Natural Product: NPC602221| Natural Product ID | NPC602221 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| WEEFNMFMNMASJY-UHFFFAOYSA-M |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL258893 |
| PubChem CID | n.a. |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | WEEFNMFMNMASJY-UHFFFAOYSA-M |
| Standard InCHI | InChI=1S/C21H18NO4.ClH/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22;/h4-10H,11H2,1-3H3;1H/q+1;/p-1 |
| SMILES | COc1ccc2c(c[n+](C)c3c4cc5c(cc4ccc23)OCO5)c1OC.[Cl-] |
  Calculated Properties| Molecular Weight:   | 348.12 | Volume:   | 352.738 Van der Waals volume.
|
| Dense:   | 0.987 | LogP:   | 3.232 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 3.088 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -5.402 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 2.0 | Rigid Bonds:   | 25.0 |
| TPSA:   | 40.8 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 5.0 |
| H-Bond Donor:   | 0.0 | Rings:   | 5.0 |
| Heavy Atoms:   | 5.0 |
| QED Drug-Likeness Score:   | 0.409 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.687 | Fsp3:   | 0.19 |
| MCE-18:   | 54.08 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Accepted | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.921 | Fluc inhibitor:   | 0.074 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.868 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.571 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.061 | Promiscuous compounds:   | 0.518 |
| Caco-2 Permeability:   | -4.942 | MDCK Permeability:   | -4.727 |
| Pgp-inhibitor:   | 0.0 | Pgp-substrate:   | 0.999 |
| PAMPA:   |
0.325 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.018 |
| 20% Bioavailability (F20%):   | 0.375 | 30% Bioavailability (F30%):   | 0.227 |
| 50% Bioavailability (F50%):   | 0.989 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.007 | MRP1:   | 0.984 |
| Plasma Protein Binding (PPB):   | 51.011% | Volume Distribution (VD):   | -0.048 |
| Fu: |
48.895% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.0 |
| OATP1B3 inhibitor:   | 0.0 | BCRP inhibitor:   | 0.021 |
| BSEP inhibitor:   | 0.658 |
| CYP1A2-inhibitor:   | 1.0 | CYP1A2-substrate:   | 1.0 |
| CYP2C19-inhibitor:   | 0.999 | CYP2C19-substrate:   | 0.009 |
| CYP2C9-inhibitor:   | 0.999 | CYP2C9-substrate:   | 0.652 |
| CYP2D6-inhibitor:   | 0.997 | CYP2D6-substrate:   | 1.0 |
| CYP3A4-inhibitor:   | 0.924 | CYP3A4-substrate:   | 0.996 |
| CYP2B6-substrate:   | 0.751 | CYP2C8-inhibitor:   | 0.249 |
| HLM stability:   |
0.205 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 4.18 | Half-life (T1/2):   | 0.632 |
| hERG Blockers:   | 0.408 | hERG Blockers (10um):   | 0.571 |
| Human Hepatotoxicity (H-HT):   | 0.144 | Drug-induced Liver Injury (DILI):   | 0.726 |
| AMES Toxicity:   | 0.755 | Rat Oral Acute Toxicity:   | 0.808 |
| Maximum Recommended Daily Dose:   | 0.904 | Skin Sensitization:   | 0.911 |
| Carcinogencity:   | 0.864 | Eye Corrosion:   | 0.004 |
| Eye Irritation:   | 0.94 | Respiratory Toxicity:   | 0.924 |
| Drug-induced Neurotoxicity:   | 0.496 | Ototoxicity:   | 0.152 |
| Hematotoxicity:   | 0.128 | Drug-induced Nephrotoxicity:   | 0.33 |
| Genotoxicity:   | 0.993 | RPMI-8226 Immunitoxicity:   | 0.174 |
| A549 Cytotoxicity:   | 0.014 | Hek293 Cytotoxicity:   | 0.83 |
| BCF:   |
2.141 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
4.303 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
5.775 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
5.322 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO2935 | Zanthoxylum parviflorum | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2935 | Zanthoxylum parviflorum | Species | Rutaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1673 | Individual protein | CaM kinase I gamma | Homo sapiens | Thermal melting change | = | -1.1 | degrees C | PMID[18077363] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT1710 | Individual protein | Serine/threonine-protein kinase 38 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1713 | Individual protein | PDZ-binding kinase | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[18077363] |
| NPT1682 | Individual protein | Dual specificity protein kinase CLK2 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1709 | Individual protein | Serine/threonine-protein kinase 17A | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[18077363] |
| NPT1672 | Individual protein | CaM kinase I delta | Homo sapiens | Thermal melting change | = | -5.3 | degrees C | PMID[18077363] |
| NPT1698 | Individual protein | Serine/threonine-protein kinase PCTAIRE-1 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1700 | Individual protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Thermal melting change | = | -3.1 | degrees C | PMID[18077363] |
| NPT1701 | Individual protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[18077363] |
| NPT1431 | Individual protein | Mitogen-activated protein kinase kinase kinase 5 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1657 | Individual protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Thermal melting change | = | -2.5 | degrees C | PMID[18077363] |
| NPT1705 | Individual protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | -1.3 | degrees C | PMID[18077363] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Ki | = | 320.0 | nM | PMID[23062825] |
| NPT1671 | Individual protein | AMP-activated protein kinase, alpha-2 subunit | Homo sapiens | Thermal melting change | = | -1.3 | degrees C | PMID[18077363] |
| NPT1684 | Individual protein | Casein kinase I gamma 1 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT2656 | Individual protein | Ras-related C3 botulinum toxin substrate 1 | Homo sapiens | Inhibition | = | 49.0 | % | PMID[19716293] |
| NPT1696 | Individual protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Thermal melting change | = | -1.7 | degrees C | PMID[18077363] |
| NPT1706 | Individual protein | Serine/threonine-protein kinase 2 | Homo sapiens | Thermal melting change | = | -2.4 | degrees C | PMID[18077363] |
| NPT2656 | Individual protein | Ras-related C3 botulinum toxin substrate 1 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[19716293] |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | Protection | = | 5.0 | % | PMID[7288825] |
| NPT1707 | Individual protein | Serine/threonine-protein kinase 10 | Homo sapiens | Thermal melting change | = | -1.1 | degrees C | PMID[18077363] |
| NPT1711 | Individual protein | Serine/threonine-protein kinase MST1 | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[18077363] |
| NPT2655 | Individual protein | Cell division control protein 42 homolog | Homo sapiens | Inhibition | = | 35.0 | % | PMID[19716293] |
| NPT1630 | Individual protein | CaM kinase II beta | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1703 | Individual protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Thermal melting change | = | 1.4 | degrees C | PMID[18077363] |
| NPT1715 | Individual protein | Serine/threonine-protein kinase VRK2 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT1717 | Individual protein | Serine/threonine-protein kinase 25 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 2059.6 | nM | PubChem BioAssay data set |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | Inhibition | = | 13.0 | % | PMID[7288825] |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | Inhibition | = | 40.0 | % | PMID[7288825] |
| NPT1371 | Individual protein | Cyclin-dependent kinase 2 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1675 | Individual protein | CaM kinase II delta | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[18077363] |
| NPT1685 | Individual protein | Casein kinase I gamma 2 | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1265 | Individual protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Thermal melting change | = | -4.4 | degrees C | PMID[18077363] |
| NPT151 | Individual protein | 15-hydroxyprostaglandin dehydrogenase [NAD+] | Homo sapiens | Potency | = | 31622.8 | nM | PubChem BioAssay data set |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | ID50 | = | 4e-06 | M | PMID[7288825] |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | = | 2818.4 | nM | PubChem BioAssay data set |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | Inhibition | = | 23.0 | % | PMID[7288825] |
| NPT1708 | Individual protein | Serine/threonine-protein kinase 16 | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[18077363] |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | Concentration | = | 3e-05 | M | PMID[7288825] |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | Protection | = | 55.0 | % | PMID[7288825] |
| NPT2968 | Individual protein | Bcl2-antagonist of cell death (BAD) | Homo sapiens | IC50 | = | 100000.0 | nM | PMID[18925736] |
| NPT1571 | Individual protein | Cyclin-dependent kinase 6 | Homo sapiens | Thermal melting change | = | -1.0 | degrees C | PMID[18077363] |
| NPT1038 | Individual protein | Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 22387.2 | nM | PubChem BioAssay data set |
| NPT1694 | Individual protein | Serine/threonine-protein kinase OSR1 | Homo sapiens | Thermal melting change | = | -2.6 | degrees C | PMID[18077363] |
| NPT2655 | Individual protein | Cell division control protein 42 homolog | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[19716293] |
| NPT2656 | Individual protein | Ras-related C3 botulinum toxin substrate 1 | Homo sapiens | Inhibition | = | 95.0 | % | PMID[19716293] |
| NPT1674 | Individual protein | CaM kinase II alpha | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT1678 | Individual protein | CaM-kinase kinase beta | Homo sapiens | Thermal melting change | = | -1.6 | degrees C | PMID[18077363] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | IC50 | = | 1540.0 | nM | PMID[23062825] |
| NPT1691 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 6 | Homo sapiens | Thermal melting change | = | -6.6 | degrees C | PMID[18077363] |
| NPT1699 | Individual protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Thermal melting change | = | -0.7 | degrees C | PMID[18077363] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Ki | = | 1120.0 | nM | PMID[23062825] |
| NPT2656 | Individual protein | Ras-related C3 botulinum toxin substrate 1 | Homo sapiens | IC50 | = | 7000.0 | nM | PMID[19716293] |
| NPT2967 | Individual protein | Alanine aminotransferase | Rattus norvegicus | Protection | = | 70.0 | % | PMID[7288825] |
| NPT1677 | Individual protein | CaM kinase IV | Homo sapiens | Thermal melting change | = | -0.6 | degrees C | PMID[18077363] |
| NPT1679 | Individual protein | Cyclin-dependent kinase-like 1 | Homo sapiens | Thermal melting change | = | -3.5 | degrees C | PMID[18077363] |
| NPT1658 | Individual protein | Serine/threonine-protein kinase NEK2 | Homo sapiens | Thermal melting change | = | -1.2 | degrees C | PMID[18077363] |
| NPT282 | Individual protein | MAP kinase ERK2 | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT1676 | Individual protein | CaM kinase II gamma | Homo sapiens | Thermal melting change | = | -0.2 | degrees C | PMID[18077363] |
| NPT1688 | Individual protein | Myotonin-protein kinase | Homo sapiens | Thermal melting change | = | 1.7 | degrees C | PMID[18077363] |
| NPT1693 | Individual protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | -4.2 | degrees C | PMID[18077363] |
| NPT1683 | Individual protein | Dual specificity protein kinase CLK3 | Homo sapiens | Thermal melting change | = | -1.0 | degrees C | PMID[18077363] |
| NPT1689 | Individual protein | Tyrosine-protein kinase JAK1 | Homo sapiens | Thermal melting change | = | 0.3 | degrees C | PMID[18077363] |
| NPT1416 | Individual protein | Neuropeptide S receptor | Homo sapiens | Potency | = | 19952.6 | nM | PubChem BioAssay data set |
| NPT1616 | Individual protein | MAP kinase p38 beta | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[18077363] |
| NPT281 | Individual protein | MAP kinase ERK1 | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[18077363] |
| NPT1692 | Individual protein | Mitogen-activated protein kinase 6 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[18077363] |
| NPT1695 | Individual protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Thermal melting change | = | -3.8 | degrees C | PMID[18077363] |
| NPT1697 | Individual protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Thermal melting change | = | -3.3 | degrees C | PMID[18077363] |
| NPT1712 | Individual protein | TRAF2- and NCK-interacting kinase | Homo sapiens | Thermal melting change | = | -1.3 | degrees C | PMID[18077363] |
| NPT1690 | Individual protein | Dual specificity mitogen-activated protein kinase kinase 2 | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[18077363] |
| NPT1680 | Individual protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Thermal melting change | = | -3.9 | degrees C | PMID[18077363] |
| NPT1686 | Individual protein | Casein kinase I isoform gamma-3 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[18077363] |
| NPT1687 | Individual protein | Death-associated protein kinase 3 | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[18077363] |
| NPT1693 | Individual protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | -1.0 | degrees C | PMID[18077363] |
| NPT1702 | Individual protein | Serine/threonine-protein kinase PLK4 | Homo sapiens | Thermal melting change | = | -3.1 | degrees C | PMID[18077363] |
| NPT1704 | Individual protein | Serine/threonine-protein kinase RIO2 | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[18077363] |
| NPT22961 | Single protein | Inactive serine/threonine-protein kinase VRK3 | Homo sapiens | Thermal melting change | = | -0.6 | degrees C | PMID[18077363] |
| NPT58 | Individual protein | Bloom syndrome protein | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 2818.4 | nM | PubChem BioAssay data set |
| NPT796 | Individual protein | Peripheral myelin protein 22 | Homo sapiens | Potency | = | 21331.3 | nM | PubChem BioAssay data set |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 3162.3 | nM | PubChem BioAssay data set |
| NPT29648 | Single protein | Dual specificity protein kinase CLK1 | Homo sapiens | Thermal melting change | = | -4.4 | degrees C | PMID[18077363] |
| NPT9 | Individual protein | DNA polymerase eta | Homo sapiens | Potency | n.a. | 44668.4 | nM | PubChem BioAssay data set |
| NPT94 | Individual protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 25118.9 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 18887.6 | nM | PubChem BioAssay data set |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 39810.7 | nM | PubChem BioAssay data set |
| NPT28500 | Nucleic-acid | Salmon testes DNA | Oncorhynchus gorbuscha | K | = | 466000.0 | 1/M | PMID[15999988] |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | 83.5 | % | PMID[23062825] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Activity | = | 43.0 | % | PMID[18457386] |
| NPT54 | Individual protein | Nonstructural protein 1 | Influenza A virus | Potency | = | 56234.1 | nM | PubChem BioAssay data set |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | IC50 | = | 6330.0 | nM | PMID[23062825] |
| NPT980 | Individual protein | Apoptosis regulator Bcl-2 | Homo sapiens | Ki | = | 171000.0 | nM | PMID[17227711] |
| NPT831 | Individual protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[18077363] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 88.4 | % | PMID[23062825] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | IC50 | = | 3780.0 | nM | PMID[23062825] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 65.0 | % | PMID[23062825] |
| NPT59 | Individual protein | DNA polymerase beta | Homo sapiens | Potency | = | 28183.8 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Ki | = | 920.0 | nM | PMID[23062825] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 0.8 | % | PMID[23062825] |
| NPT761 | Individual protein | Protein kinase C epsilon | Homo sapiens | IC50 | = | 24.0 | nM | PMID[18077363] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Ki | = | 480.0 | nM | PMID[23062825] |
| NPT591 | Individual protein | Glycogen synthase kinase-3 beta | Homo sapiens | Thermal melting change | = | -1.5 | degrees C | PMID[18077363] |
| NPT459 | Individual protein | Human immunodeficiency virus type 1 reverse transcriptase | Human immunodeficiency virus 1 | IC50 | < | 200.0 | ug.mL-1 | PMID[1710653] |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT93 | Individual protein | Survival motor neuron protein | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 75.94 | % | PMID[23062825] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | 48.5 | % | PMID[23062825] |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 15848.9 | nM | PubChem BioAssay data set |
| NPT8 | Individual protein | DNA polymerase iota | Homo sapiens | Potency | n.a. | 5623.4 | nM | PubChem BioAssay data set |
| NPT439 | Individual protein | Butyrylcholinesterase | Homo sapiens | IC50 | = | 10340.0 | nM | PMID[23062825] |
| NPT22960 | Single protein | Serine/threonine-protein kinase VRK1 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[18077363] |
| NPT3720 | Individual protein | Apoptosis regulator Bcl-W | Homo sapiens | Ki | = | 106000.0 | nM | PMID[17227711] |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 19952.6 | nM | PubChem BioAssay data set |
| NPT442 | Individual protein | Ferritin light chain | Equus caballus | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT732 | Cell line | HOP-18 | Homo sapiens | GI50 | n.a. | 1803.02 | nM | PubChem BioAssay data set |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 12.0 | % | PMID[10395504] |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 1981.53 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 1866.38 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 2094.11 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 285.76 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 1883.65 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 363.08 | nM | PubChem BioAssay data set |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 100.4 | % | PMID[18024584] |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 106.48 | % | PMID[18024584] |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 1479.11 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 3890.45 | nM | PubChem BioAssay data set |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 22.01 | % | PMID[18024584] |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 1682.67 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 2065.38 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 1782.38 | nM | PubChem BioAssay data set |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | GI50 | n.a. | 1927.52 | nM | PubChem BioAssay data set |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 101.43 | % | PMID[18024584] |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 1836.54 | nM | PubChem BioAssay data set |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 1.24 | ug.mL-1 | PMID[10395504] |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 2398.83 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 2103.78 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 2142.89 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 1914.26 | nM | PubChem BioAssay data set |
| NPT579 | Cell line | DLD-1 | Homo sapiens | GI50 | n.a. | 1698.24 | nM | PubChem BioAssay data set |
| NPT179 | Cell line | A2780 | Homo sapiens | IC50 | = | 4630.0 | nM | PMID[15999988] |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 1914.26 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 1663.41 | nM | PubChem BioAssay data set |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 33.84 | % | PMID[18024584] |
| NPT116 | Cell line | HL-60 | Homo sapiens | IC50 | = | 2990.0 | nM | PMID[26026362] |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 1757.92 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 1840.77 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 1686.55 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 1967.89 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 1803.02 | nM | PubChem BioAssay data set |
| NPT577 | Cell line | RXF 631 | Homo sapiens | GI50 | n.a. | 1857.8 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 1757.92 | nM | PubChem BioAssay data set |
| NPT572 | Cell line | DMS-273 | Homo sapiens | GI50 | n.a. | 2037.04 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 1279.38 | nM | PubChem BioAssay data set |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | n.a. | 1901.08 | nM | PubChem BioAssay data set |
| NPT1970 | Cell line | THP-1 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[19110420] |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 110.26 | % | PMID[18024584] |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 195.46 | % | PMID[18024584] |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 229.91 | % | PMID[18024584] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 1510.08 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 2130.0 | nM | PMID[26026362] |
| NPT578 | Cell line | SNB-78 | Homo sapiens | GI50 | n.a. | 1999.86 | nM | PubChem BioAssay data set |
| NPT168 | Cell line | P388 | Mus musculus | T/C | = | 111.0 | % | PMID[10395504] |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 108.72 | % | PMID[18024584] |
| NPT574 | Cell line | XF498 | Homo sapiens | GI50 | n.a. | 1790.61 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 1489.36 | nM | PubChem BioAssay data set |
| NPT731 | Cell line | LXFL 529 | Homo sapiens | GI50 | n.a. | 1725.84 | nM | PubChem BioAssay data set |
| NPT576 | Cell line | DMS-114 | Homo sapiens | GI50 | n.a. | 2177.71 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 2477.42 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 9162.2 | nM | PubChem BioAssay data set |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 30.83 | % | PMID[18024584] |
| NPT2891 | Cell line | H4 | Homo sapiens | Activity | = | 213.88 | % | PMID[18024584] |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 14576.9 | nM | PubChem BioAssay data set |
| NPT573 | Cell line | M19-MEL | Homo sapiens | GI50 | n.a. | 1599.56 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 2037.04 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 1883.65 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 1782.38 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 1524.05 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 3801.89 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 1811.34 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 1832.31 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 751.62 | nM | PubChem BioAssay data set |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 1823.9 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 1733.8 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 1857.8 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 1845.02 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 1901.08 | nM | PubChem BioAssay data set |
| NPT575 | Cell line | KM-20L2 | Homo sapiens | GI50 | n.a. | 1741.81 | nM | PubChem BioAssay data set |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 1729.82 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 1836.54 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 2488.86 | nM | PubChem BioAssay data set |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 1803.02 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 187.93 | nM | PubChem BioAssay data set |
| NPT517 | Cell line | Panel NCI-60 (60 carcinoma cell lines) | Homo sapiens | GI50 | = | 188.0 | nM | PMID[15743190] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12589.25 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | > | 14.0 | n.a. | PMID[19716293] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 40.0 | % | PMID[19716293] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 10.0 | nM | PMID[18077363] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | = | 67.0 | % | PMID[23062825] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | n.a. | 2238.7 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 15848.93 | nM | PMID[19734910] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio EC50 | = | 3.87 | n.a. | PMID[17417631] |
| NPT28438 | Unchecked | Unchecked | n.a. | Inhibition | n.a. | n.a. | % | PMID[17417631] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 660.0 | nM | PMID[18077363] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 4200.0 | nM | PMID[23062825] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 13030.0 | nM | PMID[23062825] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 900.0 | nM | PMID[18077363] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ki | = | 96000.0 | nM | PMID[17227711] |
| NPT28438 | Unchecked | Unchecked | n.a. | Potency | = | 6309.6 | nM | PubChem BioAssay data set |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 30.0 | nM | PMID[36996714] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 1852.6 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 11220.2 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 1531.0 | nM | PMID[17417631] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 12589.3 | nM | PubChem BioAssay data set |
| NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 14.3 | ug.mL-1 | PMID[28628823] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 17782.8 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Potency | = | 10000.0 | nM | PubChem BioAssay data set |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | EC50 | = | 396.0 | nM | PMID[17417631] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | Activity | n.a. | n.a. | n.a. | PMID[22182580] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MBC | > | 260.0 | uM | PMID[22182580] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MBC | > | 260.0 | uM | PMID[22182580] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | EC50 | = | 15200.0 | nM | PMID[22182580] |
| NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | = | 16300.0 | nM | PMID[22182580] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | Activity | n.a. | n.a. | n.a. | PMID[22182580] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | EC50 | = | 8600.0 | nM | PMID[22182580] |
| NPT17 | Organism | Staphylococcus epidermidis | Staphylococcus epidermidis | MIC | = | 16300.0 | nM | PMID[22182580] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | MSD | = | 10.0 | day | PMID[10395504] |
| NPT32 | Organism | Mus musculus | Mus musculus | MSD | = | 1.1 | day | PMID[10395504] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC602221 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.9796 | High Similarity | NPC100079 |
| 0.9796 | High Similarity | NPC23614 |
| 0.8462 | Intermediate Similarity | NPC46451 |
| 0.7091 | Intermediate Similarity | NPC149471 |
| 0.6909 | Remote Similarity | NPC271215 |
| 0.6897 | Remote Similarity | NPC611429 |
| 0.6557 | Remote Similarity | NPC604320 |
| 0.65 | Remote Similarity | NPC604713 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC602221 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 0.8462 | Intermediate Similarity | NPD3763 | Phase 2 |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
