Drug Information| Drug ID:   | NPD4241 |
| Drug Name:   | NOV-205 |
| Molecular Formula:   | C20H32N6O12S2 |
| Canonical SMILES:   | OC(=O)CN=C([C@@H](N=C(CC[C@@H](C(=O)O)N)[O-])CSSC[C@@H](C(=NCC(=O)O)O)N=C(CC[C@@H](C(=O)O)N)O)O |
| Standard InCHI:   | "InChI=1S/C20H32N6O12S2/c21-9(19(35)36)1-3-13(27)25-11(17(33)23-5-15(29)30)7-39-40-8-12(18(34)24-6-16(31)32)26-14(28)4-2-10(22)20(37)38/h9-12H,1-8,21-22H2,(H,23,33)(H,24,34)(H,25,27)(H,26,28)(H,29,30)(H,31,32)(H,35,36)(H,37,38)/p-1/t9-,10-,11-,12-/m0/s1" |
| Standard InCHIKey:   | YPZRWBKMTBYPTK-BJDJZHNGSA-M |
| Max Developmental Stage:   | Registered |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4241Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.8333 | NPC126779 |
| Intermediate Similarity | 0.8333 | NPC168718 |
| Remote Similarity | 0.6852 | NPC319046 |
| Remote Similarity | 0.6792 | NPC129497 |
| Remote Similarity | 0.5932 | NPC250563 |
| Remote Similarity | 0.5741 | NPC38183 |
| Remote Similarity | 0.5636 | NPC174304 |
| Remote Similarity | 0.5636 | NPC325597 |
| Remote Similarity | 0.52 | NPC235493 |
| Remote Similarity | 0.5072 | NPC108908 |
| Molecular Weight   | 611.14 |
| ALogP   | -3.7972 |
| MLogP   | 1.46 |
| XLogP   | -6.118 |
| HDA   | 18 |
| HBD   | 9 |
| Rotatable Bonds   | 31 |
| TPSA   | 385.03 |
| RO5 Violation   | 3 |