NPASS Compound

Natural Product: NPC169933

Natural Product ID	NPC169933
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	3Alpha,11Alpha-Dihydroxy-23-Oxo-Lup-20(29)-En-28-Oic Acid
IUPAC Name	(1R,3aS,5aR,5bR,7aR,8S,9R,11aS,11bR,12R,13aR,13bR)-8-formyl-9,12-dihydroxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1271589
PubChem CID	52940919
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 6.5283 0.5084 -1.5367 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6050 -0.2676 -1.3874 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8485 -0.2663 -0.1019 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4318 0.7627 0.7880 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0816 -1.6295 0.5135 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3501 -2.1022 0.0978 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0691 -2.5676 -0.0481 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6633 -2.2607 0.3596 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4380 -0.7386 0.5180 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3985 -0.0979 -0.4340 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0498 1.2894 -0.8728 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6395 1.2150 -1.4775 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6567 0.8545 -0.3462 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0222 -0.5472 0.0105 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0280 -1.2970 0.8226 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3577 -2.5244 0.2290 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1732 -0.5277 1.2324 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6873 0.4817 0.2853 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7525 0.8757 -0.8418 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9417 0.0947 -2.1022 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1830 2.3094 -1.2129 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6233 2.3936 -1.5866 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5389 1.6836 -0.6758 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0296 0.2745 -0.2976 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1316 -0.2397 0.5065 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3764 0.4686 -0.0315 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8610 1.2587 -1.2556 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3881 -1.6858 0.2832 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6525 -2.4908 -0.4600 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5891 -2.3024 0.9569 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8329 2.5155 0.4961 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6803 2.2349 1.7005 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3571 3.8050 0.2660 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8532 1.8909 0.6994 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6238 -0.4514 1.9579 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3618 -0.9402 -2.2035 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7161 0.3151 1.7849 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8519 1.6795 0.9296 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4326 1.1201 0.3920 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1297 -1.6100 1.6112 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2565 -2.6724 -0.7143 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1353 -2.5761 -1.1356 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3134 -3.6001 0.3128 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9921 -2.7137 -0.3735 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4747 -2.7809 1.3286 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2600 -0.7139 -1.3852 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2215 2.1038 -0.2083 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7028 1.4873 -1.7792 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3636 2.1230 -2.0064 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7785 0.3310 -2.1723 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0452 -1.0806 -0.9966 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5753 -1.6663 1.7446 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7112 -3.1183 0.9440 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9273 -0.0985 2.2599 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9860 -1.2400 1.4822 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7537 1.4345 0.9044 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1206 0.4257 -2.8055 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9842 -0.9804 -2.0102 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8426 0.4181 -2.6942 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5870 2.6881 -2.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0740 2.9341 -0.2767 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8856 3.4974 -1.4912 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8141 2.2070 -2.6698 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0322 -0.3029 -1.2490 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0424 -0.1152 1.6021 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8525 1.1158 0.7017 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1322 -0.2273 -0.4327 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5345 2.1303 -1.3713 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8051 0.6456 -2.1514 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9523 -3.5563 -0.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7622 -2.2252 -1.0108 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4160 -2.4581 0.2353 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8876 -1.6787 1.8060 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2707 -3.3154 1.2977 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1959 4.5709 0.9049 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9042 2.8869 0.1598 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1031 1.9591 1.4861 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8280 1.8564 1.2268 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3628 0.3183 2.2161 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9490 -1.3515 2.5678 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6811 -0.1462 2.5037 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 1 3 5 1 0 5 6 1 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 6 19 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 28 29 2 0 28 30 1 0 23 31 1 1 31 32 2 0 31 33 1 0 13 34 1 1 9 35 1 1 10 3 1 0 19 13 1 0 27 23 1 0 14 9 1 0 24 18 1 0 2 36 1 0 4 37 1 0 4 38 1 0 4 39 1 0 5 40 1 1 6 41 1 0 7 42 1 0 7 43 1 0 8 44 1 0 8 45 1 0 10 46 1 6 11 47 1 0 11 48 1 0 12 49 1 0 12 50 1 0 14 51 1 6 15 52 1 1 16 53 1 0 17 54 1 0 17 55 1 0 18 56 1 1 20 57 1 0 20 58 1 0 20 59 1 0 21 60 1 0 21 61 1 0 22 62 1 0 22 63 1 0 24 64 1 6 25 65 1 1 26 66 1 0 26 67 1 0 27 68 1 0 27 69 1 0 29 70 1 0 29 71 1 0 30 72 1 0 30 73 1 0 30 74 1 0 33 75 1 0 34 76 1 0 34 77 1 0 34 78 1 0 35 79 1 0 35 80 1 0 35 81 1 0 M END

Standard InCHIKey	XROBZOZQCIQCRT-KTYMJOEPSA-N
Standard InCHI	InChI=1S/C30H46O5/c1-17(2)18-7-12-30(25(34)35)14-13-28(5)19(23(18)30)15-20(32)24-26(3)10-9-22(33)27(4,16-31)21(26)8-11-29(24,28)6/h16,18-24,32-33H,1,7-15H2,2-6H3,(H,34,35)/t18-,19+,20+,21+,22+,23+,24+,26-,27-,28+,29+,30-/m0/s1
SMILES	O=C[C@]1(C)[C@H](O)CC[C@]2([C@H]1CC[C@@]1([C@@H]2[C@H](O)C[C@H]2[C@@]1(C)CC[C@@]1([C@@H]2[C@@H](CC1)C(=C)C)C(=O)O)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	486.33	Volume:	520.695 ? Van der Waals volume.
Dense:	0.934	LogP:	2.566 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.511 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.942 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	3.0	Rigid Bonds:	28.0
TPSA:	94.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	3.0	Rings:	5.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.375	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.163	Fsp³:	0.867
MCE-18:	107.25 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.897	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.008 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.297	Promiscuous compounds:	0.149

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.419	MDCK Permeability:	-5.082
Pgp-inhibitor:	0.0	Pgp-substrate:	0.442
PAMPA:	0.979 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.082	30% Bioavailability (F30%):	0.046
50% Bioavailability (F50%):	0.657

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.251	MRP1:	0.98
Plasma Protein Binding (PPB):	91.986%	Volume Distribution (VD):	-0.448
Fu:	7.504% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.941
OATP1B3 inhibitor:	0.256	BCRP inhibitor:	0.17
BSEP inhibitor:	0.884

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.012	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.024	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

8.702

Half-life (T1/2):

1.427

ADMET: Toxicity

hERG Blockers:	0.013	hERG Blockers (10um):	0.015
Human Hepatotoxicity (H-HT):	0.605	Drug-induced Liver Injury (DILI):	0.502
AMES Toxicity:	0.368	Rat Oral Acute Toxicity:	0.117
Maximum Recommended Daily Dose:	0.478	Skin Sensitization:	0.985
Carcinogencity:	0.943	Eye Corrosion:	0.015
Eye Irritation:	0.56	Respiratory Toxicity:	0.747
Drug-induced Neurotoxicity:	0.006	Ototoxicity:	0.795
Hematotoxicity:	0.446	Drug-induced Nephrotoxicity:	0.938
Genotoxicity:	0.95	RPMI-8226 Immunitoxicity:	0.039
A549 Cytotoxicity:	0.022	Hek293 Cytotoxicity:	0.078
BCF:	0.513 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.386 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.904 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.164 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	PMID[20621475]
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	steamed leaves	n.a.	n.a.	PMID[20932756]
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29834	Acanthopanax koreanum	n.a.	n.a.	n.a.	n.a.	n.a.	n.a.	Database[HerDing]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	1

Activity Type	# Activity
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Inhibition	=	57.6	%	PMID[20932756]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC169933 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22705
0.1-0.2	23318
0.2-0.3	3378
0.3-0.4	359
0.4-0.5	60
0.5-0.6	28
0.6-0.7	6
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8226	Intermediate Similarity	NPC2783
0.8095	Intermediate Similarity	NPC269360
0.6866	Remote Similarity	NPC57954
0.6418	Remote Similarity	NPC264317
0.6418	Remote Similarity	NPC294438
0.6324	Remote Similarity	NPC488164
0.6324	Remote Similarity	NPC264005
0.6027	Remote Similarity	NPC606727
0.5972	Remote Similarity	NPC488165
0.5926	Remote Similarity	NPC88744
0.589	Remote Similarity	NPC602147
0.5857	Remote Similarity	NPC24772
0.5694	Remote Similarity	NPC151191
0.5694	Remote Similarity	NPC16377
0.5634	Remote Similarity	NPC213832
0.5513	Remote Similarity	NPC253586
0.5417	Remote Similarity	NPC488506
0.5417	Remote Similarity	NPC291373
0.5417	Remote Similarity	NPC220498
0.5405	Remote Similarity	NPC474719
0.5342	Remote Similarity	NPC201655
0.5278	Remote Similarity	NPC80590
0.5263	Remote Similarity	NPC601176
0.5205	Remote Similarity	NPC211162
0.5205	Remote Similarity	NPC183374
0.5143	Remote Similarity	NPC68828
0.5139	Remote Similarity	NPC192744
0.5139	Remote Similarity	NPC119743
0.5135	Remote Similarity	NPC277399
0.5135	Remote Similarity	NPC195395
0.5132	Remote Similarity	NPC486704
0.5132	Remote Similarity	NPC611139
0.5068	Remote Similarity	NPC30583
0.5067	Remote Similarity	NPC4309
0.5065	Remote Similarity	NPC600004
0.5065	Remote Similarity	NPC607677

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC169933 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6166
0.1-0.2	2920
0.2-0.3	51
0.3-0.4	10
0.4-0.5	2
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6418	Remote Similarity	NPD7520	Phase 1

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data