Natural Product: NPC46565| Natural Product ID | NPC46565 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Hinokitiol |
| IUPAC Name | hydron;7-oxo-5-propan-2-ylcyclohepta-1,3,5-trien-1-olate |
| Synonyms | beta-thujaplicin |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL48310 |
| PubChem CID |
71773484 3611 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | FUWUEFKEXZQKKA-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C10H12O2/c1-7(2)8-4-3-5-9(11)10(12)6-8/h3-7H,1-2H3,(H,11,12) |
| SMILES | CC(c1cccc(c(=O)c1)O)C |
  Calculated Properties| Molecular Weight:   | 164.08 | Volume:   | 179.994 Van der Waals volume.
|
| Dense:   | 0.912 | LogP:   | 2.195 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 1.917 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -2.33 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 1.0 | Rigid Bonds:   | 8.0 |
| TPSA:   | 37.3 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 2.0 |
| H-Bond Donor:   | 1.0 | Rings:   | 1.0 |
| Heavy Atoms:   | 2.0 |
| QED Drug-Likeness Score:   | 0.688 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 1.935 | Fsp3:   | 0.3 |
| MCE-18:   | 7.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Rejected | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Accepted | BMS Rule:   | 0 |
| Chelating Alert:   | 1 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.168 | Fluc inhibitor:   | 0.242 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.016 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.002 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.975 | Promiscuous compounds:   | 0.316 |
| Caco-2 Permeability:   | -4.681 | MDCK Permeability:   | -4.709 |
| Pgp-inhibitor:   | 0.784 | Pgp-substrate:   | 0.054 |
| PAMPA:   |
0.073 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.134 |
| 20% Bioavailability (F20%):   | 0.65 | 30% Bioavailability (F30%):   | 0.943 |
| 50% Bioavailability (F50%):   | 0.993 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.04 | MRP1:   | 0.872 |
| Plasma Protein Binding (PPB):   | 95.607% | Volume Distribution (VD):   | 0.146 |
| Fu: |
3.47% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.932 |
| OATP1B3 inhibitor:   | 0.987 | BCRP inhibitor:   | 0.523 |
| BSEP inhibitor:   | 0.899 |
| CYP1A2-inhibitor:   | 0.051 | CYP1A2-substrate:   | 0.152 |
| CYP2C19-inhibitor:   | 0.022 | CYP2C19-substrate:   | 0.267 |
| CYP2C9-inhibitor:   | 0.0 | CYP2C9-substrate:   | 0.007 |
| CYP2D6-inhibitor:   | 0.005 | CYP2D6-substrate:   | 0.019 |
| CYP3A4-inhibitor:   | 0.607 | CYP3A4-substrate:   | 0.998 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.988 |
| HLM stability:   |
0.944 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 10.533 | Half-life (T1/2):   | 1.299 |
| hERG Blockers:   | 0.067 | hERG Blockers (10um):   | 0.514 |
| Human Hepatotoxicity (H-HT):   | 0.453 | Drug-induced Liver Injury (DILI):   | 0.135 |
| AMES Toxicity:   | 0.427 | Rat Oral Acute Toxicity:   | 0.383 |
| Maximum Recommended Daily Dose:   | 0.477 | Skin Sensitization:   | 0.474 |
| Carcinogencity:   | 0.496 | Eye Corrosion:   | 0.767 |
| Eye Irritation:   | 0.989 | Respiratory Toxicity:   | 0.716 |
| Drug-induced Neurotoxicity:   | 0.448 | Ototoxicity:   | 0.256 |
| Hematotoxicity:   | 0.398 | Drug-induced Nephrotoxicity:   | 0.531 |
| Genotoxicity:   | 0.746 | RPMI-8226 Immunitoxicity:   | 0.111 |
| A549 Cytotoxicity:   | 0.165 | Hek293 Cytotoxicity:   | 0.334 |
| BCF:   |
1.279 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.626 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.497 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.308 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO7904 | Ganoderma applanatum | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/S0031-9422(00)91122-1] |
| NPO88 | Rheum undulatum | Species | Polygonaceae | Eukaryota | rhizome | n.a. | n.a. |
PMID[10714491] |
| NPO18632 | Elfvingia applanata | Species | n.a. | n.a. | Fruits | n.a. | n.a. |
PMID[11975498] |
| NPO7904 | Ganoderma applanatum | Species | Polyporaceae | Eukaryota | n.a. | Sri Lankan | n.a. |
PMID[16933889] |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | n.a. | stem | n.a. |
PMID[18310955] |
| NPO1533 | Corynespora cassiicola | Species | Corynesporascaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25594263] |
| NPO1533 | Corynespora cassiicola | Species | Corynesporascaceae | Eukaryota | n.a. | Xisha Islands coral reef in the South China Sea | 2009-DEC |
PMID[25594263] |
| NPO7904 | Ganoderma applanatum | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27996259] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32223924] |
| NPO16414 | Thuja plicata | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[36985451] |
| NPO16414 | Thuja plicata | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38794396] |
| NPO18632 | Elfvingia applanata | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16414 | Thuja plicata | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO88 | Rheum undulatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO14163.1 | Hesperocyparis goveniana var. abramsiana | Varieties | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6454 | Delphinium tatsienense | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2553 | Adenocarpus commutatus | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5314 | Sargassum parvivesiculosum | Species | Sargassaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4947 | Tagetes minuta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8197 | Scrophularia deserti | Species | Scrophulariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1533 | Corynespora cassiicola | Species | Corynesporascaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2247 | Iphiona scabra | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7904 | Ganoderma applanatum | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO4947 | Tagetes minuta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO28445 | Juniperus taiwaniana | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO16414 | Thuja plicata | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO6454 | Delphinium tatsienense | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13425 | Hesperocyparis sargentii | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO16414 | Thuja plicata | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO14163.1 | Hesperocyparis goveniana var. abramsiana | Varieties | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7904 | Ganoderma applanatum | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO6454 | Delphinium tatsienense | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO5314 | Sargassum parvivesiculosum | Species | Sargassaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4947 | Tagetes minuta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO28445 | Juniperus taiwaniana | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO7904 | Ganoderma applanatum | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO6454 | Delphinium tatsienense | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO88 | Rheum undulatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO3111 | Daphnandra micrantha | Species | Atherospermataceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8197 | Scrophularia deserti | Species | Scrophulariaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5105 | Lagenaria siceraria | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7904 | Ganoderma applanatum | Species | Polyporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO23693 | Alseodaphne semecarpifolia | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO421 | Polygonum maritimum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6454 | Delphinium tatsienense | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16088 | Streptomyces scabiei | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO88 | Rheum undulatum | Species | Polygonaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18636 | Cupressus macrocarpa | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4947 | Tagetes minuta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1533 | Corynespora cassiicola | Species | Corynesporascaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5314 | Sargassum parvivesiculosum | Species | Sargassaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2553 | Adenocarpus commutatus | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5403 | Fagus menziesii | Species | Fagaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO14163.1 | Hesperocyparis goveniana var. abramsiana | Varieties | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2247 | Iphiona scabra | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7759 | Penicillium nalgiovensis | Species | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13425 | Hesperocyparis sargentii | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4112 | Ficus fistulosa | Species | Moraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5260 | Osteospermum thodei | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7604 | Viguiera lanceolata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16414 | Thuja plicata | Species | Cupressaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18632 | Elfvingia applanata | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1197 | Individual protein | Huntingtin | Homo sapiens | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT3 | Individual protein | Thioredoxin glutathione reductase | Schistosoma mansoni | Potency | = | 89125.1 | nM | PubChem BioAssay data set |
| NPT1119 | Individual protein | Arachidonate 12-lipoxygenase | Homo sapiens | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 631.0 | nM | PubChem BioAssay data set |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | Inhibition | = | 18.0 | % | PMID[21189019] |
| NPT150 | Individual protein | Anthrax lethal factor | Bacillus anthracis | Inhibition | = | 66.0 | % | PMID[21189019] |
| NPT280 | Individual protein | Matrix metalloproteinase 9 | Homo sapiens | Inhibition | = | 99.0 | % | PMID[21189019] |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 18356.4 | nM | PubChem BioAssay data set |
| NPT1139 | Individual protein | Arachidonate 15-lipoxygenase, type II | Homo sapiens | Potency | n.a. | 12589.3 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 56234.1 | nM | PubChem BioAssay data set |
| NPT135 | Individual protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 100000.0 | nM | PubChem BioAssay data set |
| NPT2971 | Individual protein | DNA dC->dU-editing enzyme APOBEC-3F | Homo sapiens | Potency | n.a. | 31622.8 | nM | PubChem BioAssay data set |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | Potency | n.a. | 2238.7 | nM | PubChem BioAssay data set |
| NPT2977 | Individual protein | Thermolysin | Bacillus thermoproteolyticus | IC50 | = | 61000.0 | nM | PMID[14519960] |
| NPT2978 | Individual protein | Collagenase | Clostridium histolyticum | IC50 | = | 24000.0 | nM | PMID[14519960] |
| NPT2979 | Individual protein | Carboxypeptidase A1 | Bos taurus | IC50 | = | 2760.0 | nM | PMID[14519960] |
| NPT160 | Individual protein | TAR DNA-binding protein 43 | Homo sapiens | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT50 | Individual protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 2818.4 | nM | PubChem BioAssay data set |
| NPT55 | Individual protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 14091.9 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT689 | Individual protein | Histone deacetylase 5 | Homo sapiens | Ki | > | 2500.0 | nM | PMID[24900743] |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 7943.3 | nM | PubChem BioAssay data set |
| NPT48 | Individual protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT54 | Individual protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT69 | Individual protein | Matrix metalloproteinase-1 | Homo sapiens | Inhibition | = | 95.0 | % | PMID[21189019] |
| NPT567 | Individual protein | Matrix metalloproteinase 3 | Homo sapiens | Inhibition | = | 98.0 | % | PMID[21189019] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Ki | > | 2500.0 | nM | PMID[24900743] |
| NPT688 | Individual protein | Histone deacetylase 4 | Homo sapiens | Ki | > | 20000.0 | nM | PMID[24900743] |
| NPT684 | Individual protein | Histone deacetylase 1 | Homo sapiens | Ki | > | 2500.0 | nM | PMID[24900743] |
| NPT685 | Individual protein | Histone deacetylase 2 | Homo sapiens | Ki | = | 15.44 | nM | PMID[24900743] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 11.67 | % | DOI[10.6019/CHEMBL4495564] |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 8912.5 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT792 | Individual protein | Arachidonate 15-lipoxygenase | Homo sapiens | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT63 | Individual protein | Bromodomain adjacent to zinc finger domain protein 2B | Homo sapiens | Potency | n.a. | 56234.1 | nM | PubChem BioAssay data set |
| NPT741 | Individual protein | Tyrosinase | Homo sapiens | Ratio IC50 | = | 63.6 | n.a. | PMID[25288494] |
| NPT741 | Individual protein | Tyrosinase | Homo sapiens | IC50 | = | 8980.0 | nM | PMID[25288494] |
| NPT43 | Individual protein | Tyrosinase | Agaricus bisporus | IC50 | = | 90.0 | nM | PMID[25288494] |
| NPT43 | Individual protein | Tyrosinase | Agaricus bisporus | Ki | = | 60.0 | nM | PMID[20947360] |
| NPT53 | Individual protein | 4'-phosphopantetheinyl transferase ffp | Bacillus subtilis | Potency | = | 56234.1 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT56 | Individual protein | Beta-lactamase AmpC | Escherichia coli K-12 | Potency | = | 3548.1 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT570 | Individual protein | Arachidonate 5-lipoxygenase | Homo sapiens | Inhibition | = | -67.0 | % | PMID[21189019] |
| NPT568 | Individual protein | Matrix metalloproteinase-2 | Homo sapiens | Inhibition | = | 90.0 | % | PMID[21189019] |
| NPT43 | Individual protein | Tyrosinase | Agaricus bisporus | Inhibition | = | 54.0 | % | PMID[21189019] |
| NPT569 | Individual protein | Matrix metalloproteinase 8 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[21189019] |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 16353.5 | nM | PubChem BioAssay data set |
| NPT687 | Individual protein | Histone deacetylase 8 | Homo sapiens | Ki | = | 177.95 | nM | PMID[24900743] |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 50118.7 | nM | PubChem BioAssay data set |
| NPT49 | Individual protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 14125.4 | nM | PubChem BioAssay data set |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1759 | Cell line | FM3A | Mus musculus | IC50 | = | 1100.0 | nM | PMID[1732542] |
| NPT1490 | Cell line | Ehrlich | Mus musculus | IC50 | = | 0.6 | ug.mL-1 | PMID[11975498] |
| NPT804 | Cell line | HT-22 | Mus musculus | EC50 | = | 4800.0 | nM | PMID[20045220] |
| NPT804 | Cell line | HT-22 | Mus musculus | Ratio EC50 | = | 1.0 | n.a. | PMID[20045220] |
| NPT804 | Cell line | HT-22 | Mus musculus | Efficacy | = | 62.0 | % | PMID[20045220] |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 11194.38 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 8090.96 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 3334.26 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 10519.62 | nM | PubChem BioAssay data set |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 15922.09 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 2494.59 | nM | PubChem BioAssay data set |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 24547.09 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 5308.84 | nM | PubChem BioAssay data set |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 12589.25 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 44055.49 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 6382.63 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 4045.76 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 3176.87 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 10864.26 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 9120.11 | nM | PubChem BioAssay data set |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 4446.31 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 15703.63 | nM | PubChem BioAssay data set |
| NPT572 | Cell line | DMS-273 | Homo sapiens | GI50 | n.a. | 3828.25 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 10864.26 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 58076.44 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 2837.92 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 5902.01 | nM | PubChem BioAssay data set |
| NPT573 | Cell line | M19-MEL | Homo sapiens | GI50 | n.a. | 13304.54 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 12387.97 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 3819.44 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 8491.8 | nM | PubChem BioAssay data set |
| NPT574 | Cell line | XF498 | Homo sapiens | GI50 | n.a. | 4236.43 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 11939.88 | nM | PubChem BioAssay data set |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 7925.01 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 5058.25 | nM | PubChem BioAssay data set |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 7227.7 | nM | PubChem BioAssay data set |
| NPT575 | Cell line | KM-20L2 | Homo sapiens | GI50 | n.a. | 4265.8 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 12133.89 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 9354.06 | nM | PubChem BioAssay data set |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | GI50 | n.a. | 9225.71 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 24378.11 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 5140.44 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 3908.41 | nM | PubChem BioAssay data set |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 6367.96 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 17258.38 | nM | PubChem BioAssay data set |
| NPT731 | Cell line | LXFL 529 | Homo sapiens | GI50 | n.a. | 6854.88 | nM | PubChem BioAssay data set |
| NPT576 | Cell line | DMS-114 | Homo sapiens | GI50 | n.a. | 3715.35 | nM | PubChem BioAssay data set |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 49431.07 | nM | PubChem BioAssay data set |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | n.a. | 6982.32 | nM | PubChem BioAssay data set |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 16069.41 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 5794.29 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 6516.28 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 13520.73 | nM | PubChem BioAssay data set |
| NPT577 | Cell line | RXF 631 | Homo sapiens | GI50 | n.a. | 30549.21 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 5223.96 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 4102.04 | nM | PubChem BioAssay data set |
| NPT578 | Cell line | SNB-78 | Homo sapiens | GI50 | n.a. | 48305.88 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 2792.54 | nM | PubChem BioAssay data set |
| NPT579 | Cell line | DLD-1 | Homo sapiens | GI50 | n.a. | 5308.84 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 11015.39 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 4265.8 | nM | PubChem BioAssay data set |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 18879.91 | nM | PubChem BioAssay data set |
| NPT406 | Cell line | RXF 393 | Homo sapiens | GI50 | n.a. | 25409.73 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 4236.43 | nM | PubChem BioAssay data set |
| NPT732 | Cell line | HOP-18 | Homo sapiens | GI50 | n.a. | 15310.87 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 0.3 | ug.mL-1 | PMID[15187442] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 0.3 | ug.mL-1 | PMID[15187442] |
| NPT616 | Cell line | MDCK | Canis lupus familiaris | MIC | = | 10.0 | ug.mL-1 | PMID[15187442] |
| NPT2980 | Cell line | Colon 26 | Mus musculus | MIC | = | 10.0 | ug.mL-1 | PMID[15187442] |
| NPT1081 | Cell line | BXPC-3 | Homo sapiens | GI50 | = | 19000.0 | nM | PMID[24900743] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | = | 6920.0 | nM | PMID[24900743] |
| NPT708 | Cell line | HuT78 | Homo sapiens | GI50 | = | 4990.0 | nM | PMID[24900743] |
| NPT15 | Cell line | Jurkat | Homo sapiens | GI50 | = | 1100.0 | nM | PMID[24900743] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 252.0 | mg | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 245.0 | mg | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 80.3 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 53.1 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 24.7 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 15.6 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 1.5 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 87.0 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 11.5 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 7.2 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 51.9 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 40.8 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 4.5 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 52.4 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 43.1 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 6.8 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 47.7 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 45.6 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 8.4 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 43.3 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | Activity | = | 48.3 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 7.4 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 53.8 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 38.8 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 11.9 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 43.5 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 44.6 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 7.7 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 37.2 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 55.1 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 8.0 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 35.4 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 56.5 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 7.5 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 34.4 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 58.1 | % | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 27.0 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI | = | 63.0 | % | PMID[24308647] |
| NPT323 | Cell line | SW-620 | Homo sapiens | IC50 | = | 4400.0 | nM | PMID[24308647] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 4500.0 | nM | PMID[24308647] |
| NPT91 | Cell line | KB | Homo sapiens | ID50 | = | 0.5 | ug ml-1 | PMID[6502608] |
| NPT91 | Cell line | KB | Homo sapiens | ID50 | = | 3.6 | nM ml-1 | PMID[6502608] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 3294.4 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 2936.2 | nM | PubChem BioAssay data set |
| NPT2974 | Organism | Daedalea dickinsii | Daedalea dickinsii | MIC | = | 0.2 | ug.mL-1 | PMID[10963310] |
| NPT2975 | Organism | Colletotrichum orbiculare | Colletotrichum orbiculare | MIC | = | 25.0 | ug.mL-1 | PMID[15187442] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.25 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.6 | ug.mL-1 | PMID[11975498] |
| NPT2972 | Organism | Pycnoporus coccineus | Pycnoporus coccineus | MIC | = | 12.5 | ug.mL-1 | PMID[10963310] |
| NPT2550 | Organism | Lenzites betulinus | Lenzites betulinus | MIC | = | 12.5 | ug.mL-1 | PMID[10963310] |
| NPT2973 | Organism | Schizophyllum commune | Schizophyllum commune | MIC | = | 12.5 | ug.mL-1 | PMID[10963310] |
| NPT834 | Organism | Trametes versicolor | Trametes versicolor | MIC | = | 12.5 | ug.mL-1 | PMID[10963310] |
| NPT635 | Organism | Botryotinia fuckeliana | Botryotinia fuckeliana | MIC | = | 50.0 | ug.mL-1 | PMID[15187442] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 0.3 | ug.mL-1 | PMID[15187442] |
| NPT1465 | Organism | Legionella pneumophila | Legionella pneumophila | MIC | = | 25.0 | ug.mL-1 | PMID[15187442] |
| NPT1465 | Organism | Legionella pneumophila | Legionella pneumophila | MIC | = | 6.25 | ug.mL-1 | PMID[15187442] |
| NPT852 | Organism | Phomopsis obscurans | Phomopsis obscurans | MIC | = | 12.0 | ug.mL-1 | PMID[15187442] |
| NPT2600 | Organism | Fusarium solani | Fusarium solani | MIC | = | 50.0 | ug.mL-1 | PMID[15187442] |
| NPT961 | Organism | Pythium aphanidermatum | Pythium aphanidermatum | MIC | = | 12.0 | ug.mL-1 | PMID[15187442] |
| NPT2254 | Organism | Schistosoma mansoni | Schistosoma mansoni | In vitro activity | n.a. | n.a. | n.a. | Using ChEMBL to complement schistosome drug discovery |
| NPT167 | Organism | Propionibacterium acnes | Propionibacterium acnes | MIC | = | 12.5 | ug.mL-1 | PMID[8158169] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 1835.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 35481.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 2267.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 3890.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT2637 | Organism | Colletotrichum lagenarium | Colletotrichum lagenarium | MIC | = | 25.0 | ug.mL-1 | PMID[15187442] |
| NPT2976 | Organism | Thanatephorus cucumeris | Thanatephorus cucumeris | MIC | = | 12.0 | ug.mL-1 | PMID[15187442] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 22387.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 99.78 | n.a. | PMID[25288494] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 100.0 | % | PMID[27094954] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 99.0 | % | PMID[27094954] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 79.0 | % | PMID[27094954] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 12.0 | % | PMID[27094954] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 98.0 | % | PMID[27094954] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 0.0 | % | PMID[6502608] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 62.0 | % | PMID[6502608] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 100.0 | % | PMID[6502608] |
| NPT32 | Organism | Mus musculus | Mus musculus | T/C | = | 103.0 | % | PMID[6502608] |
| NPT2524 | Organism | Tyrophagus putrescentiae | Tyrophagus putrescentiae | mortality | = | 0.0 | % | PMID[10963310] |
| NPT2524 | Organism | Tyrophagus putrescentiae | Tyrophagus putrescentiae | mortality | = | 11.9 | % | PMID[10963310] |
| NPT2524 | Organism | Tyrophagus putrescentiae | Tyrophagus putrescentiae | mortality | = | 33.6 | % | PMID[10963310] |
| NPT2524 | Organism | Tyrophagus putrescentiae | Tyrophagus putrescentiae | mortality | = | 91.3 | % | PMID[10963310] |
| NPT2524 | Organism | Tyrophagus putrescentiae | Tyrophagus putrescentiae | mortality | = | 100.0 | % | PMID[10963310] |
| NPT2524 | Organism | Tyrophagus putrescentiae | Tyrophagus putrescentiae | mortality | = | 77.5 | % | PMID[14519960] |
| NPT2524 | Organism | Tyrophagus putrescentiae | Tyrophagus putrescentiae | mortality | = | 55.5 | % | PMID[14519960] |
| NPT489 | Organism | Coptotermes formosanus | Coptotermes formosanus | mortality | = | 0.0 | % | PMID[10963310] |
| NPT489 | Organism | Coptotermes formosanus | Coptotermes formosanus | mortality | = | 20.0 | % | PMID[14519960] |
| NPT489 | Organism | Coptotermes formosanus | Coptotermes formosanus | mortality | = | 50.0 | % | PMID[14519960] |
| NPT489 | Organism | Coptotermes formosanus | Coptotermes formosanus | mortality | = | 100.0 | % | PMID[10963310] |
| NPT489 | Organism | Coptotermes formosanus | Coptotermes formosanus | mortality | = | 10.0 | % | PMID[10963310] |
| NPT489 | Organism | Coptotermes formosanus | Coptotermes formosanus | mortality | = | 40.0 | % | PMID[10963310] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 18.8 | % | PMID[14519960] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 45.2 | % | PMID[14519960] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 96.3 | % | PMID[14519960] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 100.0 | % | PMID[14519960] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 7.8 | % | PMID[14519960] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 2.6 | % | PMID[15187442] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 11.9 | % | PMID[15187442] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 0.0 | % | PMID[15187442] |
| NPT2525 | Organism | Dermatophagoides farinae | Dermatophagoides farinae | mortality | = | 99.0 | % | PMID[15187442] |
| NPT847 | Organism | Reticulitermes speratus | Reticulitermes speratus | mortality | = | 0.0 | % | PMID[15187442] |
| NPT847 | Organism | Reticulitermes speratus | Reticulitermes speratus | mortality | = | 100.0 | % | PMID[15187442] |
| NPT847 | Organism | Reticulitermes speratus | Reticulitermes speratus | mortality | = | 13.3 | % | PMID[15187442] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Mus musculus | Liver | T1/2 | = | 1.0 | hr | PMID[24900743] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Tyrophagus putrescentiae | LC50 | = | 0.24 | g/m2 | PMID[14519960] |
| - | Tyrophagus putrescentiae | LC50 | = | 0.246 | g/m2 | PMID[10963310] |
| - | Dermatophagoides farinae | LC50 | = | 0.37 | g/m2 | PMID[14519960] |
| - | Coptotermes formosanus | LC50 | = | 0.08 | g/m2 | PMID[14519960] |
| - | Coptotermes formosanus | LC50 | = | 0.07 | g/m2 | PMID[10963310] |
| - | Reticulitermes speratus | LC50 | = | 0.03 | g/m2 | PMID[15187442] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC46565 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC46565 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| NPD |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
