NPASS drugs

Drug Information

Drug ID:	NPD1231
Drug Name:	Pretomanid
Molecular Formula:	C14H12F3N3O5
Canonical SMILES:	O=N(=O)c1cn2c(n1)OC[C@H](C2)OCc1ccc(cc1)OC(F)(F)F
Standard InCHI:	InChI=1S/C14H12F3N3O5/c15-14(16,17)25-10-3-1-9(2-4-10)7-23-11-5-19-6-12(20(21)22)18-13(19)24-8-11/h1-4,6,11H,5,7-8H2/t11-/m0/s1
Standard InCHIKey:	ZLHZLMOSPGACSZ-NSHDSACASA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD1231

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	452
0.1-0.2	3499
0.2-0.3	9388
0.3-0.4	5777
0.4-0.5	11132
0.5-0.6	615
0.6-0.7	27
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6964	NPC160666
Remote Similarity	0.6806	NPC242923
Remote Similarity	0.6742	NPC308906
Remote Similarity	0.6667	NPC477795
Remote Similarity	0.6667	NPC477796
Remote Similarity	0.6667	NPC477806
Remote Similarity	0.6667	NPC477805
Remote Similarity	0.6652	NPC12100
Remote Similarity	0.6609	NPC471614
Remote Similarity	0.653	NPC113369
Remote Similarity	0.6518	NPC250178
Remote Similarity	0.6493	NPC280638
Remote Similarity	0.646	NPC17305
Remote Similarity	0.6356	NPC30540
Remote Similarity	0.6355	NPC267928
Remote Similarity	0.6275	NPC150447
Remote Similarity	0.6228	NPC136924
Remote Similarity	0.6167	NPC274982
Remote Similarity	0.6147	NPC46970
Remote Similarity	0.6107	NPC472068
Remote Similarity	0.6106	NPC471603
Remote Similarity	0.6094	NPC35761
Remote Similarity	0.6092	NPC223223
Remote Similarity	0.6059	NPC115595
Remote Similarity	0.6043	NPC467439
Remote Similarity	0.6017	NPC237978
Remote Similarity	0.6	NPC287208
Remote Similarity	0.5992	NPC472067
Remote Similarity	0.5992	NPC472066
Remote Similarity	0.5992	NPC472031
Remote Similarity	0.5984	NPC316756
Remote Similarity	0.5973	NPC19872
Remote Similarity	0.5972	NPC470474
Remote Similarity	0.5962	NPC20249
Remote Similarity	0.5917	NPC226202
Remote Similarity	0.5903	NPC185782
Remote Similarity	0.5903	NPC174758
Remote Similarity	0.5895	NPC26679
Remote Similarity	0.5894	NPC476518
Remote Similarity	0.589	NPC471615
Remote Similarity	0.5882	NPC127085
Remote Similarity	0.5874	NPC232727
Remote Similarity	0.5865	NPC14651
Remote Similarity	0.5865	NPC121658
Remote Similarity	0.584	NPC56271
Remote Similarity	0.5837	NPC99891
Remote Similarity	0.583	NPC472434
Remote Similarity	0.5822	NPC476138
Remote Similarity	0.5822	NPC266551
Remote Similarity	0.5822	NPC245816
Remote Similarity	0.5819	NPC288349
Remote Similarity	0.5806	NPC472289
Remote Similarity	0.5804	NPC54537
Remote Similarity	0.5774	NPC323244
Remote Similarity	0.5774	NPC107160
Remote Similarity	0.5768	NPC21461
Remote Similarity	0.5764	NPC174672
Remote Similarity	0.5751	NPC8022
Remote Similarity	0.5751	NPC470799
Remote Similarity	0.5748	NPC219963
Remote Similarity	0.5744	NPC328924
Remote Similarity	0.5728	NPC177404
Remote Similarity	0.5727	NPC470500
Remote Similarity	0.5727	NPC210256
Remote Similarity	0.5721	NPC82548
Remote Similarity	0.572	NPC141053
Remote Similarity	0.5708	NPC187145
Remote Similarity	0.5701	NPC198673
Remote Similarity	0.5693	NPC469975
Remote Similarity	0.5689	NPC176538
Remote Similarity	0.5689	NPC477019
Remote Similarity	0.5679	NPC469554
Remote Similarity	0.5674	NPC161887
Remote Similarity	0.5673	NPC254700
Remote Similarity	0.5671	NPC85273
Remote Similarity	0.5671	NPC123976
Remote Similarity	0.5671	NPC167860
Remote Similarity	0.5665	NPC476287
Remote Similarity	0.5663	NPC212850
Remote Similarity	0.5663	NPC83289
Remote Similarity	0.5663	NPC189724
Remote Similarity	0.5658	NPC264166
Remote Similarity	0.5658	NPC165349
Remote Similarity	0.5658	NPC118832
Remote Similarity	0.5658	NPC329708
Remote Similarity	0.5658	NPC47059
Remote Similarity	0.5658	NPC274291
Remote Similarity	0.5656	NPC133140
Remote Similarity	0.5656	NPC195268
Remote Similarity	0.565	NPC473053
Remote Similarity	0.5647	NPC472435
Remote Similarity	0.5633	NPC323345
Remote Similarity	0.5633	NPC470164
Remote Similarity	0.5631	NPC289786
Remote Similarity	0.5628	NPC469589
Remote Similarity	0.5625	NPC274732
Remote Similarity	0.562	NPC315822
Remote Similarity	0.5613	NPC111624
Remote Similarity	0.56	NPC239954
Remote Similarity	0.56	NPC168911

Drug Structure

NPD1231 OpenBabel08211700192D 25 27 0 0 1 0 0 0 0 0999 V2000 -4.3301 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6581 2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3364 2.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0981 5.3660 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -3.0981 5.3660 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 4.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8364 3.4487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.8364 3.4487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3364 4.3147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 1 9 2 0 0 0 0 2 4 2 0 0 0 0 2 9 1 0 0 0 0 3 10 2 0 0 0 0 4 10 1 0 0 0 0 5 11 1 0 0 0 0 5 19 1 0 0 0 0 6 12 2 0 0 0 0 6 19 1 0 0 0 0 7 9 1 0 0 0 0 7 23 1 0 0 0 0 8 11 1 0 0 0 0 8 24 1 0 0 0 0 10 25 1 0 0 0 0 11 23 1 1 0 0 0 12 18 1 0 0 0 0 12 20 1 0 0 0 0 13 18 2 0 0 0 0 13 19 1 0 0 0 0 13 24 1 0 0 0 0 14 15 1 0 0 0 0 14 16 1 0 0 0 0 14 17 1 0 0 0 0 14 25 1 0 0 0 0 20 21 2 0 0 0 0 20 22 2 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC001088
DrugBank	DB05154
ChEMBL	CHEMBL227875
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	456199
ChEBI
CAS Number	187235-37-6

Drug Properties

Molecular Weight	359.07
ALogP	2.434
MLogP	1.79
XLogP	2.965
HDA	3
HBD	0
Rotatable Bonds	10
TPSA	88.65
RO5 Violation	0