NPASS Compound

Natural Product: NPC486061

Natural Product ID	NPC486061
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	QSYMCEMXHBPDHG-VHEIIKDYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	10605754
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001551] Diterpenoids [CHEMONTID:0000676] Taxanes and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 115120 0 0 0 0 0 0 0 0999 V2000 -0.1535 -1.3254 -3.4761 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3913 -0.7497 -2.1621 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5270 -0.1201 -2.0554 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6193 -0.5964 -2.8436 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8532 -0.7669 -1.8791 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7557 -0.1734 -2.4133 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1189 -1.4358 -0.5815 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0832 -2.8914 -0.8824 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7104 -1.3595 -0.5347 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2858 -2.1221 0.5847 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5722 -2.1524 1.8562 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1914 -1.6325 1.8865 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6778 -2.9553 2.1329 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0212 -3.3783 2.3098 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7665 -0.8259 0.6675 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4892 -0.1524 1.0714 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4115 -0.1117 0.1097 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0200 -0.3158 0.2941 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5753 -0.9062 -1.0192 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8828 -0.7501 -1.2516 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9386 -1.5625 -1.3424 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7261 -2.7800 -1.1882 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2903 -1.0812 -1.6125 C 0 0 1 0 0 0 0 0 0 0 0 0 4.9999 -0.5003 -0.3823 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2224 0.5587 0.2917 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0919 1.8346 -0.1730 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3905 2.8219 0.4859 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7782 2.5327 1.6801 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8879 1.2522 2.1818 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5887 0.2867 1.5115 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2670 -0.1218 -0.6850 N 0 0 0 0 0 0 0 0 0 0 0 0 7.2406 0.4454 -1.0410 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5964 -0.2136 -0.8901 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3501 -0.2434 -2.1892 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3705 0.6309 0.0948 C 0 0 1 0 0 0 0 0 0 0 0 0 10.7570 0.0811 0.3376 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5185 2.3020 -0.4668 Cl 0 0 0 0 0 0 0 0 0 0 0 0 8.3830 -1.8760 -0.2703 Cl 0 0 0 0 0 0 0 0 0 0 0 0 7.2722 1.7143 -1.6095 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1081 -2.1957 -1.9361 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5256 0.9333 -0.9674 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6825 1.8070 -1.0536 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3452 1.8669 -1.0570 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6513 -1.4707 -0.3648 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6431 1.2141 1.4770 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2072 1.7534 2.6443 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6072 1.0145 3.4476 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4543 3.1754 2.9187 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1509 3.9721 2.0407 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3678 5.3292 2.3085 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8852 5.8999 3.4644 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1892 5.1176 4.3486 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9786 3.7717 4.0755 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0017 -0.7554 3.0161 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1862 -1.0950 4.3118 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5529 -2.2308 4.5981 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9492 -0.1070 5.3888 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1711 -1.8712 -1.7455 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6082 -1.7953 -3.4942 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9382 -1.9326 -4.8589 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2461 -0.8689 -5.4512 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9356 -3.2064 -5.5752 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9804 -1.3238 -3.5778 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4220 -0.7004 -4.3447 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3713 -2.4103 -3.5839 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8896 0.1999 -3.5812 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5977 -2.9708 -1.9133 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7906 -3.5464 -0.3345 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1953 -3.4506 -1.0232 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8937 -0.2851 -0.4881 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2944 -1.6134 0.7605 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6447 -3.1636 0.3238 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1877 -1.7911 2.7351 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1383 -3.1475 3.0843 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1290 -3.5127 1.3553 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5218 0.0326 0.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0346 -0.6488 1.9880 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1569 -1.0524 1.1430 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6165 0.5482 0.6109 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4789 -2.0284 -0.8293 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2731 -0.3334 -2.4003 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0681 -1.3992 0.3492 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5612 2.1005 -1.1249 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3061 3.8212 0.0955 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2097 3.3001 2.2344 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3820 1.0626 3.1395 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6386 -0.7004 1.9533 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8369 -1.2280 -2.3694 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1592 0.5136 -2.1825 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7093 0.0190 -3.0618 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8527 0.6496 1.0975 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0701 0.3702 1.3529 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5211 0.4789 -0.3674 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7252 -1.0250 0.2811 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5826 2.0285 -2.2807 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6826 -2.9895 -1.5538 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9378 1.8658 -2.1692 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6146 1.6335 -0.5883 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4337 2.8947 -0.8519 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1749 2.2561 -0.0293 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6337 2.8140 -1.6194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5157 1.5204 -1.5957 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4401 -2.0430 0.3829 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5396 3.5484 1.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9165 5.9523 1.6139 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0473 6.9576 3.6847 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8010 5.5582 5.2688 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4297 3.1137 4.7520 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9166 0.9319 4.9965 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7296 -0.1220 6.1736 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9846 -0.3538 5.9206 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0120 -1.4522 -2.0374 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9855 -3.6140 -5.5853 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7295 -2.9915 -6.6646 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2403 -3.9613 -5.1923 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 6 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 2 0 26 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 24 31 1 0 31 32 2 3 32 33 1 0 33 34 1 0 33 35 1 0 35 36 1 0 35 37 1 0 33 38 1 1 32 39 1 0 23 40 1 0 17 41 1 0 41 42 1 0 41 43 1 0 17 44 1 6 16 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 2 0 12 54 1 1 54 55 1 0 55 56 2 0 55 57 1 0 9 58 1 0 4 59 1 0 59 60 1 0 60 61 2 0 60 62 1 0 19 2 1 0 30 25 1 0 53 48 1 0 41 3 1 0 15 7 1 0 14 11 1 0 1 63 1 0 1 64 1 0 1 65 1 0 4 66 1 6 8 67 1 0 8 68 1 0 8 69 1 0 9 70 1 1 10 71 1 0 10 72 1 0 11 73 1 1 13 74 1 0 13 75 1 0 15 76 1 1 16 77 1 1 18 78 1 0 18 79 1 0 19 80 1 1 23 81 1 6 24 82 1 1 26 83 1 0 27 84 1 0 28 85 1 0 29 86 1 0 30 87 1 0 34 88 1 0 34 89 1 0 34 90 1 0 35 91 1 1 36 92 1 0 36 93 1 0 36 94 1 0 39 95 1 0 40 96 1 0 42 97 1 0 42 98 1 0 42 99 1 0 43100 1 0 43101 1 0 43102 1 0 44103 1 0 49104 1 0 50105 1 0 51106 1 0 52107 1 0 53108 1 0 57109 1 0 57110 1 0 57111 1 0 58112 1 0 62113 1 0 62114 1 0 62115 1 0 M END

Standard InCHIKey	QSYMCEMXHBPDHG-VHEIIKDYSA-N
Standard InCHI	InChI=1S/C45H53Cl2NO14/c1-22-28(60-39(55)33(52)32(26-15-11-9-12-16-26)48-40(56)43(8,47)23(2)46)20-45(57)37(61-38(54)27-17-13-10-14-18-27)35-42(7,29(51)19-30-44(35,21-58-30)62-25(4)50)36(53)34(59-24(3)49)31(22)41(45,5)6/h9-18,23,28-30,32-35,37,51-52,57H,19-21H2,1-8H3,(H,48,56)/t23-,28+,29+,30-,32+,33-,34-,35+,37+,42-,43-,44+,45-/m1/s1
SMILES	CC1=C2[C@H](C(=O)[C@]3(C)[C@H](C[C@@H]4[C@@](CO4)([C@H]3[C@@H]([C@](C[C@@H]1OC(=O)[C@@H]([C@H](c1ccccc1)N=C([C@@](C)([C@@H](C)Cl)Cl)O)O)(C2(C)C)O)OC(=O)c1ccccc1)OC(=O)C)O)OC(=O)C

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO41064	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9461653]
NPO41064	Taxus yunnanensis	Species	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
GI50	1
TGI	1

Activity Type	# Activity
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	GI50	=	140.0	nM	PMID[9461653]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	TGI	=	4200.0	nM	PMID[9461653]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486061 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	11787
0.1-0.2	36109
0.2-0.3	1856
0.3-0.4	41
0.4-0.5	10
0.5-0.6	11
0.6-0.7	19
0.7-0.8	1
0.8-0.85	6
0.85-0.9	9
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC486060
0.8586	High Similarity	NPC33372
0.8586	High Similarity	NPC67246
0.8586	High Similarity	NPC324251
0.8586	High Similarity	NPC206211
0.85	High Similarity	NPC487360
0.85	High Similarity	NPC479182
0.85	High Similarity	NPC479180
0.85	High Similarity	NPC471629
0.85	High Similarity	NPC306001
0.8333	Intermediate Similarity	NPC275170
0.8173	Intermediate Similarity	NPC487361
0.8119	Intermediate Similarity	NPC471623
0.8119	Intermediate Similarity	NPC208553
0.8119	Intermediate Similarity	NPC181964
0.8119	Intermediate Similarity	NPC307628
0.7264	Intermediate Similarity	NPC453583
0.713	Intermediate Similarity	NPC478329
0.7037	Intermediate Similarity	NPC471754
0.7037	Intermediate Similarity	NPC479183
0.7037	Intermediate Similarity	NPC479181
0.6961	Remote Similarity	NPC603140
0.6944	Remote Similarity	NPC473400
0.6789	Remote Similarity	NPC453588
0.6759	Remote Similarity	NPC36607
0.6697	Remote Similarity	NPC321072
0.6697	Remote Similarity	NPC215892
0.6697	Remote Similarity	NPC242662
0.6697	Remote Similarity	NPC102167
0.6697	Remote Similarity	NPC488127
0.6636	Remote Similarity	NPC191193
0.6636	Remote Similarity	NPC603171
0.6545	Remote Similarity	NPC327699
0.65	Remote Similarity	NPC479184
0.6387	Remote Similarity	NPC472391
0.6333	Remote Similarity	NPC479185
0.6261	Remote Similarity	NPC471606
0.6238	Remote Similarity	NPC155329
0.6238	Remote Similarity	NPC114357
0.6083	Remote Similarity	NPC116862
0.5776	Remote Similarity	NPC317882
0.5739	Remote Similarity	NPC473300
0.569	Remote Similarity	NPC473490
0.569	Remote Similarity	NPC478328
0.5673	Remote Similarity	NPC605573
0.5635	Remote Similarity	NPC472375
0.56	Remote Similarity	NPC479173
0.5476	Remote Similarity	NPC479186
0.537	Remote Similarity	NPC259144
0.5238	Remote Similarity	NPC289383
0.5229	Remote Similarity	NPC219419

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486061 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3187
0.1-0.2	5812
0.2-0.3	138
0.3-0.4	0
0.4-0.5	5
0.5-0.6	0
0.6-0.7	6
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8119	Intermediate Similarity	NPD8485	Phase 4
0.7315	Intermediate Similarity	NPD8486	Phase 1
0.6852	Remote Similarity	NPD8424	Phase 3
0.6697	Remote Similarity	NPD8360	Approved
0.6697	Remote Similarity	NPD8361	Phase 4
0.6486	Remote Similarity	NPD8435	Phase 4
0.6311	Remote Similarity	NPD8462	Phase 2
0.6283	Remote Similarity	NPD8368	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data