36 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC99170
Formula: C14H10N2O2
Ingredient ID: NPC99170
| Common Name | n.a. |
| IUPAC Name | methyl phenazine-1-carboxylate |
| Canonical SMILES | COC(=O)c1cccc2c1nc1ccccc1n2 |
| Standard InCHI | InChI=1S/C14H10N2O2/c1-18-14(17)9-5-4-8-12-13(9)16-11-7-3-2-6-10(11)15-12/h2-8H,1H3 |
| Standard InCHIKey | UEHCMQFOWIRZGQ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 602126 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD69484] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
 |
| Aglaia tomentosa | Aglaia | Meliaceae |
 |
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
 |
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC88573
Formula: C11H9ClN2O2
Ingredient ID: NPC88573
| Common Name | n.a. |
| IUPAC Name | 4-(2-amino-3-chlorophenyl)-1H-pyrrole-2-carboxylic acid |
| Canonical SMILES | OC(=O)c1[nH]cc(c1)c1cccc(c1N)Cl |
| Standard InCHI | InChI=1S/C11H9ClN2O2/c12-8-3-1-2-7(10(8)13)6-4-9(11(15)16)14-5-6/h1-5,14H,13H2,(H,15,16) |
| Standard InCHIKey | CCQSWPUSHHCADO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 121223548 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD100928] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC71540
Formula: C15H12N2O3
Ingredient ID: NPC71540
| Common Name | n.a. |
| IUPAC Name | methyl 4-methoxyphenazine-1-carboxylate |
| Canonical SMILES | COC(=O)c1ccc(c2c1nc1ccccc1n2)OC |
| Standard InCHI | InChI=1S/C15H12N2O3/c1-19-12-8-7-9(15(18)20-2)13-14(12)17-11-6-4-3-5-10(11)16-13/h3-8H,1-2H3 |
| Standard InCHIKey | YKVYTBONTCUWEC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 21679906 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD133428] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC59506
Formula: C19H32O2
Ingredient ID: NPC59506
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CCCCCCCc1cc(O)c(c(c1)O)CCCCCC |
| Standard InCHI | InChI=1S/C19H32O2/c1-3-5-7-9-10-12-16-14-18(20)17(19(21)15-16)13-11-8-6-4-2/h14-15,20-21H,3-13H2,1-2H3 |
| Standard InCHIKey | KLAVUSHQLJDZCS-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD196677] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC59108
Formula: C13H8N2O4
Ingredient ID: NPC59108
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC(=O)c1c(O)c(O)cc2c1nc1ccccc1n2 |
| Standard InCHI | InChI=1S/C13H8N2O4/c16-9-5-8-11(10(12(9)17)13(18)19)15-7-4-2-1-3-6(7)14-8/h1-5,16-17H,(H,18,19) |
| Standard InCHIKey | AZEWZCMCVNANLS-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD76975] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC49561
Formula: C10H5Cl2FN2O2
Ingredient ID: NPC49561
| Common Name | n.a. |
| IUPAC Name | 3-chloro-4-(3-chloro-4-fluoro-2-nitrophenyl)-1H-pyrrole |
| Canonical SMILES | O=N(=O)c1c(Cl)c(F)ccc1c1c[nH]cc1Cl |
| Standard InCHI | InChI=1S/C10H5Cl2FN2O2/c11-7-4-14-3-6(7)5-1-2-8(13)9(12)10(5)15(16)17/h1-4,14H |
| Standard InCHIKey | ICUDVCSRICMBIV-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 13024187 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD51071] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC37802
Formula: C17H28O2
Ingredient ID: NPC37802
| Common Name | n.a. |
| IUPAC Name | 2-hexyl-5-pentylbenzene-1,3-diol |
| Canonical SMILES | CCCCCCc1c(O)cc(cc1O)CCCCC |
| Standard InCHI | InChI=1S/C17H28O2/c1-3-5-7-9-11-15-16(18)12-14(13-17(15)19)10-8-6-4-2/h12-13,18-19H,3-11H2,1-2H3 |
| Standard InCHIKey | GAZJVWPMPITOLB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 198749 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD157455] Database: NPASS [NPC37802] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Asarum heterotropoides | Asarum | Aristolochiaceae | |
| Centaurea aspera | Centaurea | Asteraceae | |
| Senecio macrocephalus | Senecio | Asteraceae | |
| Pteris fauriei | Pteris | Pteridaceae |
|
| Crotalaria novae-hollandiae | Crotalaria | Fabaceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Hyptis brevipes | Hyptis | Lamiaceae |
|
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC36168
Formula: C12H8N2O
Ingredient ID: NPC36168
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc2c(c1)nc1c(n2)cccc1 |
| Standard InCHI | InChI=1S/C12H8N2O/c15-8-5-6-11-12(7-8)14-10-4-2-1-3-9(10)13-11/h1-7,15H |
| Standard InCHIKey | RETSEGNZNUBJRB-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD162041] Database: NPASS [NPC36168] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC29128
Formula: C16H14N2O4
Ingredient ID: NPC29128
| Common Name | n.a. |
| IUPAC Name | methyl 2,3-dimethoxyphenazine-1-carboxylate |
| Canonical SMILES | COc1cc2nc3ccccc3nc2c(c1OC)C(=O)OC |
| Standard InCHI | InChI=1S/C16H14N2O4/c1-20-12-8-11-14(13(15(12)21-2)16(19)22-3)18-10-7-5-4-6-9(10)17-11/h4-8H,1-3H3 |
| Standard InCHIKey | YTVYJJMELVOPAB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 21856883 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD35755] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC289574
Formula: C7H6ClNO2
Ingredient ID: NPC289574
| Common Name | n.a. |
| IUPAC Name | 2-amino-3-chlorobenzoic acid |
| Canonical SMILES | OC(=O)c1cccc(c1N)Cl |
| Standard InCHI | InChI=1S/C7H6ClNO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H,10,11) |
| Standard InCHIKey | LWUAMROXVQLJKA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 80807 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD172256] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC288202
Formula: C12H8N2O2
Ingredient ID: NPC288202
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1cc2nc3ccccc3nc2cc1O |
| Standard InCHI | InChI=1S/C12H8N2O2/c15-11-5-9-10(6-12(11)16)14-8-4-2-1-3-7(8)13-9/h1-6,15-16H |
| Standard InCHIKey | UVPLITJCYDVORW-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD138693] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC287823
Formula: C14H8N2O7
Ingredient ID: NPC287823
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1cc2nc3c(nc2c(c1O)C(=O)O)ccc(c3C(=O)O)O |
| Standard InCHI | InChI=1S/C14H8N2O7/c17-6-2-1-4-10(8(6)13(20)21)16-5-3-7(18)12(19)9(14(22)23)11(5)15-4/h1-3,17-19H,(H,20,21)(H,22,23) |
| Standard InCHIKey | VQRXDNACUSPCGR-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD136610] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC285635
Formula: C13H10N2O
Ingredient ID: NPC285635
| Common Name | 2-Methoxyphenazine |
| IUPAC Name | 2-methoxyphenazine |
| Canonical SMILES | COc1ccc2c(c1)nc1c(n2)cccc1 |
| Standard InCHI | InChI=1S/C13H10N2O/c1-16-9-6-7-12-13(8-9)15-11-5-3-2-4-10(11)14-12/h2-8H,1H3 |
| Standard InCHIKey | YGSXHEXJOFMTHZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 235279 ChEMBL ID: CHEMBL1420181 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD15072] Database: NPASS [NPC285635] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC271638
Formula: C17H16N2O5
Ingredient ID: NPC271638
| Common Name | n.a. |
| IUPAC Name | methyl 2,3,4-trimethoxyphenazine-1-carboxylate |
| Canonical SMILES | COC(=O)c1c(OC)c(OC)c(c2c1nc1ccccc1n2)OC |
| Standard InCHI | InChI=1S/C17H16N2O5/c1-21-14-11(17(20)24-4)12-13(15(22-2)16(14)23-3)19-10-8-6-5-7-9(10)18-12/h5-8H,1-4H3 |
| Standard InCHIKey | WIKPMELCZRXISE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 21856881 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD33566] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC265024
Formula: C11H16O2
Ingredient ID: NPC265024
| Common Name | n.a. |
| IUPAC Name | (2R)-4-[(Z)-hex-1-enyl]-2-methyl-2H-furan-5-one |
| Canonical SMILES | CCCC/C=CC1=C[C@H](OC1=O)C |
| Standard InCHI | InChI=1S/C11H16O2/c1-3-4-5-6-7-10-8-9(2)13-11(10)12/h6-9H,3-5H2,1-2H3/b7-6-/t9-/m1/s1 |
| Standard InCHIKey | OVEBWDPQALSVNI-ATJFRQLMSA-N |
| Ingredient External Links |
PubChem CID: 11321306 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD37659] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC26211
Formula: C13H8N2O3
Ingredient ID: NPC26211
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC(=O)c1ccc(c2c1nc1ccccc1n2)O |
| Standard InCHI | InChI=1S/C13H8N2O3/c16-10-6-5-7(13(17)18)11-12(10)15-9-4-2-1-3-8(9)14-11/h1-6,16H,(H,17,18) |
| Standard InCHIKey | FTPQQTMOIZXREL-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD9387] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC261178
Formula: C11H16O3
Ingredient ID: NPC261178
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CCCC/C=CC1=C[C@](OC1=O)(C)O |
| Standard InCHI | InChI=1S/C11H16O3/c1-3-4-5-6-7-9-8-11(2,13)14-10(9)12/h6-8,13H,3-5H2,1-2H3/b7-6-/t11-/m1/s1 |
| Standard InCHIKey | DLESRUNXEOWSOI-JMEBYUIHSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD26003] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC258773
Formula: C14H12N2O2
Ingredient ID: NPC258773
| Common Name | 2,3-Dimethoxyphenazine |
| IUPAC Name | 2,3-dimethoxyphenazine |
| Canonical SMILES | COc1cc2nc3ccccc3nc2cc1OC |
| Standard InCHI | InChI=1S/C14H12N2O2/c1-17-13-7-11-12(8-14(13)18-2)16-10-6-4-3-5-9(10)15-11/h3-8H,1-2H3 |
| Standard InCHIKey | YQIADNJBCIVZAI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 21679909 ChEMBL ID: CHEMBL1802263 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD189172] Database: NPASS [NPC258773] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC256268
Formula: C14H8N2O4
Ingredient ID: NPC256268
| Common Name | n.a. |
| IUPAC Name | phenazine-1,6-dicarboxylic acid |
| Canonical SMILES | OC(=O)c1cccc2c1nc1cccc(c1n2)C(=O)O |
| Standard InCHI | InChI=1S/C14H8N2O4/c17-13(18)7-3-1-5-9-11(7)16-10-6-2-4-8(14(19)20)12(10)15-9/h1-6H,(H,17,18)(H,19,20) |
| Standard InCHIKey | MJALVONLCNWZHK-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 193025 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD113630] Database: NPASS [NPC256268] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC251949
Formula: C16H12N2O4
Ingredient ID: NPC251949
| Common Name | n.a. |
| IUPAC Name | dimethyl phenazine-1,6-dicarboxylate |
| Canonical SMILES | COC(=O)c1cccc2c1nc1cccc(c1n2)C(=O)OC |
| Standard InCHI | InChI=1S/C16H12N2O4/c1-21-15(19)9-5-3-7-11-13(9)17-12-8-4-6-10(14(12)18-11)16(20)22-2/h3-8H,1-2H3 |
| Standard InCHIKey | BKKXRPZAWAUFKA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10756325 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD71166] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC219848
Formula: C13H8N2O2
Ingredient ID: NPC219848
| Common Name | Phenazine-1-Carboxylic Acid |
| IUPAC Name | phenazine-1-carboxylic acid |
| Canonical SMILES | OC(=O)c1cccc2c1nc1ccccc1n2 |
| Standard InCHI | InChI=1S/C13H8N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7H,(H,16,17) |
| Standard InCHIKey | JGCSKOVQDXEQHI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 95069 ChEMBL ID: CHEMBL463686 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD148889] Database: NPASS [NPC219848] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC213345
Formula: C10H8ClNO2
Ingredient ID: NPC213345
| Common Name | n.a. |
| IUPAC Name | 2-(7-chloro-1H-indol-3-yl)acetic acid |
| Canonical SMILES | OC(=O)Cc1c[nH]c2c1cccc2Cl |
| Standard InCHI | InChI=1S/C10H8ClNO2/c11-8-3-1-2-7-6(4-9(13)14)5-12-10(7)8/h1-3,5,12H,4H2,(H,13,14) |
| Standard InCHIKey | IFOAZUXPPBRTBS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 3083739 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD179665] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC209217
Formula: C15H14N2O3
Ingredient ID: NPC209217
| Common Name | n.a. |
| IUPAC Name | 2,3,7-trimethoxyphenazine |
| Canonical SMILES | COc1ccc2c(c1)nc1c(n2)cc(c(c1)OC)OC |
| Standard InCHI | InChI=1S/C15H14N2O3/c1-18-9-4-5-10-11(6-9)17-13-8-15(20-3)14(19-2)7-12(13)16-10/h4-8H,1-3H3 |
| Standard InCHIKey | JLAONHHPFOHTJH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 21856873 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD109427] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC192698
Formula: C19H18N2O7
Ingredient ID: NPC192698
| Common Name | n.a. |
| IUPAC Name | dimethyl 2,3,7-trimethoxyphenazine-1,6-dicarboxylate |
| Canonical SMILES | COc1cc2nc3c(nc2c(c1OC)C(=O)OC)ccc(c3C(=O)OC)OC |
| Standard InCHI | InChI=1S/C19H18N2O7/c1-24-11-7-6-9-15(13(11)18(22)27-4)21-10-8-12(25-2)17(26-3)14(16(10)20-9)19(23)28-5/h6-8H,1-5H3 |
| Standard InCHIKey | WSUXJSZDSVZUQU-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 21856884 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD33195] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC186994
Formula: C15H12N2O3
Ingredient ID: NPC186994
| Common Name | n.a. |
| IUPAC Name | methyl 2-methoxyphenazine-1-carboxylate |
| Canonical SMILES | COC(=O)c1c(OC)ccc2c1nc1ccccc1n2 |
| Standard InCHI | InChI=1S/C15H12N2O3/c1-19-12-8-7-11-14(13(12)15(18)20-2)17-10-6-4-3-5-9(10)16-11/h3-8H,1-2H3 |
| Standard InCHIKey | GNPMGTJEVQIOGB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 12318580 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD101194] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC178218
Formula: C13H8N2O4
Ingredient ID: NPC178218
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1cccc2c1nc1ccc(c(c1n2)C(=O)O)O |
| Standard InCHI | InChI=1S/C13H8N2O4/c16-8-5-4-7-12(10(8)13(18)19)15-6-2-1-3-9(17)11(6)14-7/h1-5,16-17H,(H,18,19) |
| Standard InCHIKey | KRVVINAWMQTPMH-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD76714] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC170656
Formula: C16H14N2O4
Ingredient ID: NPC170656
| Common Name | n.a. |
| IUPAC Name | methyl 2,6-dimethoxyphenazine-1-carboxylate |
| Canonical SMILES | COc1cccc2c1nc1ccc(c(c1n2)C(=O)OC)OC |
| Standard InCHI | InChI=1S/C16H14N2O4/c1-20-11-8-7-10-15(13(11)16(19)22-3)18-9-5-4-6-12(21-2)14(9)17-10/h4-8H,1-3H3 |
| Standard InCHIKey | AXQRRUDMDZOPGI-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 101289916 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD166023] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC167647
Formula: C15H12N2O3
Ingredient ID: NPC167647
| Common Name | n.a. |
| IUPAC Name | methyl 6-methoxyphenazine-1-carboxylate |
| Canonical SMILES | COC(=O)c1cccc2c1nc1cccc(c1n2)OC |
| Standard InCHI | InChI=1S/C15H12N2O3/c1-19-12-8-4-7-11-14(12)17-10-6-3-5-9(13(10)16-11)15(18)20-2/h3-8H,1-2H3 |
| Standard InCHIKey | GQFPWKFVZSSJSR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 12318570 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD77866] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC157925
Formula: C10H5Cl3N2O2
Ingredient ID: NPC157925
| Common Name | n.a. |
| IUPAC Name | 2,3-dichloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole |
| Canonical SMILES | Clc1[nH]cc(c1Cl)c1cccc(c1N(=O)=O)Cl |
| Standard InCHI | InChI=1S/C10H5Cl3N2O2/c11-7-3-1-2-5(9(7)15(16)17)6-4-14-10(13)8(6)12/h1-4,14H |
| Standard InCHIKey | CZHPYSUGJMFCTC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 367486 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD68896] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC1527
Formula: C13H10N2O
Ingredient ID: NPC1527
| Common Name | 1-Methoxyphenazine |
| IUPAC Name | 1-methoxyphenazine |
| Canonical SMILES | COc1cccc2c1nc1ccccc1n2 |
| Standard InCHI | InChI=1S/C13H10N2O/c1-16-12-8-4-7-11-13(12)15-10-6-3-2-5-9(10)14-11/h2-8H,1H3 |
| Standard InCHIKey | ZYDGCYWJDWIJCS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 76137 ChEMBL ID: CHEMBL1802197 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD149499] Database: NPASS [NPC1527] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC147398
Formula: C13H8N2O3
Ingredient ID: NPC147398
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC(=O)c1c(O)ccc2c1nc1ccccc1n2 |
| Standard InCHI | InChI=1S/C13H8N2O3/c16-10-6-5-9-12(11(10)13(17)18)15-8-4-2-1-3-7(8)14-9/h1-6,16H,(H,17,18) |
| Standard InCHIKey | GXLWPTUCVZRTBQ-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD169836] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC146394
Formula: C25H16N4O2
Ingredient ID: NPC146394
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc2c(c1Cc1c(O)ccc3c1nc1ccccc1n3)nc1c(n2)cccc1 |
| Standard InCHI | InChI=1S/C25H16N4O2/c30-22-11-9-20-24(28-18-7-3-1-5-16(18)26-20)14(22)13-15-23(31)12-10-21-25(15)29-19-8-4-2-6-17(19)27-21/h1-12,30-31H,13H2 |
| Standard InCHIKey | UEMRXUPBPMNPIE-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD176901] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC140751
Formula: C10H8ClNO2
Ingredient ID: NPC140751
| Common Name | n.a. |
| IUPAC Name | 2-(7-chloroindol-1-yl)acetic acid |
| Canonical SMILES | OC(=O)Cn1ccc2c1c(Cl)ccc2 |
| Standard InCHI | InChI=1S/C10H8ClNO2/c11-8-3-1-2-7-4-5-12(10(7)8)6-9(13)14/h1-5H,6H2,(H,13,14) |
| Standard InCHIKey | HCPLEHHIQHALRW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 67082699 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD164216] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC131383
Formula: C12H8N2O3
Ingredient ID: NPC131383
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc2c(c1)nc1c(n2)cc(c(c1)O)O |
| Standard InCHI | InChI=1S/C12H8N2O3/c15-6-1-2-7-8(3-6)14-10-5-12(17)11(16)4-9(10)13-7/h1-5,15-17H |
| Standard InCHIKey | IDKBBGJMQPTZSX-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD197008] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC115049
Formula: C10H6Cl2N2O2
Ingredient ID: NPC115049
| Common Name | Pyrrolnitrin |
| IUPAC Name | 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole |
| Canonical SMILES | Clc1c[nH]cc1c1cccc(c1N(=O)=O)Cl |
| Standard InCHI | InChI=1S/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| Standard InCHIKey | QJBZDBLBQWFTPZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 13916 ChEMBL ID: CHEMBL97972 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD85612] Database: NPASS [NPC115049] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Ingredient ID: NPC105363
Formula: C13H8N2O5
Ingredient ID: NPC105363
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1c(O)c(C(=O)O)c2c(c1O)nc1c(n2)cccc1 |
| Standard InCHI | InChI=1S/C13H8N2O5/c16-10-7(13(19)20)8-9(11(17)12(10)18)15-6-4-2-1-3-5(6)14-8/h1-4,16-18H,(H,19,20) |
| Standard InCHIKey | FIPXTPAPLDJRFC-UHFFFAOYSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD48090] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Backhousia citriodora | Backhousia | Myrtaceae |
|
| Aglaia tomentosa | Aglaia | Meliaceae |
|
| Senecio macrocephalus | Senecio | Asteraceae | |
| Upuna borneensis | Upuna | Dipterocarpaceae | |
| Mentha timija | Mentha | Lamiaceae | |
| Capraria biflora | Capraria | Scrophulariaceae |
|
| Centipeda minima | Centipeda | Asteraceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC105363 | C13H8N2O5 | 272.0433214 | -1.6207 | 2.12 | 1.797 | 4 | 4 | 123.77 | 1 | 3 | 20 | 0 | |
| NPC115049 | C10H6Cl2N2O2 | Pyrrolnitrin | 255.98 | 1.7283 | 1.9 | 2.865 | 1 | 1 | 58.93 | 5 | 2 | 16 | 0 |
| NPC131383 | C12H8N2O3 | 228.0534921 | -1.3809 | 2.23 | 1.148 | 2 | 3 | 86.47 | 0 | 3 | 17 | 0 | |
| NPC140751 | C10H8ClNO2 | 2-(7-chloroindol-1-yl)acetic acid | 209.0243562 | 0.3159 | 2.12 | 1.956 | 3 | 1 | 42.23 | 2 | 2 | 14 | 0 |
| NPC146394 | C25H16N4O2 | 404.1273258 | -0.4644 | 3.55 | 4.816 | 4 | 2 | 92.02 | 2 | 6 | 31 | 0 | |
| NPC147398 | C13H8N2O3 | 240.0534921 | -0.7001 | 2.34 | 2.865 | 4 | 2 | 83.31 | 1 | 3 | 18 | 0 | |
| NPC1527 | C13H10N2O | 1-Methoxyphenazine | 210.08 | -0.0518 | 2.56 | 3.164 | 2 | 0 | 35.01 | 2 | 3 | 16 | 0 |
| NPC157925 | C10H5Cl3N2O2 | 2,3-dichloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole | 289.9416604 | 2.262 | 1.79 | 3.346 | 1 | 1 | 58.93 | 2 | 2 | 17 | 0 |
| NPC167647 | C15H12N2O3 | methyl 6-methoxyphenazine-1-carboxylate | 268.0847922 | -0.0406 | 2.56 | 2.722 | 4 | 0 | 61.31 | 3 | 3 | 20 | 0 |
| NPC170656 | C16H14N2O4 | methyl 2,6-dimethoxyphenazine-1-carboxylate | 298.0953569 | -0.0924 | 2.56 | 2.832 | 4 | 0 | 70.54 | 4 | 3 | 22 | 0 |
| NPC178218 | C13H8N2O4 | 256.0484067 | -1.1604 | 2.23 | 1.902 | 4 | 3 | 103.54 | 1 | 3 | 19 | 0 | |
| NPC186994 | C15H12N2O3 | methyl 2-methoxyphenazine-1-carboxylate | 268.0847922 | -0.0406 | 2.56 | 3.276 | 4 | 0 | 61.31 | 3 | 3 | 20 | 0 |
| NPC192698 | C19H18N2O7 | dimethyl 2,3,7-trimethoxyphenazine-1,6-dicarboxylate | 386.1114009 | -0.133 | 2.56 | 1.946 | 6 | 0 | 106.07 | 7 | 3 | 28 | 0 |
| NPC209217 | C15H14N2O3 | 2,3,7-trimethoxyphenazine | 270.1004423 | -0.1554 | 2.56 | 2.276 | 2 | 0 | 53.47 | 3 | 3 | 20 | 0 |
| NPC213345 | C10H8ClNO2 | 2-(7-chloro-1H-indol-3-yl)acetic acid | 209.0243562 | 0.1189 | 2.12 | 1.564 | 3 | 2 | 53.09 | 2 | 2 | 14 | 0 |
| NPC219848 | C13H8N2O2 | Phenazine-1-Carboxylic Acid | 224.06 | -0.2398 | 2.45 | 2.845 | 4 | 1 | 63.08 | 2 | 3 | 17 | 0 |
| NPC251949 | C16H12N2O4 | dimethyl phenazine-1,6-dicarboxylate | 296.0797069 | 0.0224 | 2.56 | 2.724 | 6 | 0 | 78.38 | 4 | 3 | 22 | 0 |
| NPC256268 | C14H8N2O4 | 268.0484067 | -0.4796 | 2.34 | 2.082 | 6 | 2 | 100.38 | 4 | 3 | 20 | 0 | |
| NPC258773 | C14H12N2O2 | 2,3-Dimethoxyphenazine | 240.09 | -0.1036 | 2.56 | 2.72 | 2 | 0 | 44.24 | 4 | 3 | 18 | 0 |
| NPC261178 | C11H16O3 | 196.1099444 | -0.0092 | 2.34 | 2.719 | 3 | 1 | 46.53 | 4 | 1 | 14 | 0 | |
| NPC26211 | C13H8N2O3 | 240.0534921 | -0.7001 | 2.34 | 1.882 | 4 | 2 | 83.31 | 1 | 3 | 18 | 0 | |
| NPC265024 | C11H16O2 | (2R)-4-[(Z)-hex-1-enyl]-2-methyl-2H-furan-5-one | 180.1150298 | 0.3807 | 2.45 | 3.604 | 2 | 0 | 26.3 | 4 | 1 | 13 | 0 |
| NPC271638 | C17H16N2O5 | methyl 2,3,4-trimethoxyphenazine-1-carboxylate | 328.1059216 | -0.1442 | 2.56 | 2.388 | 4 | 0 | 79.77 | 5 | 3 | 24 | 0 |
| NPC285635 | C13H10N2O | 2-Methoxyphenazine | 210.08 | -0.0518 | 2.56 | 3.164 | 2 | 0 | 35.01 | 2 | 3 | 16 | 0 |
| NPC287823 | C14H8N2O7 | 316.0331506 | -1.8605 | 2.01 | 1.034 | 6 | 5 | 161.07 | 2 | 3 | 23 | 0 | |
| NPC288202 | C12H8N2O2 | 212.0585775 | -0.9206 | 2.34 | 2.111 | 2 | 2 | 66.24 | 0 | 3 | 16 | 0 | |
| NPC289574 | C7H6ClNO2 | 2-amino-3-chlorobenzoic acid | 171.0087061 | -0.2454 | 1.79 | 1.528 | 3 | 2 | 63.32 | 1 | 1 | 11 | 0 |
| NPC29128 | C16H14N2O4 | methyl 2,3-dimethoxyphenazine-1-carboxylate | 298.0953569 | -0.0924 | 2.56 | 2.832 | 4 | 0 | 70.54 | 4 | 3 | 22 | 0 |
| NPC36168 | C12H8N2O | 196.0636629 | -0.4603 | 2.45 | 2.645 | 2 | 1 | 46.01 | 1 | 3 | 15 | 0 | |
| NPC37802 | C17H28O2 | 264.2089301 | -2.7092 | 3.11 | 6.426 | 0 | 2 | 40.46 | 13 | 1 | 19 | 1 | |
| NPC49561 | C10H5Cl2FN2O2 | 3-chloro-4-(3-chloro-4-fluoro-2-nitrophenyl)-1H-pyrrole | 273.971211 | 2.208 | 1.79 | 2.824 | 1 | 1 | 58.93 | 2 | 2 | 17 | 0 |
| NPC59108 | C13H8N2O4 | 256.0484067 | -1.1604 | 2.23 | 2.331 | 4 | 3 | 103.54 | 1 | 3 | 19 | 0 | |
| NPC59506 | C19H32O2 | 292.2402303 | -3.2852 | 3.33 | 7.564 | 0 | 2 | 40.46 | 11 | 1 | 21 | 2 | |
| NPC71540 | C15H12N2O3 | methyl 4-methoxyphenazine-1-carboxylate | 268.0847922 | -0.0406 | 2.56 | 2.722 | 4 | 0 | 61.31 | 3 | 3 | 20 | 0 |
| NPC88573 | C11H9ClN2O2 | 4-(2-amino-3-chlorophenyl)-1H-pyrrole-2-carboxylic acid | 236.0352552 | -0.6658 | 2.12 | -0.689 | 4 | 3 | 79.11 | 2 | 2 | 16 | 0 |
| NPC99170 | C14H10N2O2 | methyl phenazine-1-carboxylate | 238.0742276 | 0.0112 | 2.56 | 3.166 | 4 | 0 | 52.08 | 2 | 3 | 18 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
