NPASS Compound

Natural Product: NPC323365

Natural Product ID	NPC323365
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	CTNHZEZBBGIUJB-OPLGKKKHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	5315630
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 84 88 0 0 0 0 0 0 0 0999 V2000 -5.5198 -2.5090 0.1987 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6385 -1.5628 0.9789 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3081 -1.5112 0.2300 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7009 -0.2374 0.5974 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2550 0.0178 0.5180 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4347 -0.3158 1.4764 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0500 -0.1220 1.5491 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6046 0.8003 0.5514 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1086 0.6668 0.3825 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7641 0.7738 1.7749 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2241 0.5424 1.7371 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7874 -0.3433 0.6876 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8592 -1.0790 -0.1992 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4058 -0.7252 -0.0565 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4735 -1.2081 -1.0664 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3074 -0.4328 -1.5167 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8241 0.7504 -0.7077 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6605 0.7280 -0.6399 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3533 2.0936 -0.5669 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6833 2.1093 0.0951 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5313 0.8858 0.0483 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6432 1.0140 1.1422 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3143 -0.3116 1.2385 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5006 2.0144 0.7187 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3421 0.7003 -1.1528 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9748 1.9559 -1.4003 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6266 2.4904 1.4439 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1104 0.1830 -2.0028 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1004 2.0179 -1.5535 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3814 -1.1751 -1.6046 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9385 -2.5867 0.2057 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8547 0.2777 0.0050 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7740 1.7172 -0.3841 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3533 -2.3127 2.2973 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5963 -2.2096 0.3631 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3400 -2.3452 -0.8909 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4007 -3.5586 0.4958 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6697 -2.3432 0.5925 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4717 -1.7095 -0.8395 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8969 -0.2441 1.7474 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9399 -0.8119 2.3463 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4381 -1.1423 1.6441 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3179 0.2957 2.5835 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4821 1.8558 0.9537 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5594 1.8155 2.0972 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3111 0.1073 2.4985 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7832 1.5300 1.6978 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5159 0.2152 2.7911 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4005 -1.1206 1.2579 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1030 -1.3179 0.8937 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1882 -2.2922 -0.8273 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0919 -1.4155 -2.0079 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5155 -0.0460 -2.5692 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5052 -1.1926 -1.6833 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5149 2.4858 -1.5896 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7290 2.8587 -0.0629 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3203 2.9255 -0.3707 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1023 1.2409 2.0677 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6954 -0.3343 2.3159 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3039 -0.2187 0.6940 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4481 1.8523 0.9571 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9535 0.3581 -2.0817 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2695 0.0519 -0.9900 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8816 2.2141 -2.3509 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3338 3.0968 1.7161 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5502 -0.8020 -1.9494 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8136 0.9293 -2.5154 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3186 0.1880 -2.7798 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0387 2.9375 -0.9728 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2654 2.1459 -2.3219 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9598 1.8907 -2.2237 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4083 -0.2884 -2.2080 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4801 -1.4604 -1.4719 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9765 -2.0759 -2.1359 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1293 -3.1447 -0.2657 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9471 -2.9491 -0.0468 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8298 -2.5627 1.3119 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6078 0.6799 -0.8325 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7973 2.0188 0.0246 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2917 2.6974 -0.4537 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0367 1.3794 -1.3996 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3388 -2.5656 2.7677 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7731 -1.6742 2.9742 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8257 -3.2513 2.0233 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 21 25 1 0 25 26 1 0 20 27 1 0 18 28 1 0 17 29 1 0 13 30 1 0 13 31 1 0 12 32 1 0 9 33 1 0 2 34 1 0 23 2 1 0 21 4 1 0 18 5 1 0 17 8 1 0 14 9 1 0 1 35 1 0 1 36 1 0 1 37 1 0 3 38 1 0 3 39 1 0 4 40 1 0 6 41 1 0 7 42 1 0 7 43 1 0 8 44 1 0 10 45 1 0 10 46 1 0 11 47 1 0 11 48 1 0 12 49 1 0 14 50 1 0 15 51 1 0 15 52 1 0 16 53 1 0 16 54 1 0 19 55 1 0 19 56 1 0 20 57 1 0 22 58 1 0 23 59 1 0 23 60 1 0 24 61 1 0 25 62 1 0 25 63 1 0 26 64 1 0 27 65 1 0 28 66 1 0 28 67 1 0 28 68 1 0 29 69 1 0 29 70 1 0 29 71 1 0 30 72 1 0 30 73 1 0 30 74 1 0 31 75 1 0 31 76 1 0 31 77 1 0 32 78 1 0 33 79 1 0 33 80 1 0 33 81 1 0 34 82 1 0 34 83 1 0 34 84 1 0 M END

Standard InCHIKey	CTNHZEZBBGIUJB-OPLGKKKHSA-N
Standard InCHI	InChI=1S/C30H50O4/c1-25(2)14-19-18-8-9-21-27(5)12-11-22(32)26(3,4)20(27)10-13-28(21,6)29(18,7)16-24(34)30(19,17-31)23(33)15-25/h8,19-24,31-34H,9-17H2,1-7H3/t19?,20?,21?,22-,23?,24?,27-,28+,29?,30+/m0/s1
SMILES	CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C1)O)CO)O)C)C)(C)C)O)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	474.37	Volume:	517.178 ? Van der Waals volume.
Dense:	0.917	LogP:	3.499 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.816 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.801 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	1.0	Rigid Bonds:	26.0
TPSA:	80.92 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	4.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.399	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.972	Fsp³:	0.933
MCE-18:	107.586 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.102	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.003 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.32	Promiscuous compounds:	0.004

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.205	MDCK Permeability:	-4.806
Pgp-inhibitor:	0.004	Pgp-substrate:	0.661
PAMPA:	0.913 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.318
20% Bioavailability (F20%):	0.549	30% Bioavailability (F30%):	0.752
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.847	MRP1:	0.904
Plasma Protein Binding (PPB):	78.746%	Volume Distribution (VD):	-0.016
Fu:	23.114% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.009
OATP1B3 inhibitor:	0.433	BCRP inhibitor:	0.031
BSEP inhibitor:	0.76

ADMET: Metabolism

CYP1A2-inhibitor:	0.001	CYP1A2-substrate:	0.017
CYP2C19-inhibitor:	0.996	CYP2C19-substrate:	0.706
CYP2C9-inhibitor:	0.734	CYP2C9-substrate:	0.007
CYP2D6-inhibitor:	0.688	CYP2D6-substrate:	0.047
CYP3A4-inhibitor:	0.577	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.431	CYP2C8-inhibitor:	0.17
HLM stability:	0.986 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

13.055

Half-life (T1/2):

1.754

ADMET: Toxicity

hERG Blockers:	0.084	hERG Blockers (10um):	0.591
Human Hepatotoxicity (H-HT):	0.272	Drug-induced Liver Injury (DILI):	0.063
AMES Toxicity:	0.074	Rat Oral Acute Toxicity:	0.271
Maximum Recommended Daily Dose:	0.837	Skin Sensitization:	0.055
Carcinogencity:	0.216	Eye Corrosion:	0.0
Eye Irritation:	0.072	Respiratory Toxicity:	0.846
Drug-induced Neurotoxicity:	0.349	Ototoxicity:	0.959
Hematotoxicity:	0.034	Drug-induced Nephrotoxicity:	0.014
Genotoxicity:	0.007	RPMI-8226 Immunitoxicity:	0.037
A549 Cytotoxicity:	0.363	Hek293 Cytotoxicity:	0.513
BCF:	2.133 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.659 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.079 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.427 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21201	Camellia oleifera	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21201	Camellia oleifera	Species	Theaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO21201	Camellia oleifera	Species	Theaceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO21201	Camellia oleifera	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO21201	Camellia oleifera	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO21201	Camellia oleifera	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21201	Camellia oleifera	Species	Theaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC323365 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25144
0.1-0.2	20626
0.2-0.3	2940
0.3-0.4	911
0.4-0.5	151
0.5-0.6	57
0.6-0.7	17
0.7-0.8	0
0.8-0.85	2
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC311078
0.8	Intermediate Similarity	NPC253807
0.8	Intermediate Similarity	NPC158662
0.7857	Intermediate Similarity	NPC159168
0.7544	Intermediate Similarity	NPC238992
0.75	Intermediate Similarity	NPC101475
0.75	Intermediate Similarity	NPC34177
0.6964	Remote Similarity	NPC290598
0.6964	Remote Similarity	NPC30590
0.6769	Remote Similarity	NPC294360
0.6667	Remote Similarity	NPC230295
0.6667	Remote Similarity	NPC253402
0.6667	Remote Similarity	NPC488519
0.6667	Remote Similarity	NPC98386
0.65	Remote Similarity	NPC235341
0.6471	Remote Similarity	NPC283343
0.6333	Remote Similarity	NPC196753
0.623	Remote Similarity	NPC480924
0.619	Remote Similarity	NPC246708
0.6167	Remote Similarity	NPC474989
0.6119	Remote Similarity	NPC480919
0.6066	Remote Similarity	NPC132478
0.6066	Remote Similarity	NPC237344
0.6032	Remote Similarity	NPC480950
0.597	Remote Similarity	NPC164349
0.5915	Remote Similarity	NPC473160
0.5833	Remote Similarity	NPC27765
0.5833	Remote Similarity	NPC122418
0.5833	Remote Similarity	NPC491014
0.5714	Remote Similarity	NPC40394
0.5694	Remote Similarity	NPC258547
0.5625	Remote Similarity	NPC53744
0.5625	Remote Similarity	NPC470588
0.5574	Remote Similarity	NPC120098
0.5556	Remote Similarity	NPC471433
0.5556	Remote Similarity	NPC471432
0.5522	Remote Similarity	NPC480946
0.5522	Remote Similarity	NPC213412
0.5522	Remote Similarity	NPC130577
0.5522	Remote Similarity	NPC142415
0.5522	Remote Similarity	NPC102683
0.5507	Remote Similarity	NPC228784
0.5507	Remote Similarity	NPC324341
0.5507	Remote Similarity	NPC601810
0.5441	Remote Similarity	NPC7260
0.5441	Remote Similarity	NPC182797
0.5441	Remote Similarity	NPC210037
0.5441	Remote Similarity	NPC120968
0.5441	Remote Similarity	NPC171203
0.5441	Remote Similarity	NPC307426
0.5441	Remote Similarity	NPC98442
0.5441	Remote Similarity	NPC242468
0.5441	Remote Similarity	NPC227467
0.5441	Remote Similarity	NPC273621
0.5441	Remote Similarity	NPC52169
0.5441	Remote Similarity	NPC488562
0.5417	Remote Similarity	NPC175006
0.5312	Remote Similarity	NPC1319
0.5294	Remote Similarity	NPC187722
0.5294	Remote Similarity	NPC198664
0.5294	Remote Similarity	NPC99254
0.5294	Remote Similarity	NPC2539
0.5286	Remote Similarity	NPC202728
0.5286	Remote Similarity	NPC158059
0.5286	Remote Similarity	NPC49776
0.5286	Remote Similarity	NPC63118
0.5286	Remote Similarity	NPC474436
0.5231	Remote Similarity	NPC291379
0.5231	Remote Similarity	NPC478657
0.5217	Remote Similarity	NPC51700
0.5217	Remote Similarity	NPC88716
0.5217	Remote Similarity	NPC68160
0.5217	Remote Similarity	NPC112866
0.5195	Remote Similarity	NPC167383
0.5152	Remote Similarity	NPC95594
0.5147	Remote Similarity	NPC477872
0.5135	Remote Similarity	NPC273668
0.5135	Remote Similarity	NPC86368
0.5072	Remote Similarity	NPC274330
0.5072	Remote Similarity	NPC610937
0.507	Remote Similarity	NPC293564

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC323365 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7895
0.1-0.2	1205
0.2-0.3	45
0.3-0.4	4
0.4-0.5	0
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5672	Remote Similarity	NPD7645	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data