NPASS Compound

Natural Product: NPC580776

Natural Product ID	NPC580776
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(1~{R},3~{a}~{S},5~{a}~{R},5~{b}~{R},8~{R},9~{R},11~{a}~{R})-1-(1-formylvinyl)-9-hydroxy-8-(hydroxymethyl)-5~{a},5~{b},8,11~{a}-tetramethyl-1,2,3,4,5,6,7,7~{a},9,10,11,11~{b},12,13,13~{a},13~{b}-hexadecahydrocyclopenta[a]chrysene-3~{a}-carboxylic acid
IUPAC Name	(1~{R},3~{a}~{S},5~{a}~{R},5~{b}~{R},8~{R},9~{R},11~{a}~{R})-1-(1-formylvinyl)-9-hydroxy-8-(hydroxymethyl)-5~{a},5~{b},8,11~{a}-tetramethyl-1,2,3,4,5,6,7,7~{a},9,10,11,11~{b},12,13,13~{a},13~{b}-hexadecahydrocyclopenta[a]chrysene-3~{a}-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 4.4365 -1.8347 2.5517 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4718 -1.7521 1.2350 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5396 -2.9857 0.4696 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5646 -4.1150 1.0438 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4573 -0.4788 0.5877 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5754 0.7518 1.4036 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3190 1.8491 0.3579 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8492 1.1407 -0.8638 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0349 0.8498 -1.7126 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2093 1.1980 -1.4413 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8244 0.1433 -2.8871 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8565 1.8594 -1.6916 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4654 1.9172 -1.1968 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0354 0.9682 -0.1484 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6236 1.8054 1.0818 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9661 -0.0642 0.3242 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4369 -1.4833 0.3282 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0107 -1.6757 0.5537 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8759 -0.5007 0.3434 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3195 -0.8428 0.1065 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6217 -1.5385 -1.1521 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7401 -1.7541 1.2658 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1980 -2.0062 1.2434 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0821 -0.8428 1.0734 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5681 -0.4280 2.3389 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5714 0.2968 0.2577 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1509 0.3040 -1.1076 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0933 1.5737 0.9532 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5944 1.6033 2.2518 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0658 0.4430 0.3276 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5452 1.5898 -0.4509 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2333 1.4651 -1.0989 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2966 0.3768 -0.6920 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1240 -0.3849 -1.9348 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3131 -0.1643 -0.3572 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4573 -2.7904 3.0520 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3859 -0.9590 3.1820 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5687 -2.9167 -0.6203 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3628 -0.4659 -0.1053 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6524 0.8208 1.7413 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9411 0.8426 2.2797 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3034 2.3563 0.1335 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6119 2.5903 0.7268 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5105 -0.4335 -3.3289 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9271 1.3845 -2.7213 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2967 2.8877 -1.8847 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2897 2.9963 -0.8812 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8301 1.8829 -2.1429 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9139 1.2923 2.0207 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4126 2.1179 1.0434 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2473 2.7203 1.0375 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2612 0.1132 1.4096 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9217 -2.0777 1.1649 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8047 -2.0358 -0.5871 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2785 -2.0993 1.5700 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3538 -2.4945 -0.1472 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8710 0.0886 1.3117 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7206 -1.8035 -1.1280 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1261 -2.5400 -1.1350 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4686 -0.9945 -2.0789 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2107 -2.7308 1.1665 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4549 -1.3322 2.2398 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4023 -2.8277 0.4926 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4584 -2.5071 2.2258 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0190 -1.2178 0.5580 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9685 -0.6860 3.0637 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7999 -0.6143 -1.2258 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8803 1.1484 -1.2885 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4761 0.3097 -1.9510 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8639 2.4681 0.3710 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2064 1.4322 0.9813 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5173 2.5637 2.5118 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8745 0.6747 1.4248 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3396 1.8283 -1.2278 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6124 2.5272 0.1897 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6903 2.4480 -0.9438 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3794 1.4656 -2.2227 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4256 -0.0000 -2.8450 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1246 -1.4590 -1.8884 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1829 -0.3081 -2.1835 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3299 -0.9495 -1.1414 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 2 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 6 9 10 2 0 9 11 1 0 8 12 1 0 12 13 1 0 13 14 1 0 14 15 1 1 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 6 26 28 1 0 28 29 1 0 26 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 6 16 35 1 0 35 5 1 0 35 8 1 0 33 14 1 0 33 19 1 0 30 20 1 0 1 36 1 0 1 37 1 0 3 38 1 0 5 39 1 6 6 40 1 0 6 41 1 0 7 42 1 0 7 43 1 0 11 44 1 0 12 45 1 0 12 46 1 0 13 47 1 0 13 48 1 0 15 49 1 0 15 50 1 0 15 51 1 0 16 52 1 0 17 53 1 0 17 54 1 0 18 55 1 0 18 56 1 0 19 57 1 0 21 58 1 0 21 59 1 0 21 60 1 0 22 61 1 0 22 62 1 0 23 63 1 0 23 64 1 0 24 65 1 6 25 66 1 0 27 67 1 0 27 68 1 0 27 69 1 0 28 70 1 0 28 71 1 0 29 72 1 0 30 73 1 0 31 74 1 0 31 75 1 0 32 76 1 0 32 77 1 0 34 78 1 0 34 79 1 0 34 80 1 0 35 81 1 0 M END

Standard InCHIKey	QFMLBJPCQONEAF-IQSFLHLTSA-N
Standard InCHI	InChI=1S/C30H46O5/c1-18(16-31)19-8-13-30(25(34)35)15-14-28(4)20(24(19)30)6-7-22-26(2)11-10-23(33)27(3,17-32)21(26)9-12-29(22,28)5/h16,19-24,32-33H,1,6-15,17H2,2-5H3,(H,34,35)/t19-,20?,21?,22?,23+,24?,26-,27-,28+,29+,30-/m0/s1
SMILES	C=C(C=O)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)C(CCC4[C@@]5(C)CC[C@@H](O)[C@@](C)(CO)C5CC[C@]43C)C12

Calculated Properties

Physi-Chem Properties

Molecular Weight:	486.33	Volume:	520.695 ? Van der Waals volume.
Dense:	0.934	LogP:	2.619 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.505 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.934 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	28.0
TPSA:	94.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.373	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.056	Fsp³:	0.867
MCE-18:	104.5 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.558	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.018 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.239	Promiscuous compounds:	0.066

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.329	MDCK Permeability:	-5.026
Pgp-inhibitor:	0.0	Pgp-substrate:	0.01
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.908	30% Bioavailability (F30%):	0.218
50% Bioavailability (F50%):	0.995

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.029	MRP1:	0.864
Plasma Protein Binding (PPB):	77.178%	Volume Distribution (VD):	-0.176
Fu:	22.89% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.98
OATP1B3 inhibitor:	0.035	BCRP inhibitor:	0.09
BSEP inhibitor:	0.979

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.403	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.006	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.134	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.915

Half-life (T1/2):

1.338

ADMET: Toxicity

hERG Blockers:	0.038	hERG Blockers (10um):	0.074
Human Hepatotoxicity (H-HT):	0.803	Drug-induced Liver Injury (DILI):	0.128
AMES Toxicity:	0.079	Rat Oral Acute Toxicity:	0.144
Maximum Recommended Daily Dose:	0.53	Skin Sensitization:	0.719
Carcinogencity:	0.875	Eye Corrosion:	0.002
Eye Irritation:	0.331	Respiratory Toxicity:	0.316
Drug-induced Neurotoxicity:	0.006	Ototoxicity:	0.793
Hematotoxicity:	0.033	Drug-induced Nephrotoxicity:	0.283
Genotoxicity:	0.162	RPMI-8226 Immunitoxicity:	0.018
A549 Cytotoxicity:	0.019	Hek293 Cytotoxicity:	0.304
BCF:	0.638 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.902 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.683 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.662 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40286	Phoradendron vernicosum	Species	Viscaceae	Eukaryota	Aerial Parts	n.a.	n.a.	PMID[29120172]
NPO40286	Phoradendron vernicosum	Species	Viscaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC580776 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21853
0.1-0.2	23722
0.2-0.3	3591
0.3-0.4	515
0.4-0.5	124
0.5-0.6	37
0.6-0.7	6
0.7-0.8	1
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC488165
0.8644	High Similarity	NPC488164
0.8644	High Similarity	NPC264005
0.7302	Intermediate Similarity	NPC264317
0.7302	Intermediate Similarity	NPC294438
0.7231	Intermediate Similarity	NPC16377
0.6866	Remote Similarity	NPC269360
0.6471	Remote Similarity	NPC151191
0.6324	Remote Similarity	NPC201655
0.6269	Remote Similarity	NPC30583
0.6176	Remote Similarity	NPC213832
0.6143	Remote Similarity	NPC601275
0.5972	Remote Similarity	NPC169933
0.5942	Remote Similarity	NPC24772
0.5942	Remote Similarity	NPC488506
0.5942	Remote Similarity	NPC220498
0.5909	Remote Similarity	NPC68828
0.5882	Remote Similarity	NPC192744
0.5857	Remote Similarity	NPC195395
0.5797	Remote Similarity	NPC80590
0.5775	Remote Similarity	NPC2783
0.5714	Remote Similarity	NPC476071
0.5652	Remote Similarity	NPC119743
0.5634	Remote Similarity	NPC271974
0.5634	Remote Similarity	NPC277399
0.5634	Remote Similarity	NPC247312
0.5556	Remote Similarity	NPC18064
0.5556	Remote Similarity	NPC4309
0.5541	Remote Similarity	NPC608379
0.5507	Remote Similarity	NPC472608
0.5493	Remote Similarity	NPC211162
0.5493	Remote Similarity	NPC183374
0.5493	Remote Similarity	NPC291373
0.5441	Remote Similarity	NPC246445
0.5405	Remote Similarity	NPC160506
0.5405	Remote Similarity	NPC486704
0.5333	Remote Similarity	NPC600004
0.527	Remote Similarity	NPC474719
0.527	Remote Similarity	NPC475061
0.527	Remote Similarity	NPC488213
0.5224	Remote Similarity	NPC78067
0.5224	Remote Similarity	NPC278091
0.5217	Remote Similarity	NPC269396
0.52	Remote Similarity	NPC611139
0.5195	Remote Similarity	NPC481311
0.5195	Remote Similarity	NPC603461
0.5132	Remote Similarity	NPC478841
0.5132	Remote Similarity	NPC488166
0.506	Remote Similarity	NPC486709

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC580776 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5736
0.1-0.2	3335
0.2-0.3	67
0.3-0.4	9
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7302	Intermediate Similarity	NPD7520	Phase 1
0.5405	Remote Similarity	NPD8035	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data