NPASS Compound

Natural Product: NPC479048

Natural Product ID	NPC479048
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	FCGQQGKCBHGUPU-UOJCLGOKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 90 94 0 0 0 0 0 0 0 0999 V2000 4.6531 2.3268 -3.2374 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4829 1.2651 -2.5852 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8889 0.9536 -1.2298 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7503 -0.1190 -0.5988 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5159 0.4045 -1.4001 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0389 0.2678 -2.5647 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7178 0.0291 -0.3525 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4219 -0.4913 -0.4867 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2377 -1.8255 0.1489 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0537 -2.4198 -0.4328 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3905 -3.5891 0.4317 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1295 -1.4175 -0.6614 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5312 -1.8685 -0.4470 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2109 -0.9381 -1.4885 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1673 0.4747 -1.0310 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7501 0.9161 -0.7617 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9788 -0.1053 0.0602 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6029 -0.0269 1.4253 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1381 -0.9273 2.3631 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6435 -0.9344 3.6304 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5475 -0.1297 4.0017 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1467 -1.9016 4.6433 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4133 0.4219 0.1743 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8199 0.4987 1.5510 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3076 1.6674 2.1150 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3845 2.6669 1.3838 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6923 1.6417 3.5137 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1895 2.7138 4.2211 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4187 2.2309 5.5154 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0823 0.9594 5.5778 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6475 0.5900 4.3965 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6738 2.1893 -0.1928 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1207 3.3189 -0.7199 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6132 3.2136 -1.8710 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0793 4.6154 -0.0508 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5666 4.9535 1.1945 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2697 6.3132 1.3496 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6612 6.7580 0.3005 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5309 5.7733 -0.5544 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2506 -1.2187 -2.6357 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5851 -2.5749 -3.2174 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4491 -0.2323 -3.7873 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0430 -1.1001 -2.0417 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8182 -3.1932 -0.8250 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5544 -4.0558 -0.0451 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0141 -3.7054 1.0551 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7866 -5.4282 -0.5581 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4217 -2.9972 -1.6464 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0506 2.8407 -2.4767 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3094 3.0916 -3.7289 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9990 1.8409 -3.9945 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5194 1.6479 -2.4937 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5103 0.3639 -3.2134 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8774 1.8172 -0.5601 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2906 -1.1209 -0.8262 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8071 -0.0194 0.5005 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7525 -0.1029 -1.0268 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1733 -0.5416 -1.5561 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1163 -2.4508 -0.1128 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2119 -1.8028 1.2528 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7143 -4.4740 -0.1917 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0762 -3.4240 1.2491 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5537 -3.9860 0.9186 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9652 -1.7156 0.5351 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2319 -1.2745 -1.6914 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8472 0.5786 -0.1677 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5710 1.1292 -1.8142 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2322 0.9625 -1.7319 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2744 0.9923 1.8106 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7065 0.0744 1.4273 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3041 -2.5044 4.2478 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8242 -1.4225 5.5754 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9809 -2.5942 4.8769 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5846 1.4251 -0.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3785 3.7254 3.8928 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8109 2.7845 6.3632 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3024 -0.4324 4.1811 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0581 4.2848 1.8605 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5105 6.9143 2.2180 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0512 5.8949 -1.5151 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9237 -3.3870 -2.9595 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6617 -2.7747 -2.9666 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5947 -2.5609 -4.3516 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3693 0.3752 -3.6744 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5391 0.3598 -4.0091 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6265 -0.7730 -4.7683 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4585 -5.3832 -1.4516 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1973 -6.0949 0.2259 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8520 -5.9106 -0.9105 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5453 -2.3171 -2.3378 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 18 19 1 0 19 20 1 0 20 21 2 0 20 22 1 0 17 23 1 0 23 24 1 0 24 25 1 0 25 26 2 0 25 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 1 0 16 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 36 37 2 0 37 38 1 0 38 39 1 0 14 40 1 0 40 41 1 0 40 42 1 0 40 43 1 0 13 44 1 0 44 45 1 0 45 46 2 0 45 47 1 0 10 48 1 6 23 8 1 0 31 27 2 0 39 35 2 0 17 12 1 0 12 43 1 6 1 49 1 0 1 50 1 0 1 51 1 0 2 52 1 0 2 53 1 0 3 54 1 0 4 55 1 0 4 56 1 0 4 57 1 0 8 58 1 6 9 59 1 0 9 60 1 0 11 61 1 0 11 62 1 0 11 63 1 0 13 64 1 1 14 65 1 6 15 66 1 0 15 67 1 0 16 68 1 6 18 69 1 0 18 70 1 0 22 71 1 0 22 72 1 0 22 73 1 0 23 74 1 6 28 75 1 0 29 76 1 0 31 77 1 0 36 78 1 0 37 79 1 0 39 80 1 0 41 81 1 0 41 82 1 0 41 83 1 0 42 84 1 0 42 85 1 0 42 86 1 0 47 87 1 0 47 88 1 0 47 89 1 0 48 90 1 0 M END

Standard InCHIKey	FCGQQGKCBHGUPU-UOJCLGOKSA-N
Standard InCHI	InChI=1S/C34H42O14/c1-8-18(2)28(37)45-24-14-32(7,40)34-26(44-20(4)36)23(31(5,6)48-34)13-25(46-29(38)21-9-11-41-15-21)33(34,17-43-19(3)35)27(24)47-30(39)22-10-12-42-16-22/h9-12,15-16,18,23-27,40H,8,13-14,17H2,1-7H3/t18?,23-,24+,25-,26-,27+,32+,33-,34+/m1/s1
SMILES	CCC(C)C(=O)O[C@H]1C[C@@](C)([C@@]23[C@@H]([C@@H](C[C@H]([C@]2(COC(=O)C)[C@H]1OC(=O)c1ccoc1)OC(=O)c1ccoc1)C(C)(C)O3)OC(=O)C)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	674.26	Volume:	653.173 ? Van der Waals volume.
Dense:	1.032	LogP:	2.861 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.927 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.57 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	29.0
TPSA:	187.24 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.283	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.411	Fsp³:	0.618
MCE-18:	176.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.451	Fluc inhibitor:	0.002 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.061 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.084	Promiscuous compounds:	0.229

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.474	MDCK Permeability:	-4.925
Pgp-inhibitor:	0.842	Pgp-substrate:	0.394
PAMPA:	0.758 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.002
20% Bioavailability (F20%):	0.521	30% Bioavailability (F30%):	0.977
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.011	MRP1:	1.0
Plasma Protein Binding (PPB):	45.773%	Volume Distribution (VD):	-0.341
Fu:	54.361% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.998	BCRP inhibitor:	0.289
BSEP inhibitor:	0.998

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.013
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.026
CYP3A4-inhibitor:	0.731	CYP3A4-substrate:	0.221
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.995 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.392

Half-life (T1/2):

1.295

ADMET: Toxicity

hERG Blockers:	0.074	hERG Blockers (10um):	0.285
Human Hepatotoxicity (H-HT):	0.078	Drug-induced Liver Injury (DILI):	0.974
AMES Toxicity:	0.464	Rat Oral Acute Toxicity:	0.589
Maximum Recommended Daily Dose:	0.765	Skin Sensitization:	0.848
Carcinogencity:	0.946	Eye Corrosion:	0.0
Eye Irritation:	0.409	Respiratory Toxicity:	0.19
Drug-induced Neurotoxicity:	0.112	Ototoxicity:	0.27
Hematotoxicity:	0.024	Drug-induced Nephrotoxicity:	0.199
Genotoxicity:	0.403	RPMI-8226 Immunitoxicity:	0.073
A549 Cytotoxicity:	0.113	Hek293 Cytotoxicity:	0.411
BCF:	0.708 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.743 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.525 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.108 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3549	Euonymus maackii	Species	Celastraceae	Eukaryota	Seeds	n.a.	n.a.	PMID[31713425]
NPO3549	Euonymus maackii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3549	Euonymus maackii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO3549	Euonymus maackii	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT519	Cell line	SH-SY5Y	Homo sapiens	Activity	=	71.0	%	PMID[31713425]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC479048 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15187
0.1-0.2	32735
0.2-0.3	1598
0.3-0.4	243
0.4-0.5	55
0.5-0.6	19
0.6-0.7	14
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9155	High Similarity	NPC479049
0.9041	High Similarity	NPC479041
0.8378	Intermediate Similarity	NPC6815
0.8228	Intermediate Similarity	NPC479045
0.7561	Intermediate Similarity	NPC294512
0.7349	Intermediate Similarity	NPC176413
0.6962	Remote Similarity	NPC479042
0.675	Remote Similarity	NPC294803
0.6552	Remote Similarity	NPC483885
0.6543	Remote Similarity	NPC481064
0.6543	Remote Similarity	NPC481062
0.6543	Remote Similarity	NPC481058
0.6543	Remote Similarity	NPC481060
0.65	Remote Similarity	NPC97667
0.6471	Remote Similarity	NPC10904
0.6296	Remote Similarity	NPC70716
0.6279	Remote Similarity	NPC180668
0.6145	Remote Similarity	NPC609309
0.6098	Remote Similarity	NPC95265
0.6092	Remote Similarity	NPC148896
0.5977	Remote Similarity	NPC56953
0.5833	Remote Similarity	NPC147340
0.5761	Remote Similarity	NPC483868
0.5698	Remote Similarity	NPC271460
0.5638	Remote Similarity	NPC471013
0.5542	Remote Similarity	NPC171207
0.5294	Remote Similarity	NPC481061
0.5275	Remote Similarity	NPC610134
0.5172	Remote Similarity	NPC481063
0.5152	Remote Similarity	NPC6981
0.5116	Remote Similarity	NPC481057
0.5116	Remote Similarity	NPC305403
0.5057	Remote Similarity	NPC481059
0.5056	Remote Similarity	NPC481489
0.5055	Remote Similarity	NPC488899
0.5054	Remote Similarity	NPC75600
0.5054	Remote Similarity	NPC483884
0.5054	Remote Similarity	NPC127026
0.5054	Remote Similarity	NPC483890

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC479048 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3720
0.1-0.2	5362
0.2-0.3	68
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data