NPASS Compound

Natural Product: NPC236203

Natural Product ID	NPC236203
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	WROHFEWGWYQNPP-QURHSSNOSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10677252
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 140147 0 0 0 0 0 0 0 0999 V2000 9.3729 -2.6928 -0.6036 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3925 -1.6290 -0.0802 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2566 -1.6386 -1.1142 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2475 -0.6373 -0.6977 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0874 -0.4907 -1.5839 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1537 -1.5791 -1.8512 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6239 -2.9633 -2.0656 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1725 -1.4989 -0.6889 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5428 -0.1904 -0.0222 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2363 0.5339 0.2990 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2295 -0.5480 0.1435 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1891 -0.0982 -0.0249 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6938 0.3097 1.3657 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1742 0.7015 1.2827 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8951 -0.5845 0.8563 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3548 -0.5468 1.1471 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2410 -1.1858 0.1466 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.6433 -2.3095 -0.6293 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1945 -2.2316 -0.9166 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4953 -0.9790 -0.5218 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6791 0.0687 -1.5685 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9958 -1.2844 -0.4486 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4833 -1.9784 -1.6687 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9378 -2.4525 -1.3432 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7581 -1.2332 -1.1266 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6432 -0.3317 -2.3175 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8636 -3.5087 0.0898 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8029 -0.1979 -0.6577 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1697 -0.1060 -0.5484 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5119 1.2785 -0.0102 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4944 2.3255 -1.0989 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4223 1.9447 -2.2025 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7578 0.4783 -2.1470 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1461 0.0856 -3.5799 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2074 0.8762 -4.0157 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7159 -0.3331 -1.7900 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5937 2.6944 -2.1449 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1964 2.5789 -1.5258 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7717 1.2476 0.5987 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7334 1.6487 1.9293 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6515 2.8449 2.1479 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9613 2.4042 1.4781 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.4486 1.1178 2.0354 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.4411 0.2084 2.6044 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9136 -0.3299 3.9644 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1781 0.6504 2.7636 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.2243 0.4793 1.0391 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9183 3.4269 1.5345 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8805 3.0179 3.5086 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2568 0.5090 -0.9677 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5076 0.1070 -2.8098 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1174 -0.3255 -0.0178 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2046 -0.5144 0.8522 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9540 0.6473 0.9907 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0040 1.0760 2.4231 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8605 2.3203 2.5638 C 0 0 2 0 0 0 0 0 0 0 0 0 13.1928 2.0393 1.9326 C 0 0 1 0 0 0 0 0 0 0 0 0 13.0550 1.4960 0.5271 C 0 0 1 0 0 0 0 0 0 0 0 0 14.4402 1.0416 0.0980 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3504 0.4251 -1.1441 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2621 0.3632 0.5931 O 0 0 0 0 0 0 0 0 0 0 0 0 13.9774 3.1862 1.9386 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0867 2.5971 3.9168 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7424 1.2685 2.9662 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8545 -3.6615 -0.4879 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3335 -2.6370 -0.0630 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5030 -2.4575 -1.6825 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0507 -1.9147 0.9249 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9403 -2.6533 -1.3036 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7046 -1.2560 -2.0812 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7958 0.3682 -0.7125 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9771 -0.7244 0.3905 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5241 -1.3285 -2.7664 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7024 -3.5291 -2.4738 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8495 -3.5531 -1.1533 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3375 -3.0602 -2.8908 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2174 -2.3619 -0.0266 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0661 -0.3479 0.9355 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2686 0.9921 1.3017 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0620 1.3078 -0.4772 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3201 -1.2636 0.9716 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3005 0.7925 -0.6474 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6149 -0.5418 2.0441 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0912 1.1727 1.7475 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3516 1.5184 0.5847 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4971 0.9794 2.2849 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4514 -1.3676 1.5455 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6410 0.5418 1.2520 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5735 -0.9602 2.1775 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1228 -1.6339 0.6985 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2680 -2.4441 -1.5609 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0649 -2.3412 -2.0338 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6130 -3.0907 -0.4847 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7240 0.3915 -2.0487 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1668 0.9958 -1.2100 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2844 -0.3453 -2.4283 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9186 -2.0359 0.3925 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5200 -1.3456 -2.5586 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0660 -2.9221 -1.7957 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2802 -3.0777 -2.1798 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8349 -3.0735 -0.4172 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5794 -0.9751 -3.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4611 0.3711 -2.4633 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7082 0.2643 -2.3335 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0777 -3.2793 1.0432 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5469 -0.8785 0.1809 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7896 1.6210 0.7572 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8829 3.2627 -0.6196 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9302 2.2294 -3.1751 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6512 0.2903 -1.5151 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2791 0.1810 -4.2668 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4704 -0.9770 -3.6226 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9859 1.2884 -4.8684 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4000 2.1394 -2.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5283 2.4263 -0.8076 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7203 1.9254 2.2570 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2830 3.7610 1.6528 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7025 2.2825 0.3993 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2052 1.3725 2.8372 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4019 -0.7154 1.9521 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0067 -0.4705 3.9436 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6962 0.3790 4.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4509 -1.2866 4.2124 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6492 0.0496 0.3722 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7993 3.0395 1.8375 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7365 2.5613 3.7425 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9439 -0.2699 -3.5475 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4155 0.0436 -1.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4328 0.4559 0.4299 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5036 1.4387 0.3871 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5356 0.2765 2.9855 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3442 3.1825 2.1308 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7119 1.2653 2.5423 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6682 2.2717 -0.1628 H 0 0 0 0 0 0 0 0 0 0 0 0 15.1763 1.8752 0.1060 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7926 0.2994 0.8563 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4586 0.4565 -1.5462 H 0 0 0 0 0 0 0 0 0 0 0 0 14.2441 3.4517 1.0271 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9453 2.1833 4.1970 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2979 0.3899 3.0205 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 18 27 1 0 17 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 31 38 1 0 30 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 44 46 1 0 43 47 1 0 42 48 1 0 41 49 1 0 9 50 1 0 5 51 1 0 2 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 56 63 1 0 55 64 1 0 50 5 1 0 61 54 1 0 25 8 1 0 36 29 1 0 46 40 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 65 1 0 1 66 1 0 1 67 1 0 2 68 1 1 3 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 6 73 1 6 7 74 1 0 7 75 1 0 7 76 1 0 8 77 1 1 9 78 1 1 10 79 1 0 10 80 1 0 11 81 1 1 12 82 1 6 13 83 1 0 13 84 1 0 14 85 1 0 14 86 1 0 15 87 1 1 16 88 1 0 16 89 1 0 17 90 1 1 18 91 1 6 19 92 1 0 19 93 1 0 21 94 1 0 21 95 1 0 21 96 1 0 22 97 1 1 23 98 1 0 23 99 1 0 24100 1 0 24101 1 0 26102 1 0 26103 1 0 26104 1 0 27105 1 0 29106 1 1 30107 1 1 31108 1 1 32109 1 6 33110 1 1 34111 1 0 34112 1 0 35113 1 0 37114 1 0 38115 1 0 40116 1 1 41117 1 6 42118 1 6 43119 1 1 44120 1 6 45121 1 0 45122 1 0 45123 1 0 47124 1 0 48125 1 0 49126 1 0 51127 1 0 52128 1 0 52129 1 0 54130 1 6 55131 1 1 56132 1 6 57133 1 1 58134 1 6 59135 1 0 59136 1 0 60137 1 0 62138 1 0 63139 1 0 64140 1 0 M END

Standard InCHIKey	WROHFEWGWYQNPP-QURHSSNOSA-N
Standard InCHI	InChI=1S/C45H76O19/c1-18(17-58-40-37(55)35(53)32(50)28(15-46)61-40)8-11-45(57)19(2)30-27(64-45)13-24-22-7-6-21-12-26(25(48)14-44(21,5)23(22)9-10-43(24,30)4)60-42-39(36(54)33(51)29(16-47)62-42)63-41-38(56)34(52)31(49)20(3)59-41/h18-42,46-57H,6-17H2,1-5H3/t18-,19+,20+,21+,22-,23+,24+,25-,26-,27+,28-,29-,30+,31+,32-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42-,43+,44+,45?/m1/s1
SMILES	C[C@H](CCC1([C@@H](C)[C@H]2[C@H](C[C@H]3[C@@H]4CC[C@H]5C[C@H]([C@@H](C[C@]5(C)[C@H]4CC[C@]23C)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O1)O)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	920.5	Volume:	885.438 ? Van der Waals volume.
Dense:	1.04	LogP:	0.819 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.639 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.699 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	42.0
TPSA:	307.37 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.096	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.424	Fsp³:	1.0
MCE-18:	159.822 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.619	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.309	Promiscuous compounds:	0.243

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.311	MDCK Permeability:	-5.148
Pgp-inhibitor:	0.0	Pgp-substrate:	0.965
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.924
20% Bioavailability (F20%):	0.517	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.016	MRP1:	0.013
Plasma Protein Binding (PPB):	45.388%	Volume Distribution (VD):	-0.383
Fu:	34.823% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.072
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.869
HLM stability:	0.02 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.17

Half-life (T1/2):

3.43

ADMET: Toxicity

hERG Blockers:	0.016	hERG Blockers (10um):	0.034
Human Hepatotoxicity (H-HT):	0.654	Drug-induced Liver Injury (DILI):	0.81
AMES Toxicity:	0.873	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.026	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.429	Drug-induced Nephrotoxicity:	0.896
Genotoxicity:	0.007	RPMI-8226 Immunitoxicity:	0.186
A549 Cytotoxicity:	0.859	Hek293 Cytotoxicity:	0.604
BCF:	1.426 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.386 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.584 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.799 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11599360]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	seed	n.a.	PMID[21381697]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[37120447]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Plant	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.		Database[Phenol-Explorer]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO8210	Trigonella foenum-graecum	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC236203 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26505
0.1-0.2	19882
0.2-0.3	2803
0.3-0.4	539
0.4-0.5	78
0.5-0.6	32
0.6-0.7	14
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7907	Intermediate Similarity	NPC291203
0.7907	Intermediate Similarity	NPC217205
0.7582	Intermediate Similarity	NPC485601
0.701	Intermediate Similarity	NPC98696
0.6961	Remote Similarity	NPC470861
0.6957	Remote Similarity	NPC222731
0.6931	Remote Similarity	NPC51520
0.6931	Remote Similarity	NPC303069
0.6739	Remote Similarity	NPC294686
0.663	Remote Similarity	NPC485602
0.6374	Remote Similarity	NPC485600
0.6289	Remote Similarity	NPC476538
0.6289	Remote Similarity	NPC476539
0.6122	Remote Similarity	NPC54619
0.604	Remote Similarity	NPC195297
0.6038	Remote Similarity	NPC73243
0.6038	Remote Similarity	NPC244086
0.6038	Remote Similarity	NPC84956
0.5926	Remote Similarity	NPC470863
0.5926	Remote Similarity	NPC247037
0.5888	Remote Similarity	NPC98018
0.5888	Remote Similarity	NPC284104
0.5888	Remote Similarity	NPC103616
0.5888	Remote Similarity	NPC102016
0.5888	Remote Similarity	NPC95051
0.5766	Remote Similarity	NPC249265
0.5714	Remote Similarity	NPC23808
0.5714	Remote Similarity	NPC87998
0.57	Remote Similarity	NPC128123
0.5664	Remote Similarity	NPC84111
0.5664	Remote Similarity	NPC287483
0.5664	Remote Similarity	NPC470865
0.5657	Remote Similarity	NPC477451
0.5625	Remote Similarity	NPC218571
0.5625	Remote Similarity	NPC487615
0.5524	Remote Similarity	NPC485599
0.5455	Remote Similarity	NPC297348
0.5455	Remote Similarity	NPC249204
0.5455	Remote Similarity	NPC48339
0.5455	Remote Similarity	NPC141769
0.5455	Remote Similarity	NPC477547
0.5421	Remote Similarity	NPC473601
0.5392	Remote Similarity	NPC476540
0.5392	Remote Similarity	NPC476541
0.5304	Remote Similarity	NPC83137
0.5192	Remote Similarity	NPC211354
0.5172	Remote Similarity	NPC470862
0.513	Remote Similarity	NPC232611
0.5094	Remote Similarity	NPC107962
0.5086	Remote Similarity	NPC92710

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC236203 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7718
0.1-0.2	1357
0.2-0.3	66
0.3-0.4	8
0.4-0.5	1
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data