NPASS Compound

Natural Product: NPC305000

Natural Product ID	NPC305000
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FNIRVWPHRMMRQI-RFMRREALSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	16757287
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 124129 0 0 0 0 0 0 0 0999 V2000 9.7828 0.9315 -2.0290 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6983 0.0548 -0.8297 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7837 -0.8867 -0.7016 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7491 -1.2019 -1.6836 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3189 -1.0823 -1.2356 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9150 0.2994 -0.8199 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7036 0.8325 0.3363 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4731 0.6032 -0.7833 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8940 0.4256 -2.1725 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3704 0.5204 -1.9934 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2179 0.5343 -0.5328 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2320 2.0010 -0.1190 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5034 -0.1325 0.0061 C 0 0 2 0 0 0 0 0 0 0 0 0 3.5024 -0.0985 1.4665 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2099 -0.5118 2.1347 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0256 0.0841 1.4613 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2726 -0.0469 2.2125 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5671 -1.4956 2.3895 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2354 0.5378 3.5758 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4179 2.0337 3.5912 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7555 2.4302 3.0903 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3493 1.4646 2.0426 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9461 2.4399 1.0297 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4931 0.7116 2.6067 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2705 0.7388 1.3834 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4943 -0.0737 0.1833 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2378 0.1842 -0.7157 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0037 -0.2082 0.0198 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2480 -1.6732 -0.3440 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5573 0.0684 -0.6333 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1791 -1.0912 -0.9973 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6408 -1.1911 -0.8804 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0017 -2.6828 -0.8298 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9497 -3.4868 -1.5553 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1735 -2.7371 -2.5639 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8084 -2.8739 -3.9593 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1216 -4.2020 -4.2201 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8837 -1.4296 -2.3464 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1630 -4.1972 -0.6412 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2735 -2.9062 -1.3290 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1745 -0.5435 0.1834 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2130 0.3207 -0.1504 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5195 -0.0045 0.5224 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1917 1.2404 1.0731 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1683 2.3798 0.0786 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8646 2.3883 -0.6559 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9319 1.6497 0.1069 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2551 2.1882 -0.8050 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6320 1.6664 2.2566 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4033 -0.5355 -0.4267 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7127 2.5287 4.1197 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4171 -1.0671 1.9590 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3901 1.0703 -1.9375 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6820 0.2476 0.2691 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6823 0.3021 -2.9433 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8013 1.3658 -2.0795 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0661 1.7619 -2.0188 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8006 -1.4948 0.2039 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9137 -0.6739 -2.6674 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9484 -2.2831 -1.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7452 -1.4036 -2.1601 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1762 -1.8324 -0.4232 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4678 1.5712 0.0266 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0075 1.4557 0.9625 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2066 0.0627 0.9096 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4151 1.6913 -0.4716 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2826 1.1650 -2.8862 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0170 -0.6190 -2.4994 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1043 1.5153 -2.4675 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8134 -0.2084 -2.5738 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1964 2.4343 -0.1264 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7897 2.2145 0.7878 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7175 2.6425 -0.9226 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5354 -1.1953 -0.3071 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8698 0.8721 1.8536 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2782 -0.0652 3.1615 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1415 -1.6054 2.3074 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2019 1.2043 1.5566 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2162 -2.1911 1.6452 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6064 -1.7386 2.6359 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0016 -1.7989 3.3269 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1513 0.1328 4.1117 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5931 0.2664 4.2226 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4290 2.4865 3.0558 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3316 2.3539 4.6576 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6508 3.4625 2.7006 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2491 2.0163 0.0882 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2784 3.3398 0.9212 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8896 2.9013 1.4572 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4220 0.7859 3.7343 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4958 1.1295 2.3775 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5369 -0.3508 2.3801 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6680 1.6556 1.0405 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4334 -1.1958 0.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2560 1.2461 -1.0197 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4216 -0.4253 -1.6101 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8620 -1.7628 -1.2925 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8113 -2.2302 0.3970 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2894 -2.1791 -0.6734 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6782 -1.9160 -0.4250 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1074 -0.8645 -1.8658 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9920 -2.9874 0.2279 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5242 -4.2880 -2.1118 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1817 -3.2721 -2.6829 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1238 -2.5047 -4.7197 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7589 -2.2681 -3.9562 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4374 -4.5930 -4.8430 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1844 -5.1597 -0.7559 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4705 -2.1190 -1.9295 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3280 0.2344 -1.2701 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4223 -0.7396 1.3198 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2544 0.9866 1.2628 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2923 3.3567 0.5805 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4823 3.3782 -0.9095 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0215 1.8124 -1.6157 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0207 1.8109 -0.2932 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0113 2.4293 2.0430 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9695 -1.2575 -0.0612 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3323 2.9011 4.9399 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6966 -0.8362 2.8767 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1759 1.9959 -1.7074 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6945 0.2803 -0.2097 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6852 -0.5868 0.9854 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5208 1.2090 0.7995 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 1 26 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 43 50 1 0 21 51 1 0 14 52 1 0 6 53 1 6 2 54 1 0 13 8 1 0 28 16 1 0 38 31 1 0 47 42 1 0 28 11 1 0 25 17 1 0 1 55 1 0 1 56 1 0 1 57 1 0 3 58 1 0 4 59 1 0 4 60 1 0 5 61 1 0 5 62 1 0 7 63 1 0 7 64 1 0 7 65 1 0 8 66 1 1 9 67 1 0 9 68 1 0 10 69 1 0 10 70 1 0 12 71 1 0 12 72 1 0 12 73 1 0 13 74 1 1 14 75 1 6 15 76 1 0 15 77 1 0 16 78 1 6 18 79 1 0 18 80 1 0 18 81 1 0 19 82 1 0 19 83 1 0 20 84 1 0 20 85 1 0 21 86 1 6 23 87 1 0 23 88 1 0 23 89 1 0 24 90 1 0 24 91 1 0 24 92 1 0 25 93 1 6 26 94 1 1 27 95 1 0 27 96 1 0 29 97 1 0 29 98 1 0 29 99 1 0 31100 1 1 32101 1 6 33102 1 1 34103 1 6 35104 1 6 36105 1 0 36106 1 0 37107 1 0 39108 1 0 40109 1 0 42110 1 6 43111 1 1 44112 1 1 45113 1 1 46114 1 0 46115 1 0 48116 1 0 49117 1 0 50118 1 0 51119 1 0 52120 1 0 53121 1 0 54122 1 0 54123 1 0 54124 1 0 M END

Standard InCHIKey	FNIRVWPHRMMRQI-RFMRREALSA-N
Standard InCHI	InChI=1S/C41H70O13/c1-20(2)10-9-13-41(8,50)21-11-15-39(6)28(21)22(43)16-26-38(5)14-12-27(45)37(3,4)34(38)24(17-40(26,39)7)52-36-33(31(48)30(47)25(18-42)53-36)54-35-32(49)29(46)23(44)19-51-35/h10,21-36,42-50H,9,11-19H2,1-8H3/t21-,22+,23+,24-,25+,26+,27-,28-,29-,30+,31-,32+,33+,34-,35-,36+,38+,39+,40+,41+/m0/s1
SMILES	CC(=CCC[C@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3[C@H](C[C@@]21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	770.48	Volume:	777.99 ? Van der Waals volume.
Dense:	0.99	LogP:	2.356 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.906 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.108 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	33.0
TPSA:	218.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	9.0	Rings:	6.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.121	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.978	Fsp³:	0.951
MCE-18:	133.75 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.677	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.23	Promiscuous compounds:	0.371

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.108	MDCK Permeability:	-5.157
Pgp-inhibitor:	0.0	Pgp-substrate:	0.802
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.114
20% Bioavailability (F20%):	0.838	30% Bioavailability (F30%):	0.935
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.101	MRP1:	0.535
Plasma Protein Binding (PPB):	72.979%	Volume Distribution (VD):	-0.435
Fu:	19.016% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.005
BSEP inhibitor:	0.004

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.044	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.004	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.013
HLM stability:	0.008 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.917

Half-life (T1/2):

2.513

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.034
Human Hepatotoxicity (H-HT):	0.522	Drug-induced Liver Injury (DILI):	0.161
AMES Toxicity:	0.716	Rat Oral Acute Toxicity:	0.014
Maximum Recommended Daily Dose:	0.025	Skin Sensitization:	1.0
Carcinogencity:	0.105	Eye Corrosion:	0.0
Eye Irritation:	0.01	Respiratory Toxicity:	0.081
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.994
Hematotoxicity:	0.74	Drug-induced Nephrotoxicity:	0.977
Genotoxicity:	0.025	RPMI-8226 Immunitoxicity:	0.18
A549 Cytotoxicity:	0.866	Hek293 Cytotoxicity:	0.321
BCF:	0.922 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.257 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.691 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.793 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC305000 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22183
0.1-0.2	23168
0.2-0.3	3829
0.3-0.4	584
0.4-0.5	44
0.5-0.6	22
0.6-0.7	13
0.7-0.8	0
0.8-0.85	5
0.85-0.9	2
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC286969
0.869	High Similarity	NPC472252
0.869	High Similarity	NPC245280
0.8391	Intermediate Similarity	NPC16520
0.8391	Intermediate Similarity	NPC211879
0.8391	Intermediate Similarity	NPC189852
0.8391	Intermediate Similarity	NPC155010
0.8068	Intermediate Similarity	NPC231340
0.7619	Intermediate Similarity	NPC47566
0.7619	Intermediate Similarity	NPC129372
0.7474	Intermediate Similarity	NPC160816
0.7204	Intermediate Similarity	NPC210759
0.71	Intermediate Similarity	NPC6931
0.7097	Intermediate Similarity	NPC194842
0.7033	Intermediate Similarity	NPC473020
0.6667	Remote Similarity	NPC473199
0.6562	Remote Similarity	NPC127801
0.6535	Remote Similarity	NPC305418
0.6495	Remote Similarity	NPC601606
0.6364	Remote Similarity	NPC140446
0.63	Remote Similarity	NPC208594
0.6289	Remote Similarity	NPC288694
0.6211	Remote Similarity	NPC165033
0.6211	Remote Similarity	NPC273879
0.6146	Remote Similarity	NPC229801
0.6105	Remote Similarity	NPC8039
0.6105	Remote Similarity	NPC120123
0.6019	Remote Similarity	NPC203434
0.596	Remote Similarity	NPC307167
0.5769	Remote Similarity	NPC472988
0.5769	Remote Similarity	NPC38217
0.5745	Remote Similarity	NPC609286
0.5743	Remote Similarity	NPC152584
0.5684	Remote Similarity	NPC309425
0.5625	Remote Similarity	NPC114874
0.5532	Remote Similarity	NPC136816
0.5532	Remote Similarity	NPC7341
0.5312	Remote Similarity	NPC472989
0.5312	Remote Similarity	NPC82955
0.5263	Remote Similarity	NPC88000
0.5263	Remote Similarity	NPC4831
0.5263	Remote Similarity	NPC472023
0.5258	Remote Similarity	NPC472899
0.5258	Remote Similarity	NPC472898
0.5152	Remote Similarity	NPC472901
0.5138	Remote Similarity	NPC237071
0.5138	Remote Similarity	NPC238796
0.5059	Remote Similarity	NPC80530
0.5059	Remote Similarity	NPC273410
0.5052	Remote Similarity	NPC131466

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC305000 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7553
0.1-0.2	1552
0.2-0.3	42
0.3-0.4	2
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data