Drug Information| Drug ID:   | NPD5510 |
| Drug Name:   | Pralatrexate |
| Molecular Formula:   | C23H23N7O5 |
| Canonical SMILES:   | C#CCC(c1ccc(cc1)C(=O)N[C@H](C(=O)O)CCC(=O)O)Cc1cnc2c(n1)c(N)[nH]c(=N)n2 |
| Standard InCHI:   | "InChI=1S/C23H23N7O5/c1-2-3-14(10-15-11-26-20-18(27-15)19(24)29-23(25)30-20)12-4-6-13(7-5-12)21(33)28-16(22(34)35)8-9-17(31)32/h1,4-7,11,14,16H,3,8-10H2,(H,28,33)(H,31,32)(H,34,35)(H4,24,25,26,29,30)/t14?,16-/m0/s1" |
| Standard InCHIKey:   | OGSBUKJUDHAQEA-WMCAAGNKSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5510Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 477.18 |
| ALogP   | -2.4829 |
| MLogP   | 2.67 |
| XLogP   | 0.039 |
| HDA   | 12 |
| HBD   | 6 |
| Rotatable Bonds   | 14 |
| TPSA   | 203.74 |
| RO5 Violation   | 3 |