Drug Information| Drug ID:   | NPD4826 |
| Drug Name:   | Streptomycin Sulfate |
| Molecular Formula:   | C21H39N7O12.H2O4S |
| Canonical SMILES:   | OS(=O)(=O)O.OC[C@@H]1O[C@@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@@H]([C@H]([C@@H]3NC(=N)N)O)NC(=N)N)O[C@H]([C@]2(O)C=O)C)[C@H]([C@@H]([C@H]1O)O)NC |
| Standard InCHI:   | "InChI=1S/C21H39N7O12.H2O4S/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35;1-5(2,3)4/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28);(H2,1,2,3,4)/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+;/m0./s1" |
| Standard InCHIKey:   | CFCMMYICHMLDCC-RMIBZTJPSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4826Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC478664 |
| High Similarity | 1.0 | NPC487063 |
| High Similarity | 1.0 | NPC489233 |
| High Similarity | 0.9385 | NPC299614 |
| High Similarity | 0.9385 | NPC478574 |
| High Similarity | 0.9385 | NPC94319 |
| High Similarity | 0.8507 | NPC568077 |
| Intermediate Similarity | 0.8429 | NPC121479 |
| Intermediate Similarity | 0.8429 | NPC611621 |
| Intermediate Similarity | 0.7714 | NPC140931 |
| Intermediate Similarity | 0.7714 | NPC57436 |
| Intermediate Similarity | 0.7714 | NPC611234 |
| Intermediate Similarity | 0.7297 | NPC520521 |
| Intermediate Similarity | 0.7108 | NPC41074 |
| Intermediate Similarity | 0.7108 | NPC508414 |
| Intermediate Similarity | 0.7037 | NPC128455 |
| Remote Similarity | 0.6265 | NPC497815 |
| Remote Similarity | 0.5926 | NPC538916 |
| Remote Similarity | 0.5897 | NPC283971 |
| Remote Similarity | 0.5238 | NPC116392 |
| Remote Similarity | 0.5185 | NPC600222 |
| Remote Similarity | 0.5185 | NPC611964 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 581.27 |
| ALogP   | -5.8504 |
| MLogP   | 1.68 |
| XLogP   | -3.511 |
| HDA   | 19 |
| HBD   | 14 |
| Rotatable Bonds   | 22 |
| TPSA   | 331.43 |
| RO5 Violation   | 3 |