NPASS Compound

Natural Product: NPC317882

Natural Product ID	NPC317882
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	OUZGCGZMZBOCBH-HGKICXJESA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL420691
PubChem CID	5316384
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0000676] Taxanes and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 113118 0 0 0 0 0 0 0 0999 V2000 7.8761 3.5367 0.7392 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5527 2.3268 1.5870 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4020 1.5331 0.9813 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7543 1.0599 -0.3879 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6770 0.2739 -1.0531 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2739 -0.9540 -0.3692 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8298 -1.3129 0.7214 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2532 -1.8338 -0.8485 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9054 -3.0358 -0.1157 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4298 -4.1853 -0.9098 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6952 -4.0968 -1.4132 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2830 -5.1050 -2.1661 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5229 -6.2303 -2.3940 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2401 -6.3185 -1.8827 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6735 -5.3023 -1.1349 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4297 -3.1754 0.1446 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9988 -1.9265 0.8749 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6272 -1.6228 1.9079 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9695 -1.1453 0.4457 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5301 0.0623 1.1132 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8920 -0.1404 1.4628 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7738 1.0791 1.6285 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0379 0.8658 0.9257 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6639 1.6733 -0.1022 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2190 1.6970 -1.4991 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1384 2.6449 -2.2938 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5448 2.6680 -2.0359 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0529 2.3084 -0.7054 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1409 1.3477 0.0032 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8514 0.4299 -0.8366 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9932 1.2766 -0.6579 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6328 1.3005 1.3644 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6359 2.3639 2.2121 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2092 3.4750 1.8470 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1567 2.1972 3.5958 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6212 3.9686 -2.2435 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8855 2.2985 -1.7762 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8445 2.7778 -2.9105 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5235 2.5795 -1.2479 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3135 2.0457 0.0869 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6136 1.1058 0.0579 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6285 1.1541 -1.0148 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9712 2.3360 1.3946 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1347 2.4388 2.4476 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6984 3.6209 1.4575 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3580 3.9630 -1.2144 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1452 0.3703 -2.2222 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0422 -0.4820 0.4577 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7126 -1.5443 0.9435 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4498 -1.3874 1.9468 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5873 -2.8802 0.3104 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3089 -3.9368 0.8266 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2419 -5.2093 0.2992 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4251 -5.4443 -0.7854 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7060 -4.3891 -1.2988 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7740 -3.1176 -0.7704 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0101 1.1660 3.0233 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6809 -3.2510 -1.0318 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6399 4.1365 1.2780 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9852 4.1864 0.6324 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3055 3.2579 -0.2380 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2232 2.6583 2.5833 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4356 1.6674 1.6165 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5575 2.2577 0.8835 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1666 0.7340 1.6999 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9493 1.9592 -1.0274 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7152 0.4979 -0.3195 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9846 0.0347 -2.1039 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7968 0.9490 -1.1664 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7704 -1.5992 -1.7211 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4946 -3.0533 0.8295 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3363 -3.2152 -1.2548 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2912 -4.9956 -2.5481 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9651 -7.0347 -2.9835 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6873 -7.2221 -2.0902 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6631 -5.4218 -0.7574 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1732 -4.0513 0.7374 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2199 0.1628 1.9502 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8815 -0.7507 2.4233 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2981 -0.8770 0.7320 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8086 0.8007 1.7632 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7147 2.7641 0.2110 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9351 2.3497 -3.3640 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1436 2.1007 -2.8153 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9437 3.7194 -2.2323 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4705 3.1450 -0.0763 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0726 -0.5984 -0.4189 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7731 0.3454 -1.9113 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3258 1.9907 4.3170 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7079 3.1177 3.9155 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8300 1.3180 3.6328 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2430 4.5364 -1.7254 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1851 2.2159 -2.0158 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5085 0.5720 -0.6005 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0058 2.1613 -1.1548 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3619 0.5927 -1.9302 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1347 2.5082 2.0005 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0129 1.6975 3.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0612 3.4178 3.0268 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8846 4.1409 0.5053 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5531 3.5508 2.1492 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0620 4.4177 1.9887 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9154 4.3776 -1.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0799 0.0208 -2.3888 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6143 -0.4743 -1.7446 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5094 0.5424 -3.2792 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9668 -3.8095 1.6785 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8054 -6.0457 0.6989 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3589 -6.4421 -1.2161 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0664 -4.5823 -2.1521 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1875 -2.2938 -1.1969 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9279 0.3045 3.4705 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0295 -2.6602 -1.7442 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 2 0 9 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 29 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 26 36 1 0 25 37 1 0 37 38 2 0 37 39 1 0 39 40 1 0 40 41 2 0 41 42 1 0 40 43 1 0 43 44 1 0 43 45 1 0 39 46 1 0 25 47 1 0 23 48 1 0 48 49 1 0 49 50 2 0 49 51 1 0 51 52 2 0 52 53 1 0 53 54 2 0 54 55 1 0 55 56 2 0 22 57 1 0 16 58 1 0 15 10 1 0 41 20 1 0 43 22 1 0 29 24 1 0 31 28 1 0 56 51 1 0 1 59 1 0 1 60 1 0 1 61 1 0 2 62 1 0 2 63 1 0 3 64 1 0 3 65 1 0 4 66 1 0 4 67 1 0 5 68 1 0 5 69 1 0 8 70 1 0 9 71 1 0 11 72 1 0 12 73 1 0 13 74 1 0 14 75 1 0 15 76 1 0 16 77 1 0 20 78 1 0 21 79 1 0 21 80 1 0 23 81 1 0 24 82 1 0 26 83 1 0 27 84 1 0 27 85 1 0 28 86 1 0 30 87 1 0 30 88 1 0 35 89 1 0 35 90 1 0 35 91 1 0 36 92 1 0 39 93 1 0 42 94 1 0 42 95 1 0 42 96 1 0 44 97 1 0 44 98 1 0 44 99 1 0 45100 1 0 45101 1 0 45102 1 0 46103 1 0 47104 1 0 47105 1 0 47106 1 0 52107 1 0 53108 1 0 54109 1 0 55110 1 0 56111 1 0 57112 1 0 58113 1 0 M END

Standard InCHIKey	OUZGCGZMZBOCBH-HGKICXJESA-N
Standard InCHI	InChI=1S/C44H55NO13/c1-7-8-11-20-31(48)45-33(26-16-12-9-13-17-26)35(50)40(53)56-28-22-44(54)38(57-39(52)27-18-14-10-15-19-27)36-42(6,37(51)34(49)32(24(28)2)41(44,4)5)29(47)21-30-43(36,23-55-30)58-25(3)46/h9-10,12-19,28-30,33-36,38,47,49-50,54H,7-8,11,20-23H2,1-6H3,(H,45,48)/t28-,29-,30+,33?,34+,35+,36-,38-,42+,43-,44+/m0/s1
SMILES	CCCCCC(=O)NC(C1=CC=CC=C1)C(C(=O)OC2CC3(C(C4C(C(CC5C4(CO5)OC(=O)C)O)(C(=O)C(C(=C2C)C3(C)C)O)C)OC(=O)C6=CC=CC=C6)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	805.37	Volume:	811.873 ? Van der Waals volume.
Dense:	0.992	LogP:	3.71 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.553 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.314 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	16.0	Rigid Bonds:	37.0
TPSA:	215.22 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	5.0	Rings:	6.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.09	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.877	Fsp³:	0.568
MCE-18:	158.71 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.593	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.057 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.407 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.002	Promiscuous compounds:	0.0

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.285	MDCK Permeability:	-4.723
Pgp-inhibitor:	0.001	Pgp-substrate:	0.934
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.156
20% Bioavailability (F20%):	0.827	30% Bioavailability (F30%):	0.974
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	1.0
Plasma Protein Binding (PPB):	94.685%	Volume Distribution (VD):	-0.0
Fu:	4.872% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.054
OATP1B3 inhibitor:	0.979	BCRP inhibitor:	0.0
BSEP inhibitor:	0.594

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.005
CYP2C19-inhibitor:	0.842	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.112	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.824
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.992 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.352

Half-life (T1/2):

2.359

ADMET: Toxicity

hERG Blockers:	0.064	hERG Blockers (10um):	0.409
Human Hepatotoxicity (H-HT):	0.695	Drug-induced Liver Injury (DILI):	0.909
AMES Toxicity:	0.483	Rat Oral Acute Toxicity:	0.628
Maximum Recommended Daily Dose:	0.883	Skin Sensitization:	0.214
Carcinogencity:	0.042	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.011
Drug-induced Neurotoxicity:	0.986	Ototoxicity:	0.995
Hematotoxicity:	0.016	Drug-induced Nephrotoxicity:	0.981
Genotoxicity:	0.998	RPMI-8226 Immunitoxicity:	0.27
A549 Cytotoxicity:	0.115	Hek293 Cytotoxicity:	0.935
BCF:	0.72 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.751 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.533 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.604 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29841	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12217376]
NPO29841	Taxus yunnanensis	Species	Taxaceae	Eukaryota	wood	n.a.	n.a.	PMID[12444707]
NPO29841	Taxus yunnanensis	Species	Taxaceae	Eukaryota	wood	Yunnang Province, China	2000-OCT	PMID[21138310]
NPO29841	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	xylem	n.a.	PMID[21138310]
NPO29841	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29841	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT137	Cell line	L1210	Mus musculus	IC50	=	0.24	ug.mL-1	DOI[10.1016/S0960-894X(97)00029-2]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC317882 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	11627
0.1-0.2	35970
0.2-0.3	2109
0.3-0.4	85
0.4-0.5	16
0.5-0.6	25
0.6-0.7	15
0.7-0.8	2
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8925	High Similarity	NPC473300
0.7549	Intermediate Similarity	NPC471754
0.7282	Intermediate Similarity	NPC453583
0.7282	Intermediate Similarity	NPC473400
0.7212	Intermediate Similarity	NPC479183
0.7212	Intermediate Similarity	NPC479181
0.7184	Intermediate Similarity	NPC321072
0.7184	Intermediate Similarity	NPC215892
0.7184	Intermediate Similarity	NPC242662
0.7184	Intermediate Similarity	NPC102167
0.7184	Intermediate Similarity	NPC488127
0.6792	Remote Similarity	NPC603171
0.6637	Remote Similarity	NPC472392
0.6545	Remote Similarity	NPC471606
0.6216	Remote Similarity	NPC471629
0.6216	Remote Similarity	NPC306001
0.6186	Remote Similarity	NPC229545
0.6186	Remote Similarity	NPC248265
0.6186	Remote Similarity	NPC134685
0.6126	Remote Similarity	NPC33372
0.6126	Remote Similarity	NPC67246
0.6126	Remote Similarity	NPC324251
0.6126	Remote Similarity	NPC206211
0.6106	Remote Similarity	NPC275170
0.6071	Remote Similarity	NPC487360
0.6071	Remote Similarity	NPC478329
0.5946	Remote Similarity	NPC478328
0.5929	Remote Similarity	NPC479182
0.5929	Remote Similarity	NPC479180
0.5893	Remote Similarity	NPC471623
0.5893	Remote Similarity	NPC473558
0.5893	Remote Similarity	NPC208553
0.5893	Remote Similarity	NPC181964
0.5893	Remote Similarity	NPC307628
0.5893	Remote Similarity	NPC191193
0.5856	Remote Similarity	NPC36607
0.5849	Remote Similarity	NPC603140
0.5776	Remote Similarity	NPC486061
0.5776	Remote Similarity	NPC486060
0.5738	Remote Similarity	NPC472375
0.5726	Remote Similarity	NPC487361
0.5644	Remote Similarity	NPC605573
0.5526	Remote Similarity	NPC327699
0.5328	Remote Similarity	NPC289383
0.5323	Remote Similarity	NPC479186
0.5288	Remote Similarity	NPC11588
0.5143	Remote Similarity	NPC155329
0.5143	Remote Similarity	NPC114357
0.5096	Remote Similarity	NPC197037
0.5096	Remote Similarity	NPC91730
0.5096	Remote Similarity	NPC609501

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC317882 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3358
0.1-0.2	5650
0.2-0.3	129
0.3-0.4	0
0.4-0.5	3
0.5-0.6	8
0.6-0.7	0
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7184	Intermediate Similarity	NPD8360	Approved
0.7184	Intermediate Similarity	NPD8361	Phase 4
0.5893	Remote Similarity	NPD8485	Phase 4
0.5378	Remote Similarity	NPD8434	Phase 2
0.5366	Remote Similarity	NPD8404	Phase 2
0.5294	Remote Similarity	NPD8486	Phase 1
0.5169	Remote Similarity	NPD8368	Phase 2
0.5128	Remote Similarity	NPD8424	Phase 3
0.5085	Remote Similarity	NPD8435	Phase 4
0.5039	Remote Similarity	NPD8462	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data