Natural Product: NPC166788
Natural Product ID:   | NPC166788 |
Common Name*:   | Thymoquinone |
IUPAC Name:   | 2-methyl-5-propan-2-ylcyclohexa-2,5-diene-1,4-dione |
Synonyms:   | Thymoquinone |
Standard InCHIKey:   | KEQHJBNSCLWCAE-UHFFFAOYSA-N |
Standard InCHI:   | InChI=1S/C10H12O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6H,1-3H3 |
SMILES:   | CC(C)C1=CC(=O)C(=CC1=O)C
|
Synthetic Gene Cluster:   |
n.a. |
ChEMBL Identifier:   |
CHEMBL1672002 |
PubChem CID:   |
10281 |
Chemical Classification**:   |
-
CHEMONTID:0000000 [Organic compounds]
-
[CHEMONTID:0004603] Organic oxygen compounds
-
[CHEMONTID:0000323] Organooxygen compounds
[CHEMONTID:0001831] Carbonyl compounds[CHEMONTID:0000118] Ketones[CHEMONTID:0003487] Cyclic ketones[CHEMONTID:0002495] Quinones[CHEMONTID:0002384] Benzoquinones[CHEMONTID:0002494] P-benzoquinones
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[10869193] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
Leaves |
n.a. |
n.a. |
PMID[12088434] |
NPO27360 |
Pyracantha fortuneana |
Species |
Rosaceae |
Eukaryota |
fruit |
n.a. |
n.a. |
PMID[16872137] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
Berries |
n.a. |
n.a. |
PMID[18314960] |
NPO11654 |
Eusynstyela misakiensis |
Species |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
PMID[19505081] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[21707257] |
NPO15436 |
Brucea mollis |
Species |
Simaroubaceae |
Eukaryota |
stems |
n.a. |
n.a. |
PMID[22070654] |
NPO15436 |
Brucea mollis |
Species |
Simaroubaceae |
Eukaryota |
n.a. |
stem |
n.a. |
PMID[22070654] |
NPO15436 |
Brucea mollis |
Species |
Simaroubaceae |
Eukaryota |
n.a. |
stem |
n.a. |
PMID[24199564] |
NPO22667 |
Plectranthus amboinicus |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[24491635] |
NPO2136 |
Nigella glandulifera |
Species |
Ranunculaceae |
Eukaryota |
Seeds |
n.a. |
n.a. |
PMID[24593120] |
NPO2136 |
Nigella glandulifera |
Species |
Ranunculaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[26227777] |
NPO11654 |
Eusynstyela misakiensis |
Species |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
PMID[7931370] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
Plant |
n.a. |
n.a. |
Database[FooDB] |
NPO23226 |
Satureja montana |
Species |
Lamiaceae |
Eukaryota |
Plant |
n.a. |
n.a. |
Database[FooDB] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
Shoot |
n.a. |
n.a. |
Database[FooDB] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
|
n.a. |
n.a. |
Database[FooDB] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
|
n.a. |
n.a. |
Database[FooDB] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
Essential Oil |
n.a. |
n.a. |
Database[FooDB] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[FooDB] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
Fruit |
n.a. |
n.a. |
Database[FooDB] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[FooDB] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
Leaf |
n.a. |
n.a. |
Database[FooDB] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
Leaf |
n.a. |
n.a. |
Database[FooDB] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
Leaf Essent. Oil |
n.a. |
n.a. |
Database[FooDB] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
Plant |
n.a. |
n.a. |
Database[FooDB] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO12935 |
Thymus quinquecostatus |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[Phenol-Explorer] |
NPO23226 |
Satureja montana |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[Phenol-Explorer] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO12935 |
Thymus quinquecostatus |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO2136 |
Nigella glandulifera |
Species |
Ranunculaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO12935 |
Thymus quinquecostatus |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO15243 |
Pimenta dioica |
Species |
Myrtaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO15618 |
Teucrium luteum |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO12935 |
Thymus quinquecostatus |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO1685 |
Mespilodaphne pretiosa |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO6262 |
Rumphella aggregata |
Species |
Plexauridae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO2136 |
Nigella glandulifera |
Species |
Ranunculaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO3209 |
Anchusa strigosa |
Species |
Boraginaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO13652 |
Laurilia sulcata |
Species |
Corticiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO22667 |
Plectranthus amboinicus |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO19472 |
Thymus vulgaris |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO15532 |
Polygala crotalarioides |
Species |
Polygalaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO11654 |
Eusynstyela misakiensis |
Species |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO27360 |
Pyracantha fortuneana |
Species |
Rosaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO14275 |
Carissa opaca |
Species |
Apocynaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO3904 |
Casearia esculenta |
Species |
Salicaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO15436 |
Brucea mollis |
Species |
Simaroubaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO15152 |
Fagara leprieurii |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO14854 |
Stereocaulon ramulosum |
Species |
Stereocaulaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO12504 |
Penstemon acuminatus |
Species |
Plantaginaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO23226 |
Satureja montana |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration
Organism ID |
NP ID |
Organism Material Preparation |
Organism Part |
NP Quantity (Standard) |
NP Quantity (Minimum) |
NP Quantity (Maximum) |
Quantity Unit |
Reference |
NPO23226 |
NPC166788 |
n.a. |
Plant |
3.8 |
0.1 |
7.5 |
mg/100g |
Database [DUKE] |
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  Biological Activity
Activity Type |
# Activity |
EC50 |
8 |
IC50 |
23 |
Others |
61 |
Activity Type |
# Activity |
Cell Line |
14 |
Individual Protein |
9 |
NON-MOLECULAR |
4 |
Organism |
56 |
Others |
9 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT116 |
Cell Line |
HL-60 |
Homo sapiens |
IC50 |
= |
28000.0 |
nM |
PMID[572455] |
NPT139 |
Cell Line |
HT-29 |
Homo sapiens |
IC50 |
= |
47000.0 |
nM |
PMID[572455] |
NPT859 |
Cell Line |
HFF |
Homo sapiens |
IC50 |
= |
33000.0 |
nM |
PMID[572455] |
NPT66 |
Individual Protein |
Acetylcholinesterase |
Electrophorus electricus |
Inhibition |
= |
7.9 |
% |
PMID[572456] |
NPT1217 |
Individual Protein |
Botulinum neurotoxin type A |
Clostridium botulinum |
Ratio |
= |
0.38 |
/M/s |
PMID[572461] |
NPT165 |
Cell Line |
HeLa |
Homo sapiens |
IC50 |
= |
2060.0 |
nM |
PMID[572462] |
NPT83 |
Cell Line |
MCF7 |
Homo sapiens |
IC50 |
= |
6190.0 |
nM |
PMID[572462] |
NPT3414 |
Individual Protein |
Serine/threonine-protein kinase PLK2 |
Homo sapiens |
IC50 |
= |
14720.0 |
nM |
PMID[572462] |
NPT3358 |
Individual Protein |
Serine/threonine-protein kinase PLK3 |
Homo sapiens |
IC50 |
> |
50000.0 |
nM |
PMID[572462] |
NPT404 |
Cell Line |
CCRF-CEM |
Homo sapiens |
EC50 |
= |
300.0 |
nM |
PMID[572464] |
NPT2251 |
Cell Line |
ADR5000 cell line |
|
EC50 |
= |
300.0 |
nM |
PMID[572464] |
NPT2251 |
Cell Line |
ADR5000 cell line |
|
EC50 |
= |
300.0 |
nM |
PMID[572466] |
NPT404 |
Cell Line |
CCRF-CEM |
Homo sapiens |
EC50 |
= |
300.0 |
nM |
PMID[572466] |
NPT2615 |
Cell Line |
HEK-293T |
Homo sapiens |
CC50 |
= |
140.0 |
ug.mL-1 |
PMID[572467] |
NPT65 |
Cell Line |
HepG2 |
Homo sapiens |
Activity |
= |
3.3 |
% |
PMID[572468] |
NPT65 |
Cell Line |
HepG2 |
Homo sapiens |
Activity |
= |
91.8 |
% |
PMID[572468] |
NPT179 |
Cell Line |
A2780 |
Homo sapiens |
IC50 |
= |
7900.0 |
nM |
PMID[572469] |
NPT381 |
Cell Line |
OVCAR-8 |
Homo sapiens |
IC50 |
= |
11600.0 |
nM |
PMID[572469] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
= |
28000.0 |
nM |
PMID[572455] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
= |
32000.0 |
nM |
PMID[572455] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
= |
27000.0 |
nM |
PMID[572455] |
NPT67 |
Individual Protein |
Cholinesterase |
Equus caballus |
Inhibition |
= |
-0.33 |
% |
PMID[572456] |
NPT1365 |
Organism |
Trichoplusia ni |
Trichoplusia ni |
mortality |
= |
26.7 |
% |
PMID[572457] |
NPT1365 |
Organism |
Trichoplusia ni |
Trichoplusia ni |
DC50 |
= |
19.3 |
microg/cm2 |
PMID[572457] |
NPT1365 |
Organism |
Trichoplusia ni |
Trichoplusia ni |
FDI |
= |
100.0 |
% |
PMID[572457] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
Activity |
= |
93.1 |
mg |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
Activity |
= |
80.6 |
mg |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
Activity |
= |
75.4 |
mg |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
Activity |
= |
74.0 |
mg |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
Activity |
= |
83.5 |
mg |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
Activity |
= |
0.0 |
mg |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
5.0 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
11.7 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
8.3 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
6.7 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
1.7 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
10.0 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
3.3 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
0.0 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
18.3 |
% |
PMID[572458] |
NPT489 |
Organism |
Coptotermes formosanus |
Coptotermes formosanus |
mortality |
= |
100.0 |
% |
PMID[572458] |
NPT72 |
Individual Protein |
Solute carrier organic anion transporter family member 1B3 |
Homo sapiens |
Inhibition |
= |
98.24 |
% |
PMID[572459] |
NPT73 |
Individual Protein |
Solute carrier organic anion transporter family member 1B1 |
Homo sapiens |
Inhibition |
= |
126.43 |
% |
PMID[572459] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
= |
101900.0 |
nM |
PMID[572460] |
NPT831 |
Individual Protein |
Serine/threonine-protein kinase PLK1 |
Homo sapiens |
IC50 |
= |
2180.0 |
nM |
PMID[572462] |
NPT2 |
Others |
Unspecified |
|
Ratio IC50 |
= |
7.0 |
n.a. |
PMID[572462] |
NPT3697 |
Organism |
Leishmania tropica |
Leishmania tropica |
IC50 |
= |
1.16 |
ug.mL-1 |
PMID[572463] |
NPT1021 |
Organism |
Leishmania infantum |
Leishmania infantum |
IC50 |
= |
1.47 |
ug.mL-1 |
PMID[572463] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Cmax |
= |
0.4 |
ug.mL-1 |
PMID[572463] |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Cmax |
= |
0.9 |
ug.mL-1 |
PMID[572463] |
NPT6 |
Organism |
Plasmodium falciparum |
Plasmodium falciparum |
EC50 |
> |
80000.0 |
nM |
PMID[572464] |
NPT2262 |
Organism |
Human herpesvirus 5 strain AD169 |
Human herpesvirus 5 strain AD169 |
EC50 |
> |
10000.0 |
nM |
PMID[572464] |
NPT2 |
Others |
Unspecified |
|
Activity |
= |
24.0 |
% |
PMID[572465] |
NPT2 |
Others |
Unspecified |
|
Activity |
= |
33.0 |
% |
PMID[572465] |
NPT2 |
Others |
Unspecified |
|
Activity |
= |
40.0 |
% |
PMID[572465] |
NPT6 |
Organism |
Plasmodium falciparum |
Plasmodium falciparum |
EC50 |
> |
80000.0 |
nM |
PMID[572466] |
NPT2262 |
Organism |
Human herpesvirus 5 strain AD169 |
Human herpesvirus 5 strain AD169 |
EC50 |
> |
10000.0 |
nM |
PMID[572466] |
NPT831 |
Individual Protein |
Serine/threonine-protein kinase PLK1 |
Homo sapiens |
INH |
= |
2.19 |
ug ml-1 |
PMID[572467] |
NPT6 |
Organism |
Plasmodium falciparum |
Plasmodium falciparum |
IC50 |
= |
1200.0 |
nM |
PMID[572469] |
NPT35 |
Others |
n.a. |
|
Solubility |
= |
467.8 |
ug.mL-1 |
PMID[572469] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
7800.0 |
nM |
PMID[572469] |
NPT6 |
Organism |
Plasmodium falciparum |
Plasmodium falciparum |
IC50 |
= |
25000.0 |
nM |
PMID[572469] |
NPT2 |
Others |
Unspecified |
|
Ratio IC50 |
= |
2.3 |
n.a. |
PMID[572469] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
17800.0 |
nM |
PMID[572469] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
Hit score |
= |
0.1059 |
n.a. |
PMID[572470] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
Hit score |
= |
0.2773 |
n.a. |
PMID[572470] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
IC50 |
> |
20000.0 |
nM |
PMID[572471] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
IC50 |
> |
19952.62 |
nM |
PMID[572471] |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
130000.0 |
nM |
PMID[572472] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
  Chemically structural similarity: I. Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC166788 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 179 |
0.1-0.2 | 6257 |
0.2-0.3 | 20926 |
0.3-0.4 | 9580 |
0.4-0.5 | 4407 |
0.5-0.6 | 1046 |
0.6-0.7 | 224 |
0.7-0.8 | 60 |
0.8-0.85 | 8 |
0.85-0.9 | 8 |
0.9-0.95 | 1 |
0.95-1 | 1 |
  Chemically structural similarity: II. Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC166788 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 161 |
0.1-0.2 | 4305 |
0.2-0.3 | 3805 |
0.3-0.4 | 622 |
0.4-0.5 | 208 |
0.5-0.6 | 39 |
0.6-0.7 | 9 |
0.7-0.8 | 1 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 0 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
0.7333 |
Intermediate Similarity |
NPD5783 |
Phase 3 |
0.7143 |
Intermediate Similarity |
NPD287 |
Approved |
0.6667 |
Remote Similarity |
NPD8779 |
Phase 3 |
0.6462 |
Remote Similarity |
NPD4691 |
Approved |
0.6429 |
Remote Similarity |
NPD539 |
Approved |
0.6349 |
Remote Similarity |
NPD7331 |
Phase 2 |
0.6308 |
Remote Similarity |
NPD4137 |
Phase 3 |
0.6212 |
Remote Similarity |
NPD4747 |
Approved |
0.6176 |
Remote Similarity |
NPD4058 |
Approved |
0.617 |
Remote Similarity |
NPD319 |
Phase 1 |
0.6129 |
Remote Similarity |
NPD2664 |
Clinical (unspecified phase) |
0.6119 |
Remote Similarity |
NPD5276 |
Approved |
0.6094 |
Remote Similarity |
NPD6108 |
Clinical (unspecified phase) |
0.6034 |
Remote Similarity |
NPD4627 |
Clinical (unspecified phase) |
0.5942 |
Remote Similarity |
NPD5733 |
Approved |
0.5942 |
Remote Similarity |
NPD4687 |
Approved |
0.5938 |
Remote Similarity |
NPD7341 |
Phase 2 |
0.5818 |
Remote Similarity |
NPD4220 |
Pre-registration |
0.5758 |
Remote Similarity |
NPD3709 |
Clinical (unspecified phase) |
0.5714 |
Remote Similarity |
NPD4194 |
Approved |
0.5714 |
Remote Similarity |
NPD4191 |
Approved |
0.5714 |
Remote Similarity |
NPD4192 |
Approved |
0.5714 |
Remote Similarity |
NPD4193 |
Approved |
0.5676 |
Remote Similarity |
NPD4695 |
Discontinued |
0.5672 |
Remote Similarity |
NPD3621 |
Clinical (unspecified phase) |
0.5614
|
Remote Similarity |
NPD6927 |
Phase 3 |