NPASS Compound

Natural Product: NPC291373

Natural Product ID	NPC291373
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	2Alpha,3Beta,6Beta-Trihydroxylup-20(29)-En-28-Oic Acid
IUPAC Name	(1R,3aS,5aR,5bR,7R,7aR,9R,10R,11aR,11bR,13aR,13bR)-7,9,10-trihydroxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL515706
PubChem CID	9982971
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 83 87 0 0 0 0 0 0 0 0999 V2000 -5.6672 -1.1283 2.5859 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5007 -0.6094 2.3109 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3633 -0.9972 3.2169 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2862 0.3227 1.1785 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5521 0.5379 0.4146 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3742 -0.2680 -0.8847 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9158 -0.0171 -1.1459 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2606 -1.0217 -2.0212 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7867 -0.7331 -2.0801 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1043 -0.6320 -0.7343 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9325 -2.0552 -0.2734 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9466 0.2317 0.1617 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2603 0.6190 1.4338 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0105 1.4131 0.9854 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8711 0.3505 0.3678 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3242 0.7048 0.3870 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6571 2.0986 -0.0088 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7380 0.5974 1.8704 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2209 0.5967 2.0451 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9218 -0.4797 1.2966 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5585 -0.3481 -0.1741 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2893 0.7675 -0.8138 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0828 -1.6453 -0.8182 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0866 -0.3842 -0.3095 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5925 -0.6649 -1.7142 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1634 -1.1677 -1.5405 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2881 -0.0552 -0.9441 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1857 1.0263 -1.9550 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7677 0.3155 -2.6171 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2752 -0.4248 1.5219 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4384 0.4329 3.4339 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3154 -0.2865 0.2493 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7324 1.3441 -1.6092 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4041 1.5670 -2.8006 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8936 2.4638 -0.8165 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7178 -1.8234 3.4826 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6019 -0.9985 2.0793 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8966 -0.1201 3.6589 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7748 -1.7048 3.9692 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6958 -1.6173 2.5850 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9098 1.2922 1.6240 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7040 1.6246 0.1493 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4868 0.2244 0.8310 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6458 -1.3125 -0.7612 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9547 0.2801 -1.6547 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4818 -2.0676 -1.7300 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6331 -0.9221 -3.0682 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6736 0.1806 -2.7041 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2787 -1.5316 -2.7063 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8569 -2.5887 -0.0308 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5621 -2.6155 -1.1884 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2652 -2.1890 0.5902 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0147 1.2162 -0.4008 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8740 1.3264 1.9889 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8630 -0.2378 2.0192 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3603 2.1631 0.2504 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3968 1.8649 1.8841 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7858 -0.5348 1.0452 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3498 2.6222 0.7215 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1452 2.2333 -0.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7118 2.7091 0.1103 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3647 1.5553 2.3349 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2940 -0.2676 2.3554 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7081 1.5617 1.7999 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4797 -1.4644 1.6219 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9487 0.9229 -1.8452 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3681 0.4360 -0.9178 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3535 1.6995 -0.2217 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2364 -1.5171 -1.9031 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0474 -1.8855 -0.3237 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3791 -2.4634 -0.5643 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7732 -1.3259 0.2549 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1720 -1.5713 -2.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2781 -1.9320 -0.7134 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7429 -1.5982 -2.4442 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0443 1.7333 -1.9604 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2662 0.5471 -2.9722 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6932 1.6974 -1.8616 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2930 0.1067 -3.4114 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5818 0.5008 1.5062 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1686 1.3224 3.8278 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4087 -1.3872 0.3605 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6907 3.3852 -1.1301 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 1 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 6 16 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 25 29 1 0 20 30 1 0 19 31 1 0 12 32 1 0 7 33 1 6 33 34 2 0 33 35 1 0 32 4 1 0 32 7 1 0 27 10 1 0 27 15 1 0 24 16 1 0 1 36 1 0 1 37 1 0 3 38 1 0 3 39 1 0 3 40 1 0 4 41 1 1 5 42 1 0 5 43 1 0 6 44 1 0 6 45 1 0 8 46 1 0 8 47 1 0 9 48 1 0 9 49 1 0 11 50 1 0 11 51 1 0 11 52 1 0 12 53 1 6 13 54 1 0 13 55 1 0 14 56 1 0 14 57 1 0 15 58 1 1 17 59 1 0 17 60 1 0 17 61 1 0 18 62 1 0 18 63 1 0 19 64 1 6 20 65 1 1 22 66 1 0 22 67 1 0 22 68 1 0 23 69 1 0 23 70 1 0 23 71 1 0 24 72 1 1 25 73 1 6 26 74 1 0 26 75 1 0 28 76 1 0 28 77 1 0 28 78 1 0 29 79 1 0 30 80 1 0 31 81 1 0 32 82 1 1 35 83 1 0 M END

Standard InCHIKey	HWFGKGTUJQBDEU-YWZYZHMESA-N
Standard InCHI	InChI=1S/C30H48O5/c1-16(2)17-10-11-30(25(34)35)13-12-28(6)18(22(17)30)8-9-21-27(5)14-20(32)24(33)26(3,4)23(27)19(31)15-29(21,28)7/h17-24,31-33H,1,8-15H2,2-7H3,(H,34,35)/t17-,18+,19+,20+,21+,22+,23-,24-,27+,28+,29+,30-/m0/s1
SMILES	C=C(C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)C[C@H]([C@@H](C(C)(C)[C@@H]5[C@@H](C[C@@]34C)O)O)O)[C@@H]12)C(=O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	488.35	Volume:	523.332 ? Van der Waals volume.
Dense:	0.933	LogP:	2.688 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.722 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.171 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	27.0
TPSA:	97.99 ? Topological Polar Surface Area.	H-Bond Acceptor:	5.0
H-Bond Donor:	4.0	Rings:	5.0
Heavy Atoms:	5.0

MedChem Properties

QED Drug-Likeness Score:	0.409	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.097	Fsp³:	0.9
MCE-18:	109.474 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.884	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.325	Promiscuous compounds:	0.141

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.451	MDCK Permeability:	-5.107
Pgp-inhibitor:	0.0	Pgp-substrate:	0.19
PAMPA:	0.98 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.185	30% Bioavailability (F30%):	0.479
50% Bioavailability (F50%):	0.942

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.728	MRP1:	0.989
Plasma Protein Binding (PPB):	93.52%	Volume Distribution (VD):	-0.242
Fu:	5.645% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.993	BCRP inhibitor:	0.028
BSEP inhibitor:	0.037

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.007	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.004
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

5.787

Half-life (T1/2):

1.414

ADMET: Toxicity

hERG Blockers:	0.035	hERG Blockers (10um):	0.059
Human Hepatotoxicity (H-HT):	0.632	Drug-induced Liver Injury (DILI):	0.502
AMES Toxicity:	0.253	Rat Oral Acute Toxicity:	0.124
Maximum Recommended Daily Dose:	0.244	Skin Sensitization:	0.956
Carcinogencity:	0.759	Eye Corrosion:	0.021
Eye Irritation:	0.624	Respiratory Toxicity:	0.701
Drug-induced Neurotoxicity:	0.011	Ototoxicity:	0.813
Hematotoxicity:	0.488	Drug-induced Nephrotoxicity:	0.761
Genotoxicity:	0.311	RPMI-8226 Immunitoxicity:	0.022
A549 Cytotoxicity:	0.061	Hek293 Cytotoxicity:	0.074
BCF:	0.635 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.253 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.815 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.083 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO30384	Combretum quadrangulare	Species	Combretaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10650080]
NPO30384	Combretum quadrangulare	Species	Combretaceae	Eukaryota	seeds	n.a.	n.a.	PMID[10785422]
NPO30384	Combretum quadrangulare	Species	Combretaceae	Eukaryota	Seeds	n.a.	n.a.	PMID[11277757]
NPO30384	Combretum quadrangulare	Species	Combretaceae	Eukaryota	n.a.	leaf	n.a.	PMID[21265555]
NPO30384	Combretum quadrangulare	Species	Combretaceae	Eukaryota	leaves	Khon Kaen, Thailand	2006-AUG	PMID[21265555]
NPO30384	Combretum quadrangulare	Species	Combretaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9934464]
NPO30384	Combretum quadrangulare	Species	Combretaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	3
Inhibition	3
IC50	2

Activity Type	# Activity
Cell line	8

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT993	Cell line	Hepatocyte	Mus musculus	Activity	=	47.6	%	PMID[23013292]
NPT993	Cell line	Hepatocyte	Mus musculus	Activity	=	28.4	%	PMID[23013292]
NPT993	Cell line	Hepatocyte	Mus musculus	Activity	=	22.2	%	PMID[23013292]
NPT993	Cell line	Hepatocyte	Mus musculus	Inhibition	=	127.5	%	PMID[23013292]
NPT993	Cell line	Hepatocyte	Mus musculus	Inhibition	=	35.8	%	PMID[23013292]
NPT993	Cell line	Hepatocyte	Mus musculus	Inhibition	=	5.9	%	PMID[23013292]
NPT993	Cell line	Hepatocyte	Mus musculus	IC50	=	60900.0	nM	PMID[19877653]
NPT993	Cell line	Hepatocyte	Mus musculus	IC50	=	60900.0	nM	PMID[29353722]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC291373 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24572
0.1-0.2	22119
0.2-0.3	2782
0.3-0.4	267
0.4-0.5	73
0.5-0.6	30
0.6-0.7	6
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8448	Intermediate Similarity	NPC277399
0.7966	Intermediate Similarity	NPC488506
0.7966	Intermediate Similarity	NPC220498
0.7031	Intermediate Similarity	NPC474719
0.7031	Intermediate Similarity	NPC488213
0.6667	Remote Similarity	NPC264317
0.6667	Remote Similarity	NPC294438
0.6308	Remote Similarity	NPC488164
0.6308	Remote Similarity	NPC213832
0.6308	Remote Similarity	NPC264005
0.6061	Remote Similarity	NPC24772
0.5909	Remote Similarity	NPC80590
0.5882	Remote Similarity	NPC2783
0.5882	Remote Similarity	NPC151191
0.5882	Remote Similarity	NPC16377
0.5821	Remote Similarity	NPC211162
0.5821	Remote Similarity	NPC183374
0.5781	Remote Similarity	NPC246445
0.5781	Remote Similarity	NPC68828
0.5735	Remote Similarity	NPC201655
0.5714	Remote Similarity	NPC486704
0.5571	Remote Similarity	NPC269360
0.5522	Remote Similarity	NPC192744
0.5507	Remote Similarity	NPC195395
0.5493	Remote Similarity	NPC488165
0.5429	Remote Similarity	NPC57954
0.5417	Remote Similarity	NPC169933
0.5417	Remote Similarity	NPC601176
0.5417	Remote Similarity	NPC607677
0.5316	Remote Similarity	NPC486709
0.5286	Remote Similarity	NPC271974
0.5286	Remote Similarity	NPC247312
0.5278	Remote Similarity	NPC611139
0.5211	Remote Similarity	NPC4309
0.5205	Remote Similarity	NPC600004
0.5139	Remote Similarity	NPC475061
0.5139	Remote Similarity	NPC601275
0.5072	Remote Similarity	NPC119743
0.507	Remote Similarity	NPC193907
0.507	Remote Similarity	NPC43686
0.5068	Remote Similarity	NPC160506

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC291373 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5971
0.1-0.2	3119
0.2-0.3	52
0.3-0.4	5
0.4-0.5	1
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6667	Remote Similarity	NPD7520	Phase 1
0.5068	Remote Similarity	NPD8035	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data