NPASS Compound

Natural Product: NPC478616

Natural Product ID	NPC478616
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	PGKGIQLKUPNZFG-KYHWDRKFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	134141861
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000261] Phenylpropanoids and polyketides [CHEMONTID:0000334] Flavonoids [CHEMONTID:0001586] Biflavonoids and polyflavonoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 97107 0 0 0 0 0 0 0 0999 V2000 4.8423 -3.6401 1.3554 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1131 -4.9432 0.9945 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5781 -5.2479 -0.2673 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7623 -4.2081 -1.1531 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4873 -2.8896 -0.7848 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0222 -2.5830 0.4765 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7229 -1.2133 0.8990 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9862 -0.4673 1.3064 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6490 0.8943 1.7992 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4553 1.5077 1.1714 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1725 2.8019 1.5317 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0724 3.3980 0.9673 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2547 2.7208 0.0518 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5221 1.4235 -0.3207 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6860 0.6893 -1.2759 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5403 -0.0384 -0.6939 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5605 -1.3897 -0.4902 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5462 -2.0448 0.0639 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6707 -1.3640 0.4149 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7065 -0.0022 0.2151 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9482 0.7072 0.6109 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.1755 0.7202 2.0775 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5405 1.6572 2.8785 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6994 1.7334 4.2422 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5273 0.8452 4.8768 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1818 -0.1058 4.1256 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0010 -0.1590 2.7421 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6787 -1.1314 2.0254 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1147 -1.4489 0.7429 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0138 -2.4186 0.1097 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1340 -3.6706 0.6746 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9635 -4.6328 0.1302 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6783 -4.3148 -1.0027 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5637 -3.0587 -1.5775 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7322 -2.1187 -1.0176 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3187 -2.8138 -2.7214 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5105 -5.2774 -1.5502 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0868 -0.1215 0.0018 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3039 0.5181 0.1864 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8087 -1.9658 0.9730 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6695 0.9449 6.2554 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6922 2.5795 2.2885 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6223 0.6490 -0.3295 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6198 2.0159 -0.5498 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2994 2.7118 -1.3445 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3537 3.7379 -2.2002 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6479 3.5515 -2.6747 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2678 4.4970 -3.4710 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6268 5.6578 -3.8235 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3434 5.8612 -3.3632 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2702 4.9107 -2.5670 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2894 7.0393 -3.7287 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2397 6.6230 -4.6273 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0439 1.7302 -2.2168 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1212 1.1243 -3.0570 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1683 3.3930 -0.4709 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6361 -2.1924 -0.8053 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6433 0.8288 0.2594 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9909 -0.4689 -0.0562 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9913 3.4771 2.4473 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5596 -1.2038 2.3514 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2308 -4.5204 -2.4229 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8470 -6.5724 -0.6155 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4726 -3.3968 2.3581 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9728 -5.7714 1.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6394 -2.0777 -1.4995 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0967 -1.2510 1.8379 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7328 -0.4586 0.4839 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5538 1.5452 1.7146 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4105 0.8245 2.8993 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8389 4.4264 1.2469 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2892 0.0438 -1.9607 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5291 -3.1161 0.2253 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9838 1.7422 0.2132 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1691 2.4980 4.8231 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8387 -0.8164 4.6028 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5751 -3.9298 1.5657 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0761 -5.6152 0.5490 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6675 -1.1578 -1.4879 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9848 -3.2420 -3.5766 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8818 -5.1724 -2.4820 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8238 -0.2828 -1.0458 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4935 1.0803 -0.5900 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5573 0.6711 6.6532 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8021 2.7298 2.7437 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1784 2.6586 -2.4195 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2847 4.3699 -3.8544 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2763 5.1171 -2.2327 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5926 7.7367 -3.0682 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9524 7.2370 -4.2594 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8609 2.2219 -2.7616 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0285 1.6951 -3.8751 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1145 -2.6894 -0.0765 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8735 3.8839 2.1846 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4529 -1.5397 2.1306 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9758 -5.4077 -2.8375 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0856 -7.2791 0.0472 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 23 24 1 0 24 25 2 0 25 26 1 0 26 27 2 0 27 28 1 0 28 29 1 0 29 30 1 6 30 31 2 0 31 32 1 0 32 33 2 0 33 34 1 0 34 35 2 0 34 36 1 0 33 37 1 0 29 38 1 0 38 39 1 0 29 40 1 0 25 41 1 0 23 42 1 0 20 43 2 0 43 44 1 0 44 45 1 0 45 46 1 6 46 47 2 0 47 48 1 0 48 49 2 0 49 50 1 0 50 51 2 0 50 52 1 0 49 53 1 0 45 54 1 0 54 55 1 0 45 56 1 0 17 57 1 0 14 58 2 0 58 59 1 0 11 60 1 0 8 61 1 0 4 62 1 0 3 63 1 0 6 1 1 0 59 7 1 0 58 10 1 0 56 13 1 0 54 15 1 0 43 16 1 0 51 46 1 0 40 19 1 0 38 21 1 0 27 22 1 0 35 30 1 0 1 64 1 0 2 65 1 0 5 66 1 0 7 67 1 1 8 68 1 6 9 69 1 0 9 70 1 0 12 71 1 0 15 72 1 6 18 73 1 0 21 74 1 6 24 75 1 0 26 76 1 0 31 77 1 0 32 78 1 0 35 79 1 0 36 80 1 0 37 81 1 0 38 82 1 6 39 83 1 0 41 84 1 0 42 85 1 0 47 86 1 0 48 87 1 0 51 88 1 0 52 89 1 0 53 90 1 0 54 91 1 6 55 92 1 0 57 93 1 0 60 94 1 0 61 95 1 0 62 96 1 0 63 97 1 0 M END

Standard InCHIKey	PGKGIQLKUPNZFG-KYHWDRKFSA-N
Standard InCHI	InChI=1S/C45H34O18/c46-18-10-27(54)33-30(11-18)60-44(16-2-5-21(48)25(52)8-16)42(57)37(33)36-32(61-44)14-28(55)34-38-35-31(62-45(43(38)58,63-41(34)36)17-3-6-22(49)26(53)9-17)13-23(50)19-12-29(56)39(59-40(19)35)15-1-4-20(47)24(51)7-15/h1-11,13-14,29,37-39,42-43,46-58H,12H2/t29-,37+,38-,39+,42+,43-,44-,45-/m1/s1
SMILES	c1cc(c(cc1[C@H]1[C@@H](Cc2c(cc3c([C@H]4c5c(cc6c([C@@H]7c8c(cc(cc8O[C@@](c8ccc(c(c8)O)O)([C@H]7O)O6)O)O)c5O[C@](c5ccc(c(c5)O)O)([C@@H]4O)O3)O)c2O1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	862.17	Volume:	803.523 ? Van der Waals volume.
Dense:	1.073	LogP:	1.747 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.755 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.861 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	3.0	Rigid Bonds:	57.0
TPSA:	309.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	13.0	Rings:	11.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.112	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.705	Fsp³:	0.2
MCE-18:	226.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	1	PAINS Alert:	1
Colloidal aggregators:	0.928	Fluc inhibitor:	0.039 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.737 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.847 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.575	Promiscuous compounds:	0.157

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.623	MDCK Permeability:	-4.76
Pgp-inhibitor:	0.0	Pgp-substrate:	0.065
PAMPA:	0.007 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	1.0	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.975
Plasma Protein Binding (PPB):	91.845%	Volume Distribution (VD):	0.276
Fu:	10.468% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.001
BSEP inhibitor:	0.02

ADMET: Metabolism

CYP1A2-inhibitor:	0.829	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.195	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

7.62

Half-life (T1/2):

6.3

ADMET: Toxicity

hERG Blockers:	0.084	hERG Blockers (10um):	0.961
Human Hepatotoxicity (H-HT):	0.982	Drug-induced Liver Injury (DILI):	0.924
AMES Toxicity:	0.678	Rat Oral Acute Toxicity:	0.976
Maximum Recommended Daily Dose:	1.0	Skin Sensitization:	1.0
Carcinogencity:	0.003	Eye Corrosion:	0.0
Eye Irritation:	0.047	Respiratory Toxicity:	0.988
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.998
Hematotoxicity:	0.005	Drug-induced Nephrotoxicity:	0.421
Genotoxicity:	0.995	RPMI-8226 Immunitoxicity:	0.185
A549 Cytotoxicity:	1.0	Hek293 Cytotoxicity:	0.999
BCF:	1.359 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.367 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.925 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.19 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO41077	Xanthoceras sorbifolia Bunge	Strain	Sapindaceae	Eukaryota	Leaves	n.a.	n.a.	PMID[27623545]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	4
IC50	1

Activity Type	# Activity
Non-molecular	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	97.35	%	PMID[27623545]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	94.36	%	PMID[27623545]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	100000.0	nM	PMID[27623545]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	104.48	%	PMID[27623545]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	112.33	%	PMID[27623545]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC478616 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27363
0.1-0.2	20618
0.2-0.3	1652
0.3-0.4	109
0.4-0.5	44
0.5-0.6	32
0.6-0.7	16
0.7-0.8	0
0.8-0.85	7
0.85-0.9	4
0.9-0.95	4
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC478339
0.9394	High Similarity	NPC272552
0.9394	High Similarity	NPC226108
0.9394	High Similarity	NPC322899
0.9143	High Similarity	NPC471404
0.8841	High Similarity	NPC44192
0.8696	High Similarity	NPC46283
0.8696	High Similarity	NPC469944
0.8696	High Similarity	NPC134911
0.8421	Intermediate Similarity	NPC478337
0.8421	Intermediate Similarity	NPC478338
0.8378	Intermediate Similarity	NPC147743
0.8378	Intermediate Similarity	NPC4809
0.8378	Intermediate Similarity	NPC73517
0.8158	Intermediate Similarity	NPC86630
0.8052	Intermediate Similarity	NPC78074
0.7901	Intermediate Similarity	NPC478617
0.7857	Intermediate Similarity	NPC155564
0.7821	Intermediate Similarity	NPC478340
0.7654	Intermediate Similarity	NPC159526
0.7595	Intermediate Similarity	NPC106601
0.7595	Intermediate Similarity	NPC151474
0.75	Intermediate Similarity	NPC212614
0.75	Intermediate Similarity	NPC205613
0.6628	Remote Similarity	NPC484331
0.6552	Remote Similarity	NPC12326
0.6351	Remote Similarity	NPC58190
0.6351	Remote Similarity	NPC108811
0.6351	Remote Similarity	NPC170103
0.6351	Remote Similarity	NPC236202
0.6351	Remote Similarity	NPC262911
0.6351	Remote Similarity	NPC202742
0.6292	Remote Similarity	NPC484330
0.6267	Remote Similarity	NPC246202
0.6267	Remote Similarity	NPC224161
0.6267	Remote Similarity	NPC46335
0.6267	Remote Similarity	NPC279406
0.6267	Remote Similarity	NPC486519
0.6173	Remote Similarity	NPC20050
0.6044	Remote Similarity	NPC185231
0.5904	Remote Similarity	NPC306267
0.5875	Remote Similarity	NPC226809
0.5732	Remote Similarity	NPC278548
0.5641	Remote Similarity	NPC294558
0.5641	Remote Similarity	NPC18185
0.5641	Remote Similarity	NPC263940
0.55	Remote Similarity	NPC313116
0.55	Remote Similarity	NPC603340
0.5465	Remote Similarity	NPC135021
0.5443	Remote Similarity	NPC20757
0.5443	Remote Similarity	NPC227516
0.5429	Remote Similarity	NPC261619
0.5429	Remote Similarity	NPC61477
0.5429	Remote Similarity	NPC78770
0.5429	Remote Similarity	NPC219876
0.5429	Remote Similarity	NPC126029
0.5429	Remote Similarity	NPC15658
0.5366	Remote Similarity	NPC70409
0.5366	Remote Similarity	NPC204770
0.5366	Remote Similarity	NPC600551
0.5366	Remote Similarity	NPC601980
0.5366	Remote Similarity	NPC602065
0.5366	Remote Similarity	NPC611024
0.5357	Remote Similarity	NPC302549
0.5256	Remote Similarity	NPC96576
0.5238	Remote Similarity	NPC600630
0.5238	Remote Similarity	NPC607896
0.5238	Remote Similarity	NPC611369
0.5185	Remote Similarity	NPC184245
0.5185	Remote Similarity	NPC187801
0.5185	Remote Similarity	NPC610920
0.5067	Remote Similarity	NPC178054

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC478616 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5745
0.1-0.2	3379
0.2-0.3	21
0.3-0.4	3
0.4-0.5	0
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5429	Remote Similarity	NPD1612	Clinical (unspecified phase)
0.5429	Remote Similarity	NPD1613	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data