NPASS Compound

Natural Product: NPC149520

Natural Product ID	NPC149520
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	RAQNTCRNSXYLAH-FQCRJTERSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	118987126
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 107111 0 0 0 0 0 0 0 0999 V2000 8.3328 0.6653 -0.1037 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4808 1.8020 0.2413 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8228 1.8998 1.3623 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8199 0.9033 2.4567 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4061 0.4557 2.7443 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7196 -0.2055 1.5774 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4103 -1.4405 1.1207 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2623 -0.3177 1.8848 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7685 1.1264 2.0836 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6514 1.3195 1.0517 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0657 -0.0839 1.0838 C 0 0 2 0 0 0 0 0 0 0 0 0 0.5052 -0.2781 2.4400 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3776 -0.8443 0.8426 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0258 -2.2676 0.7848 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1735 -2.4026 -0.5003 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1276 -1.7620 -0.1595 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3149 -2.2423 -0.9582 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0261 -2.1524 -2.4029 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4383 -3.7104 -0.6115 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6268 -3.9892 0.2740 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8971 -3.5366 -0.3901 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8456 -2.0870 -0.8455 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0769 -2.1248 -2.3397 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0357 -1.4212 -0.2465 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5264 -1.5215 -0.4446 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3638 -0.0301 -0.5682 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2395 0.3349 0.4414 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0647 -0.3068 -0.0305 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5189 0.4552 -1.2100 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4098 0.7788 -0.4343 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7510 1.6322 -1.4284 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1632 1.7187 -1.8465 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6972 3.1240 -1.9756 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2629 4.0819 -0.9387 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1158 3.5525 -0.1532 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4817 2.8375 1.1170 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3585 3.6337 1.8335 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2597 2.9054 -0.9842 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8106 5.2567 -1.5919 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1108 3.1148 -2.0322 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4489 1.0580 -3.0572 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2375 -4.4118 -1.4313 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9943 -3.2101 0.8423 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8312 0.7203 0.5042 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3571 2.9246 -0.7548 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7236 -0.1098 -0.6264 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1217 0.9487 -0.8410 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7991 0.2501 0.8106 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1943 2.7932 1.5589 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5238 0.0824 2.3544 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1527 1.4703 3.3768 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8632 1.3042 3.1814 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5172 -0.2728 3.6088 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1520 -1.6907 0.0801 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5069 -1.1989 1.1040 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3443 -2.2838 1.8384 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2128 -0.8792 2.8630 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4457 1.3221 3.1023 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5296 1.8786 1.8158 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1446 1.5483 0.1059 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9341 2.0759 1.3914 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2880 -0.3515 3.2062 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1830 -1.0984 2.6057 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0847 0.6580 2.6815 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7939 -0.5450 -0.1397 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3145 -2.4782 1.6404 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6910 -1.7714 -1.2823 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1576 -3.4090 -0.8863 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3763 -2.1364 0.8847 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2110 -3.1288 -2.9479 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0909 -2.0279 -2.5475 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4954 -1.3625 -2.9763 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5877 -4.3370 -1.5308 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5668 -4.1344 -0.1004 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6977 -5.1077 0.3467 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5086 -3.6355 1.3132 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7054 -3.7106 0.3812 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1708 -2.3038 -2.4736 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5935 -2.9975 -2.8212 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8707 -1.1644 -2.8449 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6414 -2.2188 0.2944 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8547 -0.6802 0.5294 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7883 -1.1008 -1.0304 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4854 -1.7016 0.6784 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9480 0.1500 -1.6111 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0630 1.4067 0.4716 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5042 -0.1626 1.3699 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5931 0.3802 -1.4660 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0201 0.3279 -2.1504 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3804 1.5516 -0.9551 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1225 1.5401 -2.3676 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8064 1.2363 -1.0857 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3916 3.5066 -2.9719 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1385 4.3520 -0.3020 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5411 4.4704 0.1998 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9004 1.8462 1.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5547 2.7585 1.7209 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3310 3.4580 2.8057 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8428 5.3374 -1.5806 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4159 2.6120 -2.8450 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0115 1.5959 -3.7753 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7858 -5.1760 -1.1182 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1452 -3.4980 1.7974 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6710 0.2289 -0.3340 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6600 2.6111 -1.7594 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9834 3.7469 -0.3457 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3021 3.2698 -0.6971 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 6 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 6 26 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 21 42 1 0 14 43 1 0 6 44 1 6 2 45 1 0 13 8 1 0 28 16 1 0 38 31 1 0 28 11 1 0 25 17 1 0 1 46 1 0 1 47 1 0 1 48 1 0 3 49 1 0 4 50 1 0 4 51 1 0 5 52 1 0 5 53 1 0 7 54 1 0 7 55 1 0 7 56 1 0 8 57 1 1 9 58 1 0 9 59 1 0 10 60 1 0 10 61 1 0 12 62 1 0 12 63 1 0 12 64 1 0 13 65 1 0 14 66 1 1 15 67 1 0 15 68 1 0 16 69 1 1 18 70 1 0 18 71 1 0 18 72 1 0 19 73 1 0 19 74 1 0 20 75 1 0 20 76 1 0 21 77 1 1 23 78 1 0 23 79 1 0 23 80 1 0 24 81 1 0 24 82 1 0 24 83 1 0 25 84 1 1 26 85 1 6 27 86 1 0 27 87 1 0 29 88 1 0 29 89 1 0 29 90 1 0 31 91 1 6 32 92 1 1 33 93 1 6 34 94 1 1 35 95 1 1 36 96 1 0 36 97 1 0 37 98 1 0 39 99 1 0 40100 1 0 41101 1 0 42102 1 0 43103 1 0 44104 1 0 45105 1 0 45106 1 0 45107 1 0 M END

Standard InCHIKey	RAQNTCRNSXYLAH-FQCRJTERSA-N
Standard InCHI	InChI=1S/C36H62O9/c1-19(2)10-9-13-36(8,43)20-11-15-34(6)26(20)21(38)16-24-33(5)14-12-25(39)32(3,4)30(33)22(17-35(24,34)7)44-31-29(42)28(41)27(40)23(18-37)45-31/h10,20-31,37-43H,9,11-18H2,1-8H3/t20-,21+,22-,23+,24+,25-,26?,27+,28-,29+,30-,31+,33+,34+,35+,36-/m0/s1
SMILES	CC(=CCC[C@@](C)([C@H]1CC[C@]2(C)C1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3[C@H](C[C@@]21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	638.44	Volume:	664.905 ? Van der Waals volume.
Dense:	0.96	LogP:	2.696 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.216 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.726 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	27.0
TPSA:	160.07 ? Topological Polar Surface Area.	H-Bond Acceptor:	9.0
H-Bond Donor:	7.0	Rings:	5.0
Heavy Atoms:	9.0

MedChem Properties

QED Drug-Likeness Score:	0.164	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.531	Fsp³:	0.944
MCE-18:	113.029 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.706	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.196	Promiscuous compounds:	0.303

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.96	MDCK Permeability:	-5.21
Pgp-inhibitor:	0.0	Pgp-substrate:	0.643
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.076
20% Bioavailability (F20%):	0.689	30% Bioavailability (F30%):	0.713
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.769	MRP1:	0.765
Plasma Protein Binding (PPB):	73.816%	Volume Distribution (VD):	-0.471
Fu:	19.572% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.025
BSEP inhibitor:	0.005

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.085	CYP2C19-substrate:	0.005
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.014	CYP3A4-substrate:	0.178
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.976
HLM stability:	0.01 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

3.511

Half-life (T1/2):

2.176

ADMET: Toxicity

hERG Blockers:	0.02	hERG Blockers (10um):	0.091
Human Hepatotoxicity (H-HT):	0.56	Drug-induced Liver Injury (DILI):	0.272
AMES Toxicity:	0.868	Rat Oral Acute Toxicity:	0.143
Maximum Recommended Daily Dose:	0.102	Skin Sensitization:	1.0
Carcinogencity:	0.403	Eye Corrosion:	0.0
Eye Irritation:	0.025	Respiratory Toxicity:	0.397
Drug-induced Neurotoxicity:	0.025	Ototoxicity:	0.96
Hematotoxicity:	0.625	Drug-induced Nephrotoxicity:	0.905
Genotoxicity:	0.178	RPMI-8226 Immunitoxicity:	0.143
A549 Cytotoxicity:	0.933	Hek293 Cytotoxicity:	0.385
BCF:	1.263 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.556 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.149 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.333 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 12877918]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12350149]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Flower buds	n.a.	n.a.	PMID[12880307]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Stems	n.a.	n.a.	PMID[17663584]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[18186611]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	leaves and stems	n.a.	n.a.	PMID[25442304]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Steamed Roots	n.a.	n.a.	PMID[26200131]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[28006911]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28202328]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC149520 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21172
0.1-0.2	23204
0.2-0.3	4847
0.3-0.4	538
0.4-0.5	45
0.5-0.6	13
0.6-0.7	22
0.7-0.8	0
0.8-0.85	6
0.85-0.9	2
0.9-0.95	1
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC47566
1.0	High Similarity	NPC129372
0.9054	High Similarity	NPC473020
0.8816	High Similarity	NPC472252
0.8816	High Similarity	NPC245280
0.831	Intermediate Similarity	NPC140446
0.825	Intermediate Similarity	NPC16520
0.825	Intermediate Similarity	NPC211879
0.825	Intermediate Similarity	NPC189852
0.825	Intermediate Similarity	NPC155010
0.8125	Intermediate Similarity	NPC231340
0.7848	Intermediate Similarity	NPC473199
0.7619	Intermediate Similarity	NPC286969
0.7403	Intermediate Similarity	NPC609286
0.7308	Intermediate Similarity	NPC309425
0.7215	Intermediate Similarity	NPC114874
0.7143	Intermediate Similarity	NPC136816
0.7143	Intermediate Similarity	NPC7341
0.6835	Remote Similarity	NPC472989
0.6795	Remote Similarity	NPC88000
0.6795	Remote Similarity	NPC4831
0.6795	Remote Similarity	NPC472023
0.675	Remote Similarity	NPC472899
0.675	Remote Similarity	NPC472898
0.6625	Remote Similarity	NPC82955
0.65	Remote Similarity	NPC131466
0.6477	Remote Similarity	NPC127801
0.6477	Remote Similarity	NPC152584
0.6386	Remote Similarity	NPC472901
0.6279	Remote Similarity	NPC165033
0.6279	Remote Similarity	NPC273879
0.6222	Remote Similarity	NPC601606
0.6196	Remote Similarity	NPC208594
0.6163	Remote Similarity	NPC8039
0.6163	Remote Similarity	NPC120123
0.6056	Remote Similarity	NPC80530
0.6056	Remote Similarity	NPC273410
0.6047	Remote Similarity	NPC274833
0.6023	Remote Similarity	NPC229801
0.6	Remote Similarity	NPC288694
0.5833	Remote Similarity	NPC160816
0.5663	Remote Similarity	NPC66654
0.5652	Remote Similarity	NPC307167
0.56	Remote Similarity	NPC322313
0.56	Remote Similarity	NPC102253
0.56	Remote Similarity	NPC236237
0.5402	Remote Similarity	NPC160734
0.5392	Remote Similarity	NPC6931
0.5306	Remote Similarity	NPC472988
0.5306	Remote Similarity	NPC38217
0.5263	Remote Similarity	NPC194842
0.5208	Remote Similarity	NPC210759
0.5149	Remote Similarity	NPC305418

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC149520 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7539
0.1-0.2	1537
0.2-0.3	70
0.3-0.4	3
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.56	Remote Similarity	NPD7525	Registered

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data