NPASS Compound

Natural Product: NPC603140

Natural Product ID	NPC603140
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UNCQAFYASAWAFL-KWIOUIIFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL103020
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 100105 0 0 0 0 0 0 0 0999 V2000 1.5288 -6.0535 -1.8153 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8954 -4.7238 -2.0589 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6573 -4.3677 -3.2460 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5580 -3.8672 -1.0592 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0202 -2.6435 -1.2066 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5393 -2.6672 -0.8905 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8538 -3.7437 -1.3520 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6946 -2.0025 -0.3118 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9344 -2.8359 0.9606 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9126 -0.5758 -0.2025 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0003 0.5046 0.2424 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3349 1.6915 -0.4389 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5098 2.9456 -0.0241 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3078 3.0639 1.1981 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8881 4.1052 -0.8168 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1295 4.0755 -2.1556 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4862 5.2500 -2.8156 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6021 6.4534 -2.1416 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3592 6.4818 -0.7963 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0073 5.3086 -0.1607 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5407 0.2255 0.2301 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7389 -1.0004 1.0040 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4626 0.7218 1.1383 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6108 -0.3005 1.1649 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8764 0.2291 1.1312 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8038 0.1703 2.1144 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5260 -0.4178 3.1869 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1497 0.8121 1.9005 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1706 1.3822 0.6312 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2456 -0.2154 1.9420 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9805 -1.1939 0.9524 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5079 0.4430 1.4819 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5818 -0.3404 1.0380 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7671 0.2074 0.6018 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9325 1.5788 0.5903 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8806 2.3562 1.0256 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6749 1.8096 1.4696 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4196 -1.4693 0.2156 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1904 -2.7146 0.3620 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5334 -1.4329 -0.7487 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1140 -0.0191 -1.0890 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3484 0.7096 -1.4426 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7770 0.0415 -2.3074 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2651 -0.2831 0.4501 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3949 1.0384 0.8259 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3488 1.7133 1.4994 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3774 3.1714 1.8114 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3060 1.0527 1.9021 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1351 -1.2196 1.0670 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2225 -0.6274 0.3514 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3051 -0.5149 -0.6782 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0316 -1.7679 -1.4349 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8024 -2.4798 -1.2946 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0630 -3.8343 -1.0196 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8143 -6.8779 -2.0262 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8548 -6.1516 -0.7802 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4354 -6.1113 -2.4636 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1138 -2.5617 -2.3167 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9721 -3.3843 1.2746 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1412 -2.2459 1.8444 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5532 -3.7369 0.7865 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1555 -0.2607 -1.2797 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1842 0.7605 1.3093 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0405 3.1483 -2.6767 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6859 5.2699 -3.8755 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8789 7.3773 -2.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4500 7.4338 -0.2577 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8238 5.3883 0.9183 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0764 -0.7721 1.8804 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0216 0.8599 2.1797 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9357 1.6938 0.9968 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5147 -0.7909 2.1826 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3215 1.5736 2.6963 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6603 0.8231 -0.0075 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3994 -0.6743 2.9208 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7252 -2.0519 1.3740 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4816 -1.4085 1.0358 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6011 -0.3951 0.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8695 2.0362 0.2465 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9802 3.4238 1.0279 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8835 2.4680 1.7989 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6905 -3.0391 -0.5711 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0560 -2.4625 1.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6852 -3.5105 0.9326 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2633 0.0423 -1.5171 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6262 1.5879 -0.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3406 1.1146 -2.5139 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3774 0.9378 -2.3469 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1083 0.1634 -3.2295 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2759 -0.9087 -2.5654 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4035 3.4435 2.1213 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6442 3.4390 2.5933 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2059 3.6914 0.8443 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3165 -1.1591 2.1897 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3013 -2.2551 0.8169 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5296 0.4037 -1.2634 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9407 -2.4409 -1.2845 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2054 -1.4754 -2.5214 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3125 -2.5531 -2.3320 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9910 -4.0835 -1.2410 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 1 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 13 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 11 21 1 0 21 22 1 1 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 30 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 2 0 24 38 1 0 38 39 1 0 38 40 2 0 40 41 1 0 41 42 1 0 41 43 1 0 10 44 1 0 44 45 1 1 45 46 1 0 46 47 1 0 46 48 2 0 44 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 40 5 1 0 51 44 1 0 53 8 1 0 20 15 1 0 41 21 1 0 37 32 1 0 1 55 1 0 1 56 1 0 1 57 1 0 5 58 1 6 9 59 1 0 9 60 1 0 9 61 1 0 10 62 1 6 11 63 1 1 16 64 1 0 17 65 1 0 18 66 1 0 19 67 1 0 20 68 1 0 22 69 1 0 23 70 1 0 23 71 1 0 24 72 1 1 28 73 1 1 29 74 1 0 30 75 1 1 31 76 1 0 33 77 1 0 34 78 1 0 35 79 1 0 36 80 1 0 37 81 1 0 39 82 1 0 39 83 1 0 39 84 1 0 42 85 1 0 42 86 1 0 42 87 1 0 43 88 1 0 43 89 1 0 43 90 1 0 47 91 1 0 47 92 1 0 47 93 1 0 49 94 1 0 49 95 1 0 51 96 1 6 52 97 1 0 52 98 1 0 53 99 1 6 54100 1 0 M END

Standard InCHIKey	UNCQAFYASAWAFL-KWIOUIIFSA-N
Standard InCHI	InChI=1S/C40H46O14/c1-20-25(52-36(48)30(45)29(44)23-13-9-7-10-14-23)18-40(49)34(53-35(47)24-15-11-8-12-16-24)32-38(6,26(43)17-27-39(32,19-50-27)54-22(3)42)33(46)31(51-21(2)41)28(20)37(40,4)5/h7-16,25-27,29-32,34,43-45,49H,17-19H2,1-6H3/t25-,26-,27+,29-,30+,31+,32-,34-,38+,39-,40+/m0/s1
SMILES	CC(=O)O[C@H]1C(=O)[C@@]2(C)[C@H]([C@H](OC(=O)c3ccccc3)[C@]3(O)C[C@H](OC(=O)[C@H](O)[C@@H](O)c4ccccc4)C(C)=C1C3(C)C)[C@]1(OC(C)=O)CO[C@@H]1C[C@@H]2O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	750.29	Volume:	740.483 ? Van der Waals volume.
Dense:	1.013	LogP:	2.344 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.651 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.533 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	37.0
TPSA:	212.42 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	4.0	Rings:	6.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.173	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.828	Fsp³:	0.525
MCE-18:	161.033 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.901	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.02 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.253 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.051	Promiscuous compounds:	0.202

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.885	MDCK Permeability:	-5.317
Pgp-inhibitor:	0.386	Pgp-substrate:	0.964
PAMPA:	0.997 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.895	30% Bioavailability (F30%):	0.948
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	1.0
Plasma Protein Binding (PPB):	88.758%	Volume Distribution (VD):	0.204
Fu:	11.627% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.997	BCRP inhibitor:	0.0
BSEP inhibitor:	0.585

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	0.568
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.833 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.217

Half-life (T1/2):

2.807

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.056
Human Hepatotoxicity (H-HT):	0.851	Drug-induced Liver Injury (DILI):	0.986
AMES Toxicity:	0.998	Rat Oral Acute Toxicity:	0.516
Maximum Recommended Daily Dose:	0.986	Skin Sensitization:	1.0
Carcinogencity:	0.624	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.013
Drug-induced Neurotoxicity:	0.998	Ototoxicity:	0.819
Hematotoxicity:	0.816	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.808
A549 Cytotoxicity:	0.997	Hek293 Cytotoxicity:	0.94
BCF:	0.483 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.237 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.866 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.991 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO41064	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9461653]
NPO41064	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO55205	Taxus yunanensis	Genus	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Ratio	2
IC50	1

Activity Type	# Activity
Cell line	2
Individual protein	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT781	Individual protein	Tubulin alpha chain	Sus scrofa	Ratio	>	100.0	n.a.	DOI[10.1016/S0960-894X(97)10142-1]

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT393	Cell line	HCT-116	Homo sapiens	Ratio	>	100.0	n.a.	DOI[10.1016/S0960-894X(97)10142-1]
NPT393	Cell line	HCT-116	Homo sapiens	IC50	>	200.0	nM	DOI[10.1016/S0960-894X(97)10142-1]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC603140 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	11273
0.1-0.2	36345
0.2-0.3	1930
0.3-0.4	237
0.4-0.5	19
0.5-0.6	26
0.6-0.7	9
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.766	Intermediate Similarity	NPC36607
0.732	Intermediate Similarity	NPC471623
0.732	Intermediate Similarity	NPC208553
0.732	Intermediate Similarity	NPC181964
0.732	Intermediate Similarity	NPC307628
0.732	Intermediate Similarity	NPC473400
0.732	Intermediate Similarity	NPC603171
0.7245	Intermediate Similarity	NPC33372
0.7245	Intermediate Similarity	NPC67246
0.7245	Intermediate Similarity	NPC324251
0.7245	Intermediate Similarity	NPC206211
0.7172	Intermediate Similarity	NPC487360
0.7172	Intermediate Similarity	NPC479182
0.7172	Intermediate Similarity	NPC479180
0.7172	Intermediate Similarity	NPC471629
0.7172	Intermediate Similarity	NPC306001
0.7126	Intermediate Similarity	NPC155329
0.7126	Intermediate Similarity	NPC114357
0.703	Intermediate Similarity	NPC275170
0.6961	Remote Similarity	NPC486061
0.6961	Remote Similarity	NPC486060
0.6893	Remote Similarity	NPC487361
0.6863	Remote Similarity	NPC471606
0.6629	Remote Similarity	NPC605573
0.6064	Remote Similarity	NPC259144
0.6064	Remote Similarity	NPC219419
0.6	Remote Similarity	NPC453583
0.6	Remote Similarity	NPC453588
0.5962	Remote Similarity	NPC473300
0.5905	Remote Similarity	NPC321072
0.5905	Remote Similarity	NPC215892
0.5905	Remote Similarity	NPC242662
0.5905	Remote Similarity	NPC102167
0.5905	Remote Similarity	NPC488127
0.5888	Remote Similarity	NPC478329
0.5849	Remote Similarity	NPC317882
0.5849	Remote Similarity	NPC191193
0.5806	Remote Similarity	NPC197037
0.5806	Remote Similarity	NPC229545
0.5806	Remote Similarity	NPC248265
0.5806	Remote Similarity	NPC134685
0.5794	Remote Similarity	NPC471754
0.5794	Remote Similarity	NPC479183
0.5794	Remote Similarity	NPC479181
0.5755	Remote Similarity	NPC327699
0.5638	Remote Similarity	NPC91730
0.5607	Remote Similarity	NPC473490
0.5579	Remote Similarity	NPC217918
0.5378	Remote Similarity	NPC479184
0.5345	Remote Similarity	NPC116862
0.5254	Remote Similarity	NPC472391
0.521	Remote Similarity	NPC479185
0.5204	Remote Similarity	NPC11588
0.5155	Remote Similarity	NPC609501

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC603140 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3825
0.1-0.2	5217
0.2-0.3	95
0.3-0.4	0
0.4-0.5	4
0.5-0.6	4
0.6-0.7	4
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.732	Intermediate Similarity	NPD8485	Phase 4
0.6733	Remote Similarity	NPD8368	Phase 2
0.6538	Remote Similarity	NPD8486	Phase 1
0.614	Remote Similarity	NPD8462	Phase 2
0.6058	Remote Similarity	NPD8424	Phase 3
0.5905	Remote Similarity	NPD8360	Approved
0.5905	Remote Similarity	NPD8361	Phase 4
0.5556	Remote Similarity	NPD8435	Phase 4
0.5089	Remote Similarity	NPD8407	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data