NPASS Compound

Natural Product: NPC478827

Natural Product ID	NPC478827
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZUWHXWYKPYYOMV-KKWCUDMMSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 88 95 0 0 0 0 0 0 0 0999 V2000 -3.1527 -2.4692 2.9494 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9781 -2.4348 1.7152 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1444 -3.4004 1.7576 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9487 -3.1121 0.5028 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0454 -3.0192 -0.6722 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7033 -3.6519 -0.4468 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3283 -2.4311 0.3955 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3460 -1.6623 -0.4395 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8635 -1.0596 -1.6833 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2256 0.1078 -1.6999 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4932 1.3997 -1.4713 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6586 1.7360 -1.1404 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4472 2.4415 -1.6002 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7589 3.7283 -1.2887 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7910 4.7292 -1.4302 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5405 4.3881 -1.8829 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2220 3.0847 -2.1992 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1977 2.0971 -2.0527 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2669 -1.0276 0.5044 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5929 -1.1462 1.7379 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4346 -1.8185 0.6045 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0694 -1.9852 0.1947 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0289 -2.6889 0.6951 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1292 -3.3307 -0.3267 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8287 -2.3148 -0.9106 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6226 -1.7629 0.2509 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6638 -1.2642 1.2932 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1519 0.1191 0.9973 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2123 0.9340 0.6049 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3159 1.2843 1.3312 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4087 0.8268 2.5164 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4245 2.1612 0.8488 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9197 3.5172 0.5126 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6265 2.0572 1.7532 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6327 3.1526 1.5567 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1524 3.1372 0.1496 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1345 2.6091 -0.8363 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8472 2.1463 -2.0904 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5158 3.2187 -2.6305 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3011 1.5175 -0.2256 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0484 0.8405 0.9171 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2846 -2.1634 1.7074 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4382 -2.7859 0.7268 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1503 -1.2546 -1.5011 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6758 -4.2984 0.2964 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9785 -4.0343 0.3364 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5241 -1.5573 2.9943 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8340 -2.3250 3.8640 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6046 -3.3736 3.1736 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7717 -3.1071 2.6427 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8504 -4.4434 1.8610 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4845 -3.1291 -1.6783 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8243 -4.5884 0.1052 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1035 -3.6655 -1.3541 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8147 -0.9450 -2.3467 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2847 -1.8043 -2.3201 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7444 3.9782 -0.9334 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1007 5.7132 -1.1699 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2138 5.1590 -1.9957 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7487 2.7918 -2.5571 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9287 1.0864 -2.3115 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5301 0.0121 0.3577 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5357 -3.6050 1.1765 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6350 -3.8246 -1.1436 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4868 -2.7879 -1.6719 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2914 -0.9542 -0.1225 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3246 -1.1189 2.2211 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3434 0.4702 1.9330 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6247 0.0855 0.2353 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6430 4.3361 0.6691 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0172 3.7224 1.1329 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5635 3.5416 -0.5415 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3958 1.7982 2.8139 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5018 2.8933 2.2229 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2765 4.1382 1.8981 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5007 4.1527 -0.1677 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0679 2.4914 0.0881 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5037 3.4685 -1.1355 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5354 1.3123 -1.9203 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0288 1.8774 -2.8197 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3669 4.0819 -2.1951 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7772 0.8564 -0.9133 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5934 -0.1093 1.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1417 0.7497 0.7654 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3817 -2.5554 0.7343 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1602 -1.2690 -2.4893 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1520 -4.7963 -0.4087 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5744 -4.8753 0.0750 H 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 1 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 11 13 1 0 13 14 2 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 2 0 8 19 1 0 19 20 1 0 19 21 1 0 7 22 1 1 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 6 32 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 27 42 1 0 26 43 1 0 25 44 1 0 24 45 1 0 4 46 1 6 7 2 1 0 18 13 1 0 42 23 1 0 20 2 1 0 40 32 1 0 21 4 1 0 41 34 1 0 8 5 1 0 1 47 1 0 1 48 1 0 1 49 1 0 3 50 1 0 3 51 1 0 5 52 1 0 6 53 1 0 6 54 1 0 9 55 1 0 9 56 1 0 14 57 1 0 15 58 1 0 16 59 1 0 17 60 1 0 18 61 1 0 19 62 1 6 23 63 1 1 24 64 1 6 25 65 1 6 26 66 1 6 27 67 1 1 28 68 1 0 28 69 1 0 33 70 1 0 33 71 1 0 33 72 1 0 34 73 1 1 35 74 1 0 35 75 1 0 36 76 1 0 36 77 1 0 37 78 1 6 38 79 1 0 38 80 1 0 39 81 1 0 40 82 1 6 41 83 1 0 41 84 1 0 43 85 1 0 44 86 1 0 45 87 1 0 46 88 1 0 M END

Standard InCHIKey	ZUWHXWYKPYYOMV-KKWCUDMMSA-N
Standard InCHI	InChI=1S/C33H42O13/c1-29-14-32(40)21-11-33(29,31(21,28(45-29)46-32)15-42-25(38)16-6-4-3-5-7-16)44-26-24(37)23(36)22(35)20(43-26)13-41-27(39)30(2)18-9-8-17(12-34)19(30)10-18/h3-7,17-24,26,28,34-37,40H,8-15H2,1-2H3/t17-,18+,19+,20+,21?,22+,23-,24+,26-,28+,29-,30-,31?,32+,33-/m0/s1
SMILES	C[C@]12C[C@@]3(C4C[C@]1(C4(COC(=O)c1ccccc1)[C@H](O2)O3)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](COC(=O)[C@@]2(C)[C@@H]3CC[C@@H](CO)[C@H]2C3)O1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	646.26	Volume:	611.963 ? Van der Waals volume.
Dense:	1.056	LogP:	1.639 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.053 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.052 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	35.0
TPSA:	190.67 ? Topological Polar Surface Area.	H-Bond Acceptor:	13.0
H-Bond Donor:	5.0	Rings:	10.0
Heavy Atoms:	13.0

MedChem Properties

QED Drug-Likeness Score:	0.23	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.002	Fsp³:	0.758
MCE-18:	191.862 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.803	Fluc inhibitor:	0.005 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.018 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.013 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.057	Promiscuous compounds:	0.033

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.911	MDCK Permeability:	-5.19
Pgp-inhibitor:	0.001	Pgp-substrate:	0.285
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.015
20% Bioavailability (F20%):	0.648	30% Bioavailability (F30%):	0.804
50% Bioavailability (F50%):	0.976

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.443	MRP1:	0.832
Plasma Protein Binding (PPB):	56.568%	Volume Distribution (VD):	-0.66
Fu:	59.905% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.994
OATP1B3 inhibitor:	0.989	BCRP inhibitor:	0.002
BSEP inhibitor:	0.511

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.017	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.001	CYP2D6-substrate:	0.046
CYP3A4-inhibitor:	0.005	CYP3A4-substrate:	0.05
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.983
HLM stability:	0.232 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.966

Half-life (T1/2):

2.28

ADMET: Toxicity

hERG Blockers:	0.046	hERG Blockers (10um):	0.236
Human Hepatotoxicity (H-HT):	0.612	Drug-induced Liver Injury (DILI):	0.545
AMES Toxicity:	0.582	Rat Oral Acute Toxicity:	0.092
Maximum Recommended Daily Dose:	0.252	Skin Sensitization:	0.969
Carcinogencity:	0.36	Eye Corrosion:	0.0
Eye Irritation:	0.035	Respiratory Toxicity:	0.088
Drug-induced Neurotoxicity:	0.038	Ototoxicity:	0.938
Hematotoxicity:	0.18	Drug-induced Nephrotoxicity:	0.818
Genotoxicity:	0.381	RPMI-8226 Immunitoxicity:	0.148
A549 Cytotoxicity:	0.309	Hek293 Cytotoxicity:	0.358
BCF:	0.506 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.475 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.315 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.429 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Seeds	Henan province, China		DOI[10.1016/j.foodres.2020.109416]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Seeds	Gansu province, China		DOI[10.1016/j.foodres.2020.109416]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Seeds	Anhui province, China		DOI[10.1016/j.foodres.2020.109416]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Seeds	Shanxi province, China		DOI[10.1016/j.foodres.2020.109416]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Seeds	Shandong province, China		DOI[10.1016/j.foodres.2020.109416]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	DOI[10.2174/092986712800229032]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19402674]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[19721258]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[19772486]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Roots	n.a.	n.a.	PMID[20806783]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[21782011]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[22190295]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	seed	n.a.	PMID[23497864]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[26838074]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[27313650]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	root	n.a.	PMID[27429639]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Roots	n.a.	n.a.	PMID[29741372]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Seeds	HeZe, ShanDong, China	early autumn (from August to the beginning of September	PMID[32545196]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Roots	n.a.	n.a.	PMID[32951423]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	Seeds	Xinjiang,China		PMID[33063333]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO9798	Paeonia lactiflora	Species	Paeoniaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Inhibition	5
IC50	1

Activity Type	# Activity
Cell line	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT113	Cell line	RAW264.7	Mus musculus	Inhibition	=	40.71	%	PMID[29741372]
NPT113	Cell line	RAW264.7	Mus musculus	Inhibition	=	39.47	%	PMID[29741372]
NPT113	Cell line	RAW264.7	Mus musculus	Inhibition	=	22.1	%	PMID[29741372]
NPT113	Cell line	RAW264.7	Mus musculus	Inhibition	=	20.85	%	PMID[29741372]
NPT113	Cell line	RAW264.7	Mus musculus	Inhibition	=	19.71	%	PMID[29741372]
NPT113	Cell line	RAW264.7	Mus musculus	IC50	>	100000.0	nM	PMID[29741372]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478827 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15970
0.1-0.2	30716
0.2-0.3	3092
0.3-0.4	40
0.4-0.5	9
0.5-0.6	9
0.6-0.7	15
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC478826
0.7528	Intermediate Similarity	NPC34066
0.7528	Intermediate Similarity	NPC190862
0.7347	Intermediate Similarity	NPC478828
0.734	Intermediate Similarity	NPC469398
0.6979	Remote Similarity	NPC469396
0.6979	Remote Similarity	NPC469458
0.6979	Remote Similarity	NPC149002
0.6923	Remote Similarity	NPC303429
0.6923	Remote Similarity	NPC56594
0.6837	Remote Similarity	NPC80360
0.6796	Remote Similarity	NPC478829
0.6635	Remote Similarity	NPC469421
0.6602	Remote Similarity	NPC188217
0.6562	Remote Similarity	NPC88176
0.6296	Remote Similarity	NPC469397
0.6117	Remote Similarity	NPC195114
0.6058	Remote Similarity	NPC148185
0.602	Remote Similarity	NPC293568
0.602	Remote Similarity	NPC161626
0.596	Remote Similarity	NPC120012
0.5872	Remote Similarity	NPC477617
0.5714	Remote Similarity	NPC469448
0.5392	Remote Similarity	NPC469422
0.5347	Remote Similarity	NPC469417
0.5283	Remote Similarity	NPC469420
0.5185	Remote Similarity	NPC469438
0.5098	Remote Similarity	NPC469399
0.5047	Remote Similarity	NPC469419

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478827 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	4426
0.1-0.2	4645
0.2-0.3	78
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data