NPASS Compound

Natural Product: NPC75871

Natural Product ID	NPC75871
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	SCRQJMORGYBWEK-UHFFFAOYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	5319157
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 85 89 0 0 0 0 0 0 0 0999 V2000 -4.8285 -1.5511 -1.9901 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7180 -1.4844 -0.4781 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7106 -2.5100 0.1096 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3682 -1.7739 0.0270 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5384 -0.7556 0.6785 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0514 -0.9224 0.3574 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3563 -1.8785 0.8908 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1018 -2.1593 0.6716 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6957 -0.8492 0.2762 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1686 -0.7041 0.3206 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5954 -1.3705 1.6454 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9902 -1.3083 -0.7388 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1178 -0.4637 -1.2799 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7680 0.4476 -0.3114 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8292 1.2097 0.5610 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3406 1.1777 2.0061 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8856 2.6933 0.1455 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3979 0.8131 0.4466 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6408 1.5481 -0.6025 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7780 0.7810 -1.5098 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9761 -0.3428 -0.9263 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8273 -1.3933 -2.0256 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4387 0.0570 -0.5770 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1434 0.2203 -1.8941 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5628 1.3874 0.1210 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9700 1.7154 0.4320 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9840 0.6379 0.5557 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1532 0.8399 -0.4028 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2068 -0.1541 0.0474 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4416 0.1777 -0.5618 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7051 0.9742 1.8661 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7831 0.1665 2.7986 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2611 2.2380 1.9355 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9547 2.6566 3.1067 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7471 -0.2720 0.3986 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9002 -1.8200 -2.4929 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5895 -2.3168 -2.2351 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2818 -0.5886 -2.3632 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7197 -2.1678 -0.1389 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5026 -3.4954 -0.3107 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5894 -2.4700 1.2263 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4817 -2.6418 0.7655 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8331 -2.3124 -0.8135 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5729 -0.9827 1.8034 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8702 -2.5548 1.5661 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3348 -3.0340 0.1042 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4879 -2.3777 1.7180 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3224 -0.1626 1.1141 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6546 -1.2525 1.8581 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4804 -2.4757 1.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9176 -1.1404 2.4630 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4494 -1.6409 -1.6579 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4780 -2.2728 -0.3943 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7767 0.0881 -2.2069 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9210 -1.1473 -1.6867 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3829 1.1654 -0.9352 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5469 0.9674 2.7302 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2397 0.5139 2.0994 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7482 2.1853 2.3191 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9418 3.2083 0.3497 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6543 3.2305 0.7788 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2704 2.8042 -0.8874 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9379 1.0435 1.4574 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1219 2.4240 -0.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4143 2.0650 -1.2508 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0776 1.4880 -2.0123 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4049 0.3933 -2.3680 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2233 -1.0142 -3.0137 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2171 -2.3779 -1.7772 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2529 -1.6255 -2.2624 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6961 1.2079 -1.9554 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9396 -0.5220 -2.0899 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4310 0.3241 -2.7658 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0722 1.4609 1.0198 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2054 2.1592 -0.5935 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9167 2.4018 1.3425 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4095 2.4518 -0.3246 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5041 1.8777 -0.2398 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9593 0.6403 -1.4393 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3068 -0.2205 1.1299 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0637 0.5618 0.1261 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6675 3.4460 2.8045 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4388 1.8298 3.6289 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2346 3.1334 3.8034 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6067 -0.3056 -0.0757 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 15 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 21 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 27 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 14 35 1 0 29 2 1 0 27 5 1 0 23 6 1 0 21 9 1 0 18 10 1 0 1 36 1 0 1 37 1 0 1 38 1 0 3 39 1 0 3 40 1 0 3 41 1 0 4 42 1 0 4 43 1 0 5 44 1 0 7 45 1 0 8 46 1 0 8 47 1 0 9 48 1 0 11 49 1 0 11 50 1 0 11 51 1 0 12 52 1 0 12 53 1 0 13 54 1 0 13 55 1 0 14 56 1 0 16 57 1 0 16 58 1 0 16 59 1 0 17 60 1 0 17 61 1 0 17 62 1 0 18 63 1 0 19 64 1 0 19 65 1 0 20 66 1 0 20 67 1 0 22 68 1 0 22 69 1 0 22 70 1 0 24 71 1 0 24 72 1 0 24 73 1 0 25 74 1 0 25 75 1 0 26 76 1 0 26 77 1 0 28 78 1 0 28 79 1 0 29 80 1 0 30 81 1 0 34 82 1 0 34 83 1 0 34 84 1 0 35 85 1 0 M END

Standard InCHIKey	SCRQJMORGYBWEK-UHFFFAOYSA-N
Standard InCHI	InChI=1S/C31H50O4/c1-26(2)17-20-19-9-10-22-28(5)13-12-23(32)27(3,4)21(28)11-14-30(22,7)29(19,6)15-16-31(20,18-24(26)33)25(34)35-8/h9,20-24,32-33H,10-18H2,1-8H3
SMILES	CC1(C)CC2C3=CCC4C5(C)CCC(C(C)(C)C5CCC4(C)C3(C)CCC2(CC1O)C(=O)OC)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	486.37	Volume:	531.838 ? Van der Waals volume.
Dense:	0.915	LogP:	4.245 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	4.08 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.424 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	27.0
TPSA:	66.76 ? Topological Polar Surface Area.	H-Bond Acceptor:	4.0
H-Bond Donor:	2.0	Rings:	5.0
Heavy Atoms:	4.0

MedChem Properties

QED Drug-Likeness Score:	0.337	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	4.858	Fsp³:	0.903
MCE-18:	107.119 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Accepted	GSK Rule:	Accepted
Golden Triangle Rule:	Rejected	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.221	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.038 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.309	Promiscuous compounds:	0.0

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.046	MDCK Permeability:	-4.797
Pgp-inhibitor:	0.001	Pgp-substrate:	0.495
PAMPA:	0.838 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.015
20% Bioavailability (F20%):	0.268	30% Bioavailability (F30%):	0.594
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.742	MRP1:	0.999
Plasma Protein Binding (PPB):	80.472%	Volume Distribution (VD):	-0.158
Fu:	17.679% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.027
OATP1B3 inhibitor:	0.962	BCRP inhibitor:	0.104
BSEP inhibitor:	0.446

ADMET: Metabolism

CYP1A2-inhibitor:	0.798	CYP1A2-substrate:	0.338
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.437
CYP2C9-inhibitor:	0.521	CYP2C9-substrate:	0.007
CYP2D6-inhibitor:	0.424	CYP2D6-substrate:	0.424
CYP3A4-inhibitor:	0.973	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.999	CYP2C8-inhibitor:	0.984
HLM stability:	0.993 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

14.981

Half-life (T1/2):

0.764

ADMET: Toxicity

hERG Blockers:	0.147	hERG Blockers (10um):	0.639
Human Hepatotoxicity (H-HT):	0.299	Drug-induced Liver Injury (DILI):	0.037
AMES Toxicity:	0.059	Rat Oral Acute Toxicity:	0.251
Maximum Recommended Daily Dose:	0.892	Skin Sensitization:	0.06
Carcinogencity:	0.301	Eye Corrosion:	0.0
Eye Irritation:	0.04	Respiratory Toxicity:	0.649
Drug-induced Neurotoxicity:	0.238	Ototoxicity:	0.931
Hematotoxicity:	0.049	Drug-induced Nephrotoxicity:	0.043
Genotoxicity:	0.011	RPMI-8226 Immunitoxicity:	0.019
A549 Cytotoxicity:	0.249	Hek293 Cytotoxicity:	0.362
BCF:	2.102 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.836 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.141 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.618 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	bark	n.a.	PMID[15283458]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	stem	n.a.	PMID[15577257]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9051910]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	Fruit	n.a.	n.a.	Database[FooDB]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	Leaf	n.a.	n.a.	Database[FooDB]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO12181	Albizia julibrissin	Species	Fabaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO1551	Luffa aegyptiaca	Species	Cucurbitaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC75871 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	18603
0.1-0.2	25381
0.2-0.3	4630
0.3-0.4	949
0.4-0.5	206
0.5-0.6	73
0.6-0.7	14
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8136	Intermediate Similarity	NPC246708
0.6984	Remote Similarity	NPC40552
0.6667	Remote Similarity	NPC488519
0.6515	Remote Similarity	NPC136313
0.6508	Remote Similarity	NPC235341
0.6471	Remote Similarity	NPC49776
0.6471	Remote Similarity	NPC63118
0.6471	Remote Similarity	NPC474436
0.6406	Remote Similarity	NPC470588
0.6393	Remote Similarity	NPC290598
0.6393	Remote Similarity	NPC30590
0.6154	Remote Similarity	NPC159168
0.6094	Remote Similarity	NPC101475
0.6053	Remote Similarity	NPC167383
0.6	Remote Similarity	NPC164349
0.5873	Remote Similarity	NPC27765
0.5873	Remote Similarity	NPC120098
0.5873	Remote Similarity	NPC122418
0.5873	Remote Similarity	NPC491014
0.5846	Remote Similarity	NPC311078
0.5846	Remote Similarity	NPC34177
0.5821	Remote Similarity	NPC133954
0.5797	Remote Similarity	NPC214756
0.5758	Remote Similarity	NPC253807
0.5758	Remote Similarity	NPC158662
0.5714	Remote Similarity	NPC7260
0.5714	Remote Similarity	NPC210037
0.5714	Remote Similarity	NPC120968
0.5714	Remote Similarity	NPC171203
0.5714	Remote Similarity	NPC307426
0.5714	Remote Similarity	NPC307335
0.5714	Remote Similarity	NPC98442
0.5714	Remote Similarity	NPC74855
0.5714	Remote Similarity	NPC242468
0.5714	Remote Similarity	NPC227467
0.5714	Remote Similarity	NPC273621
0.5714	Remote Similarity	NPC481361
0.5672	Remote Similarity	NPC95594
0.5616	Remote Similarity	NPC294360
0.5588	Remote Similarity	NPC267517
0.5584	Remote Similarity	NPC191763
0.5493	Remote Similarity	NPC259788
0.5493	Remote Similarity	NPC255589
0.5455	Remote Similarity	NPC474989
0.5429	Remote Similarity	NPC162107
0.5429	Remote Similarity	NPC46912
0.5429	Remote Similarity	NPC477579
0.5395	Remote Similarity	NPC283343
0.5373	Remote Similarity	NPC237344
0.5373	Remote Similarity	NPC196753
0.5352	Remote Similarity	NPC187722
0.5352	Remote Similarity	NPC295643
0.5352	Remote Similarity	NPC610937
0.5325	Remote Similarity	NPC473160
0.5309	Remote Similarity	NPC237503
0.5294	Remote Similarity	NPC40394
0.5217	Remote Similarity	NPC230295
0.5217	Remote Similarity	NPC253402
0.5217	Remote Similarity	NPC98386
0.5211	Remote Similarity	NPC477872
0.5205	Remote Similarity	NPC18872
0.5205	Remote Similarity	NPC290614
0.52	Remote Similarity	NPC476879
0.5195	Remote Similarity	NPC471433
0.5195	Remote Similarity	NPC471432
0.5185	Remote Similarity	NPC46388
0.5147	Remote Similarity	NPC132478
0.5143	Remote Similarity	NPC480950
0.5143	Remote Similarity	NPC470224
0.5139	Remote Similarity	NPC480946
0.5139	Remote Similarity	NPC272075
0.5139	Remote Similarity	NPC213412
0.5139	Remote Similarity	NPC130577
0.5139	Remote Similarity	NPC142415
0.5139	Remote Similarity	NPC102683
0.5139	Remote Similarity	NPC2539
0.5135	Remote Similarity	NPC202728
0.5135	Remote Similarity	NPC158059
0.5072	Remote Similarity	NPC291379
0.5068	Remote Similarity	NPC182797
0.5068	Remote Similarity	NPC51700
0.5068	Remote Similarity	NPC88716
0.5068	Remote Similarity	NPC68160
0.5068	Remote Similarity	NPC52169
0.5068	Remote Similarity	NPC488562
0.5068	Remote Similarity	NPC112866
0.5068	Remote Similarity	NPC606443
0.5067	Remote Similarity	NPC480919

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC75871 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7000
0.1-0.2	2069
0.2-0.3	76
0.3-0.4	3
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5278	Remote Similarity	NPD7645	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data