NPASS Compound

Natural Product: NPC249046

Natural Product ID	NPC249046
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	TVWNWTCNFUZDDJ-HBIKTYAUSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	6325576
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 129135 0 0 0 0 0 0 0 0999 V2000 2.3801 2.7566 2.9411 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2411 3.4410 2.1596 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8378 4.5839 1.4452 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3401 3.9907 3.2535 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4833 2.8604 3.7637 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5148 2.5164 2.7422 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9831 2.6643 1.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3275 4.1020 0.9156 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7286 1.7794 0.3630 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1495 1.5051 0.7051 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5553 0.0602 0.6311 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1022 -0.6504 -0.6128 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1024 -0.6596 -1.7133 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3892 -0.1633 -2.9468 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3156 0.7349 -2.3272 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8352 -0.0735 -1.2101 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0551 -1.2591 -1.7611 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9587 0.6030 -0.1661 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5943 -0.4603 0.7779 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2188 1.2611 -0.8496 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1492 1.9444 0.1391 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5073 2.3951 1.3838 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1162 0.9291 0.3510 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3007 1.2024 -0.2371 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5401 0.8660 0.4704 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5830 1.8308 -0.0444 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6730 1.4928 -1.5391 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3780 1.2521 -2.2014 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6460 0.4696 -3.4947 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5950 1.1748 -4.2279 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4295 0.5191 -1.5001 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2853 2.5901 -2.1854 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8133 1.7409 0.5188 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4970 0.6703 1.8200 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8375 -0.5831 2.2467 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8975 -0.7052 3.2713 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0876 -2.1444 3.6687 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8501 -2.9610 3.7610 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8673 -2.6238 2.6706 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5299 -3.2845 2.9785 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5884 -2.8905 2.0331 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6820 -1.2453 2.7098 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2469 -4.3169 3.6727 O 0 0 0 0 0 0 0 0 0 0 0 0 6.6846 -2.1419 4.9522 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1486 -0.2877 2.7695 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8142 -1.9640 -1.9525 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5798 -2.4096 -0.6960 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9452 -3.1095 -2.3337 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9022 -3.9624 -3.1443 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7522 -2.8858 -3.7788 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0701 -3.3895 -4.2550 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7855 -2.3330 -5.0926 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.0277 -3.7715 -3.1632 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8207 -4.4651 -5.1187 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7793 -1.8250 -2.9258 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9700 0.0995 0.7165 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1598 4.3919 4.3483 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4366 3.0549 3.9841 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3634 3.0432 2.4878 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2290 1.6577 2.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9384 4.7176 1.6987 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4323 5.5834 1.7990 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8580 4.5499 0.3448 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1945 4.9034 2.9903 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2083 2.0301 4.0161 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0178 3.1158 4.7147 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8780 1.5144 2.9606 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3779 3.2054 2.8980 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4872 4.7278 0.6705 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9306 4.1081 -0.0572 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0793 4.5631 1.6131 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8187 2.4125 -0.5917 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8972 2.0571 0.0529 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4451 1.8601 1.7300 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2669 -0.4991 1.5710 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9009 -1.7148 -0.2905 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8605 0.1403 -1.4493 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9505 -0.9443 -3.5740 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1236 0.4688 -3.5274 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5458 0.8404 -3.1257 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8529 1.6659 -2.1255 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0196 -1.2393 -1.4878 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1035 -1.3683 -2.8415 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4177 -2.2346 -1.3179 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8912 -0.3469 1.8319 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4972 -0.6517 0.7367 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0224 -1.4877 0.5354 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2316 2.0678 -1.5024 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7610 0.6145 -1.5565 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6723 2.7111 -0.4672 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5530 1.5035 2.0688 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2789 2.2534 -0.5874 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9101 -0.1449 0.0480 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1249 2.8570 0.0759 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3961 0.6308 -1.6076 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9583 2.2375 -2.5374 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7291 0.2494 -4.0485 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1259 -0.5162 -3.2327 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1779 1.6646 -4.9934 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1080 2.3192 -2.6471 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9752 2.5568 1.0794 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1466 -1.1824 1.3384 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7429 -0.1202 4.1825 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7961 -2.6456 2.9751 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3632 -2.8912 4.7781 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2221 -2.9894 1.7090 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6349 -4.4019 2.9777 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1586 -3.0131 3.9889 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0311 -2.7866 1.1607 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8362 -4.4808 2.8979 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0931 -2.5276 5.6316 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7744 -0.4126 3.5523 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9021 -2.5497 0.1693 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9823 -3.4561 -0.8697 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4757 -1.8088 -0.5070 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1245 -2.8587 -3.0583 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5431 -3.6692 -1.4600 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4998 -4.6069 -2.4680 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3596 -4.5626 -3.9098 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1814 -2.5564 -4.6977 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2991 -2.1881 -6.0779 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8514 -2.5771 -5.1375 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6998 -1.3343 -4.5702 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8140 -4.8428 -2.8942 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0874 -3.7785 -3.5294 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9262 -3.1911 -2.2393 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3787 -5.2277 -4.8414 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2054 0.7487 1.4251 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5018 5.3114 4.1872 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 16 18 1 0 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 27 32 1 0 26 33 1 0 25 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 38 43 1 0 37 44 1 0 36 45 1 0 13 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 51 53 1 0 51 54 1 0 50 55 1 0 11 56 1 0 4 57 1 0 22 2 1 0 31 24 1 0 42 35 1 0 55 46 1 0 22 7 1 0 18 9 1 0 16 12 1 0 1 58 1 0 1 59 1 0 1 60 1 0 3 61 1 0 3 62 1 0 3 63 1 0 4 64 1 0 5 65 1 0 5 66 1 0 6 67 1 0 6 68 1 0 8 69 1 0 8 70 1 0 8 71 1 0 9 72 1 0 10 73 1 0 10 74 1 0 11 75 1 0 12 76 1 0 13 77 1 0 14 78 1 0 14 79 1 0 15 80 1 0 15 81 1 0 17 82 1 0 17 83 1 0 17 84 1 0 19 85 1 0 19 86 1 0 19 87 1 0 20 88 1 0 20 89 1 0 21 90 1 0 22 91 1 0 24 92 1 6 25 93 1 6 26 94 1 6 27 95 1 1 28 96 1 6 29 97 1 0 29 98 1 0 30 99 1 0 32100 1 0 33101 1 0 35102 1 6 36103 1 1 37104 1 6 38105 1 1 39106 1 6 40107 1 0 40108 1 0 41109 1 0 43110 1 0 44111 1 0 45112 1 0 47113 1 0 47114 1 0 47115 1 0 48116 1 0 48117 1 0 49118 1 0 49119 1 0 50120 1 0 52121 1 0 52122 1 0 52123 1 0 53124 1 0 53125 1 0 53126 1 0 54127 1 0 56128 1 0 57129 1 0 M END

Standard InCHIKey	TVWNWTCNFUZDDJ-HBIKTYAUSA-N
Standard InCHI	InChI=1S/C42H72O15/c1-37(2)25(46)10-12-39(5)24-15-20(45)27-19(42(8)14-11-26(57-42)38(3,4)52)9-13-40(27,6)41(24,7)16-21(34(37)39)53-36-33(31(50)29(48)23(18-44)55-36)56-35-32(51)30(49)28(47)22(17-43)54-35/h19-36,43-52H,9-18H2,1-8H3/t19?,20?,21?,22-,23-,24?,25?,26?,27?,28-,29-,30+,31+,32-,33-,34?,35+,36-,39?,40?,41?,42?/m1/s1
SMILES	CC1(C)C(CCC2(C)C3CC(C4C(CCC4(C)C3(C)CC(C12)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)C1(C)CCC(C(C)(C)O)O1)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	root	n.a.	PMID[18975262]
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24333010]
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO18176	Ephedra sinica	Species	Ephedraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC249046 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26759
0.1-0.2	19346
0.2-0.3	3318
0.3-0.4	325
0.4-0.5	60
0.5-0.6	17
0.6-0.7	18
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC229801
0.9359	High Similarity	NPC307167
0.8919	High Similarity	NPC82955
0.8659	High Similarity	NPC210759
0.8182	Intermediate Similarity	NPC305418
0.7674	Intermediate Similarity	NPC127801
0.7556	Intermediate Similarity	NPC237071
0.7556	Intermediate Similarity	NPC238796
0.7333	Intermediate Similarity	NPC208594
0.7174	Intermediate Similarity	NPC203434
0.7045	Intermediate Similarity	NPC472252
0.7045	Intermediate Similarity	NPC245280
0.6951	Remote Similarity	NPC131466
0.6915	Remote Similarity	NPC160816
0.6889	Remote Similarity	NPC231340
0.6706	Remote Similarity	NPC309425
0.663	Remote Similarity	NPC16520
0.663	Remote Similarity	NPC211879
0.663	Remote Similarity	NPC189852
0.663	Remote Similarity	NPC155010
0.6628	Remote Similarity	NPC114874
0.6477	Remote Similarity	NPC274833
0.6413	Remote Similarity	NPC288694
0.64	Remote Similarity	NPC6931
0.631	Remote Similarity	NPC140446
0.6277	Remote Similarity	NPC601606
0.617	Remote Similarity	NPC152584
0.6146	Remote Similarity	NPC286969
0.6023	Remote Similarity	NPC47566
0.6023	Remote Similarity	NPC129372
0.5977	Remote Similarity	NPC136816
0.5909	Remote Similarity	NPC472989
0.5889	Remote Similarity	NPC472901
0.5843	Remote Similarity	NPC472899
0.5843	Remote Similarity	NPC472898
0.5795	Remote Similarity	NPC7341
0.5667	Remote Similarity	NPC609286
0.5641	Remote Similarity	NPC64081
0.5579	Remote Similarity	NPC473020
0.5521	Remote Similarity	NPC181467
0.5417	Remote Similarity	NPC208477
0.5366	Remote Similarity	NPC474574
0.5263	Remote Similarity	NPC252253
0.5253	Remote Similarity	NPC269627
0.5222	Remote Similarity	NPC66654
0.52	Remote Similarity	NPC472715
0.5054	Remote Similarity	NPC43912

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC249046 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7958
0.1-0.2	1135
0.2-0.3	56
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data