NPASS Compound

Natural Product: NPC481064

Natural Product ID	NPC481064
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	YHONAKPCYCXZSN-BEOPYLOGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 81 85 0 0 0 0 0 0 0 0999 V2000 -4.4509 -1.5461 3.2173 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2006 -0.7597 3.0799 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8792 0.0457 3.9733 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4062 -0.9180 1.9799 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 -0.2310 1.7468 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5369 -0.6177 0.4261 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2367 -2.0879 0.4103 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9443 -2.8509 -0.6738 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4027 -2.4494 -0.7798 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5287 -0.9905 -1.1091 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8205 -0.4913 -0.5466 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2995 -0.1969 -0.7908 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5334 1.2796 -0.7301 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1297 1.7597 -1.1632 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7085 1.5193 0.0458 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8258 0.0854 0.4605 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8226 -0.6657 -0.1328 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9490 -1.1307 0.5329 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0394 -0.8197 1.7524 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9457 -1.9232 -0.1536 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1363 -2.4268 0.3933 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7717 -3.1256 -0.6038 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0425 -3.0638 -1.6777 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9493 -2.3596 -1.4549 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9465 2.1511 0.0773 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3297 3.1445 0.9551 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4862 3.5148 1.8045 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6606 3.6965 0.8510 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1900 4.6880 1.6493 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4758 4.9107 1.2112 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6754 4.0985 0.2221 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6446 3.3542 -0.0421 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1103 0.7986 -2.2822 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5803 0.7052 -2.6682 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5745 1.3580 -3.5095 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4223 -0.3839 -1.8953 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4090 1.7866 -1.7036 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3591 2.7411 -1.5241 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5049 3.2498 -0.3895 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2248 3.1937 -2.6361 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7155 -0.9601 -2.5208 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5993 -2.5903 1.6946 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2369 -3.2086 2.5737 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4247 -3.3772 2.2788 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3611 -3.6526 3.8727 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9182 -1.4195 4.2100 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1391 -1.2703 2.3771 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2320 -2.6411 3.0474 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5009 -0.6298 2.5467 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2335 0.8396 1.9392 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8378 -2.2561 0.2849 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9292 -3.9367 -0.4594 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4010 -2.6930 -1.6202 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8223 -3.0448 -1.6159 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9807 -2.7809 0.1033 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6076 -0.3451 -1.3409 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3119 -1.2740 0.1085 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7171 0.4000 0.0812 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6937 1.7246 0.2394 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1215 2.8092 -1.4289 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1208 2.0104 0.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1072 0.1248 1.5694 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4668 -2.2769 1.4134 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7195 -3.6540 -0.5506 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1662 -2.1569 -2.1973 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6880 5.1925 2.4636 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2105 5.6112 1.5843 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5950 2.5999 -0.8362 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7723 1.1749 -3.6852 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8050 -0.3622 -2.8515 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2629 1.2297 -2.0115 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3131 0.7156 -3.9771 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1751 1.5442 -4.3562 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9451 2.4174 -3.3363 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3048 2.9694 -2.3940 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0013 2.5759 -3.5293 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1230 4.2768 -2.8396 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4554 -1.6290 -2.6668 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0146 -2.8227 4.2147 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5023 -3.6592 4.5994 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8662 -4.6179 3.8017 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 6 5 1 1 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 18 20 1 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 1 0 15 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 2 0 30 31 1 0 31 32 1 0 14 33 1 0 33 34 1 0 33 35 1 0 33 36 1 0 13 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 10 41 1 6 7 42 1 0 42 43 1 0 43 44 2 0 43 45 1 0 16 6 1 0 24 20 2 0 32 28 2 0 12 6 1 0 12 36 1 6 1 46 1 0 1 47 1 0 1 48 1 0 5 49 1 0 5 50 1 0 7 51 1 6 8 52 1 0 8 53 1 0 9 54 1 0 9 55 1 0 11 56 1 0 11 57 1 0 11 58 1 0 13 59 1 1 14 60 1 6 15 61 1 1 16 62 1 1 21 63 1 0 22 64 1 0 24 65 1 0 29 66 1 0 30 67 1 0 32 68 1 0 34 69 1 0 34 70 1 0 34 71 1 0 35 72 1 0 35 73 1 0 35 74 1 0 40 75 1 0 40 76 1 0 40 77 1 0 41 78 1 0 45 79 1 0 45 80 1 0 45 81 1 0 M END

Standard InCHIKey	YHONAKPCYCXZSN-BEOPYLOGSA-N
Standard InCHI	InChI=1S/C31H36O14/c1-16(32)40-15-30-21(41-17(2)33)7-10-29(6,37)31(30)24(42-18(3)34)22(28(4,5)45-31)23(43-26(35)19-8-11-38-13-19)25(30)44-27(36)20-9-12-39-14-20/h8-9,11-14,21-25,37H,7,10,15H2,1-6H3/t21-,22+,23-,24+,25-,29-,30-,31-/m0/s1
SMILES	CC(=O)OC[C@]12[C@H](CC[C@@](C)([C@]32[C@@H]([C@@H]([C@@H]([C@@H]1OC(=O)c1ccoc1)OC(=O)c1ccoc1)C(C)(C)O3)OC(=O)C)O)OC(=O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	632.21	Volume:	601.285 ? Van der Waals volume.
Dense:	1.051	LogP:	2.02 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.231 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.612 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	29.0
TPSA:	187.24 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	1.0	Rings:	5.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.33	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.22	Fsp³:	0.581
MCE-18:	173.51 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.162	Fluc inhibitor:	0.004 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.077 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.05	Promiscuous compounds:	0.279

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.524	MDCK Permeability:	-5.013
Pgp-inhibitor:	0.94	Pgp-substrate:	0.797
PAMPA:	0.915 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.047
20% Bioavailability (F20%):	0.926	30% Bioavailability (F30%):	0.996
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.007	MRP1:	0.999
Plasma Protein Binding (PPB):	32.861%	Volume Distribution (VD):	-0.511
Fu:	65.606% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	0.981	BCRP inhibitor:	0.078
BSEP inhibitor:	0.842

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.318
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.103
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.266
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.561
CYP3A4-inhibitor:	0.003	CYP3A4-substrate:	0.003
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	1.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.535

Half-life (T1/2):

1.146

ADMET: Toxicity

hERG Blockers:	0.051	hERG Blockers (10um):	0.177
Human Hepatotoxicity (H-HT):	0.097	Drug-induced Liver Injury (DILI):	0.978
AMES Toxicity:	0.79	Rat Oral Acute Toxicity:	0.869
Maximum Recommended Daily Dose:	0.898	Skin Sensitization:	0.946
Carcinogencity:	0.979	Eye Corrosion:	0.0
Eye Irritation:	0.346	Respiratory Toxicity:	0.181
Drug-induced Neurotoxicity:	0.1	Ototoxicity:	0.135
Hematotoxicity:	0.022	Drug-induced Nephrotoxicity:	0.445
Genotoxicity:	0.983	RPMI-8226 Immunitoxicity:	0.115
A549 Cytotoxicity:	0.074	Hek293 Cytotoxicity:	0.227
BCF:	0.594 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.348 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.805 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.441 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO6255	Celastrus paniculatus	Species	Celastraceae	Eukaryota	n.a.	root	n.a.	DOI[10.1016/0031-9422(90)80182-G]
NPO6255	Celastrus paniculatus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32031809]
NPO6255	Celastrus paniculatus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO6255	Celastrus paniculatus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO6255	Celastrus paniculatus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO6255	Celastrus paniculatus	Species	Celastraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Survival	2

Activity Type	# Activity
Organism	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT530	Organism	Caenorhabditis elegans	Caenorhabditis elegans	Survival	=	17.39	day	PMID[32031809]
NPT530	Organism	Caenorhabditis elegans	Caenorhabditis elegans	Survival	=	14.0	%	PMID[32031809]

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC481064 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	13609
0.1-0.2	34001
0.2-0.3	1903
0.3-0.4	235
0.4-0.5	72
0.5-0.6	14
0.6-0.7	11
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	4
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9403	High Similarity	NPC481062
0.9403	High Similarity	NPC481058
0.9403	High Similarity	NPC481060
0.9155	High Similarity	NPC180668
0.8841	High Similarity	NPC294803
0.863	High Similarity	NPC10904
0.8133	Intermediate Similarity	NPC148896
0.7778	Intermediate Similarity	NPC481063
0.7013	Intermediate Similarity	NPC271460
0.6824	Remote Similarity	NPC471013
0.6711	Remote Similarity	NPC481059
0.6709	Remote Similarity	NPC479049
0.6591	Remote Similarity	NPC6981
0.6543	Remote Similarity	NPC479048
0.6538	Remote Similarity	NPC147340
0.6494	Remote Similarity	NPC57628
0.6296	Remote Similarity	NPC6815
0.6265	Remote Similarity	NPC479041
0.6092	Remote Similarity	NPC479045
0.6024	Remote Similarity	NPC488900
0.5949	Remote Similarity	NPC481057
0.5949	Remote Similarity	NPC305403
0.5833	Remote Similarity	NPC488899
0.573	Remote Similarity	NPC176413
0.573	Remote Similarity	NPC294512
0.5517	Remote Similarity	NPC301368
0.5517	Remote Similarity	NPC84815
0.5488	Remote Similarity	NPC11685
0.5432	Remote Similarity	NPC171207
0.5227	Remote Similarity	NPC610927
0.5181	Remote Similarity	NPC481061
0.5119	Remote Similarity	NPC472569
0.5119	Remote Similarity	NPC16912
0.5054	Remote Similarity	NPC483885

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC481064 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3892
0.1-0.2	5200
0.2-0.3	58
0.3-0.4	0
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data