NPASS Compound

Natural Product: NPC5785

Natural Product ID	NPC5785
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FNBWVROKJBBUAG-MDVCOEFCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 145153 0 0 0 0 0 0 0 0999 V2000 0.1036 -1.6783 -1.1728 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3063 -1.1136 0.2277 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.2409 0.2769 0.2455 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1672 0.8775 1.5748 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6658 1.1021 1.4352 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3511 -0.0791 0.8332 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6094 -1.1429 0.5250 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9821 0.3389 -0.3399 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3557 0.1827 -0.2755 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8301 -0.8762 -1.2750 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2784 -1.1260 -0.9227 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1382 0.1000 -0.9379 C 0 0 1 0 0 0 0 0 0 0 0 0 7.6762 0.2456 -2.3452 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4841 1.3700 -0.5244 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8130 1.8082 0.8900 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2653 2.0921 1.1030 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0736 1.1486 0.2442 C 0 0 2 0 0 0 0 0 0 0 0 0 8.2873 -0.1203 0.0594 C 0 0 2 0 0 0 0 0 0 0 0 0 9.1121 -1.3107 -0.2027 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5129 -1.0862 -0.6776 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2403 0.0673 -0.0993 C 0 0 2 0 0 0 0 0 0 0 0 0 11.7977 0.9920 -1.1576 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3741 -0.3005 0.8370 C 0 0 2 0 0 0 0 0 0 0 0 0 13.3810 -1.1792 0.2725 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5218 -1.6330 -0.9548 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7128 -2.5061 -1.0404 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2712 -2.5292 0.2343 O 0 0 0 0 0 0 0 0 0 0 0 0 14.4809 -1.7352 1.0478 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7427 -1.5689 2.2696 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5830 -0.8872 1.9925 C 0 0 2 0 0 0 0 0 0 0 0 0 10.4084 0.0989 2.0983 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4009 0.9035 0.8439 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0745 2.1310 0.9793 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3460 -0.8733 3.1619 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0095 1.4589 -0.7047 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0124 -0.0626 2.5844 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6055 0.2386 0.0477 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0357 1.0168 -1.0077 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7121 0.2042 -2.1068 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1947 0.5986 -2.1242 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6626 0.3486 -0.6906 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0129 1.3821 0.1674 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5551 0.8632 1.5099 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9385 1.9319 -0.5111 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0234 0.4204 -0.5694 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6294 -0.7904 -0.2663 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3220 -0.8938 1.0241 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6495 -0.2315 1.0084 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.3913 -0.4158 -0.2922 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7034 -1.3625 -1.2134 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2815 -1.1656 -2.6306 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3693 -1.1535 -1.3356 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7289 -0.6524 -0.1120 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6318 0.3038 -0.5406 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.5463 -0.2613 -1.5894 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.9445 -0.5046 -1.2050 C 0 0 2 0 0 0 0 0 0 0 0 0 -14.3881 0.0057 0.1131 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.5302 1.2318 0.4622 C 0 0 1 0 0 0 0 0 0 0 0 0 -14.0085 1.6344 1.8598 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.0013 0.4860 2.6552 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.2682 0.7308 0.6159 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.7353 0.2911 0.1817 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.2451 -1.8929 -1.2251 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5304 0.5262 -2.7636 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3763 -0.7844 2.0992 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8017 -0.0632 3.2003 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5166 1.1800 3.2321 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5481 -0.7337 4.2693 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3758 1.9165 -2.4578 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0661 -0.8310 -1.8709 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8473 -2.2429 -1.1803 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9445 -2.3721 -1.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3334 -1.7444 0.9109 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2592 0.8908 -0.5417 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3092 1.8162 1.8276 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0619 1.2913 2.4431 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7921 2.0301 0.8453 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1828 -0.4294 1.5183 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6313 -0.1986 0.7078 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2936 -1.8179 -1.1813 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7067 -0.5015 -2.3058 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2970 -1.5571 0.1011 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7301 -1.8624 -1.6392 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3538 -0.6112 -3.0086 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1857 1.1339 -2.7932 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7511 0.4197 -2.3969 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9140 2.1961 -1.1752 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2731 2.7806 1.0371 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4550 1.1358 1.6675 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5787 1.9320 2.1575 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5512 3.1337 0.8484 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2517 1.5690 -0.7920 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7533 -0.2948 1.0413 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1447 -2.0168 0.6837 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6186 -1.9393 -0.9955 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5731 -1.0160 -1.7980 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0868 -2.0224 -0.4227 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8731 1.1790 -1.0520 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5290 0.5827 -2.1688 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3167 2.0089 -1.1264 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7886 0.6775 1.2038 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9066 -1.4392 -1.8274 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4734 -3.5418 -1.3581 H 0 0 0 0 0 0 0 0 0 0 0 0 15.4238 -2.0125 -1.7577 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2511 -1.9085 1.8208 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4731 -0.3725 2.3824 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6844 0.8116 2.9302 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5366 2.6796 1.5919 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0952 -0.0184 3.6396 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6572 2.3382 -0.1176 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7010 1.6516 -1.7547 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3468 0.3311 3.4326 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1977 1.5819 -1.4805 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2531 0.3506 -3.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6921 -0.8650 -1.8609 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6777 -0.1111 -2.8154 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2435 -0.6504 -0.4504 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8003 2.1661 0.3597 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3899 -0.2158 1.4713 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3391 1.0998 2.2691 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6607 1.4226 1.7793 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7593 -1.5298 -0.2200 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7166 -0.5524 1.8921 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4685 -1.9970 1.2323 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5344 0.8601 1.2802 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3402 0.5880 -0.8061 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8692 -2.4343 -0.9666 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4864 -1.0396 -3.3925 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8614 -0.2128 -2.6660 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8746 -2.0463 -2.9536 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1449 1.1958 -0.9837 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0978 -1.2369 -1.9207 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.6643 -0.0818 -1.9709 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.1128 -0.7608 0.8957 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6548 2.0396 -0.2565 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3327 2.4073 2.2258 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.0614 1.9569 1.7497 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5882 0.6510 3.5369 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.2312 -0.5714 0.3455 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8849 -2.1930 -2.0972 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3926 1.0047 -2.8701 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2070 -0.3370 5.2673 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3315 -1.8276 4.2821 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6396 -0.6053 4.1596 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6606 2.3142 -2.9838 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 6 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 21 23 1 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 23 30 1 0 30 31 1 0 31 32 1 0 32 33 1 1 30 34 1 0 14 35 1 0 4 36 1 0 3 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 41 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 49 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 56 63 1 0 55 64 1 0 48 65 1 0 65 66 1 0 66 67 2 0 66 68 1 0 40 69 1 0 7 2 1 0 35 9 1 0 44 38 1 0 52 46 1 0 61 54 1 0 18 12 1 0 32 21 1 0 32 17 1 0 28 24 1 0 1 70 1 0 1 71 1 0 1 72 1 0 2 73 1 1 3 74 1 6 4 75 1 1 5 76 1 0 5 77 1 0 6 78 1 1 9 79 1 1 10 80 1 0 10 81 1 0 11 82 1 0 11 83 1 0 13 84 1 0 13 85 1 0 13 86 1 0 14 87 1 6 15 88 1 0 15 89 1 0 16 90 1 0 16 91 1 0 17 92 1 6 18 93 1 1 19 94 1 0 19 95 1 0 20 96 1 0 20 97 1 0 22 98 1 0 22 99 1 0 22100 1 0 23101 1 1 25102 1 0 26103 1 0 26104 1 0 30105 1 6 31106 1 0 31107 1 0 33108 1 0 34109 1 0 35110 1 0 35111 1 0 36112 1 0 38113 1 6 39114 1 0 39115 1 0 40116 1 6 41117 1 1 42118 1 1 43119 1 0 43120 1 0 43121 1 0 46122 1 1 47123 1 0 47124 1 0 48125 1 1 49126 1 6 50127 1 1 51128 1 0 51129 1 0 51130 1 0 54131 1 6 55132 1 6 56133 1 6 57134 1 1 58135 1 6 59136 1 0 59137 1 0 60138 1 0 62139 1 0 63140 1 0 64141 1 0 68142 1 0 68143 1 0 68144 1 0 69145 1 0 M END

Standard InCHIKey	FNBWVROKJBBUAG-MDVCOEFCSA-N
Standard InCHI	InChI=1S/C49H76O20/c1-21-42(67-36-17-31(53)43(22(2)62-36)68-37-18-33(64-24(4)51)44(23(3)63-37)69-46-41(57)40(56)39(55)34(20-50)66-46)30(52)16-35(61-21)65-26-9-12-47(5)25(15-26)7-8-29-28(47)10-13-48(6)38(27-11-14-60-45(27)58)32(54)19-49(29,48)59/h11,21-23,25-26,28-44,46,50,52-57,59H,7-10,12-20H2,1-6H3/t21-,22-,23-,25-,26+,28+,29-,30+,31+,32+,33+,34-,35+,36+,37+,38-,39-,40+,41-,42-,43-,44-,46+,47+,48-,49+/m1/s1
SMILES	C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@H](C4=CCOC4=O)[C@H](C[C@]32O)O)C1)O)O[C@H]1C[C@@H]([C@@H]([C@@H](C)O1)O[C@H]1C[C@@H]([C@@H]([C@@H](C)O1)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)OC(=O)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	984.49	Volume:	946.947 ? Van der Waals volume.
Dense:	1.04	LogP:	1.396 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.175 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.243 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	51.0
TPSA:	288.28 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	8.0	Rings:	9.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.104	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.672	Fsp³:	0.918
MCE-18:	174.128 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.769	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.365	Promiscuous compounds:	0.573

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.778	MDCK Permeability:	-5.456
Pgp-inhibitor:	0.001	Pgp-substrate:	0.974
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.015
20% Bioavailability (F20%):	0.168	30% Bioavailability (F30%):	0.865
50% Bioavailability (F50%):	0.975

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.965
Plasma Protein Binding (PPB):	46.588%	Volume Distribution (VD):	-0.584
Fu:	37.972% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.995	BCRP inhibitor:	0.001
BSEP inhibitor:	0.332

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.001
CYP3A4-inhibitor:	0.991	CYP3A4-substrate:	0.742
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.415
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.688

Half-life (T1/2):

4.21

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.104
Human Hepatotoxicity (H-HT):	0.523	Drug-induced Liver Injury (DILI):	0.999
AMES Toxicity:	0.997	Rat Oral Acute Toxicity:	0.492
Maximum Recommended Daily Dose:	0.825	Skin Sensitization:	1.0
Carcinogencity:	0.432	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.153
Drug-induced Neurotoxicity:	0.019	Ototoxicity:	0.999
Hematotoxicity:	0.934	Drug-induced Nephrotoxicity:	0.978
Genotoxicity:	0.807	RPMI-8226 Immunitoxicity:	0.579
A549 Cytotoxicity:	0.992	Hek293 Cytotoxicity:	0.795
BCF:	0.476 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.244 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.89 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.862 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO17774	Hemerocallis fulva	Species	Xanthorrhoeaceae	Eukaryota	Flowers	n.a.	n.a.	DOI[10.1016/j.lwt.2014.11.023]
NPO12474	Cordyline fruticosa	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18930	Rubus coreanus	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27168	Atropa belladona	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO13401	Phoenix canariensis	Species	Arecaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18180	Erysimum repandum	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO17774	Hemerocallis fulva	Species	Xanthorrhoeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO19015	Begonia glabra	Species	Begoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO13401	Phoenix canariensis	Species	Arecaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO17774	Hemerocallis fulva	Species	Xanthorrhoeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO19015	Begonia glabra	Species	Begoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO13401	Phoenix canariensis	Species	Arecaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO17774	Hemerocallis fulva	Species	Xanthorrhoeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO19015	Begonia glabra	Species	Begoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO17774	Hemerocallis fulva	Species	Xanthorrhoeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO18930	Rubus coreanus	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO27168	Atropa belladona	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19093	Streptomyces aburaviensis	Species	Streptomycetaceae	Bacteria	n.a.	n.a.	n.a.	Database[UNPD]
NPO19175	Iguana iguana	Species	Iguanidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19441	Strychnos splendens	Species	Loganiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO12474	Cordyline fruticosa	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO13401	Phoenix canariensis	Species	Arecaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19015	Begonia glabra	Species	Begoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18180	Erysimum repandum	Species	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO17635	Aria arguta	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO17774	Hemerocallis fulva	Species	Xanthorrhoeaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO18930	Rubus coreanus	Species	Rosaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC5785 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20722
0.1-0.2	24725
0.2-0.3	3753
0.3-0.4	528
0.4-0.5	64
0.5-0.6	47
0.6-0.7	12
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7778	Intermediate Similarity	NPC74259
0.7184	Intermediate Similarity	NPC117445
0.7184	Intermediate Similarity	NPC308262
0.6699	Remote Similarity	NPC475219
0.6698	Remote Similarity	NPC474908
0.6604	Remote Similarity	NPC120390
0.6535	Remote Similarity	NPC231518
0.6535	Remote Similarity	NPC488944
0.6429	Remote Similarity	NPC193893
0.6262	Remote Similarity	NPC475590
0.6168	Remote Similarity	NPC479360
0.6168	Remote Similarity	NPC479359
0.6154	Remote Similarity	NPC208193
0.6147	Remote Similarity	NPC475419
0.6071	Remote Similarity	NPC474423
0.5872	Remote Similarity	NPC488943
0.5872	Remote Similarity	NPC488942
0.5849	Remote Similarity	NPC486143
0.5849	Remote Similarity	NPC125077
0.5849	Remote Similarity	NPC486142
0.5849	Remote Similarity	NPC486149
0.5741	Remote Similarity	NPC329986
0.5741	Remote Similarity	NPC140092
0.5741	Remote Similarity	NPC486146
0.5728	Remote Similarity	NPC72260
0.5714	Remote Similarity	NPC236973
0.57	Remote Similarity	NPC5311
0.566	Remote Similarity	NPC479353
0.566	Remote Similarity	NPC479354
0.5586	Remote Similarity	NPC488938
0.5586	Remote Similarity	NPC488937
0.5565	Remote Similarity	NPC488945
0.5565	Remote Similarity	NPC488946
0.5536	Remote Similarity	NPC486144
0.5536	Remote Similarity	NPC486145
0.5536	Remote Similarity	NPC486147
0.5536	Remote Similarity	NPC486148
0.5526	Remote Similarity	NPC329675
0.5463	Remote Similarity	NPC488941
0.5463	Remote Similarity	NPC488940
0.5455	Remote Similarity	NPC488939
0.5391	Remote Similarity	NPC486134
0.5391	Remote Similarity	NPC486141
0.5357	Remote Similarity	NPC479357
0.5327	Remote Similarity	NPC30483
0.5327	Remote Similarity	NPC470897
0.5278	Remote Similarity	NPC292467
0.5278	Remote Similarity	NPC40749
0.5254	Remote Similarity	NPC488947
0.5243	Remote Similarity	NPC99080
0.5234	Remote Similarity	NPC173555
0.5229	Remote Similarity	NPC475556
0.5229	Remote Similarity	NPC311706
0.5135	Remote Similarity	NPC55532
0.5135	Remote Similarity	NPC486135
0.5135	Remote Similarity	NPC486137
0.513	Remote Similarity	NPC479358
0.5089	Remote Similarity	NPC232785
0.5089	Remote Similarity	NPC486139
0.5049	Remote Similarity	NPC99620
0.5049	Remote Similarity	NPC471633
0.5044	Remote Similarity	NPC146857

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC5785 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7168
0.1-0.2	1909
0.2-0.3	54
0.3-0.4	11
0.4-0.5	0
0.5-0.6	6
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6535	Remote Similarity	NPD8033	Approved
0.5728	Remote Similarity	NPD8294	Phase 4
0.5701	Remote Similarity	NPD8377	Phase 4
0.5238	Remote Similarity	NPD8380	Approved
0.5234	Remote Similarity	NPD8296	Phase 4
0.5225	Remote Similarity	NPD8378	Pre-clinical
0.5225	Remote Similarity	NPD8379	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data