NPASS Compound

Natural Product: NPC138435

Natural Product ID	NPC138435
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Bacillistatin 2
IUPAC Name	(3R,6R,9S,12S,15R,18R,21S,24S,27R,30R,33S,36S)-6,18-bis[(2S)-butan-2-yl]-12,24,36-trimethyl-30-(2-methylpropyl)-3,9,15,21,27,33-hexa(propan-2-yl)-1,7,13,19,25,31-hexaoxa-4,10,16,22,28,34-hexazacyclohexatriacontane-2,5,8,11,14,17,20,23,26,29,32,35-dodecone
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2448555
PubChem CID	45268830
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000264] Organic acids and derivatives [CHEMONTID:0001813] Peptidomimetics [CHEMONTID:0001961] Depsipeptides [CHEMONTID:0001994] Cyclic depsipeptides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 177177 0 0 0 0 0 0 0 0999 V2000 7.3218 -4.0866 2.5403 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6668 -4.5778 1.1777 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4533 -3.5909 0.0779 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9910 -3.1362 -0.0387 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9328 -2.2053 -1.1261 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6394 -0.8739 -1.0501 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3859 -0.3717 0.0574 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6356 -0.0521 -2.3098 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6473 1.3512 -1.9594 N 0 0 0 0 0 0 0 0 0 0 0 0 5.5186 2.2900 -2.8081 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3506 1.9179 -4.1566 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5525 3.7124 -2.4063 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9151 4.3241 -2.5439 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0004 3.9673 -1.1357 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8735 4.7412 -0.9629 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3541 5.2256 -2.0219 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2137 5.0587 0.3188 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9590 5.7507 0.0611 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8562 5.4274 0.5653 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6960 4.3446 1.4521 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4131 6.1661 0.2645 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3587 5.2716 -0.3142 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4352 4.7921 0.3601 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5598 5.1995 1.5765 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4736 3.8639 -0.1165 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2028 3.3115 1.0423 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.7344 2.3212 1.7085 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5180 1.7757 1.3059 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4400 1.7814 2.8511 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0143 0.4906 2.6805 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3537 0.2808 3.0729 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8958 1.3432 3.5505 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0840 -0.9768 2.9741 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6925 -1.9599 2.0877 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.3702 -1.9980 0.8568 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9941 -3.2719 0.1764 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8942 -3.2107 -0.6758 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7231 -3.8742 -0.4491 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6656 -4.5670 0.6126 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5329 -3.8262 -1.3824 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6246 -4.7892 -0.9283 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6196 -4.9278 -0.2476 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2091 -3.9707 0.5131 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6075 -4.3312 0.3350 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3529 -4.6604 1.4459 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8034 -4.6138 2.5788 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7973 -5.0901 1.4159 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3963 -5.0196 0.1576 N 0 0 0 0 0 0 0 0 0 0 0 0 5.2163 -4.3265 -0.4531 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4830 -4.7253 -1.8017 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7684 -6.5853 1.8692 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1983 -6.7120 3.2548 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0955 -7.2365 1.7727 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0354 -2.5768 0.0038 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1258 -6.2776 -0.1412 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1026 -4.3635 -2.7260 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6302 -5.7727 -2.5061 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0590 -4.3271 -3.7977 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1299 -4.0807 -0.3241 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0685 -3.5474 -1.3060 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5007 -3.0908 -2.6144 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1402 -2.6161 -0.8434 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3798 -0.7901 0.1443 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5907 -0.6278 2.8567 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3781 -1.9430 2.7568 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9919 0.0053 4.1691 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3994 1.5439 3.9867 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5376 4.5634 -0.9427 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5839 3.5623 -1.4062 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9405 5.2941 -2.1214 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2210 7.4309 -0.4837 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6346 8.4304 0.2483 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7883 9.7114 -0.5756 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5636 8.0240 -0.8567 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1502 5.9288 1.1364 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5242 6.2856 2.4763 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5799 7.1578 0.3878 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8343 -0.4315 -3.1511 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7469 -1.8891 -3.4812 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1446 -0.1839 -2.4172 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3795 -2.4102 0.3089 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4087 -3.4895 2.5870 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2089 -4.9699 3.2190 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1704 -3.4856 2.9477 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7920 -4.7793 1.1756 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1328 -5.5077 0.9500 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7668 -4.0729 -0.8728 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7179 -2.6735 0.8948 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7299 -0.3671 -2.8583 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7109 1.1490 -4.3981 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8889 4.2789 -3.1364 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2749 4.7695 -1.5669 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6940 3.5464 -2.7765 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9459 5.1724 -3.2560 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0682 4.1286 0.8635 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2456 3.5080 1.3128 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8099 6.4072 1.2957 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1090 3.0140 -0.6926 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3214 1.5208 0.3477 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1627 2.5334 3.2453 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0856 -1.4927 4.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6071 -3.9151 1.0633 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1721 -2.7973 -1.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0241 -4.0265 1.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2882 -4.5326 2.2316 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9720 -5.4848 -2.2306 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0595 -7.0770 1.1611 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6399 -7.5798 3.7988 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0817 -6.8641 3.2355 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4217 -5.8185 3.8738 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9746 -8.2882 2.1120 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8184 -6.7798 2.4755 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4933 -7.2756 0.7315 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2535 -2.5613 -1.0839 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9356 -2.1614 0.2935 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8732 -1.9794 0.4965 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7938 -7.0107 -0.3369 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9646 -3.7456 -3.0546 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4641 -5.7051 -1.7550 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0713 -6.1226 -3.4480 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8101 -6.4017 -2.1520 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3302 -3.5820 -4.5811 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0839 -4.0782 -3.3415 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9680 -5.3341 -4.2460 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7197 -4.4110 0.5905 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7143 -5.0638 -0.7018 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6882 -4.4880 -1.6302 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3439 -3.0754 -3.3489 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1346 -2.0375 -2.6141 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7677 -3.8033 -3.0377 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8025 -2.2802 -1.6920 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8173 -1.6820 -0.3669 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7883 -3.1124 -0.0521 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6380 0.1061 0.5330 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8157 -0.0418 1.9682 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3650 -1.8061 2.2941 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7760 -2.5837 2.0475 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3747 -2.4849 3.7195 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7980 -0.5854 4.7074 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1557 0.0222 4.9198 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4507 1.0266 4.0267 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5512 1.0745 3.4578 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8082 0.7988 4.6977 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1620 2.4976 4.4824 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0511 5.2912 -0.2878 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1589 3.9385 -2.2835 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2858 3.3318 -0.5767 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0521 2.6176 -1.6221 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8313 5.2557 -2.0916 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3571 4.9092 -3.0914 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2262 6.3612 -2.0594 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3088 7.1943 -1.4563 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1660 8.7258 1.2062 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6402 8.0572 0.4976 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3474 9.4176 -1.4924 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3923 10.4438 -0.0111 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1937 10.0993 -0.8890 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3852 7.3308 -0.6659 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5191 8.3263 -1.9138 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7389 8.9524 -0.2575 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0496 5.3190 1.3568 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9388 7.2317 2.4228 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9287 5.4303 2.7966 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3582 6.4477 3.1891 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3257 7.0238 -0.6966 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1022 8.0829 0.7850 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6858 7.2350 0.4492 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8179 0.1909 -4.0905 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4520 -2.4469 -2.8610 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1431 -1.9910 -4.5392 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7336 -2.3098 -3.4426 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6370 0.7104 -2.8730 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8614 -1.0168 -2.5717 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9729 -0.0553 -1.3395 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8248 -1.4835 0.5399 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0812 -2.2749 -0.5486 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0194 -2.6358 1.1915 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 2 3 10 11 1 0 10 12 1 0 12 13 1 0 12 14 1 0 14 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 2 3 19 20 1 0 19 21 1 0 21 22 1 0 22 23 1 0 23 24 2 0 23 25 1 0 25 26 1 0 26 27 2 3 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 34 35 2 3 35 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 40 41 1 0 41 42 2 3 42 43 1 0 43 44 1 0 44 45 1 0 45 46 2 0 45 47 1 0 47 48 1 0 48 49 2 3 49 50 1 0 47 51 1 0 51 52 1 0 51 53 1 0 43 54 1 0 42 55 1 0 40 56 1 0 56 57 1 0 56 58 1 0 36 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 35 63 1 0 33 64 1 0 64 65 1 0 64 66 1 0 29 67 1 0 25 68 1 0 68 69 1 0 68 70 1 0 21 71 1 0 71 72 1 0 72 73 1 0 71 74 1 0 17 75 1 0 75 76 1 0 75 77 1 0 8 78 1 0 78 79 1 0 78 80 1 0 3 81 1 0 49 4 1 0 1 82 1 0 1 83 1 0 1 84 1 0 2 85 1 0 2 86 1 0 3 87 1 6 4 88 1 1 8 89 1 6 11 90 1 0 12 91 1 6 13 92 1 0 13 93 1 0 13 94 1 0 17 95 1 1 20 96 1 0 21 97 1 1 25 98 1 6 28 99 1 0 29100 1 1 33101 1 1 36102 1 1 40103 1 6 43104 1 1 47105 1 1 50106 1 0 51107 1 0 52108 1 0 52109 1 0 52110 1 0 53111 1 0 53112 1 0 53113 1 0 54114 1 0 54115 1 0 54116 1 0 55117 1 0 56118 1 0 57119 1 0 57120 1 0 57121 1 0 58122 1 0 58123 1 0 58124 1 0 59125 1 0 59126 1 0 60127 1 0 61128 1 0 61129 1 0 61130 1 0 62131 1 0 62132 1 0 62133 1 0 63134 1 0 64135 1 0 65136 1 0 65137 1 0 65138 1 0 66139 1 0 66140 1 0 66141 1 0 67142 1 0 67143 1 0 67144 1 0 68145 1 0 69146 1 0 69147 1 0 69148 1 0 70149 1 0 70150 1 0 70151 1 0 71152 1 6 72153 1 0 72154 1 0 73155 1 0 73156 1 0 73157 1 0 74158 1 0 74159 1 0 74160 1 0 75161 1 0 76162 1 0 76163 1 0 76164 1 0 77165 1 0 77166 1 0 77167 1 0 78168 1 0 79169 1 0 79170 1 0 79171 1 0 80172 1 0 80173 1 0 80174 1 0 81175 1 0 81176 1 0 81177 1 0 M END

Standard InCHIKey	KVJGVUIUGIEWCD-RPUMXUQMSA-N
Standard InCHI	InChI=1S/C57H96N6O18/c1-22-32(17)44-50(68)62-39(27(7)8)53(71)77-34(19)46(64)58-41(29(11)12)55(73)79-37(24-25(3)4)49(67)61-38(26(5)6)52(70)76-35(20)47(65)59-42(30(13)14)56(74)80-45(33(18)23-2)51(69)63-40(28(9)10)54(72)78-36(21)48(66)60-43(31(15)16)57(75)81-44/h25-45H,22-24H2,1-21H3,(H,58,64)(H,59,65)(H,60,66)(H,61,67)(H,62,68)(H,63,69)/t32-,33-,34-,35-,36-,37+,38+,39+,40+,41-,42-,43-,44+,45+/m0/s1
SMILES	CC[C@@H]([C@H]1OC(=O)[C@@H](N=C(O)[C@H](C)OC(=O)[C@H](N=C(O)[C@H](OC(=O)[C@@H](N=C(O)[C@@H](OC(=O)[C@H](N=C([C@H](OC(=O)[C@@H](N=C([C@@H](OC(=O)[C@H](N=C1O)C(C)C)C)O)C(C)C)CC(C)C)O)C(C)C)C)C(C)C)[C@H](CC)C)C(C)C)C(C)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1152.68	Volume:	1178.438 ? Van der Waals volume.
Dense:	0.978	LogP:	3.687 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.241 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.723 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	42.0
TPSA:	353.34 ? Topological Polar Surface Area.	H-Bond Acceptor:	24.0
H-Bond Donor:	6.0	Rings:	1.0
Heavy Atoms:	24.0

MedChem Properties

QED Drug-Likeness Score:	0.079	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.326	Fsp³:	0.789
MCE-18:	80.471 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.343	Fluc inhibitor:	0.003 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.327 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.307 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.42	Promiscuous compounds:	0.159

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.343	MDCK Permeability:	-4.891
Pgp-inhibitor:	1.0	Pgp-substrate:	0.075
PAMPA:	0.001 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.928
20% Bioavailability (F20%):	0.971	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.371
Plasma Protein Binding (PPB):	50.272%	Volume Distribution (VD):	-0.379
Fu:	47.282% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	1.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.002	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.354	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.002
HLM stability:	0.004 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.544

Half-life (T1/2):

4.133

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	1.0	Drug-induced Liver Injury (DILI):	1.0
AMES Toxicity:	0.0	Rat Oral Acute Toxicity:	0.276
Maximum Recommended Daily Dose:	0.22	Skin Sensitization:	1.0
Carcinogencity:	0.972	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.081
Drug-induced Neurotoxicity:	0.342	Ototoxicity:	1.0
Hematotoxicity:	0.996	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.0
A549 Cytotoxicity:	0.0	Hek293 Cytotoxicity:	0.0
BCF:	0.423 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.547 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.588 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.749 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33228	bacillus silvestris	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[19216517]
NPO33228	bacillus silvestris	Species	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[19226154]
NPO1239	Bacillus silvestris	Species	Planococcaceae	Bacteria	n.a.	n.a.	n.a.	PMID[25688575]
NPO1239	Bacillus silvestris	Species	Planococcaceae	Bacteria	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1239	Bacillus silvestris	Species	Planococcaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	6
ED50	7
GI50	13
MBC	4

Activity Type	# Activity
Cell line	18
Organism	10
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT168	Cell line	P388	Mus musculus	ED50	=	0.013	ug ml-1	PMID[24900575]
NPT1081	Cell line	BXPC-3	Homo sapiens	GI50	=	0.00034	ug.mL-1	PMID[24900575]
NPT83	Cell line	MCF7	Homo sapiens	GI50	=	0.00031	ug.mL-1	PMID[20739103]
NPT395	Cell line	SF-268	Homo sapiens	GI50	=	0.0018	ug.mL-1	PMID[20739103]
NPT397	Cell line	NCI-H460	Homo sapiens	GI50	=	0.00045	ug.mL-1	PubChem BioAssay data set
NPT575	Cell line	KM-20L2	Homo sapiens	GI50	=	0.00026	ug.mL-1	PubChem BioAssay data set
NPT90	Cell line	DU-145	Homo sapiens	GI50	=	0.00086	ug.mL-1	PMID[20368405]
NPT168	Cell line	P388	Mus musculus	ED50	=	0.016	ug ml-1	PMID[15568791]
NPT1081	Cell line	BXPC-3	Homo sapiens	ED50	<	0.001	ug ml-1	PMID[15568791]
NPT83	Cell line	MCF7	Homo sapiens	ED50	<	0.001	ug ml-1	PMID[15568791]
NPT395	Cell line	SF-268	Homo sapiens	ED50	<	0.001	ug ml-1	PMID[15568791]
NPT397	Cell line	NCI-H460	Homo sapiens	GI50	<	0.001	ug.mL-1	PMID[15568791]
NPT575	Cell line	KM-20L2	Homo sapiens	ED50	<	0.001	ug ml-1	PMID[15568791]
NPT90	Cell line	DU-145	Homo sapiens	ED50	<	0.001	ug ml-1	PMID[15568791]
NPT397	Cell line	NCI-H460	Homo sapiens	GI50	=	0.39	nM	PMID[17933535]
NPT395	Cell line	SF-268	Homo sapiens	GI50	=	1.6	nM	PMID[17665953]
NPT83	Cell line	MCF7	Homo sapiens	GI50	=	0.27	nM	PMID[15332840]
NPT90	Cell line	DU-145	Homo sapiens	GI50	=	0.75	nM	PMID[18183025]
NPT1118	Organism	Streptococcus pneumoniae	Streptococcus pneumoniae	MIC	>	64.0	ug.mL-1	PMID[23046382]
NPT1118	Organism	Streptococcus pneumoniae	Streptococcus pneumoniae	MIC	=	1.0	ug.mL-1	PubChem BioAssay data set
NPT1118	Organism	Streptococcus pneumoniae	Streptococcus pneumoniae	MBC	=	2.0	ug ml-1	PubChem BioAssay data set
NPT1118	Organism	Streptococcus pneumoniae	Streptococcus pneumoniae	MBC	=	1.0	ug ml-1	PubChem BioAssay data set
NPT1118	Organism	Streptococcus pneumoniae	Streptococcus pneumoniae	MIC	<	0.5	ug.mL-1	PMID[19128055]
NPT1118	Organism	Streptococcus pneumoniae	Streptococcus pneumoniae	MBC	<	0.5	ug ml-1	PMID[23398362]
NPT1228	Organism	Streptococcus pyogenes	Streptococcus pyogenes	MIC	>	64.0	ug.mL-1	PMID[23252603]
NPT1228	Organism	Streptococcus pyogenes	Streptococcus pyogenes	MBC	>	16.0	ug ml-1	PMID[19128055]
NPT1228	Organism	Streptococcus pyogenes	Streptococcus pyogenes	MIC	=	2.0	ug.mL-1	PMID[19128055]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	GI50	=	0.23	nM	PMID[25688575]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	GI50	=	0.29	nM	PMID[25688575]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC138435 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	29027
0.1-0.2	20378
0.2-0.3	404
0.3-0.4	24
0.4-0.5	6
0.5-0.6	10
0.6-0.7	4
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.825	Intermediate Similarity	NPC141325
0.825	Intermediate Similarity	NPC480514
0.7692	Intermediate Similarity	NPC476130
0.7692	Intermediate Similarity	NPC476324
0.7021	Intermediate Similarity	NPC480516
0.6829	Remote Similarity	NPC193280
0.6667	Remote Similarity	NPC476125
0.6458	Remote Similarity	NPC480518
0.6	Remote Similarity	NPC480525
0.5789	Remote Similarity	NPC480523
0.5636	Remote Similarity	NPC480521
0.5614	Remote Similarity	NPC480519
0.5577	Remote Similarity	NPC476291
0.5577	Remote Similarity	NPC476285
0.55	Remote Similarity	NPC476260
0.55	Remote Similarity	NPC480517
0.541	Remote Similarity	NPC480515
0.5333	Remote Similarity	NPC476184
0.5283	Remote Similarity	NPC476248

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC138435 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6102
0.1-0.2	2981
0.2-0.3	67
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data