NPASS Compound

Natural Product: NPC530613

Natural Product ID	NPC530613
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{R},6~{R},7~{S},8~{R},9~{S},10~{S},12~{S},13~{R},16~{S})-10-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
IUPAC Name	(2~{S},3~{R},4~{R},5~{R},6~{S})-2-[(2~{R},3~{R},4~{S},5~{R},6~{R})-4-hydroxy-2-(hydroxymethyl)-6-[(1~{R},2~{S},4~{S},5'~{R},6~{R},7~{S},8~{R},9~{S},10~{S},12~{S},13~{R},16~{S})-10-hydroxy-5',7,9,13-tetramethyl-spiro[5-oxapentacyclo[10.8.0.0^{2,9}.0^{4,8}.0^{13,18}]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-[(2~{S},3~{R},4~{R},5~{R},6~{S})-3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 12.1546 -1.6775 -3.2030 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3205 -1.2320 -2.0325 C 0 0 2 0 0 0 0 0 0 0 0 0 10.8959 -2.3741 -1.1318 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1267 -1.7233 0.0248 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8432 -1.1968 -0.5162 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9001 -0.9266 -1.8996 N 0 0 0 0 0 0 0 0 0 0 0 0 10.1160 -0.4619 -2.4531 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8636 -2.2143 -0.3383 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7094 -1.5456 -0.6317 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4864 -2.1477 0.0985 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7122 -0.8975 0.2949 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4987 -0.8687 1.0895 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4719 -1.9042 0.7821 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1653 -1.4702 1.3375 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8469 -0.2730 1.7419 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5346 -0.0099 2.2790 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0948 1.0893 1.4001 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4229 1.3626 1.5951 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1791 1.0889 0.4766 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7077 2.3201 0.0351 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7956 2.0748 -0.8222 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9411 3.2750 -1.6865 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9392 3.2357 -2.6248 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0028 1.6228 -0.0902 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8256 2.7073 0.1736 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1187 2.5912 -0.2600 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4649 3.7118 -1.0161 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7556 3.6055 -1.5299 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9484 2.4406 -2.4482 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7953 3.5430 -0.4353 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.0368 4.7719 0.1403 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4604 2.5525 0.6457 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8408 1.2545 0.3501 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0121 2.6760 0.9879 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5610 1.7018 1.8668 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5634 0.9340 1.1925 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1769 1.8631 2.1685 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2925 0.1446 0.8440 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5096 -0.7107 -0.2304 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3227 -2.0484 0.0715 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3211 -2.5554 -0.7184 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6443 -3.6510 -1.4763 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3445 -4.2060 -2.0615 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2066 -4.7655 -0.6087 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4018 -5.8939 -1.4185 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4928 -4.2758 -0.0186 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6354 -4.7635 1.2725 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6327 -2.7776 -0.1020 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5494 -2.4056 0.8753 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2613 2.3187 1.6838 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1007 2.1082 1.0899 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8060 0.8918 1.6980 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2844 1.2886 3.0552 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8705 0.4968 0.7381 C 0 0 1 0 0 0 0 0 0 0 0 0 3.9246 1.5173 0.4762 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2125 1.2761 1.2191 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0476 2.3539 0.9945 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8121 -0.0619 0.9729 C 0 0 1 0 0 0 0 0 0 0 0 0 6.2862 -0.7006 2.2399 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8209 -0.1248 -0.1189 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2567 -0.0537 0.3040 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9431 1.2379 -0.0825 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7775 -0.7836 -3.4972 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5327 -1.8789 -4.1065 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8410 -2.4876 -2.9577 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9935 -0.5849 -1.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8126 -2.8526 -0.7646 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2252 -3.0240 -1.6916 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9255 -2.5382 0.7497 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6994 -0.8812 0.4659 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0414 -0.5294 -2.3197 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0291 -0.5981 -3.5724 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3383 0.6153 -2.3360 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4359 -1.5892 -1.7117 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7794 -2.6383 1.0239 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9757 -2.8832 -0.5472 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5616 -0.4254 -0.7033 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5989 -0.8254 2.1930 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7911 -2.8526 1.3062 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3918 -2.1349 -0.3036 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3982 -2.2669 1.4044 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1797 -0.8805 2.1958 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5058 0.3256 3.3358 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9710 0.7134 0.3477 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5924 0.6619 -0.3571 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4413 1.2381 -1.4834 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9933 3.5085 -2.2545 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1222 4.1770 -1.0326 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2419 4.1519 -2.8618 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5603 0.8763 -0.6565 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3696 1.6509 -0.7573 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9459 4.5279 -2.1157 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1403 2.3483 -3.1747 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0722 1.4825 -1.8963 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9399 2.5992 -2.9643 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7542 3.1869 -0.9154 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6398 4.7961 1.0442 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0411 2.8601 1.5484 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7245 0.7293 1.1909 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8825 3.7168 1.4094 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7339 1.9336 2.8148 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2791 0.2191 1.5899 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3811 1.4828 3.0561 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0175 -0.5079 1.7099 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0368 -2.1030 1.1572 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3453 -3.4439 -2.2977 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8554 -4.8989 -1.3440 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5854 -4.8092 -2.9667 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6158 -3.3933 -2.2735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4577 -5.0595 0.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3336 -5.9087 -1.7774 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3146 -4.7221 -0.6306 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6082 -4.9366 1.4767 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1074 -2.5237 -1.0794 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2816 -2.7708 1.7536 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6781 3.2415 1.2843 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1510 2.4031 2.7850 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0732 1.9401 -0.0028 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7111 3.0122 1.3464 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9127 0.5407 3.5496 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7732 2.2898 2.9502 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3659 1.3886 3.7053 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3580 0.3110 -0.2531 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1951 1.5647 -0.6145 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5913 2.5468 0.7140 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9405 1.3162 2.3148 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4499 2.7331 1.8180 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0609 -1.4837 2.1017 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7256 0.0622 2.9172 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4828 -1.2184 2.8234 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5849 0.6187 -0.9039 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4422 -0.1958 1.3734 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6059 1.6284 -1.0492 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0392 1.0493 -0.0083 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7547 2.0439 0.6589 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 5 8 1 6 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 24 36 1 0 36 37 1 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 17 50 1 0 50 51 1 0 51 52 1 0 52 53 1 1 52 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 56 58 1 0 58 59 1 1 58 60 1 0 60 61 1 0 61 62 1 0 7 2 1 0 60 9 1 0 61 5 1 0 58 11 1 0 54 12 1 0 52 15 1 0 38 19 1 0 48 40 1 0 34 26 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 1 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 6 71 1 0 7 72 1 0 7 73 1 0 9 74 1 6 10 75 1 0 10 76 1 0 11 77 1 6 12 78 1 1 13 79 1 0 13 80 1 0 14 81 1 0 16 82 1 0 16 83 1 0 17 84 1 6 19 85 1 6 21 86 1 6 22 87 1 0 22 88 1 0 23 89 1 0 24 90 1 6 26 91 1 6 28 92 1 6 29 93 1 0 29 94 1 0 29 95 1 0 30 96 1 6 31 97 1 0 32 98 1 1 33 99 1 0 34100 1 1 35101 1 0 36102 1 1 37103 1 0 38104 1 1 40105 1 1 42106 1 6 43107 1 0 43108 1 0 43109 1 0 44110 1 1 45111 1 0 46112 1 6 47113 1 0 48114 1 6 49115 1 0 50116 1 0 50117 1 0 51118 1 0 51119 1 0 53120 1 0 53121 1 0 53122 1 0 54123 1 6 55124 1 0 55125 1 0 56126 1 1 57127 1 0 59128 1 0 59129 1 0 59130 1 0 60131 1 6 61132 1 1 62133 1 0 62134 1 0 62135 1 0 M END

Standard InCHIKey	RIVIQJIJCOXJBE-GGSANYSYSA-N
Standard InCHI	InChI=1S/C45H73NO16/c1-18-9-12-45(46-16-18)19(2)30-27(62-45)14-26-24-8-7-22-13-23(10-11-43(22,5)25(24)15-29(48)44(26,30)6)58-42-39(61-41-36(54)34(52)32(50)21(4)57-41)37(55)38(28(17-47)59-42)60-40-35(53)33(51)31(49)20(3)56-40/h7,18-21,23-42,46-55H,8-17H2,1-6H3/t18-,19+,20+,21+,23+,24-,25+,26+,27+,28-,29+,30+,31+,32+,33-,34-,35-,36-,37+,38+,39-,40+,41+,42-,43+,44-,45-/m1/s1
SMILES	C[C@@H]1CC[C@@]2(NC1)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@H](O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]6O[C@@H](C)[C@H](O)[C@@H](O)[C@H]6O)CC[C@]5(C)[C@H]4C[C@H](O)[C@]3(C)[C@H]1[C@@H]2C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	883.49	Volume:	858.872 ? Van der Waals volume.
Dense:	1.029	LogP:	1.314 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.967 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.207 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	258.71 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.148	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.893	Fsp³:	0.956
MCE-18:	232.909 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.738	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.012	Promiscuous compounds:	0.048

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.146	MDCK Permeability:	-5.067
Pgp-inhibitor:	0.0	Pgp-substrate:	0.998
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.003
20% Bioavailability (F20%):	0.503	30% Bioavailability (F30%):	0.75
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.609
Plasma Protein Binding (PPB):	52.002%	Volume Distribution (VD):	-0.442
Fu:	37.648% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.999
OATP1B3 inhibitor:	0.995	BCRP inhibitor:	0.009
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.711	CYP3A4-substrate:	0.971
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.595
HLM stability:	0.206 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.309

Half-life (T1/2):

2.781

ADMET: Toxicity

hERG Blockers:	0.035	hERG Blockers (10um):	0.195
Human Hepatotoxicity (H-HT):	0.278	Drug-induced Liver Injury (DILI):	0.741
AMES Toxicity:	0.955	Rat Oral Acute Toxicity:	0.03
Maximum Recommended Daily Dose:	0.023	Skin Sensitization:	1.0
Carcinogencity:	0.04	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.997
Hematotoxicity:	0.217	Drug-induced Nephrotoxicity:	0.718
Genotoxicity:	0.012	RPMI-8226 Immunitoxicity:	0.466
A549 Cytotoxicity:	0.963	Hek293 Cytotoxicity:	0.863
BCF:	1.471 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.362 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.527 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.831 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO22063	Solanum lycocarpum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[17249729]
NPO22063	Solanum lycocarpum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO22063	Solanum lycocarpum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC530613 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24278
0.1-0.2	22811
0.2-0.3	2393
0.3-0.4	290
0.4-0.5	44
0.5-0.6	34
0.6-0.7	4
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8454	Intermediate Similarity	NPC122819
0.7593	Intermediate Similarity	NPC287885
0.7129	Intermediate Similarity	NPC15249
0.7129	Intermediate Similarity	NPC25455
0.6916	Remote Similarity	NPC150057
0.6916	Remote Similarity	NPC147753
0.6139	Remote Similarity	NPC165439
0.6019	Remote Similarity	NPC94272
0.5965	Remote Similarity	NPC73243
0.5965	Remote Similarity	NPC244086
0.5965	Remote Similarity	NPC84956
0.5929	Remote Similarity	NPC42171
0.5893	Remote Similarity	NPC470433
0.5893	Remote Similarity	NPC46190
0.5893	Remote Similarity	NPC171073
0.5862	Remote Similarity	NPC247037
0.5841	Remote Similarity	NPC248746
0.5739	Remote Similarity	NPC480555
0.5739	Remote Similarity	NPC150372
0.5714	Remote Similarity	NPC249265
0.5667	Remote Similarity	NPC23808
0.5667	Remote Similarity	NPC87998
0.5603	Remote Similarity	NPC475182
0.5593	Remote Similarity	NPC269297
0.5593	Remote Similarity	NPC222202
0.5546	Remote Similarity	NPC475333
0.5546	Remote Similarity	NPC224098
0.5546	Remote Similarity	NPC208383
0.55	Remote Similarity	NPC194207
0.55	Remote Similarity	NPC22779
0.5462	Remote Similarity	NPC486386
0.5455	Remote Similarity	NPC480554
0.5385	Remote Similarity	NPC124677
0.5372	Remote Similarity	NPC254255
0.5366	Remote Similarity	NPC480553
0.5345	Remote Similarity	NPC265275
0.528	Remote Similarity	NPC232054
0.52	Remote Similarity	NPC308140
0.5156	Remote Similarity	NPC480556
0.5116	Remote Similarity	NPC224314
0.5041	Remote Similarity	NPC102016
0.5041	Remote Similarity	NPC95051

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC530613 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7614
0.1-0.2	1487
0.2-0.3	45
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8454	Intermediate Similarity	NPD8449	Approved
0.6916	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data