = | 597.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2080 | Cell line | EW-13 | Homo sapiens | IC50 | = | 72.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2418 | Cell line | HCC1569 | Homo sapiens | IC50 | = | 6370.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2419 | Cell line | HT-1376 | Homo sapiens | IC50 | = | 14994.27 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2082 | Cell line | HT-144 | Homo sapiens | IC50 | = | 8206.87 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2084 | Cell line | KARPAS-45 | Homo sapiens | IC50 | = | 123.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2086 | Cell line | L-428 | Homo sapiens | IC50 | = | 1256.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2070 | Cell line | LXF-289 cell line | n.a. | IC50 | = | 6562.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT114 | Cell line | LoVo | Homo sapiens | IC50 | = | 13744.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2072 | Cell line | MN-60 | Homo sapiens | IC50 | = | 65.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2074 | Cell line | NCI-H1355 | Homo sapiens | IC50 | = | 10878.01 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2089 | Cell line | NCI-H1395 | Homo sapiens | IC50 | = | 7279.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2411 | Cell line | NCI-H2228 | Homo sapiens | IC50 | = | 7687.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | IC50 | = | 5355.17 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2420 | Cell line | NCI-H2291 | Homo sapiens | IC50 | = | 4340.85 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2091 | Cell line | SNU-5 | Homo sapiens | IC50 | = | 1499.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 2637.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2421 | Cell line | PFSK-1 | Homo sapiens | IC50 | = | 1206.31 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2422 | Cell line | SCC-4 | Homo sapiens | IC50 | = | 7609.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2423 | Cell line | SCC-9 | Homo sapiens | IC50 | = | 7433.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT368 | Cell line | SN12C | Homo sapiens | IC50 | = | 5554.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT392 | Cell line | SNB-75 | Homo sapiens | IC50 | = | 24775.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2424 | Cell line | T84 | Homo sapiens | IC50 | = | 17536.83 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1125 | Cell line | T98G | Homo sapiens | IC50 | = | 12845.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2425 | Cell line | UMC-11 | Homo sapiens | IC50 | = | 9583.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2096 | Cell line | VA-ES-BJ | Homo sapiens | IC50 | = | 5058.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2097 | Cell line | EW-16 | Homo sapiens | IC50 | = | 894.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2426 | Cell line | HCC1806 | Homo sapiens | IC50 | = | 5254.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1884 | Cell line | HCC1937 | Homo sapiens | IC50 | = | 8179.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2427 | Cell line | HCC1954 | Homo sapiens | IC50 | = | 11991.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 153.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2428 | Cell line | HT-3 | Homo sapiens | IC50 | = | 69.37 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2429 | Cell line | HT55 | Homo sapiens | IC50 | = | 2408.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2099 | Cell line | KE-37 | Homo sapiens | IC50 | = | 15.53 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1358 | Cell line | LAMA-84 | Homo sapiens | IC50 | = | 12.39 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2101 | Cell line | LAN-6 | Homo sapiens | IC50 | = | 1745.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2430 | Cell line | M059J | Homo sapiens | IC50 | = | 15123.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT387 | Cell line | M14 | Homo sapiens | IC50 | = | 1942.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2088 | Cell line | MOLT-16 | Homo sapiens | IC50 | = | 11.6 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | IC50 | = | 21.17 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2431 | Cell line | NCI-H1437 | Homo sapiens | IC50 | = | 1677.36 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | IC50 | = | 293.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2432 | Cell line | NCI-H2342 | Homo sapiens | IC50 | = | 21618.45 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2092 | Cell line | NEC8 | Homo sapiens | IC50 | = | 289.76 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2106 | Cell line | NH-12 | Homo sapiens | IC50 | = | 3506.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2107 | Cell line | PSN1 | Homo sapiens | IC50 | = | 1586.64 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2109 | Cell line | SCH | Homo sapiens | IC50 | = | 984.47 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT890 | Cell line | SNU-387 | Homo sapiens | IC50 | = | 12342.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2433 | Cell line | SNU-423 | Homo sapiens | IC50 | = | 16346.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2434 | Cell line | TCC-SUP | Homo sapiens | IC50 | = | 8569.61 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2435 | Cell line | VM-CUB-1 | Homo sapiens | IC50 | = | 374.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2436 | Cell line | VMRC-RCZ | Homo sapiens | IC50 | = | 5079.77 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1653 | Cell line | WM-115 | Homo sapiens | IC50 | = | 1827.33 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2098 | Cell line | EW-18 | Homo sapiens | IC50 | = | 499.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2437 | Cell line | EW-22 | Homo sapiens | IC50 | = | 217.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2113 | Cell line | EW-24 | Homo sapiens | IC50 | = | 496.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2438 | Cell line | HTC-C3 | Homo sapiens | IC50 | = | 3442.45 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2100 | Cell line | KG-1 | n.a. | IC50 | = | 508.53 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2118 | Cell line | KGN | Homo sapiens | IC50 | = | 150.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2120 | Cell line | LB1047-RCC | Homo sapiens | IC50 | = | 15223.85 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2439 | Cell line | MC-IXC | Homo sapiens | IC50 | = | 9512.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2122 | Cell line | MC116 | Homo sapiens | IC50 | = | 60.61 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2123 | Cell line | MPP-89 | Homo sapiens | IC50 | = | 11256.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2440 | Cell line | NCI-H1563 | Homo sapiens | IC50 | = | 1433.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2441 | Cell line | NCI-H2347 | Homo sapiens | IC50 | = | 9716.96 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2442 | Cell line | NCI-H2405 | Homo sapiens | IC50 | = | 29089.52 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2126 | Cell line | NKM-1 | Homo sapiens | IC50 | = | 7.702 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2127 | Cell line | NMC-G1 | Homo sapiens | IC50 | = | 11348.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2108 | Cell line | QIMR-WIL | Homo sapiens | IC50 | = | 139.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2128 | Cell line | RCC10RGB | Homo sapiens | IC50 | = | 20210.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2111 | Cell line | SF-126 | Homo sapiens | IC50 | = | 17962.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 427.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2443 | Cell line | SNU-449 | Homo sapiens | IC50 | = | 827.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2112 | Cell line | TE-1 | Homo sapiens | IC50 | = | 388.24 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2130 | Cell line | TE-10 | Homo sapiens | IC50 | = | 12658.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2444 | Cell line | YAPC | Homo sapiens | IC50 | = | 665.75 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2445 | Cell line | YH-13 | Homo sapiens | IC50 | = | 21406.55 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | IC50 | = | 211.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2446 | Cell line | HCC38 | Homo sapiens | IC50 | = | 17567.12 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT402 | Cell line | Hs-578T | Homo sapiens | IC50 | = | 24709.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2447 | Cell line | HuCCT-1 | Homo sapiens | IC50 | = | 16327.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2119 | Cell line | KINGS-1 | Homo sapiens | IC50 | = | 614.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2448 | Cell line | KLE | Homo sapiens | IC50 | = | 6159.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2121 | Cell line | LB2241-RCC | Homo sapiens | IC50 | = | 13798.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2134 | Cell line | LB2518-MEL | Homo sapiens | IC50 | = | 6822.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 16198.91 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2137 | Cell line | MS-1 | Homo sapiens | IC50 | = | 45.26 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2449 | Cell line | NCI-H1573 | Homo sapiens | IC50 | = | 13217.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2139 | Cell line | NCI-H1581 | Homo sapiens | IC50 | = | 8690.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2450 | Cell line | NCI-H2452 | Homo sapiens | IC50 | = | 650.63 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2451 | Cell line | NCI-H28 | Homo sapiens | IC50 | = | 299.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2452 | Cell line | NCI-H292 | n.a. | IC50 | = | 6477.48 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2140 | Cell line | NOMO-1 | Homo sapiens | IC50 | = | 16.25 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2453 | Cell line | RCM-1 | Homo sapiens | IC50 | = | 1461.39 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2454 | Cell line | RD | Homo sapiens | IC50 | = | 8437.19 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT399 | Cell line | SF-295 | Homo sapiens | IC50 | = | 12419.8 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT374 | Cell line | SF-539 | Homo sapiens | IC50 | = | 19090.24 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2455 | Cell line | SNU-C2B | Homo sapiens | IC50 | = | 144.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2456 | Cell line | TE-11 | Homo sapiens | IC50 | = | 773.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2144 | Cell line | TE-12 | Homo sapiens | IC50 | = | 510.68 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2457 | Cell line | YKG-1 | Homo sapiens | IC50 | = | 23243.0 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT994 | Cell line | ZR-75-30 | Homo sapiens | IC50 | = | 2232.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1216 | Cell line | FaDu | Homo sapiens | IC50 | = | 6289.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2458 | Cell line | FTC-133 | Homo sapiens | IC50 | = | 2513.95 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2459 | Cell line | HCC70 | Homo sapiens | IC50 | = | 389.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2460 | Cell line | HCE-4 | Homo sapiens | IC50 | = | 778.72 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1229 | Cell line | Huh-7 | Homo sapiens | IC50 | = | 3188.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2461 | Cell line | HuO-3N1 | Homo sapiens | IC50 | = | 89.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2462 | Cell line | HuO9 | Homo sapiens | IC50 | = | 1327.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2133 | Cell line | KM-H2 | Homo sapiens | IC50 | = | 369.4 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT386 | Cell line | KM12 | Homo sapiens | IC50 | = | 164.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2463 | Cell line | MDA-MB-157 | Homo sapiens | IC50 | = | 3245.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2464 | Cell line | MDA-MB-175-VII | Homo sapiens | IC50 | = | 17429.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 22897.96 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2138 | Cell line | MSTO-211H | Homo sapiens | IC50 | = | 518.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1649 | Cell line | MV4-11 | Homo sapiens | IC50 | = | 19.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2465 | Cell line | NCI-H1623 | Homo sapiens | IC50 | = | 13117.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2150 | Cell line | NCI-H1648 | Homo sapiens | IC50 | = | 14804.07 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2141 | Cell line | NOS-1 | Homo sapiens | IC50 | = | 4555.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2152 | Cell line | NTERA-2-cl-D1 | Homo sapiens | IC50 | = | 3148.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2467 | Cell line | RERF-LC-MS | Homo sapiens | IC50 | = | 1110.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2153 | Cell line | RH-1 | Homo sapiens | IC50 | = | 361.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2154 | Cell line | SH-4 | Homo sapiens | IC50 | = | 6942.67 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2159 | Cell line | TE-5 | Homo sapiens | IC50 | = | 11992.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2160 | Cell line | no-10 | Homo sapiens | IC50 | = | 7307.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2469 | Cell line | G-401 | Homo sapiens | IC50 | = | 639.01 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2470 | Cell line | G-402 | Homo sapiens | IC50 | = | 21578.06 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2162 | Cell line | HCE-T | Homo sapiens | IC50 | = | 875.84 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 787.69 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2471 | Cell line | HuP-T3 | Homo sapiens | IC50 | = | 4618.39 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2472 | Cell line | HuP-T4 | Homo sapiens | IC50 | = | 8848.49 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2163 | Cell line | KMOE-2 | Homo sapiens | IC50 | = | 97.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2148 | Cell line | LB771-HNC | Homo sapiens | IC50 | = | 17719.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2166 | Cell line | LB831-BLC | Homo sapiens | IC50 | = | 1711.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2473 | Cell line | MDA-MB-361 | Homo sapiens | IC50 | = | 12293.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2474 | Cell line | MDA-MB-415 | Homo sapiens | IC50 | = | 8424.65 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2149 | Cell line | MZ1-PC | Homo sapiens | IC50 | = | 8833.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2168 | Cell line | MZ2-MEL | Homo sapiens | IC50 | = | 9826.77 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1820 | Cell line | NCI-H1650 | Homo sapiens | IC50 | = | 1628.66 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2475 | Cell line | NCI-H1651 | Homo sapiens | IC50 | = | 7802.43 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2466 | Cell line | NCI-H358 | Homo sapiens | IC50 | = | 250.58 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2476 | Cell line | NCI-H441 | Homo sapiens | IC50 | = | 672.92 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT937 | Cell line | NCI-H446 | Homo sapiens | IC50 | = | 11165.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2477 | Cell line | NUGC-3 | Homo sapiens | IC50 | = | 6122.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2478 | Cell line | NY | Homo sapiens | IC50 | = | 722.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2479 | Cell line | OAW-28 | Homo sapiens | IC50 | = | 13852.46 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2480 | Cell line | RH-18 | Homo sapiens | IC50 | = | 15800.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2170 | Cell line | RKO | Homo sapiens | IC50 | = | 4762.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2155 | Cell line | SHP77 | Homo sapiens | IC50 | = | 1914.59 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2481 | Cell line | SW1088 | Homo sapiens | IC50 | = | 6443.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2482 | Cell line | SW 1116 | Homo sapiens | IC50 | = | 12884.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2483 | Cell line | SW13 | Homo sapiens | IC50 | = | 8043.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2173 | Cell line | TE-6 | Homo sapiens | IC50 | = | 11032.73 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2161 | Cell line | no-11 | Homo sapiens | IC50 | = | 11195.57 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2175 | Cell line | GAK | Homo sapiens | IC50 | = | 8806.09 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2484 | Cell line | GAMG | Homo sapiens | IC50 | = | 804.97 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2176 | Cell line | HD-MY-Z | Homo sapiens | IC50 | = | 309.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2485 | Cell line | IA-LM | Homo sapiens | IC50 | = | 13723.04 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2486 | Cell line | IGR-1 | Homo sapiens | IC50 | = | 2738.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2165 | Cell line | KNS-42 | Homo sapiens | IC50 | = | 22979.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2487 | Cell line | KNS-62 | Homo sapiens | IC50 | = | 5912.16 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2180 | Cell line | LC-2-ad | Homo sapiens | IC50 | = | 2162.7 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2488 | Cell line | MDA-MB-453 | Homo sapiens | IC50 | = | 5897.94 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1773 | Cell line | ME-180 | Homo sapiens | IC50 | = | 587.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2169 | Cell line | MZ7-mel | Homo sapiens | IC50 | = | 11182.9 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2489 | Cell line | MeWo | Homo sapiens | IC50 | = | 3735.22 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2490 | Cell line | NCI-H1666 | Homo sapiens | IC50 | = | 448.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2491 | Cell line | NCI-H1693 | Homo sapiens | IC50 | = | 6680.28 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2184 | Cell line | NCI-H510A | Homo sapiens | IC50 | = | 4791.54 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2492 | Cell line | OAW-42 | Homo sapiens | IC50 | = | 8417.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2493 | Cell line | OC-314 | Homo sapiens | IC50 | = | 686.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2494 | Cell line | RMG-I | Homo sapiens | IC50 | = | 10692.98 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2188 | Cell line | SJSA-1 | Homo sapiens | IC50 | = | 15658.5 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2495 | Cell line | SW1417 | Homo sapiens | IC50 | = | 1913.34 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2496 | Cell line | SW1463 | Homo sapiens | IC50 | = | 11376.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1577 | Cell line | SW1573 | Homo sapiens | IC50 | = | 11519.79 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2174 | Cell line | TE-8 | Homo sapiens | IC50 | = | 8756.99 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2189 | Cell line | TE-9 | Homo sapiens | IC50 | = | 3470.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2190 | Cell line | GB-1 | Homo sapiens | IC50 | = | 15399.78 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2177 | Cell line | HDLM-2 | Homo sapiens | IC50 | = | 10.04 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2497 | Cell line | HEC-1 | Homo sapiens | IC50 | = | 8075.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2178 | Cell line | KNS-81-FD | Homo sapiens | IC50 | = | 9632.43 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2498 | Cell line | KOSC-2 | Homo sapiens | IC50 | = | 2342.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2499 | Cell line | KP-4 | Homo sapiens | IC50 | = | 3154.03 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2500 | Cell line | LCLC-103H cell line | n.a. | IC50 | = | 173.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2181 | Cell line | MEG-01 | Homo sapiens | IC50 | = | 99.44 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2501 | Cell line | MEL-HO | Homo sapiens | IC50 | = | 2928.93 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2503 | Cell line | NCI-H1703 | Homo sapiens | IC50 | = | 20308.77 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2504 | Cell line | NCI-H1755 | Homo sapiens | IC50 | = | 287.21 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2505 | Cell line | NCI-H520 | n.a. | IC50 | = | 1389.32 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2185 | Cell line | OCI-AML2 | Homo sapiens | IC50 | = | 265.63 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2199 | Cell line | OCUB-M | Homo sapiens | IC50 | = | 22246.22 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2506 | Cell line | RO82-W-1 | Homo sapiens | IC50 | = | 7240.89 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2507 | Cell line | RPMI-2650 | Homo sapiens | IC50 | = | 6187.82 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1086 | Cell line | SK-HEP1 | Homo sapiens | IC50 | = | 1053.35 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2508 | Cell line | SW1710 | Homo sapiens | IC50 | = | 5961.88 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2509 | Cell line | SW1783 | Homo sapiens | IC50 | = | 15764.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1354 | Cell line | TGBC11TKB | Homo sapiens | IC50 | = | 18254.62 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2202 | Cell line | TGBC1TKB | Homo sapiens | IC50 | = | 7617.41 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2191 | Cell line | GCIY | Homo sapiens | IC50 | = | 12385.3 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2510 | Cell line | GCT | Homo sapiens | IC50 | = | 16594.23 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2192 | Cell line | HEL | Homo sapiens | IC50 | = | 11.45 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2511 | Cell line | HGC-27 | Homo sapiens | IC50 | = | 3798.74 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2205 | Cell line | IST-MEL1 | Homo sapiens | IC50 | = | 126.38 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2206 | Cell line | IST-MES1 | Homo sapiens | IC50 | = | 20665.76 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2207 | Cell line | KP-N-YN | Homo sapiens | IC50 | = | 18849.42 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2208 | Cell line | KP-N-YS | Homo sapiens | IC50 | = | 3396.1 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2512 | Cell line | LCLC-97TM1 | Homo sapiens | IC50 | = | 422.2 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2513 | Cell line | LK-2 | Homo sapiens | IC50 | = | 317.51 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2514 | Cell line | LN-405 | Homo sapiens | IC50 | = | 3363.25 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2502 | Cell line | MEL-JUSO | Homo sapiens | IC50 | = | 4744.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2515 | Cell line | MFE-280 | Homo sapiens | IC50 | = | 13761.05 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2210 | Cell line | NB10 | Homo sapiens | IC50 | = | 5512.18 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT2197 | Cell line | NCI-H1770 | Homo sapiens | IC50 | = | 1.983 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT1669 | Cell line | NCI-H1792 | Homo sapiens | IC50 | = | 114.24 | nM | DOI[10.6019/CHEMBL1201861] |
| NPT83 | Cell line | MCF7 | Homo sapiens | TGI | > | 100000.0 | nM | PMID[23831811] |
| NPT139 | Cell line | HT-29 | Homo sapiens | TGI | > | 100000.0 | nM | PMID[23831811] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | = | 40.0 | nM | PMID[23831811] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 60.0 | nM | PMID[23831811] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 3450.0 | nM | PMID[23968824] |
| NPT407 | Cell line | COLO 205 | Homo sapiens | IC50 | = | 3270.0 | nM | PMID[23968824] |
| NPT886 | Cell line | NIH3T3 | Mus musculus | IC50 | = | 0.24 | ug.mL-1 | DOI[10.1007/s00044-013-0773-3] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 0.16 | ug.mL-1 | DOI[10.1007/s00044-013-0773-3] |
| NPT492 | Cell line | Caco-2 | Homo sapiens | IC50 | = | 0.32 | ug.mL-1 | DOI[10.1007/s00044-013-0773-3] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 0.23 | ug.mL-1 | DOI[10.1007/s00044-013-0773-3] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20.0 | nM | PMID[24111942] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.0 | nM | PMID[24111942] |
| NPT168 | Cell line | P388 | Mus musculus | Activity | = | 56.0 | mg kg-1 | PMID[490545] |
| NPT168 | Cell line | P388 | Mus musculus | Activity | = | 102.0 | mg kg-1 | PMID[490545] |
| NPT91 | Cell line | KB | Homo sapiens | ED50 | = | 0.004 | ug ml-1 | PMID[448685] |
| NPT91 | Cell line | KB | Homo sapiens | Ratio ED50 | = | 1.0 | n.a. | PMID[448685] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20.0 | nM | PMID[25234128] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.0 | nM | PMID[25234128] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 10.0 | nM | PMID[25668494] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 13.0 | nM | PMID[25668494] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 990.0 | nM | PMID[25668494] |
| NPT4590 | Cell line | EL4 | Mus musculus | IC50 | = | 5100.0 | nM | PMID[25951057] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 24.0 | nM | PMID[26994844] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[27031212] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 800.0 | nM | PMID[27031212] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 10.0 | nM | PMID[27017552] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 990.0 | nM | PMID[27017552] |
| NPT376 | Cell line | A498 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[27217001] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[27217001] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[27217001] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 22.0 | nM | PMID[27217001] |
| NPT1083 | Cell line | A-375 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[27217001] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[27217001] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 22.7 | nM | PMID[28152430] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[28152430] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 13.5 | nM | PMID[28152430] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | IC50 | = | 72.0 | nM | PMID[28152430] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 15.0 | nM | PMID[28177228] |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | = | 24.0 | nM | PMID[28177228] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 22.0 | nM | PMID[28830032] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 97.0 | nM | PMID[28830032] |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | = | 38.0 | nM | PMID[28711701] |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | = | 14.0 | nM | PMID[28711701] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | GI50 | = | 72.0 | nM | PMID[28711701] |
| NPT165 | Cell line | HeLa | Homo sapiens | GI50 | > | 100000.0 | nM | PMID[28711701] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 130.0 | nM | PMID[28711701] |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | > | 100000.0 | nM | PMID[28711701] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 62.0 | % | PMID[28711701] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 38.0 | % | PMID[28711701] |
| NPT81 | Cell line | A549 | Homo sapiens | Activity | = | 0.0 | % | PMID[28711701] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 6.0 | nM | PMID[29425443] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 20.0 | nM | PMID[29425443] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[29691154] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 130.0 | nM | PMID[29691154] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 25.0 | nM | PMID[29691154] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 32.7 | nM | PMID[29468872] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 39.33 | ug.mL-1 | PMID[30554970] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 47.82 | ug.mL-1 | PMID[30554970] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 31.48 | ug.mL-1 | PMID[30554970] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 5020.0 | nM | PMID[31260892] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 159200.0 | nM | PMID[31260892] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Ratio IC50 | = | 31.9 | n.a. | PMID[31260892] |
| NPT2482 | Cell line | SW 1116 | Homo sapiens | IC50 | = | 2490.0 | nM | PMID[31260892] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 300.0 | nM | PMID[31260892] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 10.0 | nM | PMID[31200235] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 13.1 | nM | PMID[31200235] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 990.0 | nM | PMID[31200235] |
| NPT737 | Cell line | HUVEC | Homo sapiens | IC50 | = | 6130.0 | nM | PMID[31200235] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 27090.0 | nM | PMID[31404864] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 9.8 | nM | PMID[31843461] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 8.9 | nM | PMID[31843461] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 35.0 | nM | PMID[31843461] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | = | 28.6 | nM | PMID[31843461] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 59.3 | nM | PMID[31843461] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 21.0 | nM | PMID[31843461] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 17.0 | % | PMID[31843461] |
| NPT116 | Cell line | HL-60 | Homo sapiens | Activity | = | 14.0 | % | PMID[31843461] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[32676149] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 820.0 | nM | PMID[32676149] |
| NPT165 | Cell line | HeLa | Homo sapiens | Ratio IC50 | = | 1.8 | n.a. | PMID[32676149] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | = | 50.0 | % | PMID[33479665] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 22000.0 | nM | PMID[33479665] |
| NPT83 | Cell line | MCF7 | Homo sapiens | TGI | = | 55.0 | % | PMID[33479665] |
| NPT83 | Cell line | MCF7 | Homo sapiens | TGI | = | 79.92 | % | PMID[33479665] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 15.0 | nM | PMID[33479665] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 27940.0 | nM | PMID[32503691] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 49220.0 | nM | PMID[32503691] |
| NPT2410 | Cell line | NCI-H1299 | Homo sapiens | IC50 | = | 72.0 | nM | PMID[32058237] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 14.0 | nM | PMID[32058237] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 23.0 | nM | PMID[32058237] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[32058237] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[32058237] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[38070351] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 21900.0 | nM | PMID[35964425] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 25320.0 | nM | PMID[35964425] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[26985967] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[26985967] |
| NPT457 | Cell line | BT-549 | Homo sapiens | Inhibition | = | 53.1 | % | PMID[31877541] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 28780.0 | nM | PMID[35964425] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 1230.0 | nM | PMID[38070351] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 334.5 | pg/L | PMID[38070351] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 235.3 | pg/L | PMID[38070351] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 9250.0 | nM | PMID[35964425] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 13690.0 | nM | PMID[35964425] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | IC50 | = | 199.53 | nM | PMID[26985967] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Inhibition | = | 82.8 | % | PMID[31877541] |
| NPT396 | Cell line | T47D | Homo sapiens | Inhibition | = | 53.8 | % | PMID[31877541] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Inhibition | = | 40.1 | % | PMID[31877541] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 15000.0 | nM | PMID[26985967] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[26985967] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 relative | < | 100.0 | nM | ECBD screening data for assay EOS300108 |
| NPT396 | Cell line | T47D | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[26985967] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 15848.93 | nM | PMID[26985967] |
| NPT71 | Cell line | HEK293 | Homo sapiens | Activity | = | 65.0 | % | PMID[26985967] |
| NPT784 | Cell line | MDA-MB-468 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[26985967] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 501.19 | nM | PMID[26985967] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 115.3 | pg/L | PMID[38070351] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 20.0 | nM | PMID[6139480] |
| NPT3577 | Cell line | TA3 | Mus musculus | ID50 | = | 0.008 | M | PMID[7069721] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 0.01 | uM | PMID[6796689] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | ID50 | = | 0.02 | uM | PMID[1548681] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 0.04 | uM | PMID[1548681] |
| NPT80 | Cell line | Raji | Homo sapiens | ID50 | = | 0.02 | uM | PMID[1548681] |
| NPT759 | Cell line | H9 | Homo sapiens | ID50 | = | 0.03 | uM | PMID[1548681] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | = | 0.003 | uM | PMID[6787199] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 0.01 | uM | PMID[6787199] |
| NPT3527 | Cell line | RBL-1 | Rattus norvegicus | ID50 | = | 0.003 | uM | PMID[6787199] |
| NPT137 | Cell line | L1210 | Mus musculus | ID50 | = | 0.012 | uM | PMID[6546949] |
| NPT1868 | Cell line | L1210 (1565) | n.a. | ID50 | < | 0.1 | ug ml-1 | PMID[8258836] |
| NPT319 | Cell line | B16 | Mus musculus | ID50 | < | 0.1 | ug ml-1 | PMID[8258836] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | = | 0.02 | ug ml-1 | PMID[109617] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | = | 0.003 | ug ml-1 | PMID[406398] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | = | 0.006 | 10'-6 mol/L | PMID[565818] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | = | 0.02 | ug ml-1 | PMID[109616] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | = | 0.003 | ug ml-1 | PMID[271739] |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | ID50 | = | 0.018 | ug ml-1 | PMID[409842] |
| NPT924 | Cell line | HSC-2 | Homo sapiens | CC50 | > | 400000.0 | nM | PMID[33744685] |
| NPT19403 | Cell line | SNB- | n.a. | IC50 | > | 1000.0 | nM | PMID[9857098] |
| NPT19405 | Cell line | H35R0.3 | Rattus norvegicus | IC50 | = | 85.0 | nM | PMID[1992121] |
| NPT19405 | Cell line | H35R0.3 | Rattus norvegicus | IC50 | = | 18000.0 | nM | PMID[1992121] |
| NPT19407 | Cell line | R1-CCRF-CEM | Homo sapiens | EC50 | = | 985.0 | nM | PMID[12570380] |
| NPT19412 | Cell line | R2 | Homo sapiens | EC50 | = | 2600.0 | nM | PMID[11960504] |
| NPT19405 | Cell line | H35R0.3 | Rattus norvegicus | IC50 | = | 1800.0 | nM | PMID[6737432] |
| NPT19405 | Cell line | H35R0.3 | Rattus norvegicus | IC50 | = | 906.0 | nM | PMID[2542557] |
| NPT17856 | Cell line | carcinoma cell line | n.a. | EC50 | = | 13.8 | nM | PMID[11052789] |
| NPT17856 | Cell line | carcinoma cell line | n.a. | EC50 | = | 14.5 | nM | PMID[11052789] |
| NPT19407 | Cell line | R1-CCRF-CEM | Homo sapiens | EC50 | = | 565.0 | nM | PMID[16451071] |
| NPT19412 | Cell line | R2 | Homo sapiens | EC50 | = | 2100.0 | nM | PMID[15615522] |
| NPT19412 | Cell line | R2 | Homo sapiens | IC50 | = | 216.0 | nM | PMID[18680275] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 44.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 91.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 92.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 0.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 66.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 1.0 | % | PMID[20485427] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.07 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.11 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.04 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.09 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 79.43 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 100.0 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 31.62 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 39.81 | nM | PMID[19734910] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 63.0 | nM | PMID[19364853] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 40.0 | nM | PMID[19528269] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 49.9 | nM | PMID[19528269] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 83.6 | nM | PMID[19528269] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 84.89 | nM | PMID[19528269] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 83.59 | nM | PMID[19528269] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 56.63 | nM | PMID[19528269] |
| NPT19412 | Cell line | R2 | Homo sapiens | IC50 | = | 216.0 | nM | PMID[21879757] |
| NPT19412 | Cell line | R2 | Homo sapiens | IC50 | = | 121.0 | nM | PMID[21879757] |
| NPT19412 | Cell line | R2 | Homo sapiens | IC50 | = | 121.0 | nM | PMID[24111942] |
| NPT19412 | Cell line | R2 | Homo sapiens | IC50 | = | 120.5 | nM | PMID[24256410] |
| NPT19412 | Cell line | R2 | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[25234128] |
| NPT19412 | Cell line | R2 | Homo sapiens | IC50 | = | 216.0 | nM | PMID[25234128] |
| NPT19431 | Protein family | Thymidylate synthase/GAR transformylase/AICAR transformylase | Homo sapiens | IC50 | = | 10.0 | nM | PMID[28830032] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -4.89 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 45.35 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 49.83 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | = | 50.0 | nM | DOI[10.6019/CHEMBL4495565] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | n.a. | n.a. | % | PMID[34390826] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[34390826] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 14.0 | nM | PMID[34894691] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 0.038 | nM | PMID[35189560] |
| NPT4276 | Organism | Yersinia enterocolitica | Yersinia enterocolitica | MIC | > | 35200.0 | nM | PMID[36586133] |
| NPT28438 | Unchecked | Unchecked | n.a. | Selectivity Index | = | 1.0 | n.a. | PMID[33744685] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 2330.0 | nM | PMID[38070351] |
| NPT1118 | Organism | Streptococcus pneumoniae | Streptococcus pneumoniae | MIC | >= | 2200.0 | nM | PMID[36586133] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 relative | = | 0.0551 | uM | ECBD screening data for assay EOS300033 |
| NPT28438 | Unchecked | Unchecked | n.a. | CC50 | > | 400000.0 | nM | PMID[33744685] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 595.0 | nM | PMID[12408727] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1700.0 | nM | PMID[12408727] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 16.0 | nM | PMID[12408727] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 8.3 | nM | PMID[8632413] |
| NPT19411 | Cell line | D54 cell line | Homo sapiens | IC50 | = | 16.0 | nM | PMID[8632413] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 9.0 | nM | PMID[8632413] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 13.0 | nM | PMID[1992118] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 14.0 | nM | PMID[9022805] |
| NPT610 | Others | Molecular identity unknown | n.a. | IC50 | = | 14.0 | nM | PMID[3872941] |
| NPT610 | Others | Molecular identity unknown | n.a. | IC50 | = | 32.0 | nM | PMID[3872941] |
| NPT610 | Others | Molecular identity unknown | n.a. | IC50 | = | 13.0 | nM | PMID[3872941] |
| NPT610 | Others | Molecular identity unknown | n.a. | IC50 | = | 150.0 | nM | PMID[3872941] |
| NPT610 | Others | Molecular identity unknown | n.a. | IC50 | = | 250.0 | nM | PMID[3872941] |
| NPT610 | Others | Molecular identity unknown | n.a. | IC50 | = | 71.0 | nM | PMID[3872941] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 14.0 | nM | PMID[9022804] |
| NPT19415 | Cell line | H35 | Rattus norvegicus | IC50 | = | 10.0 | nM | PMID[6737432] |
| NPT19418 | Cell line | SCC-7 | Mus musculus | IC50 | = | 5.8 | nM | PMID[8035423] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 100.0 | nM | PMID[17127067] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 8.0 | nM | PMID[17127067] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 12.0 | nM | PMID[18680275] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 114.0 | nM | PMID[18680275] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 461.0 | nM | PMID[18680275] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 106.0 | nM | PMID[18680275] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 211.0 | nM | PMID[18680275] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 25.0 | nM | PMID[19243173] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.01 | ug.mL-1 | PMID[10579858] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IZ | = | 1.0 | mm | PMID[20739103] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IZ | = | 8.0 | mm | PMID[20739103] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 100.0 | nM | PMID[21802949] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 12.0 | nM | PMID[21879757] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 114.0 | nM | PMID[21879757] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 461.0 | nM | PMID[21879757] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 106.0 | nM | PMID[21879757] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 211.0 | nM | PMID[21879757] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 340.0 | nM | PMID[23031590] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 84.0 | nM | PMID[23031590] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 534.0 | nM | PMID[23031590] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 24.0 | nM | PMID[23031590] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 78.66 | % | DOI[10.1007/s00044-012-9979-z] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 54.08 | % | DOI[10.1007/s00044-012-9979-z] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 64.6 | % | DOI[10.1007/s00044-012-9979-z] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2200.0 | nM | DOI[10.1007/s00044-012-0260-2] |
| NPT20 | Organism | Candida albicans | Candida albicans | IZ | = | 8.0 | mm | PMID[23792351] |
| NPT79 | Organism | Bacillus subtilis | Bacillus subtilis | IZ | = | 8.0 | mm | PMID[23792351] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 5250.0 | nM | PMID[23968824] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 211.0 | nM | PMID[24111942] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 106.0 | nM | PMID[24111942] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 461.0 | nM | PMID[24111942] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 114.0 | nM | PMID[24111942] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 12.0 | nM | PMID[24111942] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 1000.0 | nM | PMID[24256410] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 400.0 | nM | PMID[137981] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1500.0 | nM | PMID[137981] |
| NPT4130 | Organism | Lactobacillus rhamnosus | Lactobacillus rhamnosus | GI50 | = | 0.04 | nM | PMID[409842] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 15.0 | nM | PMID[26994844] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 13.0 | nM | PMID[27017552] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 2400.0 | nM | PMID[27112448] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 15800.0 | nM | PMID[27186821] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 750.0 | nM | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 250.0 | nM | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1090.0 | nM | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 410.0 | nM | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 9490.0 | nM | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 24.65 | % | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 32.69 | % | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 29.19 | % | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 44.97 | % | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 50.65 | % | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | TGI | = | 50.84 | % | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 115.14 | mm3 | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 153.09 | mm3 | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 189.83 | mm3 | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 223.6 | mm3 | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 271.71 | mm3 | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 335.97 | mm3 | PMID[27886545] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 440.75 | mm3 | PMID[27886545] |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 3380.0 | nM | PMID[30827867] |
| NPT602 | Organism | Mycobacterium smegmatis | Mycobacterium smegmatis | MIC | = | 2200000.0 | nM | PMID[31103404] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | = | 6100.0 | nM | PMID[36961984] |
| NPT334 | Organism | Vaccinia virus | Vaccinia virus | EC50 | = | 2200.0 | nM | PMID[36961984] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | ID50 | = | 0.003 | ug ml-1 | PMID[406398] |
| NPT22224 | Cell line | Vero C1008 | Chlorocebus sabaeus | CC50 | = | 50.0 | nM | DOI[10.6019/CHEMBL4495565] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.00007 | ug.mL-1 | PMID[6767031] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 500.0 | ug.mL-1 | PMID[6767031] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.000017 | ug.mL-1 | PMID[6403710] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 500.0 | ug.mL-1 | PMID[6403710] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.03 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.09 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.2 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.8 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 2.2 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 27.0 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.85 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 3.4 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 560.0 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 2600.0 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 1200.0 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 8000.0 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 100.0 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 6.0 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 1.1 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.18 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.28 | nM | PMID[2447278] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.000009 | ug.mL-1 | PMID[3091834] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 500.0 | ug.mL-1 | PMID[3091834] |
| NPT19406 | Cell line | L1210 ( R81) | Mus musculus | IC50 | = | 197000.0 | nM | PMID[2898531] |
| NPT19406 | Cell line | L1210 ( R81) | Mus musculus | IC50 | = | 220000.0 | nM | PMID[2871191] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | Activity | = | 0.006 | n.a. | PMID[8632413] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | Activity | = | 0.05 | n.a. | PMID[8632413] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.000012 | ug.mL-1 | PMID[2423690] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 500.0 | ug.mL-1 | PMID[2423690] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.000013 | ug.mL-1 | PMID[3712374] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 13.0 | nM | PMID[7108907] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 10000000.0 | nM | PMID[7108907] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.00002 | nM | PMID[2498518] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.03 | nM | PMID[3091832] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 1000000.0 | nM | PMID[3091832] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.00002 | ug.mL-1 | PMID[3100797] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 500.0 | ug.mL-1 | PMID[3100797] |
| NPT19406 | Cell line | L1210 ( R81) | Mus musculus | IC50 | = | 200000.0 | nM | PMID[3385730] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | Inhibition | = | 0.005 | % | PMID[6699882] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | Inhibition | > | 5.0 | % | PMID[6699882] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.05 | nM | PMID[3121855] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | > | 0.00001 | nM | PMID[3121855] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.00001 | ug.mL-1 | PMID[6793726] |
| NPT19406 | Cell line | L1210 ( R81) | Mus musculus | IC50 | = | 205000.0 | nM | PMID[3968685] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | Ratio | = | 8.0 | n.a. | PMID[22483632] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 640.0 | ug.mL-1 | PMID[22483632] |
| NPT18 | Organism | Pseudomonas aeruginosa | Pseudomonas aeruginosa | IZ | = | 8.0 | mm | PMID[23792351] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | IZ | = | 8.0 | mm | PMID[23792351] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | IZ | = | 8.0 | mm | PMID[23792351] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 64.0 | ug.mL-1 | PMID[24428639] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.00001 | ug.mL-1 | PMID[109616] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.06 | nM | PMID[137981] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | IC50 | = | 0.01 | nM | PMID[137981] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | Ratio IC50 | = | 0.17 | n.a. | PMID[137981] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | IC50 | = | 143000.0 | nM | PMID[137981] |
| NPT631 | Tissue | Brain | Mus musculus | Ratio | = | 0.05 | n.a. | PMID[23297298] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 40.0 | ug.mL-1 | PMID[27437079] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 40.0 | ug.mL-1 | PMID[27437079] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 40.0 | ug.mL-1 | PMID[27437079] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | >= | 40.0 | ug.mL-1 | PMID[27437079] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 64000.0 | nM | PMID[27437079] |
| NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | = | 1000000.0 | nM | PMID[27437079] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC50 | = | 20.0 | ug.mL-1 | PMID[27437079] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC90 | = | 100.0 | ug.mL-1 | PMID[27437079] |
| NPT1018 | Organism | Trypanosoma brucei | Trypanosoma brucei | Activity | = | 24.25 | % | PMID[29407968] |
| NPT1018 | Organism | Trypanosoma brucei | Trypanosoma brucei | EC50 | = | 3600.0 | nM | PMID[29407968] |
| NPT1018 | Organism | Trypanosoma brucei | Trypanosoma brucei | EC50 | = | 3500.0 | nM | PMID[29407968] |
| NPT25088 | Protein family | Janus Kinase (JAK) | Homo sapiens | Inhibition | n.a. | n.a. | % | WO-2022122668-A1 |
| NPT3901 | Tissue | Chorioallantoic membrane | Gallus gallus | IC50 | = | 3650.0 | nM | PMID[35276362] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 13.4 | nM | PMID[29656203] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 27.5 | nM | PMID[29656203] |
| NPT4129 | Organism | Lactobacillus casei | Lactobacillus casei | ID50 | = | 0.01 | ug ml-1 | PMID[109617] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.00005 | ug.mL-1 | PMID[6767031] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 3.5 | ug.mL-1 | PMID[6767031] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.0125 | ug.mL-1 | PMID[9379448] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.00012 | ug.mL-1 | PMID[6403710] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 2.9 | ug.mL-1 | PMID[6403710] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 150000.0 | nM | PMID[6403710] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 60000.0 | nM | PMID[6403710] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 15.0 | nM | PMID[9857098] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.0002 | ug.mL-1 | PMID[3091834] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 3.3 | ug.mL-1 | PMID[3091834] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 13.0 | nM | PMID[2918496] |
| NPT841 | Organism | Leishmania major | Leishmania major | EC50 | = | 1000.0 | nM | PMID[3599028] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 9.0 | nM | PMID[6694171] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 1.0 | n.a. | PMID[1992121] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 61.0 | nM | PMID[9016334] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 24.0 | nM | PMID[9016334] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 13.0 | nM | PMID[1992122] |
| NPT27 | Others | Unspecified | n.a. | Ratio | = | 0.024 | n.a. | PMID[2308134] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 3.7 | n.a. | PMID[12408727] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 20.0 | n.a. | PMID[12408727] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 1.0 | n.a. | PMID[12408727] |
| NPT27 | Others | Unspecified | n.a. | Ratio | = | 0.9 | n.a. | PMID[1992148] |
| NPT19408 | Cell line | R2-CCRF-CEM | Homo sapiens | EC50 | = | 2630.0 | nM | PMID[12570380] |
| NPT19409 | Cell line | R30dm-CCRF-CEM | Homo sapiens | EC50 | = | 12.8 | nM | PMID[12570380] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.00026 | ug.mL-1 | PMID[2423690] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 3.0 | ug.mL-1 | PMID[2423690] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 24.0 | nM | PMID[1995880] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 15.0 | nM | PMID[11960504] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.0004 | ug.mL-1 | PMID[3712374] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 90.0 | nM | PMID[7108907] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 7200000.0 | nM | PMID[7108907] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.9 | nM | PMID[2498518] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 4.3 | n.a. | DOI[10.1016/0960-894X(96)00053-4] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.3 | nM | PMID[3091832] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 3900.0 | nM | PMID[3091832] |
| NPT2 | Others | Unspecified | n.a. | Kd | = | 10.0 | n.a. | PMID[8627598] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 0.027 | n.a. | PMID[8627598] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 4.4 | n.a. | PMID[8627598] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 4.5 | nM | PMID[8627598] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 20.0 | nM | PMID[8627598] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 30.0 | nM | PMID[8627598] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 675.0 | nM | PMID[10956221] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 1600.0 | nM | PMID[10956221] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 14.0 | nM | PMID[10956221] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.00012 | ug.mL-1 | PMID[3100797] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 2.9 | ug.mL-1 | PMID[3100797] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 9200.0 | nM | PMID[10360757] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 14500.0 | nM | PMID[8568828] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | Inhibition | = | 0.15 | % | PMID[6699882] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | Inhibition | = | 5000.0 | % | PMID[6699882] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 190.0 | % | PMID[6699882] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.8 | nM | PMID[3121855] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 8000.0 | nM | PMID[3121855] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 10.0 | nM | PMID[2542557] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 243.0 | n.a. | PMID[8035423] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 2.1 | n.a. | PMID[8035423] |
| NPT19409 | Cell line | R30dm-CCRF-CEM | Homo sapiens | EC50 | = | 18.0 | nM | PMID[8164259] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 0.00015 | ug.mL-1 | PMID[6793726] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 9.0 | nM | PMID[3968685] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 18.0 | nM | PMID[3968685] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 15.0 | nM | PMID[3968685] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 25.0 | nM | PMID[3968685] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 0.00502 | ug.mL-1 | PMID[1847428] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 6.6 | nM | PMID[16451071] |
| NPT19408 | Cell line | R2-CCRF-CEM | Homo sapiens | EC50 | = | 1700.0 | nM | PMID[16451071] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 0.32 | n.a. | PMID[17269758] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 23000.0 | nM | PMID[17269758] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 6.6 | nM | PMID[17552508] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 3.33 | n.a. | PMID[17552508] |
| NPT19419 | Cell line | SNB-7 | Homo sapiens | IC50 | > | 60.0 | ug.mL-1 | PMID[17569517] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 180.0 | nM | PMID[17383876] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 33.0 | nM | PMID[18072727] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 8.8 | nM | PMID[18072727] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.6 | n.a. | PMID[18072727] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 600.0 | nM | PMID[18800768] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 3.3 | n.a. | PMID[18605720] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2.0 | n.a. | PMID[18605720] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.6 | n.a. | PMID[19719239] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 152.0 | nM | PMID[19916554] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 10.0 | n.a. | PMID[19916554] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 1000.0 | n.a. | PMID[19916554] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 90000.0 | nM | PMID[20056546] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 19.0 | nM | PMID[20092323] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 68.6 | nM | PMID[18794380] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 3.0 | n.a. | PMID[21550809] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 1000.0 | nM | PMID[21879757] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 4.0 | n.a. | PMID[23031590] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 22.0 | n.a. | PMID[23031590] |
| NPT2 | Others | Unspecified | n.a. | Ratio Ki | = | 3.0 | n.a. | PMID[22946585] |
| NPT2 | Others | Unspecified | n.a. | Ratio Ki | = | 0.0 | n.a. | PMID[22946585] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 53.85 | % | DOI[10.1007/s00044-012-9979-z] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.9 | n.a. | PMID[23627352] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 11.0 | n.a. | PMID[23627352] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.22 | nM | PMID[23627352] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.34 | n.a. | PMID[23627352] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 5.1 | nM | PMID[23627352] |
| NPT27 | Others | Unspecified | n.a. | IC50 | > | 1000.0 | nM | PMID[24111942] |
| NPT27 | Others | Unspecified | n.a. | IC50 | = | 216.0 | nM | PMID[24111942] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 26.0 | nM | PMID[448685] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 1.0 | n.a. | PMID[448685] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | Ratio IC50 | = | 5.0 | n.a. | PMID[137981] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 4.0 | n.a. | PMID[137981] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 2.0 | nM | PMID[137981] |
| NPT1531 | Organism | Enterococcus faecium | Enterococcus faecium | IC50 | = | 10.0 | nM | PMID[137981] |
| NPT471 | Organism | Trypanosoma brucei brucei | Trypanosoma brucei brucei | IC50 | = | 3660.0 | nM | PMID[25007262] |
| NPT471 | Organism | Trypanosoma brucei brucei | Trypanosoma brucei brucei | IC50 | = | 11.0 | nM | PMID[25007262] |
| NPT27 | Others | Unspecified | n.a. | Ratio | = | 0.9 | n.a. | PMID[21051535] |
| NPT27 | Others | Unspecified | n.a. | Ratio | = | 14.0 | n.a. | PMID[21051535] |
| NPT27 | Others | Unspecified | n.a. | Ratio | = | -11.0 | n.a. | PMID[21051535] |
| NPT27 | Others | Unspecified | n.a. | Ratio | = | 30.0 | n.a. | PMID[21051535] |
| NPT27 | Others | Unspecified | n.a. | Ratio | = | 0.8 | n.a. | PMID[21051535] |
| NPT790 | Organism | Mycobacterium tuberculosis H37Rv | Mycobacterium tuberculosis H37Rv | MIC | = | 968.0 | nM | PMID[26617968] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.194 | n.a. | PMID[26617968] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 100000.0 | nM | PMID[26994844] |
| NPT27 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.0 | n.a. | PMID[27217001] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.066 | n.a. | PMID[27994750] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 6.6 | nM | PMID[28258797] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 88.0 | % | PMID[29072452] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.2 | n.a. | PMID[29274493] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 114.0 | nM | PMID[29425443] |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 1000.0 | nM | PMID[29425443] |
| NPT2 | Others | Unspecified | n.a. | EC50 | = | 280.0 | nM | PMID[31549836] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 149880.0 | nM | PMID[31404864] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.061 | n.a. | PMID[30624926] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 114.0 | nM | PMID[27458733] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.194 | n.a. | PMID[30827867] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 0.35 | nM | PMID[31103404] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 11714.0 | n.a. | PMID[31103404] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 216.0 | nM | PMID[32503687] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 12.0 | nM | PMID[32503687] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 114.0 | nM | PMID[32503687] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 106.0 | nM | PMID[32503687] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 121.0 | nM | PMID[32503687] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 2900.0 | nM | PMID[32676149] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1800.0 | nM | PMID[32676149] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.6 | n.a. | PMID[32676149] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.9 | n.a. | PMID[32676149] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2.2 | n.a. | PMID[32676149] |
| NPT471 | Organism | Trypanosoma brucei brucei | Trypanosoma brucei brucei | GI | = | 19.0 | % | PMID[31982652] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 5190.0 | nM | PMID[33773393] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 5480.0 | nM | PMID[33347967] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 500000.0 | nM | PMID[33214838] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 10.0 | nM | PMID[33214838] |
| NPT2 | Others | Unspecified | n.a. | ID50 | = | 0.03 | uM | PMID[1548681] |
| NPT2 | Others | Unspecified | n.a. | CC50 | > | 10000.0 | nM | PMID[31549836] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT137 | Cell line | L1210 | Mus musculus | Survival | = | 17.2 | day | PMID[2898531] |
| NPT5516 | Cell line | EBV-positive nasopharyngealcell lines | n.a. | Survival | < | 0.01 | n.a. | PMID[6685770] |
| NPT5516 | Cell line | EBV-positive nasopharyngealcell lines | n.a. | Survival | = | 0.4 | n.a. | PMID[6685770] |
| NPT137 | Cell line | L1210 | Mus musculus | Survival | = | 68.0 | % | PMID[915899] |
| NPT137 | Cell line | L1210 | Mus musculus | Survival | = | 61.0 | % | PMID[915899] |
| NPT137 | Cell line | L1210 | Mus musculus | Survival | = | 48.0 | % | PMID[915899] |
| NPT137 | Cell line | L1210 | Mus musculus | Survival | = | 81.0 | % | PMID[915899] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Survival | > | 60.0 | % | PMID[33479665] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | Survival | = | 35.0 | % | PMID[33479665] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 31.0 | nM | PMID[8201595] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 3.28 | nM | PMID[4020824] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 78.0 | % | PMID[6546949] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 100.0 | % | PMID[6546949] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 133.0 | % | PMID[6546949] |
| NPT32 | Organism | Mus musculus | Mus musculus | Ki | = | 4200.0 | nM | PMID[8340923] |
| NPT32 | Organism | Mus musculus | Mus musculus | Kd | = | 220.0 | n.a. | PMID[8627598] |
| NPT32 | Organism | Mus musculus | Mus musculus | Ki | = | 0.004 | n.a. | PMID[8627598] |
| NPT32 | Organism | Mus musculus | Mus musculus | Ki | = | 0.13 | n.a. | PMID[8627598] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 16.8 | n.a. | PMID[16539384] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.17 | mm | PMID[19010675] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.46 | mm | PMID[19010675] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 15.0 | mg kg-1 | PMID[409842] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 49.0 | % | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 38.0 | % | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | FC | = | 2.1 | n.a. | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | FC | = | 2.0 | n.a. | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | FC | = | 2.8 | n.a. | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 66.0 | % | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 76.0 | % | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 25.28 | g | PMID[27886545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 25.47 | g | PMID[27886545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 24.88 | g | PMID[27886545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 23.98 | g | PMID[27886545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 21.85 | g | PMID[27886545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 21.62 | g | PMID[27886545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 21.4 | g | PMID[27886545] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 60.0 | % | PMID[31368705] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 83.0 | % | PMID[27476421] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 63.0 | % | PMID[27476421] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 53.1 | % | PMID[37167779] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[37883692] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Kd | = | 0.0048 | n.a. | PMID[8627598] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Kd | = | 0.443 | n.a. | PMID[8627598] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Kd | = | 10.0 | n.a. | PMID[8627598] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Ki | = | 0.0034 | n.a. | PMID[8627598] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Ki | = | 0.289 | n.a. | PMID[8627598] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Ki | = | 3.5 | n.a. | PMID[8627598] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 32.0 | nM | PMID[3462394] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 6600.0 | nM | PMID[3462394] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 17.2 | nM | PMID[9554874] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 0.7 | % | PMID[20022146] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.058 | mg.kg-1 | PMID[9379448] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 20.0 | % | PMID[19010675] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 181.7 | g | PMID[25516790] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.2795 | inches | PMID[25516790] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[33992926] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Mus musculus | n.a. | Cmax | = | 200.0 | nM | PMID[34843241] |
| Mus musculus | n.a. | Tmax | = | 1.0 | hr | PMID[34843241] |
| Mus musculus | n.a. | Cmax | = | 100.0 | nM | PMID[34843241] |
| Mus musculus | n.a. | AUC | = | 272.67 | ng.hr.mL-1 | PMID[34843241] |
| Mus musculus | n.a. | AUC | = | 181.78 | ng.hr.mL-1 | PMID[34843241] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC331654 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| NPC |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC331654 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD3968 | Phase 4 |
| 0.7738 | Intermediate Similarity | NPD3967 | Approved |
| 0.6484 | Remote Similarity | NPD3410 | Approved |
| 0.6484 | Remote Similarity | NPD3411 | Phase 2 |
| 0.6484 | Remote Similarity | NPD5510 | Phase 4 |
| 0.5283 | Remote Similarity | NPD5046 | Discontinued |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
