Natural Product: NPC331672| Natural Product ID | NPC331672 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| CGIGDMFJXJATDK-UHFFFAOYSA-N |
| IUPAC Name | n.a. |
| Synonyms | |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | n.a. |
| PubChem CID |
3715 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | CGIGDMFJXJATDK-UHFFFAOYSA-N |
| Standard InCHI | InChI=1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
| SMILES | Cc1c(CC(=O)O)c2cc(ccc2n1C(=O)c1ccc(cc1)Cl)OC |
  Calculated Properties| Molecular Weight:   | 357.08 | Volume:   | 349.151 Van der Waals volume.
|
| Dense:   | 1.023 | LogP:   | 3.091 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.668 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -5.801 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 5.0 | Rigid Bonds:   | 18.0 |
| TPSA:   | 68.53 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 5.0 |
| H-Bond Donor:   | 1.0 | Rings:   | 3.0 |
| Heavy Atoms:   | 6.0 |
| QED Drug-Likeness Score:   | 0.768 | GASA:   | 0.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 2.078 | Fsp3:   | 0.158 |
| MCE-18:   | 19.0 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Rejected |
| Pfizer Rule:   | Accepted | GSK Rule:   | Rejected |
| Golden Triangle Rule:   | Rejected | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.35 | Fluc inhibitor:   | 0.243 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.327 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.467 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.034 | Promiscuous compounds:   | 0.806 |
| Caco-2 Permeability:   | -4.682 | MDCK Permeability:   | -4.628 |
| Pgp-inhibitor:   | 0.001 | Pgp-substrate:   | 0.001 |
| PAMPA:   |
0.739 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.0 |
| 20% Bioavailability (F20%):   | 0.0 | 30% Bioavailability (F30%):   | 0.0 |
| 50% Bioavailability (F50%):   | 0.008 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.058 | MRP1:   | 0.989 |
| Plasma Protein Binding (PPB):   | 98.442% | Volume Distribution (VD):   | -0.935 |
| Fu: |
1.121% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.814 |
| OATP1B3 inhibitor:   | 0.993 | BCRP inhibitor:   | 0.0 |
| BSEP inhibitor:   | 0.989 |
| CYP1A2-inhibitor:   | 0.276 | CYP1A2-substrate:   | 0.054 |
| CYP2C19-inhibitor:   | 0.999 | CYP2C19-substrate:   | 0.981 |
| CYP2C9-inhibitor:   | 0.999 | CYP2C9-substrate:   | 0.014 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.023 |
| CYP3A4-inhibitor:   | 0.062 | CYP3A4-substrate:   | 0.001 |
| CYP2B6-substrate:   | 0.001 | CYP2C8-inhibitor:   | 0.919 |
| HLM stability:   |
0.131 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 0.845 | Half-life (T1/2):   | 1.484 |
| hERG Blockers:   | 0.239 | hERG Blockers (10um):   | 0.052 |
| Human Hepatotoxicity (H-HT):   | 0.881 | Drug-induced Liver Injury (DILI):   | 0.998 |
| AMES Toxicity:   | 0.274 | Rat Oral Acute Toxicity:   | 0.954 |
| Maximum Recommended Daily Dose:   | 0.684 | Skin Sensitization:   | 0.755 |
| Carcinogencity:   | 0.748 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.019 | Respiratory Toxicity:   | 0.925 |
| Drug-induced Neurotoxicity:   | 0.469 | Ototoxicity:   | 0.965 |
| Hematotoxicity:   | 0.822 | Drug-induced Nephrotoxicity:   | 0.962 |
| Genotoxicity:   | 0.997 | RPMI-8226 Immunitoxicity:   | 0.049 |
| A549 Cytotoxicity:   | 0.002 | Hek293 Cytotoxicity:   | 0.093 |
| BCF:   |
0.965 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.698 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.782 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.455 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | rhizome | n.a. | DOI[10.1021/np100392m] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | cone | n.a. |
PMID[10336650] |
| NPO25807 | Psacalium decompositum | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[10479309] |
| NPO6473.1 | Perilla frutescens var. acuta | Strain | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10757731] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | seeds | Mengha, Yunnan Province, China | 1991-Aug |
PMID[11277741] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | seeds | n.a. | n.a. |
PMID[11325233] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | Entire plants | the surroundings of Uppsala, Sweden | 1998-SEP |
PMID[11421736] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | Whole Plant | the surroundings of Uppsala, Sweden | 1998-SEP |
PMID[11421736] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[11430002] |
| NPO27387 | Erythrina addisoniae | Species | Fabaceae | Eukaryota | Stems; Barks | n.a. | n.a. |
PMID[12828487] |
| NPO23495 | Millettia griffoniana | Species | Fabaceae | Eukaryota | Root barks | n.a. | n.a. |
PMID[14510620] |
| NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | Leaves | n.a. | n.a. |
PMID[15043416] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[15679315] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[16252923] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | roots | n.a. | n.a. |
PMID[16792421] |
| NPO27387 | Erythrina addisoniae | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17517504] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17580910] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | cone | n.a. |
PMID[17624889] |
| NPO27387 | Erythrina addisoniae | Species | Fabaceae | Eukaryota | Barks | n.a. | n.a. |
PMID[18302333] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18611049] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18768384] |
| NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19299148] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19476340] |
| NPO40891 | Natural safrole producing species (Unclassified) | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[19699644] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | Rhizomes | n.a. | n.a. |
PMID[20879743] |
| NPO27387 | Erythrina addisoniae | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[20934335] |
| NPO4896 | Alternaria brassicicola | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21082806] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | whole plant | n.a. |
PMID[21534540] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | whole plants | Panshi, Jilin Province, China | 2009-JUN |
PMID[21534540] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21807513] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21912858] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21954931] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | cone | n.a. |
PMID[22111577] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | flower | n.a. |
PMID[22166201] |
| NPO2251 | Sphagneticola trilobata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[22574649] |
| NPO27387 | Erythrina addisoniae | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23022281] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23270478] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[23790907] |
| NPO32460 | Gentianella azurea | Species | Gentianaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24806310] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | n.a. | seed | n.a. |
PMID[24895551] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[24948953] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25396337] |
| NPO32460 | Gentianella azurea | Species | Gentianaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25442320] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25453801] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25564559] |
| NPO29795 | Syringa pinnatifolia | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25769897] |
| NPO40889 | Mucor polymorphosporus | Species | Mucoraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25821895] |
| NPO6246 | Ervatamia hainanensis | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26024020] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26702644] |
| NPO6381 | Dendrobium crepidatum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[26710212] |
| NPO2251 | Sphagneticola trilobata | Species | Asteraceae | Eukaryota | n.a. | whole plant | n.a. |
PMID[26946839] |
| NPO40695 | Penicillium purpurogenum MHZ 111 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27120704] |
| NPO9124 | Inula japonica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27276091] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27295506] |
| NPO5084 | Melampodium perfoliatum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27787995] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[28383891] |
| NPO40162 | Hoya kerrii | Species | Apocynaceae | Eukaryota | Stems | n.a. | n.a. |
PMID[28561586] |
| NPO40981 | Penicillium chrysogenum MT-12 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28960979] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29154541] |
| NPO27812 | Callistemon rigidus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29261312] |
| NPO29795 | Syringa pinnatifolia | Species | Oleaceae | Eukaryota | Peeled Stems | n.a. | n.a. |
PMID[30024153] |
| NPO40204 | Millettia extensa | Species | Fabaceae | Eukaryota | Stems | n.a. | n.a. |
PMID[30106294] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30384263] |
| NPO40575 | Trichoderma reesei 4670 | Strain | Hypocreaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30920218] |
| NPO40651 | Aspergillus sp. ZJ-68 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31365251] |
| NPO40204 | Millettia extensa | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31403786] |
| NPO18983 | Cleidion brevipetiolatum | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31419126] |
| NPO40046 | Bipolaris sp. | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31573805] |
| NPO4896 | Alternaria brassicicola | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32520548] |
| NPO25807 | Psacalium decompositum | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[32672964] |
| NPO40330 | Rydingia persica | Species | Lamiaceae | Eukaryota | Aerial Parts | n.a. | n.a. |
PMID[32786876] |
| NPO41015 | Ballota hispanica | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32818604] |
| NPO2251 | Sphagneticola trilobata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[33306388] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37631012] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38354824] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[39199155] |
| NPO12485 | Ceiba pentandra | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8133294] |
| NPO41075 | Tanacetum microphyllum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8377020] |
| NPO17416 | Santolina oblongifolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[8988605] |
| NPO41075 | Tanacetum microphyllum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9051913] |
| NPO12485 | Ceiba pentandra | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9461647] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9461664] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9784154] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6473.1 | Perilla frutescens var. acuta | Strain | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO27387 | Erythrina addisoniae | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO23495 | Millettia griffoniana | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40162 | Hoya kerrii | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18983 | Cleidion brevipetiolatum | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25807 | Psacalium decompositum | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO29795 | Syringa pinnatifolia | Species | Oleaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40046 | Bipolaris sp. | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO41075 | Tanacetum microphyllum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5084 | Melampodium perfoliatum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9124 | Inula japonica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO17416 | Santolina oblongifolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4896 | Alternaria brassicicola | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO12485 | Ceiba pentandra | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40575 | Trichoderma reesei 4670 | Strain | Hypocreaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO27812 | Callistemon rigidus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40695 | Penicillium purpurogenum MHZ 111 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40981 | Penicillium chrysogenum MT-12 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40651 | Aspergillus sp. ZJ-68 | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO40891 | Natural safrole producing species (Unclassified) | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO32460 | Gentianella azurea | Species | Gentianaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6473.1 | Perilla frutescens var. acuta | Strain | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO9124 | Inula japonica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9124 | Inula japonica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO6473.1 | Perilla frutescens var. acuta | Strain | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO6246 | Ervatamia hainanensis | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO23495 | Millettia griffoniana | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO12485 | Ceiba pentandra | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9124 | Inula japonica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO9124 | Inula japonica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO13879 | Humulus lupulus | Species | Cannabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18983 | Cleidion brevipetiolatum | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6381 | Dendrobium crepidatum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6836 | Alpinia blepharocalyx | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25807 | Psacalium decompositum | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2251 | Sphagneticola trilobata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5084 | Melampodium perfoliatum | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27387 | Erythrina addisoniae | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO21324 | Plantago major | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO25254 | Vernonia colorata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1680 | Physalis angulata | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17416 | Santolina oblongifolia | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22741 | Curcuma kwangsiensis | Species | Zingiberaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO16205 | Euphorbia fischeriana | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9124 | Inula japonica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO23495 | Millettia griffoniana | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27812 | Callistemon rigidus | Species | Myrtaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12485 | Ceiba pentandra | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4896 | Alternaria brassicicola | Species | Pleosporaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 5.9 | nM | PMID[11906281] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 3.0 | nM | PMID[11906281] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 630.0 | nM | PMID[11906281] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 230.0 | nM | PMID[11906281] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 49.0 | nM | DOI[10.1016/S0960-894X(96)00501-X] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 39.0 | nM | DOI[10.1016/S0960-894X(96)00501-X] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 730.0 | nM | PMID[14980665] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 110.0 | nM | PMID[14980665] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[14980665] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 190.0 | nM | PMID[14980665] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 2.0 | nM | PMID[12877584] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 9.0 | nM | PMID[12877584] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[12877584] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 67.9 | % | PMID[12877584] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 640.0 | nM | PMID[12877584] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2400.0 | nM | PMID[11738574] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 150.0 | nM | PMID[11738574] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[10956225] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[10956225] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | > | 100000.0 | nM | DOI[10.1016/S0960-894X(00)80396-0] |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[3930740] |
| NPT1569 | Individual protein | Chymotrypsin C | Homo sapiens | Inhibition | < | 5.0 | % | PMID[14521410] |
| NPT2683 | Individual protein | Malate dehydrogenase cytoplasmic | Homo sapiens | Inhibition | = | 7.0 | % | PMID[14521410] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 5800.0 | nM | PMID[10197959] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 12.2 | nM | PMID[10197959] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 8.2 | nM | PMID[10197959] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[7966148] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[7966148] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[9171873] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[9171873] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Activity | = | 63.8 | (ng of TXB2) (mg of protein)-1 | PMID[10579834] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | > | 250000.0 | nM | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[10397507] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 160.0 | nM | PMID[10397507] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | < | 200.0 | nM | PMID[10397507] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 410.0 | nM | PMID[10937738] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 190.0 | nM | PMID[10937738] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | > | 100000.0 | nM | DOI[10.1016/S0960-894X(00)80450-3] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[7473585] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[7473585] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 750.0 | nM | PMID[10956194] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 50.0 | nM | PMID[10956194] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[2104936] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 310.0 | nM | PMID[7562922] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 180000.0 | nM | PMID[7562922] |
| NPT1287 | Individual protein | Cannabinoid CB2 receptor | Homo sapiens | Ki | > | 20000.0 | nM | DOI[10.1016/0960-894X(96)00426-X] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | Ki | > | 20000.0 | nM | DOI[10.1016/0960-894X(96)00426-X] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[11392547] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 12400.0 | nM | PMID[11392547] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 900.0 | nM | PMID[8627608] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[8627608] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 18.0 | nM | DOI[10.1016/S0960-894X(96)00582-3] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 26.0 | nM | DOI[10.1016/S0960-894X(96)00582-3] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 460.0 | nM | DOI[10.1016/S0960-894X(96)00582-3] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 5800.0 | nM | PMID[10197960] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 12.2 | nM | PMID[10197960] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 8.2 | nM | PMID[10197960] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[10576685] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[10576685] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[10576685] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 1700.0 | nM | PMID[9484493] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 2400.0 | nM | PMID[9484493] |
| NPT2945 | Individual protein | Phospholipase A2 group 1B | Sus scrofa | IC50 | > | 1000000.0 | nM | PMID[1507204] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | > | 25000.0 | nM | PMID[1507204] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | DOI[10.1016/0960-894X(95)00131-C] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 900.0 | nM | DOI[10.1016/0960-894X(95)00131-C] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | > | 100000.0 | nM | PMID[2115586] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | = | 3700000.0 | nM | PMID[8254620] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2380.0 | nM | PMID[11906292] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 150.0 | nM | PMID[11906292] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[11462976] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 82.3 | % | PMID[11462976] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[11462976] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 67.9 | % | PMID[11462976] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 3.0 | nM | PMID[11462976] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 9.0 | nM | PMID[11462976] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[10576684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 18.0 | nM | PMID[10576684] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[10576684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[10576684] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | = | 12000.0 | nM | PMID[9057869] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 12.0 | nM | PMID[9057869] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 560.0 | nM | PMID[9057869] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 100.0 | % | PMID[12954051] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 97.0 | % | PMID[12954051] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 67.0 | nM | PMID[12954051] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 7800.0 | nM | PMID[12954051] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | >> | 20000.0 | nM | PMID[2319562] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | ID50 | > | 25.0 | uM | PMID[1433212] |
| NPT277 | Individual protein | Caspase-1 | Homo sapiens | ID50 | > | 30.0 | uM | PMID[1433212] |
| NPT2945 | Individual protein | Phospholipase A2 group 1B | Sus scrofa | IC50 | = | 250000.0 | nM | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | IC50 | > | 250000.0 | nM | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[10406640] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[10406640] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 30.0 | nM | PMID[10406640] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[10406640] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 400.0 | nM | PMID[10465547] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[10465547] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 26.0 | nM | PMID[9873621] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[9873621] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[9873621] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 18.0 | nM | DOI[10.1016/S0960-894X(96)00580-X] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 26.0 | nM | DOI[10.1016/S0960-894X(96)00580-X] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 50.0 | nM | PMID[11965379] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 250.0 | nM | PMID[10649977] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 220.0 | nM | PMID[10649977] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 100.0 | % | PMID[15026050] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 97.0 | % | PMID[15026050] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 67.0 | nM | PMID[15026050] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 7810.0 | nM | PMID[15026050] |
| NPT300 | Individual protein | Thromboxane-A synthase | Homo sapiens | IC50 | = | 100.0 | nM | PMID[2547071] |
| NPT1011 | Individual protein | Prostanoid EP1 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[15357992] |
| NPT1012 | Individual protein | Prostanoid EP2 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[15357992] |
| NPT1013 | Individual protein | Prostanoid EP3 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[15357992] |
| NPT1014 | Individual protein | Prostanoid EP4 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[15357992] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | < | 50.0 | % | PMID[15369391] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[15943479] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 5700.0 | nM | PMID[15943479] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 56.0 | % | PMID[16190777] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[16190777] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 340.0 | nM | PMID[16814546] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 5.0 | nM | PMID[16814546] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 36.0 | nM | PMID[16814546] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 4.0 | nM | PMID[16814546] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 90.0 | % | PMID[17079150] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 90.0 | % | PMID[17079150] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 30.0 | nM | PMID[17079150] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 7700.0 | nM | PMID[17079150] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 36.0 | nM | PMID[17378609] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[17509888] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 5700.0 | nM | PMID[17509888] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 5600.0 | nM | PMID[17346963] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 77100.0 | nM | PMID[17346963] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 700.0 | nM | PMID[17994684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[17994684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 10.0 | % | PMID[17994684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 33.0 | % | PMID[17994684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 59.0 | % | PMID[17994684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 92.0 | % | PMID[17994684] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 94.0 | % | PMID[17994684] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 87.0 | % | PMID[17994684] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 74.0 | % | PMID[17994684] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 31.0 | % | PMID[17994684] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 8.0 | % | PMID[17994684] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 6.0 | nM | PMID[17341061] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[17341061] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 97.0 | % | PMID[18061444] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 750.0 | nM | PMID[18061444] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 100.0 | % | PMID[18061444] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 50.0 | nM | PMID[18061444] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Ki | = | 7900.0 | nM | PMID[17434872] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 89.0 | % | PMID[18363350] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 85.0 | % | PMID[18363350] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[18363350] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 11000.0 | nM | PMID[18363350] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 0.2 | % | PMID[10757731] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 1500.0 | nM | PMID[10757731] |
| NPT1665 | Individual protein | Cyclooxygenase-1 | Bos taurus | IC50 | = | 1300.0 | nM | PMID[11421736] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2630.0 | nM | PMID[17532544] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[17532544] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 0.2 | ug.mL-1 | PMID[19303782] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 0.27 | ug.mL-1 | PMID[19303782] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 91.44 | % | PMID[19084295] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 71.89 | % | PMID[19084295] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 537.0 | nM | PMID[19084295] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 69.0 | nM | PMID[19084295] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | > | 30.0 | % | PMID[12444669] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 3900.0 | nM | PMID[12444669] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[16038536] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 3900.0 | nM | PMID[16038536] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 76.0 | % | PMID[16038536] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[16038536] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 165000.0 | nM | PMID[9784154] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 1400.0 | nM | PMID[9784154] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 71.0 | % | PMID[16038536] |
| NPT1665 | Individual protein | Cyclooxygenase-1 | Bos taurus | IC50 | = | 3300.0 | nM | PMID[9461646] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 1710000.0 | nM | PMID[9461646] |
| NPT1665 | Individual protein | Cyclooxygenase-1 | Bos taurus | IC50 | = | 1400.0 | nM | PMID[9461646] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 164000.0 | nM | PMID[9461646] |
| NPT1665 | Individual protein | Cyclooxygenase-1 | Bos taurus | IC50 | = | 1100.0 | nM | PMID[9461647] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[9544564] |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | IC50 | = | 12000.0 | nM | PMID[18707884] |
| NPT183 | Individual protein | Arachidonate 5-lipoxygenase | Rattus norvegicus | Inhibition | = | 0.0 | % | PMID[10514305] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 1400.0 | nM | PMID[16792405] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 5800.0 | nM | PMID[16792405] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 600.0 | nM | PMID[15679320] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[15679320] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Activity | = | 19.0 | % | PMID[19053751] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[19200742] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | Inhibition | = | 90.0 | % | PMID[19200742] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 28.2 | nM | PMID[19056264] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[19419861] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 5700.0 | nM | PMID[19419861] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[19427206] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 250.0 | nM | PMID[19427206] |
| NPT102 | Individual protein | Interleukin-8 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[19560921] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 900.0 | nM | PMID[19481465] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 40.0 | nM | PMID[19540763] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[19540763] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 95.0 | % | PMID[19884011] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 95.0 | % | PMID[19884011] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 95.0 | % | PMID[19884011] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 50.0 | nM | PMID[20129783] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 1090.0 | nM | PMID[20236826] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 78.0 | % | PMID[20207453] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 29.6 | % | PMID[20207453] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[20451397] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[20451397] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[20451397] |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | Ratio | = | 4.1 | n.a. | PMID[20598550] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 6.0 | nM | PMID[20503989] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[20503989] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 537.0 | nM | PMID[20692174] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 69.0 | nM | PMID[20692174] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 71.89 | % | PMID[20692174] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 89.94 | % | PMID[20692174] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 670.0 | nM | PMID[20576329] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[20576329] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 5700.0 | nM | PMID[20727750] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2630.0 | nM | PMID[20970223] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[20970223] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 35200.0 | nM | PMID[20974503] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 90.0 | % | PMID[21144750] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 86.0 | % | PMID[21144750] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 150.0 | nM | PMID[21144750] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 10000.0 | nM | PMID[21144750] |
| NPT1566 | Individual protein | Glyoxalase I | Homo sapiens | Ki | = | 24000.0 | nM | PMID[21237663] |
| NPT1566 | Individual protein | Glyoxalase I | Homo sapiens | Ki | = | 18100.0 | nM | PMID[21237663] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 98.23 | % | PMID[21345672] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 50.99 | % | PMID[21345672] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 180.0 | nM | PMID[21345672] |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | IC50 | = | 12600.0 | nM | PMID[21354800] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 85.0 | % | PMID[21261296] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 65.0 | % | PMID[21261296] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 130.0 | nM | PMID[21280601] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 6900.0 | nM | PMID[21280601] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 84.0 | % | PMID[21434686] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 17000.0 | nM | PMID[21434686] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | Inhibition | = | 63.2 | % | PMID[21381754] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | = | 48890.0 | nM | PMID[21381754] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | = | 23470.0 | nM | PMID[21381754] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1900.0 | nM | PMID[21319773] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 300.0 | nM | PMID[21319773] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 50.0 | nM | PMID[21524587] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 750.0 | nM | PMID[21524587] |
| NPT1566 | Individual protein | Glyoxalase I | Homo sapiens | Ki | = | 24400.0 | nM | PMID[21689932] |
| NPT1011 | Individual protein | Prostanoid EP1 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[21737285] |
| NPT1012 | Individual protein | Prostanoid EP2 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[21737285] |
| NPT1013 | Individual protein | Prostanoid EP3 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[21737285] |
| NPT1014 | Individual protein | Prostanoid EP4 receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[21737285] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 33.8 | nM | PMID[21752640] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[21873070] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 6.0 | nM | PMID[21873070] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[21868137] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 81.0 | % | PMID[24900317] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 110.0 | % | PMID[24900317] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 10.0 | nM | PMID[24900317] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[24900317] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 89.0 | % | PMID[24900317] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 83.0 | % | PMID[24900317] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 18000.0 | nM | PMID[24900317] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 20000.0 | nM | PMID[24900317] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 53.4 | % | PMID[22356737] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 49.7 | % | PMID[22356737] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 130.0 | nM | PMID[22361134] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 6900.0 | nM | PMID[22361134] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[22148253] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 5700.0 | nM | PMID[22148253] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 56.0 | % | PMID[22450132] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[22450132] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 4100.0 | nM | PMID[22506594] |
| NPT3506 | Individual protein | Aldo-keto reductase family 1 member C4 | Homo sapiens | IC50 | = | 54000.0 | nM | PMID[22506594] |
| NPT3505 | Individual protein | Aldo-keto reductase family 1 member C1 | Homo sapiens | IC50 | = | 130000.0 | nM | PMID[22506594] |
| NPT3507 | Individual protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | = | 75000.0 | nM | PMID[22506594] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | = | 20000.0 | nM | PMID[22633833] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 46.0 | % | PMID[22796043] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 78.0 | % | PMID[22796043] |
| NPT1665 | Individual protein | Cyclooxygenase-1 | Bos taurus | IC50 | = | 4.1 | nM | PMID[22749420] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[22749420] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 50.0 | nM | PMID[22263894] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 750.0 | nM | PMID[22263894] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 63.87 | % | PMID[22901385] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 28.43 | % | PMID[22901385] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | Activity | = | 11.0 | % | PMID[12835412] |
| NPT305 | Individual protein | Solute carrier organic anion transporter family member 1A4 | Rattus norvegicus | Activity | = | 14.3 | % | PMID[11883641] |
| NPT2850 | Individual protein | Multidrug resistance associated protein | Homo sapiens | Activity | = | 350.0 | % | PMID[16460798] |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | Activity | = | 56.0 | % | PMID[12835412] |
| NPT1472 | Individual protein | Solute carrier family 22 member 11 | Homo sapiens | Activity | = | 60.9 | % | PMID[12130730] |
| NPT1736 | Individual protein | ATP-binding cassette sub-family C member 11 | Homo sapiens | Activity | = | 64.0 | % | PMID[15537867] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | Activity | = | 74.0 | % | PMID[14643890] |
| NPT2850 | Individual protein | Multidrug resistance associated protein | Homo sapiens | Activity | = | 1.8 | fold | PMID[16460798] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 56.0 | % | PMID[22959205] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[22959205] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 680.0 | nM | PMID[23047224] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 18300.0 | nM | PMID[23047224] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 2100.0 | nM | PMID[21800856] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 6.7 | nM | PMID[23010270] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 48.0 | nM | PMID[23010270] |
| NPT1594 | Individual protein | Multidrug resistance-associated protein 1 | Homo sapiens | FC | = | 2.0 | n.a. | PMID[22916727] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 20000.0 | nM | PMID[22916727] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 18000.0 | nM | PMID[22916727] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 120.0 | nM | PMID[22916727] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 10.0 | nM | PMID[22916727] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 44.0 | nM | PMID[22652053] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 2300.0 | nM | PMID[22877157] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 730.0 | nM | PMID[22877157] |
| NPT3506 | Individual protein | Aldo-keto reductase family 1 member C4 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[22877157] |
| NPT3507 | Individual protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[22877157] |
| NPT3505 | Individual protein | Aldo-keto reductase family 1 member C1 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[22877157] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Activity | = | 23.3 | % | PMID[22992107] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1170.0 | nM | DOI[10.1007/s00044-011-9870-3] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | DOI[10.1007/s00044-011-9870-3] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Kd | = | 92.0 | nM | DOI[10.1007/s00044-011-9870-3] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Kd | = | 253.0 | nM | DOI[10.1007/s00044-011-9870-3] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 76.0 | % | DOI[10.1007/s00044-011-9747-5] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 71.0 | % | DOI[10.1007/s00044-011-9747-5] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 85.5 | % | DOI[10.1007/s00044-011-9585-5] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 63.4 | % | DOI[10.1007/s00044-011-9585-5] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 25703957.83 | nM | DOI[10.1007/s00044-004-0039-1] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 43.33 | % | PMID[23290048] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 70.07 | % | PMID[23290048] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | EC50 | = | 0.14 | nM | PMID[23432095] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 50.0 | nM | PMID[23432095] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[23432095] |
| NPT3507 | Individual protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | = | 36530.0 | nM | PMID[23432095] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[23432095] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 43.33 | % | PMID[23357629] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 70.07 | % | PMID[23357629] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 70.0 | % | PMID[23651359] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | >= | 90.0 | % | PMID[23651359] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Ki | = | 1500.0 | nM | PMID[23687559] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 180.0 | nM | PMID[23687559] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 27.0 | nM | PMID[23687559] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 480.0 | nM | PMID[23693150] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 63.0 | nM | PMID[23693150] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 53.4 | % | PMID[23914900] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 98.2 | % | PMID[23914900] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | > | 30000.0 | nM | PMID[23769654] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 180.0 | nM | PMID[23769654] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 51.0 | % | PMID[23769654] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 98.2 | % | PMID[23769654] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 79.0 | % | PMID[24171493] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 77.0 | % | PMID[24171493] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 80.0 | nM | PMID[24332492] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 960.0 | nM | PMID[24332492] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 93.0 | % | PMID[24531199] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 81.0 | % | PMID[24531199] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 4200.0 | nM | PMID[24531199] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 99.0 | nM | PMID[24531199] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 600.0 | nM | PMID[24631895] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 18500.0 | nM | PMID[24631895] |
| NPT1665 | Individual protein | Cyclooxygenase-1 | Bos taurus | Inhibition | = | 100.0 | % | PMID[24568631] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 80.0 | % | PMID[24568631] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 180.0 | nM | PMID[24763362] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | > | 30000.0 | nM | PMID[24763362] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Activity | = | 6.0 | % | PMID[24871899] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Activity | = | 41.3 | % | PMID[24844534] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[24920381] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[24920381] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 5.9 | % | PMID[24920381] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 25.0 | % | PMID[24920381] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 43.0 | % | PMID[24920381] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 9000.0 | nM | PMID[25444084] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 3100.0 | nM | PMID[25444084] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 0.7 | ug.mL-1 | PMID[25462246] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 10.0 | ug.mL-1 | PMID[25462246] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 73.5 | % | PMID[25016374] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 87.0 | % | PMID[25016374] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 80.0 | nM | PMID[24631898] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 960.0 | nM | PMID[24631898] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 210.0 | nM | PMID[24938495] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 3240.0 | nM | PMID[24938495] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 98.23 | % | PMID[25219899] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 180.0 | nM | PMID[25219899] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 50.99 | % | PMID[25219899] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 650.0 | nM | PMID[25868745] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 29600.0 | nM | PMID[25868745] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | = | 4500.0 | nM | PMID[25881822] |
| NPT208 | Individual protein | Cytochrome P450 1A2 | Homo sapiens | Inhibition | < | 10.0 | % | PMID[21467212] |
| NPT212 | Individual protein | Cytochrome P450 2C9 | Homo sapiens | Inhibition | < | 10.0 | % | PMID[21467212] |
| NPT213 | Individual protein | Cytochrome P450 2C19 | Homo sapiens | Inhibition | < | 10.0 | % | PMID[21467212] |
| NPT110 | Individual protein | Cytochrome P450 2D6 | Homo sapiens | Inhibition | < | 10.0 | % | PMID[21467212] |
| NPT109 | Individual protein | Cytochrome P450 3A4 | Homo sapiens | Inhibition | < | 10.0 | % | PMID[21467212] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 80.0 | nM | PMID[25956953] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 960.0 | nM | PMID[25956953] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 12500.0 | nM | PMID[26048794] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[26048794] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 3740.0 | nM | PMID[26117820] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 3930.0 | nM | PMID[26117820] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Ki | = | 9860.0 | nM | PMID[26117820] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 36.9 | % | PMID[26351040] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 43.2 | % | PMID[26351040] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | = | 92.1 | % | PMID[26351040] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 51.7 | % | PMID[26351040] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 69.5 | % | PMID[26351040] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 72.6 | % | PMID[26351040] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 11800.0 | nM | PMID[26455657] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 790.0 | nM | PMID[26455657] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 410.0 | nM | PMID[26487917] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 110.0 | nM | PMID[26487917] |
| NPT285 | Individual protein | Epidermal growth factor receptor erbB1 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[26487917] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 100.0 | % | PMID[27040659] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 100.0 | % | PMID[27040659] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Activity | = | 2.7 | ng/ml | PMID[27019010] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Activity | = | 2.1 | ng/ml | PMID[27019010] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 11070.0 | nM | PMID[27916468] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 710.0 | nM | PMID[27916468] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 7240.0 | nM | PMID[28038322] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 1140.0 | nM | PMID[28038322] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 87.0 | % | PMID[28025003] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 3870.0 | nM | PMID[28089698] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 8130.0 | nM | PMID[28089698] |
| NPT1249 | Individual protein | Canalicular multispecific organic anion transporter 2 | Homo sapiens | IC50 | = | 66000.0 | nM | PMID[23956101] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | IC50 | = | 5800.0 | nM | PMID[23956101] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | < | 20.0 | % | PMID[28453995] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | < | 20.0 | % | PMID[28453995] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 39.0 | nM | PMID[28916158] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 490.0 | nM | PMID[28916158] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[30017112] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2630.0 | nM | PMID[30017112] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 100.0 | % | PMID[28728107] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 80.0 | % | PMID[28728107] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[28881288] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2630.0 | nM | PMID[29031075] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 260.0 | nM | PMID[29031075] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 80.0 | nM | PMID[30095904] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 960.0 | nM | PMID[30095904] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Activity | = | 1.05 | ng/ml | PMID[30095904] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Activity | = | 1.35 | ng/ml | PMID[30095904] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 32.0 | % | PMID[30095904] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 900.0 | nM | PMID[29980364] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[29980364] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 39.0 | nM | PMID[29289887] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 490.0 | nM | PMID[29289887] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 69.52 | % | PMID[30108969] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | Inhibition | = | 84.27 | % | PMID[30108969] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 12160.0 | nM | PMID[30344915] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 35200.0 | nM | PMID[30344915] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 41.0 | nM | PMID[31539778] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 510.0 | nM | PMID[31539778] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 1560.0 | nM | PMID[31655429] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 68450.0 | nM | PMID[31655429] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 84.3 | % | PMID[30469039] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 3670.0 | nM | PMID[30469039] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 39.0 | nM | PMID[30771604] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 490.0 | nM | PMID[30771604] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 610.0 | nM | PMID[30996776] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 100.0 | nM | PMID[30996776] |
| NPT3507 | Individual protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | = | 8970.0 | nM | PMID[30996776] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 7350.0 | nM | PMID[30996776] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 220.0 | nM | PMID[30904755] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 67.72 | nM | PMID[30904755] |
| NPT270 | Individual protein | Nitric oxide synthase, inducible | Mus musculus | IC50 | = | 24890.0 | nM | PMID[30925056] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 960.0 | nM | PMID[31244108] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 80.0 | nM | PMID[31244108] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Activity | = | 0.7 | ng/ml | PMID[31244108] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 489.9 | nM | PMID[31299586] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1466.0 | nM | PMID[31299586] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 490.0 | nM | PMID[30818268] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 39.0 | nM | PMID[30818268] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 80.0 | nM | PMID[31843462] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 960.0 | nM | PMID[31843462] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Activity | = | 0.59 | ng/ml | PMID[31843462] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Activity | = | 0.98 | ng/ml | PMID[31843462] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 40.0 | nM | PMID[32127262] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[32127262] |
| NPT3507 | Individual protein | Aldo-keto reductase family 1 member C2 | Homo sapiens | IC50 | = | 50000.0 | nM | PMID[32463235] |
| NPT3505 | Individual protein | Aldo-keto reductase family 1 member C1 | Homo sapiens | IC50 | = | 96000.0 | nM | PMID[32463235] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 2300.0 | nM | PMID[32463235] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 7260.0 | nM | PMID[32463235] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 750.0 | nM | PMID[31982653] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 920.0 | nM | PMID[31982653] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 51.0 | nM | PMID[33079544] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 630.0 | nM | PMID[27541263] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 11360.0 | nM | PMID[27541263] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 250.0 | nM | PMID[31740050] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 40.0 | nM | PMID[32485532] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 490.0 | nM | PMID[32485532] |
| NPT217 | Individual protein | Adenosine A2a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 45.0 | nM | PMID[35685617] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 82.0 | nM | PMID[34245948] |
| NPT230 | Individual protein | Bradykinin B2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 200.0 | nM | PMID[35134642] |
| NPT299 | Individual protein | Androgen Receptor | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1464 | Individual protein | Phosphodiesterase 4D | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | AC50 | = | 540.3 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 32.89 | % | PMID[38516591] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 59.83 | % | PMID[38516591] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 11360.0 | nM | PMID[32485533] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 87.0 | nM | PMID[35685617] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[36796297] |
| NPT226 | Individual protein | Beta-2 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[32992247] |
| NPT259 | Individual protein | Melanocortin receptor 4 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | = | 60.4 | % | PMID[35134642] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT239 | Individual protein | Cholecystokinin A receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2719 | Individual protein | Voltage-gated L-type calcium channel alpha-1C subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | = | 16845.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 0.14 | nM | PMID[38516587] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 6200.0 | nM | PMID[32485533] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT251 | Individual protein | Histamine H1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT271 | Individual protein | Delta opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[36067929] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | = | 26799.7 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1393.0 | nM | PMID[35931005] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 12.0 | nM | PMID[34245948] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 500.0 | nM | PMID[37182334] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | = | 27881.7 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 960.0 | nM | PMID[34137625] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 200.0 | nM | PMID[32485533] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[33569941] |
| NPT1478 | Individual protein | Vascular endothelial growth factor receptor 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 220.0 | nM | PMID[29656203] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT225 | Individual protein | Beta-1 adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1778 | Individual protein | Serotonin 2a (5-HT2a) receptor | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[36075145] |
| NPT216 | Individual protein | Adenosine A1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1647 | Individual protein | Vasopressin V2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | n.a. | n.a. | % | PMID[35134642] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | = | 35999.8 | nM | PMID[37468498] |
| NPT247 | Individual protein | Endothelin receptor ET-A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | Activity | = | 0.9 | ng/ml | PMID[34137625] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | = | 15799.7 | nM | PMID[37468498] |
| NPT224 | Individual protein | Alpha-2c adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT2879 | Individual protein | Equilibrative nucleoside transporter 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT267 | Individual protein | Neuropeptide Y receptor type 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT272 | Individual protein | Kappa opioid receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT1163 | Individual protein | Glutamate (NMDA) receptor subunit zeta 1 | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT223 | Individual protein | Alpha-2b adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT227 | Individual protein | Beta-3 adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT232 | Individual protein | Cannabinoid CB1 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT325 | Individual protein | Cyclooxygenase-2 | Ovis aries | IC50 | = | 3650.0 | nM | PMID[36325400] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 610.0 | nM | PMID[33569941] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 463.1 | nM | PMID[35931005] |
| NPT248 | Individual protein | Estrogen receptor beta | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | AC50 | = | 34.4 | nM | PMID[37468498] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1814 | Individual protein | Glucagon receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1610.0 | nM | PMID[37182334] |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT243 | Individual protein | Dopamine D2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 290.0 | nM | PMID[36325400] |
| NPT3504 | Individual protein | Aldo-keto-reductase family 1 member C3 | Homo sapiens | IC50 | = | 7350.0 | nM | PMID[33569941] |
| NPT252 | Individual protein | Histamine H2 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT264 | Individual protein | Muscarinic acetylcholine receptor M3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT290 | Individual protein | Serotonin 2a (5-HT2a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | = | 1747.2 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[35134642] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 0.14 | nM | PMID[38516587] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[36170566] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 80.0 | nM | PMID[34137625] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[35134642] |
| NPT1410 | Individual protein | GABA receptor alpha-1 subunit | Rattus norvegicus | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | Inhibition | = | 66.5 | % | PMID[35134642] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 490.0 | nM | PMID[32485533] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2640.0 | nM | PMID[29656203] |
| NPT324 | Individual protein | Cyclooxygenase-1 | Ovis aries | IC50 | = | 510.0 | nM | PMID[32485533] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 2630.0 | nM | PMID[32485533] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | AC50 | = | 2232.2 | nM | PMID[37468498] |
| NPT303 | Individual protein | Vasopressin V1a receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | IC50 | = | 100.0 | nM | PMID[36796297] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | Activity | = | 0.65 | ng/ml | PMID[34137625] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT31 | Individual protein | Cyclooxygenase-2 | Homo sapiens | IC50 | = | 500.0 | nM | PMID[37182334] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT292 | Individual protein | Serotonin 2c (5-HT2c) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 3000.0 | nM | PMID[37468498] |
| NPT2761 | Individual protein | Phosphodiesterase 4A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 100.0 | nM | PMID[2502629] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 500.0 | nM | DOI[10.1016/S0960-894X(00)80396-0] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | ED50 | = | 0.1 | mg.kg-1 | PMID[9171873] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 500.0 | nM | DOI[10.1016/S0960-894X(00)80450-3] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 2.9 | nM | PMID[10821716] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 500.0 | nM | PMID[2115586] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 200.0 | nM | PMID[2115589] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 1800.0 | nM | PMID[1995900] |
| NPT1559 | Protein family | Cyclooxygenase | Rattus norvegicus | IC50 | = | 200.0 | nM | PMID[7332706] |
| NPT862 | Individual protein | Epoxide hydratase | Homo sapiens | IC50 | > | 1000.0 | nM | PMID[21434686] |
| NPT701 | Individual protein | UDP-glucuronosyltransferase 2B4 | Homo sapiens | Activity | = | 0.0 | pm/min/mg | PMID[10836148] |
| NPT25188 | Single protein | Multidrug resistance-associated protein 6 | Homo sapiens | Activity | = | 20.0 | % | PMID[11880368] |
| NPT25188 | Single protein | Multidrug resistance-associated protein 6 | Homo sapiens | Activity | = | 80.0 | % | PMID[11880368] |
| NPT666 | Individual protein | Solute carrier family 22 member 6 | Rattus norvegicus | Ki | = | 10000.0 | nM | PMID[10220563] |
| NPT666 | Individual protein | Solute carrier family 22 member 6 | Rattus norvegicus | Ki | = | 4200.0 | nM | PMID[11099697] |
| NPT669 | Individual protein | Solute carrier family 22 member 8 | Homo sapiens | Ki | = | 5950.0 | nM | PMID[12130730] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | IC50 | = | 41000.0 | nM | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Ki | = | 38000.0 | nM | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 48.6 | % | PMID[22541068] |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 50.32 | % | PMID[23571415] |
| NPT5559 | Individual protein | Potassium channel subfamily K member 2 | Homo sapiens | Activity | = | 24.0 | % | PMID[26588045] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | = | 42000.0 | nM | PMID[20829430] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | = | 49320.0 | nM | PMID[22961681] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | = | 42000.0 | nM | PMID[23956101] |
| NPT22859 | Single protein | Uracil nucleotide/cysteinyl leukotriene receptor | Homo sapiens | IC50 | = | 28800.0 | nM | PMID[30048589] |
| NPT22859 | Single protein | Uracil nucleotide/cysteinyl leukotriene receptor | Homo sapiens | Activity | = | 0.0 | % | PMID[30048589] |
| NPT22859 | Single protein | Uracil nucleotide/cysteinyl leukotriene receptor | Homo sapiens | IC50 | = | 28800.0 | nM | PMID[31727469] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | AC50 | = | 32999.7 | nM | PMID[37468498] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT5318 | Individual protein | Corticotropin releasing factor receptor 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5301 | Individual protein | Motilin receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30134 | Single protein | Gastric inhibitory polypeptide receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 630957344.48 | nM | PMID[2118185] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | = | 0.37 | n.a. | PMID[11906281] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | = | 0.1 | n.a. | PMID[10956225] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 1100.0 | nM | PMID[6481768] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 1000.0 | nM | PMID[6436487] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | = | 0.3 | n.a. | PMID[10397507] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 1100.0 | nM | PMID[6802974] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 1800.0 | nM | PMID[2104936] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | < | 0.1 | n.a. | PMID[7562922] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | IC50 | = | 10.0 | nM | PMID[3104589] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | = | 0.7 | n.a. | DOI[10.1016/S0960-894X(96)00582-3] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | = | 1.3 | n.a. | PMID[10821716] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 430.0 | nM | PMID[1507204] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | = | 0.063 | n.a. | PMID[11906292] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | ID50 | = | 0.43 | uM | PMID[1433212] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 1800.0 | nM | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 17.0 | nM | PMID[10794700] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 11.0 | nM | PMID[10794700] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | IC50 | = | 1000.0 | nM | PMID[6965727] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | Ratio | = | 1.0 | n.a. | PMID[10649977] |
| NPT41 | Individual protein | Aldose reductase | Homo sapiens | Inhibition | = | 100.0 | % | PMID[3097317] |
| NPT41 | Individual protein | Aldose reductase | Homo sapiens | Inhibition | = | 67.0 | % | PMID[3097317] |
| NPT41 | Individual protein | Aldose reductase | Homo sapiens | Inhibition | = | 8.0 | % | PMID[3097317] |
| NPT41 | Individual protein | Aldose reductase | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[3097317] |
| NPT3805 | Individual protein | Cyclooxygenase-1 | Mus musculus | IC50 | = | 2.0 | nM | PMID[15857149] |
| NPT3805 | Individual protein | Cyclooxygenase-1 | Mus musculus | Inhibition | = | 88.0 | % | PMID[17181159] |
| NPT3805 | Individual protein | Cyclooxygenase-1 | Mus musculus | Inhibition | = | 75.0 | % | PMID[17181159] |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | FC | = | 6.43 | n.a. | PMID[18222570] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Activity | = | 308.0 | % | PMID[18457386] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | IC50 | = | 235000.0 | nM | PMID[18707884] |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | EC50 | = | 50000.0 | nM | PMID[16643023] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Ratio | = | 0.75 | n.a. | PMID[20598550] |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | FC | = | 2.0 | n.a. | PMID[20583750] |
| NPT98 | Individual protein | HERG | Homo sapiens | IC50 | = | 301995.17 | nM | PMID[21185626] |
| NPT697 | Individual protein | UDP-glucuronosyltransferase 2B7 | Homo sapiens | Activity | = | 0.1 | pm/min/mg | PMID[10836148] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | Activity | < | 0.0 | % | PMID[9887087] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | Activity | = | 20.0 | % | PMID[15716364] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | Activity | = | 210.0 | % | PMID[16460798] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | Activity | = | 60.6 | % | PMID[12130730] |
| NPT665 | Individual protein | Solute carrier family 22 member 6 | Homo sapiens | IC50 | = | 3000.0 | nM | PMID[10991954] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | IC50 | = | 12000.0 | nM | PMID[22541068] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Ki | = | 11000.0 | nM | PMID[22541068] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 88.6 | % | PMID[22541068] |
| NPT5977 | Individual protein | Cytochrome c oxidase subunit 1 | Ovis aries | Activity | = | 26.6 | % | PMID[21591611] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 97.38 | % | PMID[23571415] |
| NPT4747 | Protein family | Cyclooxygenase | Bos taurus | Inhibition | = | 100.0 | % | PMID[109614] |
| NPT1476 | Protein family | Cyclooxygenase | Homo sapiens | ED50 | = | 0.1 | ug ml-1 | PMID[309947] |
| NPT627 | Individual protein | Cytochrome P450 2B6 | Homo sapiens | Inhibition | < | 10.0 | % | PMID[21467212] |
| NPT628 | Individual protein | Cytochrome P450 2C8 | Homo sapiens | Inhibition | = | 14.0 | % | PMID[21467212] |
| NPT317 | Nucleic acid | Nucleic Acid | n.a. | Ratio | = | 0.55 | n.a. | PMID[22685216] |
| NPT5976 | Individual protein | Cytochrome c oxidase subunit 2 | Homo sapiens | IC50 | = | 610.0 | nM | PMID[28881288] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 29.7 | % | DOI[10.6019/CHEMBL4495564] |
| NPT5976 | Individual protein | Cytochrome c oxidase subunit 2 | Homo sapiens | IC50 | = | 70.0 | nM | PMID[31740050] |
| NPT4358 | Individual protein | Type-1 angiotensin II receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3952 | Individual protein | Endothelin receptor ET-B | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -33.51 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT29430 | Single protein | Neuronal acetylcholine receptor protein alpha-4 subunit | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT4729 | Individual protein | Cholecystokinin B receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3805 | Individual protein | Cyclooxygenase-1 | Mus musculus | Inhibition | n.a. | n.a. | % | PMID[36318728] |
| NPT3735 | Individual protein | Neurotensin receptor 1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -1.98 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT1386 | Protein family | Adrenergic receptor beta | Homo sapiens | Activity | = | -5.67 | n.a. | DOI[10.1016/S0960-894X(97)00046-2] |
| NPT1774 | Protein family | Sodium channel alpha subunits; brain (Types I, II, III) | Homo sapiens | Inhibition | = | 3.3 | % | PMID[2579237] |
| NPT1774 | Protein family | Sodium channel alpha subunits; brain (Types I, II, III) | Homo sapiens | Inhibition | = | 11.2 | % | PMID[2579237] |
| NPT4280 | Individual protein | Prostaglandin-H2 D-isomerase | Mus musculus | IC50 | = | 500.0 | nM | PMID[1900533] |
| NPT4243 | Individual protein | Cyclooxygenase-2 | Rattus norvegicus | IC50 | = | 10.0 | nM | DOI[10.1016/0960-894X(96)00100-X] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | IC50 | = | 6.0 | nM | DOI[10.1016/0960-894X(96)00100-X] |
| NPT4316 | Individual protein | Phospholipase A2 group 1B | Rattus norvegicus | IC50 | = | 250000.0 | nM | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT4243 | Individual protein | Cyclooxygenase-2 | Rattus norvegicus | IC50 | = | 10.0 | nM | DOI[10.1016/0960-894X(96)00101-1] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | IC50 | = | 6.0 | nM | DOI[10.1016/0960-894X(96)00101-1] |
| NPT4243 | Individual protein | Cyclooxygenase-2 | Rattus norvegicus | IC50 | = | 220.0 | nM | PMID[11591502] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | IC50 | = | 190.0 | nM | PMID[11591502] |
| NPT18711 | Single protein | Prostanoid DP receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[15357992] |
| NPT18711 | Single protein | Prostanoid DP receptor | Mus musculus | IC50 | > | 10000.0 | nM | PMID[15357992] |
| NPT4261 | Individual protein | Lipoxygenase | Glycine max | Activity | > | 5.0 | % | PMID[20888086] |
| NPT18711 | Single protein | Prostanoid DP receptor | Mus musculus | Ki | > | 10000.0 | nM | PMID[21737285] |
| NPT700 | Individual protein | UDP-glucuronosyltransferase 2B10 | Homo sapiens | Activity | = | 0.0 | pm/min/mg | PMID[10836148] |
| NPT752 | Individual protein | Solute carrier organic anion transporter family member 1A1 | Rattus norvegicus | Activity | = | 1.16 | % | PMID[11883641] |
| NPT4272 | Individual protein | Multidrug resistance-associated protein 1 | Mus musculus | Activity | = | 170.0 | % | PMID[16460798] |
| NPT667 | Individual protein | Solute carrier family 22 member 8 | Rattus norvegicus | Activity | = | 40.9 | % | PMID[12679720] |
| NPT750 | Individual protein | Solute carrier organic anion transporter family member 1A3 | Rattus norvegicus | Ki | = | 1000000.0 | nM | PMID[9399974] |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | IC50 | = | 140000.0 | nM | PMID[22541068] |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | Ki | = | 130000.0 | nM | PMID[22541068] |
| NPT622 | Individual protein | Solute carrier organic anion transporter family member 2B1 | Homo sapiens | Inhibition | = | -82.4 | % | PMID[22541068] |
| NPT472 | Individual protein | Vanilloid receptor | Homo sapiens | Activity | = | 82.0 | % | PMID[25467164] |
| NPT472 | Individual protein | Vanilloid receptor | Homo sapiens | Activity | = | 98.0 | % | PMID[25467164] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | Inhibition | = | 41.47 | % | PMID[26197159] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | 7.266 | % | PMID[38318365] |
| NPT28787 | Single protein | Voltage-gated N-type calcium channel alpha-1B subunit | Rattus norvegicus | AC50 | > | 10000.0 | nM | PMID[37468498] |
| NPT20859 | Single protein | Neuropeptide Y receptor type 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT5975 | Individual protein | Cyclooxygenase-1 | Rattus norvegicus | AC50 | = | 92.5 | nM | PMID[37468498] |
| NPT6127 | Individual protein | Bradykinin B1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28448 | Single protein | Corticotropin releasing factor receptor 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT28814 | Single protein | Ghrelin receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT967 | Individual protein | Xanthine dehydrogenase | Homo sapiens | IC50 | = | 86000.0 | nM | PMID[37974965] |
| NPT4243 | Individual protein | Cyclooxygenase-2 | Rattus norvegicus | Inhibition | n.a. | n.a. | % | PMID[36170566] |
| NPT3782 | Protein family | Prostaglandin G/H synthase (cyclooxygenase) | Mus musculus | IC50 | = | 20.0 | nM | PMID[8568814] |
| NPT4866 | Protein family | Prostaglandin G/H synthase (cyclooxygenase) | Ovis aries | IC50 | = | 150.0 | nM | PMID[3930740] |
| NPT56 | Individual protein | Beta-lactamase AmpC | Escherichia coli K-12 | Inhibition | < | 5.0 | % | PMID[14521410] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 6.4 | nM | PMID[10197959] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | Activity | = | 8.6 | (ng of PGE2) (mg of protein)-1 | PMID[10579834] |
| NPT4866 | Protein family | Prostaglandin G/H synthase (cyclooxygenase) | Ovis aries | IC50 | = | 17200.0 | nM | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT711 | Individual protein | Aldose reductase | Bos taurus | Inhibition | = | 68.0 | % | PMID[11356107] |
| NPT711 | Individual protein | Aldose reductase | Bos taurus | Inhibition | = | 72.0 | % | PMID[11356107] |
| NPT711 | Individual protein | Aldose reductase | Bos taurus | Inhibition | = | 83.0 | % | PMID[11356107] |
| NPT711 | Individual protein | Aldose reductase | Bos taurus | IC50 | = | 5000.0 | nM | PMID[11356107] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 6.4 | nM | PMID[10197960] |
| NPT570 | Individual protein | Arachidonate 5-lipoxygenase | Homo sapiens | IC50 | = | 7000.0 | nM | PMID[9057869] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 210.0 | nM | PMID[11965379] |
| NPT4038 | Individual protein | Cytosolic phospholipase A2 gamma | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[11229777] |
| NPT570 | Individual protein | Arachidonate 5-lipoxygenase | Homo sapiens | Inhibition | = | 0.01 | % | PMID[2491889] |
| NPT4866 | Protein family | Prostaglandin G/H synthase (cyclooxygenase) | Ovis aries | IC50 | = | 300.0 | nM | PMID[3488405] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Ki | = | 15135612484362.07 | nM | PMID[15801837] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 9.0 | nM | PMID[15857149] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | Inhibition | = | 100.0 | % | PMID[15857149] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | Inhibition | = | 67.9 | % | PMID[15857149] |
| NPT18712 | Single protein | G protein-coupled receptor 44 | Homo sapiens | Ki | = | 8000.0 | nM | PMID[16190744] |
| NPT18712 | Single protein | G protein-coupled receptor 44 | Homo sapiens | Ki | = | 50.0 | nM | PMID[16190744] |
| NPT4149 | Protein complex | Gamma-secretase | Homo sapiens | Inhibition | = | 53.0 | % | PMID[16455248] |
| NPT4734 | Individual protein | Dehydrogenase/reductase SDR family member 9 | Homo sapiens | IC50 | = | 14000.0 | nM | PMID[17346963] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | Activity | = | 0.25 | uM | PMID[17341061] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | Inhibition | = | 100.0 | % | PMID[19200742] |
| NPT5691 | Individual protein | Hematopoietic prostaglandin D synthase | Homo sapiens | Inhibition | = | 0.0 | % | PMID[19939518] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 68.0 | nM | PMID[20188577] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 750.0 | nM | PMID[20129783] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 15370.0 | nM | PMID[21381754] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Activity | = | 25.0 | % | PMID[20869876] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Activity | = | 64.8 | % | PMID[20869876] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Activity | = | 63.2 | % | PMID[20869876] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Activity | = | 67.4 | % | PMID[20869876] |
| NPT877 | Individual protein | Solute carrier family 22 member 8 | Mus musculus | Activity | = | 1.32 | % | PMID[14762099] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | IC50 | = | 32000.0 | nM | PMID[22916727] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | IC50 | = | 28000.0 | nM | PMID[22916727] |
| NPT956 | Individual protein | Prostaglandin E synthase | Homo sapiens | IC50 | = | 40600.0 | nM | PMID[22992107] |
| NPT18712 | Single protein | G protein-coupled receptor 44 | Homo sapiens | EC50 | = | 389.0 | nM | PMID[22224640] |
| NPT4037 | Individual protein | Multidrug and toxin extrusion protein 1 | Homo sapiens | Inhibition | = | 6.0 | % | PMID[23241029] |
| NPT4037 | Individual protein | Multidrug and toxin extrusion protein 1 | Homo sapiens | IC50 | > | 500000.0 | nM | PMID[23241029] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 200.0 | nM | PMID[23432095] |
| NPT581 | Individual protein | Cyclooxygenase-2 | Mus musculus | IC50 | = | 127.0 | nM | PMID[23687559] |
| NPT956 | Individual protein | Prostaglandin E synthase | Homo sapiens | ED50 | = | 0.1 | ug ml-1 | PMID[102794] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Kd | = | 700.0 | nM | PMID[28771355] |
| NPT1881 | Nucleic acid | Calf thymus DNA | Bos taurus | Activity | = | 19.0 | % | PMID[30108839] |
| NPT670 | Individual protein | Thrombin | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT425 | Individual protein | Serotonin 3a (5-HT3a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Kd | = | 120000.0 | nM | PMID[34939412] |
| NPT30151 | Single protein | Melanocortin receptor 3 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT543 | Individual protein | Pregnane X receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT439 | Individual protein | Butyrylcholinesterase | Homo sapiens | Inhibition | n.a. | n.a. | % | PMID[36067929] |
| NPT668 | Individual protein | P-glycoprotein 1 | Homo sapiens | Ratio | = | 2.673 | n.a. | PMID[33619967] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[10737736] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 3.6 | nM | PMID[10737736] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[10821716] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[11229777] |
| NPT1970 | Cell line | THP-1 | Homo sapiens | IC50 | = | 3.6 | nM | PMID[11229777] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 177.0 | % | PMID[18951802] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 52.8 | nM | PMID[19467877] |
| NPT4009 | Cell line | L1.2 | Mus musculus | Activity | > | 95.0 | % | PMID[19560921] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 45510.0 | nM | PMID[19931461] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 59.86 | % | PMID[19931461] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 86.48 | % | PMID[19931461] |
| NPT71 | Cell line | HEK293 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[20129783] |
| NPT80 | Cell line | Raji | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[20129783] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[20129783] |
| NPT1160 | Cell line | BJ | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[20129783] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | = | 50000.0 | nM | PMID[20583750] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[20583750] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[20583750] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[20583750] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[20583750] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 12960.0 | nM | PMID[20879743] |
| NPT3908 | Cell line | N2a | Mus musculus | Inhibition | = | 108.0 | % | PMID[21405086] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 92.0 | % | PMID[21405086] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 39.8 | % | PMID[21405086] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 98.7 | % | PMID[21405086] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 70.9 | % | PMID[21405086] |
| NPT3908 | Cell line | N2a | Mus musculus | Inhibition | = | 76.7 | % | PMID[21405086] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 100000.0 | nM | PMID[21381754] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 12960.0 | nM | PMID[21807513] |
| NPT1125 | Cell line | T98G | Homo sapiens | FC | = | 2.0 | n.a. | PMID[24900317] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 59.2 | % | PMID[22633833] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 80000.0 | nM | PMID[22633833] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 1052000.0 | nM | PMID[22940705] |
| NPT783 | Cell line | MIA PaCa-2 | Homo sapiens | IC50 | > | 100000000.0 | nM | PMID[23061607] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 148000.0 | nM | PMID[23566521] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 12100.0 | nM | PMID[23755850] |
| NPT34 | Cell line | BV-2 | Mus musculus | IC50 | = | 7100.0 | nM | PMID[24042007] |
| NPT1886 | Cell line | J774 | Mus musculus | IC50 | > | 100000.0 | nM | PMID[24268542] |
| NPT1886 | Cell line | J774 | Mus musculus | IC50 | = | 29600.0 | nM | PMID[24268542] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 7645.9 | pg/ml | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 2989.6 | pg/ml | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 2313.5 | pg/ml | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 1242.0 | pg/ml | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 612.6 | pg/ml | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 366.5 | pg/ml | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 100.8 | % | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 31.3 | % | PMID[24333613] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 16670.0 | nM | PMID[24660966] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 1250.0 | nM | PMID[24806310] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 1250.0 | nM | PMID[25442320] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 3900.0 | nM | PMID[24960143] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 15800.0 | nM | PMID[24963714] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 18700.0 | nM | PMID[24963714] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | IC50 | = | 28560.0 | nM | PMID[25140384] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 80000.0 | nM | PMID[25555141] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 40300.0 | nM | PMID[25555141] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 67.99 | % | PMID[25596479] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 55.0 | % | PMID[25596479] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 10700.0 | nM | PMID[25881822] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 9200.0 | nM | PMID[25881822] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 60.6 | % | PMID[25881822] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 6300.0 | nM | PMID[25621853] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 14100.0 | nM | PMID[25821895] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 42600.0 | nM | PMID[26024020] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 38.5 | % | PMID[25945867] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 44.3 | % | PMID[25945867] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 57.9 | % | PMID[25945867] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 42600.0 | nM | PMID[25945867] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 24.5 | % | PMID[25945867] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 21.5 | % | PMID[25945867] |
| NPT34 | Cell line | BV-2 | Mus musculus | IC50 | = | 35700.0 | nM | PMID[26348503] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 16670.0 | nM | PMID[26615888] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 12500.0 | nM | PMID[26702644] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 42200.0 | nM | PMID[26710212] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 99.6 | % | DOI[10.1039/C5MD00577A] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 20.8 | % | DOI[10.1039/C5MD00577A] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 99.8 | % | DOI[10.1039/C5MD00577A] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 53.59 | % | PMID[27142640] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 24.15 | % | PMID[27142640] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 58.55 | pg/ml | PMID[27374242] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 3.15 | pg/ml | PMID[27374242] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 19.67 | pg/ml | PMID[27374242] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 0.17 | umol/ml | PMID[27374242] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 17.38 | U/ml | PMID[27374242] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 71.47 | pg/ml | PMID[27374242] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Ratio CC50/IC50 | > | 12.1 | n.a. | PMID[27575472] |
| NPT858 | Cell line | LNCaP | Homo sapiens | Activity | = | 71.5 | % | PMID[28057407] |
| NPT858 | Cell line | LNCaP | Homo sapiens | Activity | = | 23.5 | % | PMID[28057407] |
| NPT858 | Cell line | LNCaP | Homo sapiens | Activity | = | 1.12 | % | PMID[28057407] |
| NPT858 | Cell line | LNCaP | Homo sapiens | Activity | = | 2.81 | % | PMID[28057407] |
| NPT858 | Cell line | LNCaP | Homo sapiens | Activity | = | 0.88 | % | PMID[28057407] |
| NPT181 | Cell line | Bel-7402 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[28301815] |
| NPT34 | Cell line | BV-2 | Mus musculus | Inhibition | = | 50.0 | % | PMID[28923390] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 33600.0 | nM | PMID[28960979] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 21100.0 | nM | PMID[29261312] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 29.4 | % | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 100.8 | % | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 10850.0 | pg/ml | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 19664.0 | pg/ml | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 20772.0 | pg/ml | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 59.6 | pg/ml | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 120.7 | pg/ml | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 286.6 | pg/ml | PMID[29268132] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 46500.0 | nM | PMID[28561586] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 33600.0 | nM | PMID[30024153] |
| NPT858 | Cell line | LNCaP | Homo sapiens | IC50 | = | 238400.0 | nM | PMID[30996776] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 136800.0 | nM | PMID[30996776] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 312600.0 | nM | PMID[30996776] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 62900.0 | nM | PMID[31403786] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 45570.0 | nM | PMID[30925056] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 50000.0 | nM | PMID[30925056] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 59.2 | % | PMID[30925056] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 38000.0 | nM | PMID[31365251] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | Activity | = | 64.63 | % | PMID[31471100] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 8800.0 | nM | PMID[31573805] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 41000.0 | nM | PMID[30920218] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 50000.0 | nM | PMID[30920218] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 8800.0 | nM | PMID[32520548] |
| NPT380 | Cell line | U-251 | Homo sapiens | IC50 | = | 20450.0 | nM | PMID[32527536] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[32527536] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 190000.0 | nM | PMID[32527536] |
| NPT148 | Cell line | HCT-15 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[32527536] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[32527536] |
| NPT311 | Cell line | SK-LU-1 | Homo sapiens | IC50 | > | 1000000.0 | nM | PMID[32527536] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 32200.0 | nM | PMID[32247751] |
| NPT941 | Cell line | HaCaT | Homo sapiens | Inhibition | = | 88.5 | % | PMID[32786876] |
| NPT941 | Cell line | HaCaT | Homo sapiens | Inhibition | = | 77.0 | % | PMID[32786876] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 53.2 | % | PMID[33132198] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 11600.0 | nM | PMID[27276091] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 0.87 | % | PMID[33493826] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 61.59 | % | PMID[32823004] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 10000.0 | nM | PMID[32823004] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | > | 40000.0 | nM | PMID[32823004] |
| NPT660 | Cell line | SW480 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[32987314] |
| NPT165 | Cell line | HeLa | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[32987314] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[32987314] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[32987314] |
| NPT1182 | Cell line | J774.A1 | Mus musculus | Inhibition | = | 47.82 | % | PMID[37040078] |
| NPT34 | Cell line | BV-2 | Mus musculus | IC50 | = | 19510.0 | nM | PMID[37530709] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 42300.0 | nM | PMID[35512012] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 24000.0 | nM | PMID[38394380] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 620.0 | nM | PMID[36888988] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 16700.0 | nM | PMID[33533247] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 57.0 | % | PMID[38394380] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 34280.0 | nM | PMID[35660249] |
| NPT83 | Cell line | MCF7 | Homo sapiens | Activity | n.a. | n.a. | n.a. | PMID[35468536] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 54.6 | % | PMID[35175765] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 42.51 | % | PMID[35660249] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 44.2 | % | PMID[35175765] |
| NPT1635 | Cell line | H9c2 | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[36170566] |
| NPT1635 | Cell line | H9c2 | Rattus norvegicus | Inhibition | n.a. | n.a. | % | PMID[36170566] |
| NPT1635 | Cell line | H9c2 | Rattus norvegicus | Activity | = | 23.96 | % | PMID[36170566] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 10990.0 | nM | PMID[34352712] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36758306] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 34490.0 | nM | PMID[36450214] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | = | 68.84 | % | PMID[34029774] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 34.9 | % | PMID[33964436] |
| NPT83 | Cell line | MCF7 | Homo sapiens | FC | = | 2.4 | n.a. | PMID[35468536] |
| NPT34 | Cell line | BV-2 | Mus musculus | Inhibition | = | 35.8 | % | PMID[35931005] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 40700.0 | nM | PMID[35175765] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 32300.0 | nM | PMID[33422907] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[35468536] |
| NPT858 | Cell line | LNCaP | Homo sapiens | EC50 | = | 238400.0 | nM | PMID[33569941] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[36257283] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[36257283] |
| NPT2224 | Cell line | TERT-RPE1 | Homo sapiens | IC50 | > | 40000.0 | nM | PMID[35468536] |
| NPT139 | Cell line | HT-29 | Homo sapiens | EC50 | = | 312600.0 | nM | PMID[33569941] |
| NPT1635 | Cell line | H9c2 | Rattus norvegicus | Activity | = | 47.52 | nmol/mg | PMID[36170566] |
| NPT34 | Cell line | BV-2 | Mus musculus | Inhibition | = | 38.93 | % | PMID[35931005] |
| NPT34 | Cell line | BV-2 | Mus musculus | Inhibition | = | 37.07 | % | PMID[35931005] |
| NPT34 | Cell line | BV-2 | Mus musculus | Inhibition | = | 15.54 | % | PMID[35931005] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | EC50 | = | 136800.0 | nM | PMID[33569941] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Inhibition | = | 32.08 | % | PMID[36450214] |
| NPT34 | Cell line | BV-2 | Mus musculus | Inhibition | = | 34.9 | % | PMID[35931005] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 24000.0 | nM | PMID[33160760] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 26.2 | ug.mL-1 | PMID[33422907] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | IC50 | = | 26300.0 | nM | PMID[33422907] |
| NPT1635 | Cell line | H9c2 | Rattus norvegicus | Activity | = | 91.8 | % | PMID[36170566] |
| NPT1635 | Cell line | H9c2 | Rattus norvegicus | Activity | = | 9.61 | % | PMID[36170566] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[36257283] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[36450214] |
| NPT1136 | Cell line | mast cells | Mus musculus | ID50 | = | 8.0 | 10'-4M | PMID[2453615] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | CC50 | > | 50000.0 | nM | PMID[31365251] |
| NPT113 | Cell line | RAW264.7 | Mus musculus | CC50 | > | 50000.0 | nM | PMID[38394380] |
| NPT18706 | Cell line | Mononuclear cell line | n.a. | IC50 | = | 300.0 | nM | PMID[1995900] |
| NPT433 | Subcellular | Liver microsomes | Homo sapiens | Activity | = | 17.0 | pmol | PMID[22931300] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -4.31 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | ~ | 17988.71 | nM | PMID[32353859] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.04 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 100000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[34425313] |
| NPT28833 | No target | No relevant target | n.a. | pKa | = | 4.4 | n.a. | PMID[36270005] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 0.31 | n.a. | PMID[37182334] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[34137625] |
| NPT28833 | No target | No relevant target | n.a. | pKa | = | 4.41 | n.a. | PMID[33569941] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[32992247] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[36325400] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | EC50 | > | 400000.0 | nM | PMID[34534839] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | n.a. | n.a. | n.a. | PMID[36257283] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | n.a. | n.a. | n.a. | PMID[35931005] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 0.14 | n.a. | PMID[34245948] |
| NPT28438 | Unchecked | Unchecked | n.a. | Activity | n.a. | n.a. | n.a. | PMID[35978698] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | = | 2900.0 | nM | PMID[36270005] |
| NPT28438 | Unchecked | Unchecked | n.a. | Selectivity Index | = | 0.082 | n.a. | PMID[32485533] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | EC50 | n.a. | n.a. | n.a. | PMID[34534839] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 0.21 | n.a. | PMID[35685617] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 1.33 | n.a. | PMID[36796297] |
| NPT28438 | Unchecked | Unchecked | n.a. | Selectivity Index | = | 0.079 | n.a. | PMID[32485533] |
| NPT28438 | Unchecked | Unchecked | n.a. | Selectivity Index | = | 0.03 | n.a. | PMID[32485533] |
| NPT28438 | Unchecked | Unchecked | n.a. | IC50 | > | 100000.0 | nM | PMID[36257283] |
| NPT28438 | Unchecked | Unchecked | n.a. | Ratio IC50 | = | 5.5 | n.a. | PMID[35134642] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | = | 101100.0 | nM | PMID[34534839] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | EC50 | = | 94900.0 | nM | PMID[34534839] |
| NPT24755 | Organism | SARS-CoV | Severe acute respiratory syndrome-related coronavirus | IC50 | = | 50000.0 | nM | PMID[34534839] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 140.0 | nM | PMID[17197180] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 100000.0 | nM | PMID[17197180] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 40000.0 | nM | PMID[17197180] |
| NPT1308 | Tissue | Blood | Homo sapiens | IC50 | = | 120.0 | nM | PMID[18407506] |
| NPT1308 | Tissue | Blood | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[18407506] |
| NPT1308 | Tissue | Blood | Homo sapiens | IC50 | = | 400.0 | nM | PMID[18407506] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 78.13 | % | PMID[8988605] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 22000.0 | nM | PMID[8988605] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 71.1 | % | PMID[9461664] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 36.7 | % | PMID[9461664] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 100.0 | % | PMID[9461664] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 52.1 | % | PMID[9461664] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 64300.0 | nM | PMID[19398334] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 58.82 | % | PMID[19006373] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 757.99 | ug.mL-1 | PMID[19006373] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 1000000.0 | nM | PMID[20576329] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 246350.0 | nM | PMID[20576329] |
| NPT312 | Organism | Saccharomyces cerevisiae | Saccharomyces cerevisiae | IZ | = | 0.0 | mm | PMID[20739103] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 38300.0 | nM | PMID[21316977] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 32000.0 | nM | PMID[21316977] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 31.98 | ug.mL-1 | PMID[21848266] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 38.32 | ug.mL-1 | PMID[21848266] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 271212.0 | nM | PMID[22437110] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI50 | = | 64300.0 | nM | PMID[22734697] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 100000000.0 | nM | PMID[23061607] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 1620.0 | nM | PMID[23639653] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 28420.0 | nM | PMID[23688954] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 64.01 | % | PMID[24211633] |
| NPT610 | Others | Molecular identity unknown | n.a. | Activity | = | 0.39 | pg/ml | PMID[27374242] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 34500.0 | nM | PMID[27120704] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 11.4 | % | PMID[27634196] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 21.2 | % | PMID[27634196] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 6.1 | % | PMID[27634196] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 16500.0 | nM | PMID[27575472] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 30.94 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 89.38 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 11.96 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 10.28 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 5.01 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 4.85 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 15.63 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 18.65 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 22.76 | % | PMID[27843112] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 13200.0 | nM | PMID[27865705] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 54.0 | % | PMID[27955811] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 94.0 | % | PMID[27521588] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 84.0 | % | PMID[27521588] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 81.0 | % | PMID[27521588] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Inhibition | = | 86.0 | % | PMID[27521588] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | > | 300000.0 | nM | PMID[28057407] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | GI | = | 5.2 | % | PMID[28057407] |
| NPT25791 | Selectivity group | COX-1/COX-2 | Homo sapiens | Ratio IC50 | = | 0.09886 | n.a. | PMID[29031075] |
| NPT23115 | Cell line | VCaP | Homo sapiens | IC50 | = | 136900.0 | nM | PMID[30996776] |
| NPT617 | Organism | Danio rerio | Danio rerio | Activity | n.a. | n.a. | n.a. | PMID[35018782] |
| NPT617 | Organism | Danio rerio | Danio rerio | Activity | n.a. | n.a. | n.a. | PMID[37672747] |
| NPT28917 | Organism | Canine coronavirus | Canine coronavirus | IC50 | = | 5000.0 | nM | PMID[34534839] |
| NPT22224 | Cell line | Vero C1008 | Chlorocebus sabaeus | CC50 | > | 100000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT22224 | Cell line | Vero C1008 | Chlorocebus sabaeus | CC50 | > | 500000.0 | nM | PMID[34534839] |
| NPT22224 | Cell line | Vero C1008 | Chlorocebus sabaeus | CC50 | > | 100000.0 | nM | PMID[34534839] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | Inhibition | = | 100.0 | % | PMID[11738562] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | Inhibition | = | 95.4 | % | PMID[11738562] |
| NPT20967 | Cell line | Platelet | n.a. | Activity | = | 3.09 | ng | PMID[18407506] |
| NPT20967 | Cell line | Platelet | n.a. | IC50 | = | 210.0 | nM | PMID[8988600] |
| NPT20967 | Cell line | Platelet | n.a. | Activity | = | 69.5 | % | PMID[8350094] |
| NPT20967 | Cell line | Platelet | n.a. | Activity | = | 0.0 | % | PMID[8350094] |
| NPT20967 | Cell line | Platelet | n.a. | Activity | = | 72.3 | % | PMID[8350094] |
| NPT20967 | Cell line | Platelet | n.a. | Activity | = | 89.4 | % | PMID[8350094] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | Activity | = | 279.3 | mm2 | DOI[10.1007/s00044-009-9174-z] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | Activity | = | 227.0 | mm2 | DOI[10.1007/s00044-009-9174-z] |
| NPT20967 | Cell line | Platelet | n.a. | IC50 | = | 2800.0 | nM | PMID[114655] |
| NPT20967 | Cell line | Platelet | n.a. | IC50 | = | 100.0 | nM | PMID[114655] |
| NPT20967 | Cell line | Platelet | n.a. | IC50 | = | 3200.0 | nM | PMID[114655] |
| NPT419 | Organism | Oryctolagus cuniculus | Oryctolagus cuniculus | Inhibition | = | 57.0 | % | PMID[140243] |
| NPT21742 | Cell line | L02 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[28301815] |
| NPT23193 | Cell line | Bel7402/5-FU | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[28301815] |
| NPT20950 | Cell line | Erythrocyte | n.a. | Activity | = | 0.3834 | n.a. | PMID[29803359] |
| NPT20950 | Cell line | Erythrocyte | n.a. | Activity | = | 85.64 | % | PMID[29803359] |
| NPT20950 | Cell line | Erythrocyte | n.a. | IC50 | = | 0.086 | ug.mL-1 | PMID[29803359] |
| NPT20950 | Cell line | Erythrocyte | n.a. | IC50 | = | 40.04 | ug.mL-1 | PMID[30108827] |
| NPT20950 | Cell line | Erythrocyte | n.a. | IC50 | = | 40.0 | ug.mL-1 | PMID[30108882] |
| NPT21850 | Cell line | COS-7 | Chlorocebus aethiops | IC50 | > | 1000000.0 | nM | PMID[32527536] |
| NPT5272 | Organism | Zingiber officinale | Zingiber officinale | IC50 | = | 4900.0 | nM | PMID[33422907] |
| NPT24746 | Cell line | 184B5 | Homo sapiens | IC50 | n.a. | n.a. | n.a. | PMID[36257283] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 11.0 | nM | PMID[3263504] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 100.0 | nM | PMID[3118023] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 47.0 | % | PMID[14741253] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 800.0 | nM | PMID[8254620] |
| NPT2 | Others | Unspecified | n.a. | Ratio | < | 96.0 | n.a. | PMID[7473540] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.4 | n.a. | PMID[10406640] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.7 | n.a. | PMID[10406640] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1200.0 | nM | PMID[1995900] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 100.0 | nM | PMID[2547071] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 73.0 | % | PMID[16455248] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 21.3 | % | PMID[16789751] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 52.8 | % | PMID[16789751] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 33.2 | % | PMID[17461599] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.01 | n.a. | PMID[17509888] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 62.64 | ng/ml | PMID[17889545] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.7 | n.a. | PMID[17994684] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 0.08 | uM | PMID[17341061] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 4.0 | uM | PMID[17341061] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.067 | n.a. | PMID[18061444] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 209.0 | % | PMID[17284452] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 958000.0 | nM | PMID[17284452] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.098 | n.a. | PMID[17532544] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.4 | n.a. | PMID[19303782] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 250.0 | uL | PMID[15270561] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.7 | ug.mL-1 | PMID[8864236] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 560.0 | nM | PMID[8786365] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 7.0 | % | PMID[9134748] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 120.0 | n.a. | PMID[9784154] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 518.0 | n.a. | PMID[9461646] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 117.0 | n.a. | PMID[9461646] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 144.0 | % | PMID[18951802] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 100.0 | % | PMID[10514305] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.02 | n.a. | PMID[19419861] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.07 | n.a. | PMID[19144452] |
| NPT27 | Others | Unspecified | n.a. | Activity | > | 95.0 | % | PMID[19560921] |
| NPT2 | Others | Unspecified | n.a. | Ratio | > | 100.0 | n.a. | PMID[20129783] |
| NPT471 | Organism | Trypanosoma brucei brucei | Trypanosoma brucei brucei | IC50 | > | 50000.0 | nM | PMID[20129783] |
| NPT27 | Others | Unspecified | n.a. | Ratio | > | 100.0 | n.a. | PMID[20129783] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.55 | n.a. | PMID[20451397] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2.9 | n.a. | PMID[20451397] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 250000.0 | nM | PMID[20586436] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 25000.0 | nM | PMID[20503989] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.13 | n.a. | PMID[20692174] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.098 | n.a. | PMID[20970223] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 6.45 | n.a. | PMID[21319773] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.07 | n.a. | PMID[21524587] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 25000.0 | nM | PMID[21873070] |
| NPT2 | Others | Unspecified | n.a. | Ki | = | 200000.0 | nM | PMID[15781124] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 7.164 | n.a. | PMID[22305614] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.02 | n.a. | PMID[22361134] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 3.98 | n.a. | PMID[22818041] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.04 | n.a. | PMID[23047224] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 25000.0 | nM | PMID[21141968] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 7.16 | n.a. | PMID[23010270] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 20.0 | n.a. | PMID[22877157] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.25 | n.a. | PMID[23432095] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.2 | n.a. | PMID[23432095] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 365.0 | n.a. | PMID[23432095] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 3.7 | n.a. | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2.6 | n.a. | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.7 | n.a. | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 10.6 | n.a. | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2.5 | n.a. | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.8 | n.a. | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 475.0 | nM | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 326.0 | nM | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 220.0 | nM | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1340.0 | nM | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 315.0 | nM | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 71.0 | nM | PMID[23687559] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[24332492] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.03 | n.a. | PMID[24631895] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1000.0 | nM | PMID[114655] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2.9 | n.a. | PMID[25444084] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[24631898] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.021 | n.a. | PMID[25868745] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[25956953] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 84.88 | % | PMID[26117820] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.95 | n.a. | PMID[26117820] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.067 | n.a. | PMID[26455657] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | < | 50.0 | % | PMID[27165854] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 2000000.0 | nM | PMID[27165854] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 1400000.0 | nM | PMID[27165854] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 340000.0 | nM | PMID[27165854] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 15.59 | n.a. | PMID[27916468] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.15 | n.a. | PMID[28038322] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.476 | n.a. | PMID[28089698] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.027 | n.a. | PMID[23956101] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.017 | n.a. | PMID[23956101] |
| NPT2 | Others | Unspecified | n.a. | Ratio | = | 0.193 | n.a. | PMID[23956101] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.0796 | n.a. | PMID[28916158] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[30095904] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.11 | n.a. | PMID[29980364] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.07 | n.a. | PMID[29289887] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 5.0 | nM | PMID[30006172] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[31539778] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.02 | n.a. | PMID[31655429] |
| NPT35 | Others | n.a. | n.a. | Activity | = | 82.67 | % | PMID[30469039] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.1 | n.a. | PMID[30771604] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.01 | n.a. | PMID[30996776] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 1.2 | n.a. | PMID[30996776] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 3.28 | n.a. | PMID[30904755] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 4.8 | n.a. | PMID[30928709] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 100.0 | % | PMID[30928709] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[31244108] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.33 | n.a. | PMID[31299586] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 10.0 | % | PMID[31803395] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 5.0 | n.a. | PMID[31803395] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 2.6 | n.a. | PMID[31803395] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.1 | n.a. | PMID[30818268] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[31843462] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[32127262] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 22.0 | n.a. | PMID[32463235] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 12.4 | n.a. | PMID[31982653] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.81 | n.a. | PMID[31982653] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 8.3 | n.a. | PMID[31982653] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.055 | n.a. | PMID[27541263] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 3.57 | n.a. | PMID[31740050] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 10.0 | % | PMID[32311607] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 2.0 | n.a. | PMID[32311607] |
| NPT27 | Others | Unspecified | n.a. | Activity | = | 1.67 | n.a. | PMID[32311607] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 0.08 | n.a. | PMID[32485532] |
| NPT2 | Others | Unspecified | n.a. | ID50 | > | 1000.0 | uM | PMID[1433212] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 60.0 | mg.kg-1 | PMID[2724294] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1.0 | mg.kg-1 | PMID[2724294] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1.5 | mg.kg-1 | PMID[3263504] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 2.5 | mg.kg-1 | PMID[6606043] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1.63 | mg ear-1 | PMID[8568814] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 3.1 | mg.kg-1 | PMID[6977035] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 3.7 | mg m-1 | PMID[15081016] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.64 | uM site-1 | PMID[2308140] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED40 | = | 0.6 | mg kg-1 | PMID[10197959] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 89.0 | % | PMID[3669013] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 16.0 | % | PMID[3669013] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 28.0 | % | PMID[3669013] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 3.0 | mg.kg-1 | PMID[3669013] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 5.0 | mg.kg-1 | PMID[3669013] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.22 | mg.kg-1 | PMID[6436487] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 20.0 | % | PMID[2104936] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 780.0 | ug ear-1 | PMID[2104936] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 22.2 | % | PMID[11844686] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 75.0 | % | PMID[11844686] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 40.0 | % | PMID[9703468] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.3 | % | PMID[9703468] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 10.0 | % | PMID[1507204] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 254.0 | ug ear-1 | PMID[1507204] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 902.0 | ug ear-1 | PMID[1507204] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 517.0 | mg.kg-1 | PMID[6218302] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 17.0 | % | PMID[7097725] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 83.0 | % | PMID[7097725] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 4.8 | % | PMID[8254620] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1.16 | mg.kg-1 | PMID[3491210] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.35 | mg.kg-1 | PMID[3875725] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1000.0 | ug ear-1 | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 254.0 | ug ear-1 | DOI[10.1016/S0960-894X(01)81022-2] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 17.0 | % | PMID[7057427] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 83.0 | % | PMID[7057427] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.3 | mg ear-1 | PMID[7473540] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | > | 10000.0 | nM | PMID[1732519] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 500.0 | nM | PMID[1732519] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 21.1 | % | PMID[1560442] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 13.4 | % | PMID[1560442] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 10.3 | % | PMID[1560442] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 14.7 | % | PMID[1560442] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.0 | % | PMID[1560442] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | PMID[1560442] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 7.5 | mg.kg-1 | PMID[1560442] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.62 | mg.kg-1 | PMID[6982340] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1.0 | mg.kg-1 | PMID[6972450] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 60.0 | mg.kg-1 | PMID[3572970] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 60.0 | n.a. | PMID[3097317] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.3 | mg | PMID[17480098] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 838.0 | nmol | PMID[17480100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Ratio | = | 96.0 | % | PMID[17480100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 31.9 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 34.8 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 36.5 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 39.7 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 28.8 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 32.4 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.9 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.3 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 34.5 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 35.2 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 39.1 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 34.2 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 37.5 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.1 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 40.2 | 10^-2mm | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 44.2 | % | PMID[17166724] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 33.3 | 10^2 mm | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 32.3 | % | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 36.0 | 10^2 mm | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.1 | % | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 40.3 | 10^2 mm | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 33.6 | % | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 40.2 | 10^2 mm | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.2 | % | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 48.1 | % | PMID[17611112] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | -29.9 | % | PMID[17395469] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | -80.7 | % | PMID[17395469] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 22.6 | % | PMID[17395469] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | PMID[17587585] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 43.0 | % | PMID[17587585] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 46.3 | % | PMID[17587585] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.6 | % | PMID[17587585] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 16.83 | n.a. | PMID[17964781] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 51.46 | % | PMID[17964781] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 62.0 | % | PMID[17768049] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 43.11 | % | PMID[17993277] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 93.0 | microg/cm2 | PMID[18197604] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.838 | uM | PMID[18439824] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 82.0 | % | PMID[14510620] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 81.0 | % | PMID[14510620] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 60.0 | % | PMID[14510620] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.18 | mg | PMID[11473412] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 26.35 | % | PMID[11473412] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 34.77 | % | PMID[11473412] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 60.53 | % | PMID[11473412] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 93.48 | % | PMID[11473412] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 32.11 | % | PMID[19272777] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 68.81 | 10'5/cm'3 | PMID[19272777] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 78.0 | % | PMID[1800632] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 47.3 | % | PMID[9051913] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 38.6 | % | PMID[9051913] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 51.2 | % | PMID[9051913] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 77.0 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 56.0 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 44.0 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 28.7 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 28.4 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 50.0 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 43.0 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 77.2 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 81.0 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 85.8 | % | PMID[18502132] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 46.22 | % | PMID[17959273] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.3 | mg | PMID[11858752] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 96.0 | % | PMID[11858752] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.29 | umol | PMID[12828487] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 14.0 | % | PMID[12828487] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 60.0 | % | PMID[12828487] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 31.0 | % | PMID[12828487] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 82.0 | % | PMID[12828487] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 36.0 | % | PMID[12828487] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 89.0 | % | PMID[7760072] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 16.0 | % | PMID[12932134] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 20.77 | % | PMID[18829331] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 21.48 | % | PMID[18829331] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 19.53 | % | PMID[18829331] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 18.52 | % | PMID[18829331] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 17.04 | % | PMID[18829331] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 16.3 | % | PMID[18829331] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 84.0 | % | PMID[18045747] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.26 | umol | PMID[16562861] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.3 | mg | PMID[17190444] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 91.0 | % | PMID[10217718] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 51.46 | % | PMID[17945398] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 41.3 | % | PMID[18063224] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 59.25 | % | PMID[18063224] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 64.33 | % | PMID[18063224] |
| NPT32 | Organism | Mus musculus | Mus musculus | Ratio | = | 3.3 | n.a. | PMID[18063443] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 74.0 | % | PMID[18406013] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 5.66 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 6.28 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 7.14 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 10.75 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 12.57 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 1.9 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 2.09 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 2.5 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 3.5 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 5.0 | % | PMID[19481942] |
| NPT32 | Organism | Mus musculus | Mus musculus | Ratio | = | 1.0 | n.a. | PMID[19285756] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 34.4 | % | PMID[19535179] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 32.8 | % | PMID[19535179] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.4 | % | PMID[19535179] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 40.4 | % | PMID[19535179] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 84.0 | % | PMID[19913952] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.5 | % | PMID[19632747] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 46.2 | % | PMID[19632747] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 43.1 | % | PMID[19632747] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.9 | % | PMID[19632747] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 50.0 | % | PMID[19740655] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | PMID[19646868] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 56.2 | umol.kg-1 | PMID[19646868] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 71.58 | % | PMID[19628310] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 57.0 | % | PMID[19884011] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 54.9 | % | PMID[19647903] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 29.5 | % | PMID[20116903] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 30.6 | % | PMID[20116903] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.9 | % | PMID[20116903] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.7 | % | PMID[20116903] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1.0 | mg.kg-1 | PMID[20399648] |
| NPT32 | Organism | Mus musculus | Mus musculus | Ratio | = | 3.0 | n.a. | PMID[20399648] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 49.3 | % | PMID[20598893] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 29.7 | % | PMID[20598893] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 39.0 | % | PMID[20598893] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 79.4 | % | PMID[20598893] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 73.1 | % | PMID[20598893] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 240.0 | nM | PMID[20575572] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 73.6 | % | PMID[20731361] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 97.5 | % | PMID[20817329] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 240.0 | nM | PMID[20942442] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 12.2 | % | PMID[21159508] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.4 | % | PMID[21159508] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 63.0 | % | PMID[21159508] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 62.0 | % | PMID[21167711] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.23 | umol | PMID[21167711] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 26.0 | % | PMID[21167711] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 87.0 | % | PMID[21167711] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 37.03 | % | PMID[21288716] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.05 | mm | PMID[21345672] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 81.48 | % | PMID[21345672] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.3 | mg | PMID[19476340] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 87.3 | % | PMID[21608987] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 56.0 | % | PMID[21816516] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 77.3 | % | PMID[21865038] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 47.0 | % | PMID[22119153] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 4.65 | U/mg | PMID[22197135] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 3.85 | U/mg | PMID[22197135] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 10.45 | U/mg | PMID[22197135] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 73.1 | % | PMID[22197135] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 69.1 | % | PMID[22197135] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 81.0 | % | PMID[22189137] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 61.5 | % | PMID[22250858] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 58.1 | % | PMID[22250858] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 44.0 | % | PMID[22356737] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 61.0 | % | PMID[22000935] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 97.0 | % | PMID[22000935] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 45.8 | % | PMID[22633833] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 66.12 | % | PMID[22818041] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 3.0 | % | PMID[22734800] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 47.0 | % | PMID[22901385] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 4.0 | n.a. | PMID[21417376] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 3.0 | n.a. | PMID[21417376] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 2.6 | n.a. | PMID[21417376] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.0 | n.a. | PMID[21417376] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 25.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 51.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 80.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.29 | umol/cm2 | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 84.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 76.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 24.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 27.0 | % | PMID[21800856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 55.0 | % | PMID[23159805] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 26.7 | % | DOI[10.1007/s00044-010-9508-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 34.6 | % | DOI[10.1007/s00044-010-9508-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 56.7 | % | DOI[10.1007/s00044-010-9508-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 6.9 | % | DOI[10.1007/s00044-010-9508-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 68.0 | % | DOI[10.1007/s00044-011-9726-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 40.1 | % | DOI[10.1007/s00044-009-9168-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 36.2 | % | DOI[10.1007/s00044-009-9168-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 30.7 | % | DOI[10.1007/s00044-009-9168-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 25.4 | % | DOI[10.1007/s00044-009-9168-x] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.08 | % | DOI[10.1007/s00044-007-9013-z] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 133.81 | U | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 7.45 | U | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 45.32 | % | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 7.45 | nmol/ml | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 326.8 | U/L | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 9.45 | U/L | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 76.41 | U/L | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 65.37 | U/L | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 24.51 | U/L | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 6.98 | millimeter/min | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 7.2 | millimeter/min | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 7.19 | millimeter/min | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 6.5 | millimeter/min | DOI[10.1007/s00044-011-9707-0] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 45.7 | % | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 45.6 | % | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 31.7 | % | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 15.5 | % | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 42.0 | 10'-2mm | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 41.0 | 10'-2mm | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 35.0 | 10'-2mm | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 32.0 | 10'-2mm | DOI[10.1007/s00044-012-0072-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 45.54 | % | DOI[10.1007/s00044-012-0449-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 61.11 | % | DOI[10.1007/s00044-012-0449-4] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 39.4 | % | DOI[10.1007/s00044-012-0253-1] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.6 | % | DOI[10.1007/s00044-012-0253-1] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 36.9 | % | DOI[10.1007/s00044-012-0253-1] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 25.3 | % | DOI[10.1007/s00044-012-0253-1] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 47.0 | % | PMID[23219856] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 70.4 | % | PMID[23357629] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 79.6 | % | PMID[23734744] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 60.2 | % | PMID[23734744] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 3.1 | U | PMID[23734744] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 37.0 | % | PMID[23734744] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 43.7 | % | PMID[23734744] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 50.9 | % | PMID[23734744] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 55.0 | % | PMID[23734744] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 72.1 | % | PMID[23807113] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 4.7 | % | PMID[23807113] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 96.1 | % | PMID[23807113] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 72.62 | umol.kg-1 | PMID[23953687] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 44.69 | % | PMID[24211633] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 6.3 | mg.kg-1 | PMID[423183] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 54.0 | % | PMID[24568631] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.8 | mg.kg-1 | PMID[114655] |
| NPT32 | Organism | Mus musculus | Mus musculus | Survival | = | 9.66 | day | PMID[316462] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 97.0 | mg | PMID[316462] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 0.0 | % | PMID[316462] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 23.0 | mg | PMID[316462] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 74.0 | % | PMID[316462] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 8.8 | mg.kg-1 | PMID[722756] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 53.0 | % | PMID[24689881] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.7 | mg.kg-1 | PMID[833828] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 10.0 | mg.kg-1 | PMID[940112] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.24 | umol | PMID[24842703] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 8.83 | % | PMID[24842703] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 47.0 | % | PMID[25016374] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 51.0 | % | PMID[25240256] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 46.8 | % | PMID[25868745] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 50.9 | % | PMID[25868745] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 76.0 | % | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 55.0 | % | PMID[25863493] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 33.5 | % | PMID[25555141] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 81.0 | % | PMID[25522819] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 39.4 | n.a. | PMID[25596479] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 57.43 | % | PMID[25596479] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 32.05 | % | PMID[25881822] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 297.0 | nM | PMID[25634541] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 39.9 | mm | PMID[26009162] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 50.8 | % | PMID[26116178] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 75.8 | % | PMID[26116178] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 77.28 | % | PMID[26117820] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 15.64 | % | PMID[26117820] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 82.17 | % | PMID[26117820] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 78.0 | % | DOI[10.1039/C4MD00236A] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | DOI[10.1039/C4MD00236A] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 32.8 | % | DOI[10.1039/C4MD00236A] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 45.23 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 23.02 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 23.6 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.43 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 34.89 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 26.87 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 53.89 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 56.27 | % | PMID[26490095] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 59.21 | % | PMID[26876930] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 19.05 | % | PMID[26876930] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 22.49 | % | PMID[26876930] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 27.67 | % | PMID[26876930] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 63.39 | % | PMID[26876930] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 53.46 | % | PMID[26876930] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 29.65 | % | PMID[26876930] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 58.0 | % | PMID[27131068] |
| NPT32 | Organism | Mus musculus | Mus musculus | CC50 | > | 200000.0 | nM | PMID[27575472] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 41.1 | mm | PMID[27810240] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.24 | umol | PMID[27787995] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 54.37 | % | PMID[28089698] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 56.7 | % | PMID[28063353] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 50.63 | % | PMID[28063353] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 38.0 | % | PMID[28218838] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 98.6 | % | PMID[28610982] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 73.7 | % | PMID[28610982] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 51.0 | % | PMID[28610982] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 50.0 | % | PMID[28282613] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 42.0 | % | PMID[28282613] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 49.36 | % | PMID[28823493] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 2.08 | 10'6No_unit | PMID[28240894] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 3.52 | ng/ml | PMID[28240894] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 14.29 | uL | PMID[29421570] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 2.12 | umol.kg-1 | PMID[29421570] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 40.0 | % | PMID[29421570] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 52.0 | % | PMID[29421570] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 63.0 | % | PMID[30095904] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 30.0 | % | PMID[30095904] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 53.56 | % | PMID[29751235] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 35.9 | % | PMID[29523468] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 26.83 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 11.96 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 30.94 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 18.65 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 15.63 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 10.28 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 38.74 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 22.76 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 4.85 | % | PMID[29678461] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 34.51 | % | PMID[29656890] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 58.15 | % | PMID[29656890] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 12.57 | ml | PMID[30293795] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 24.51 | ml | PMID[30293795] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 17.39 | ml | PMID[30293795] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 19.06 | ml | PMID[30293795] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 84.07 | % | PMID[30293795] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 72.43 | % | PMID[30293795] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 26.5 | % | PMID[31419126] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 57.7 | % | PMID[30635220] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 64.2 | % | PMID[30635220] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 14.6 | % | PMID[30635220] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 0.49 | mg | PMID[30635220] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 4.84 | 10'6/ml | PMID[32133104] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 65.0 | % | PMID[32133104] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 458.97 | pg/ml | PMID[32133104] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | <= | 329.81 | pg/ml | PMID[32133104] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 64.3 | % | PMID[31160177] |
| NPT32 | Organism | Mus musculus | Mus musculus | ED50 | = | 1.07 | mg | PMID[31471100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 9.01 | mg | PMID[31471100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.22 | mg | PMID[31471100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.97 | % | PMID[31471100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 32.12 | % | PMID[31471100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 6.99 | mg | PMID[31471100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 41.47 | % | PMID[31471100] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 51.1 | % | PMID[32278513] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 78.3 | % | PMID[32278513] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 5.15 | mg | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 43.62 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 25.29 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 52.34 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 46.09 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 30.38 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 19.18 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 12.51 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 25.85 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 19.05 | % | PMID[32386981] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 98.2 | % | PMID[32503692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 48.0 | % | PMID[32503692] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 4.05 | mg | PMID[32672964] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 78.6 | % | PMID[32672964] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 84.4 | % | PMID[31982653] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 7.0 | n.a. | PMID[31982653] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 64.77 | % | PMID[33479680] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 64.91 | % | PMID[33479680] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 60.0 | % | PMID[33479680] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 47.47 | % | PMID[33479680] |
| NPT32 | Organism | Mus musculus | Mus musculus | IC50 | = | 270.0 | nM | PMID[32818604] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 1.05 | mg | PMID[33144244] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 84.8 | % | PMID[33144244] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 88.7 | % | PMID[33144244] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 82.4 | % | PMID[32738961] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 0.36 | mg | PMID[32738961] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 16.3 | n.a. | PMID[32311607] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 61.6 | % | PMID[32311607] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 100.0 | % | PMID[32311607] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 25.5 | % | PMID[32311607] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 53.8 | % | PMID[32311607] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 41.2 | % | PMID[32311607] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 42.0 | % | PMID[32311607] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[34283606] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[35707966] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 71.6 | % | PMID[35707966] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 91.4 | % | PMID[35175765] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 85.84 | % | PMID[34029774] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 72.1 | % | PMID[33454546] |
| NPT32 | Organism | Mus musculus | Mus musculus | Inhibition | = | 98.2 | % | PMID[38516591] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 30.67 | mM | PMID[32485533] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 47.76 | % | PMID[32485533] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 22.88 | n.a. | PMID[36395994] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | n.a. | n.a. | n.a. | PMID[37948340] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 48.83 | % | PMID[36395994] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 30.0 | % | PMID[34137625] |
| NPT32 | Organism | Mus musculus | Mus musculus | Activity | = | 55.0 | % | PMID[34137625] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.9 | umol | PMID[33422907] |
| NPT32 | Organism | Mus musculus | Mus musculus | ID50 | = | 0.3 | mg | PMID[33422907] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | ID50 | = | 9.5 | mg.kg-1 | PMID[6607354] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Inhibition | = | 99.0 | % | PMID[3656356] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | ED50 | < | 10.0 | mg.kg-1 | PMID[3656356] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | ED50 | < | 6.0 | mg.kg-1 | PMID[3965711] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | ED50 | = | 9.12 | mg.kg-1 | PMID[6982340] |
| NPT617 | Organism | Danio rerio | Danio rerio | Ratio | = | 0.5 | n.a. | PMID[22000935] |
| NPT617 | Organism | Danio rerio | Danio rerio | Ratio | = | 0.54 | n.a. | PMID[22000935] |
| NPT617 | Organism | Danio rerio | Danio rerio | Ratio | = | 0.57 | n.a. | PMID[22000935] |
| NPT617 | Organism | Danio rerio | Danio rerio | Ratio | = | 0.48 | n.a. | PMID[22000935] |
| NPT617 | Organism | Danio rerio | Danio rerio | Ratio | = | 0.38 | n.a. | PMID[22000935] |
| NPT617 | Organism | Danio rerio | Danio rerio | Ratio | = | 0.28 | n.a. | PMID[22000935] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | EC50 | = | 200.0 | ug.mL-1 | PMID[6854582] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 6000.0 | nM | PMID[2966247] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 1800.0 | nM | PMID[7359523] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 4000.0 | nM | PMID[3097316] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Inhibition | = | 55.0 | % | PMID[11020281] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 250.0 | nM | PMID[11212091] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 800.0 | nM | PMID[3133477] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 1000.0 | nM | PMID[3133477] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 700.0 | nM | PMID[3133477] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Inhibition | = | 100.0 | % | PMID[7629818] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Inhibition | = | 31.9 | % | PMID[7629818] |
| NPT875 | Organism | Bos taurus | Bos taurus | IC50 | > | 30000.0 | nM | PMID[7932530] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[11229777] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 260.0 | nM | PMID[11229777] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | IC50 | = | 360.0 | nM | PMID[11229777] |
| NPT875 | Organism | Bos taurus | Bos taurus | IC50 | > | 30000.0 | nM | DOI[10.1016/S0960-894X(01)80782-4] |
| NPT605 | Organism | Homo sapiens | Homo sapiens | Activity | = | 1.0 | % | PMID[20022146] |
| NPT1016 | Organism | Canis familiaris | Canis lupus familiaris | ED50 | = | 6.0 | mg.kg-1 | PMID[309946] |
| NPT1016 | Organism | Canis familiaris | Canis lupus familiaris | ED50 | = | 1.7 | mg.kg-1 | PMID[309947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.0 | mg.kg-1 | PMID[6608000] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED40 | = | 2.0 | mg kg-1 | PMID[6608000] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 16.0 | mg kg-1 | PMID[2724294] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 7.0 | mg.kg-1 | PMID[2724294] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 1.0 | % | PMID[3263504] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 66.2 | % | PMID[12877584] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 94.0 | % | PMID[12877584] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.3 | mg.kg-1 | PMID[8151626] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.1 | mg.kg-1 | PMID[10956225] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 60.0 | mg.kg-1 | PMID[10956225] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 31.7 | % | PMID[9871651] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 85.4 | % | PMID[9871651] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 23.9 | % | PMID[1552506] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -20.9 | % | PMID[1552506] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -8.7 | % | PMID[1552506] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -60.2 | % | PMID[1552506] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.0 | % | PMID[14761182] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.3 | mg kg-1 day-1 | PMID[14761182] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.5 | n.a. | PMID[14761182] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.83 | mg.kg-1 | PMID[6606043] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 60.0 | % | PMID[15026065] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.3 | mg kg-1 day-1 | PMID[11206450] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.0 | % | PMID[6977035] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 25.0 | % | PMID[6977035] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 19.0 | % | PMID[6977035] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.7 | mg.kg-1 | PMID[6607999] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.4 | mg.kg-1 | PMID[6607999] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.8 | mg.kg-1 | PMID[6607999] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 2.2 | mg.kg-1 | PMID[6607354] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 0.13 | mg.kg-1 | PMID[6607354] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 3.5 | mg.kg-1 | PMID[6607354] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.8 | mg.kg-1 | PMID[6607354] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 8.3 | mg.kg-1 | PMID[6607354] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 6.4 | mg.kg-1 | PMID[6607354] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[8523403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.47 | mg.kg-1 | PMID[8523403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 7.0 | mg.kg-1 | PMID[8523403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 53.3 | % | PMID[10206543] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 1.4 | mg kg-1 | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 4.0 | mg kg-1 | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.9 | mg.kg-1 | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.0 | % | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 84.0 | % | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.0 | n.a. | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4.0 | n.a. | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 6.0 | n.a. | PMID[3118023] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.3 | mg.kg-1 | PMID[2299620] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | < | 36.3 | % | PMID[2299620] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.44 | mg.kg-1 | PMID[2299620] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 0.9 | mg kg-1 | DOI[10.1016/0960-894X(96)00100-X] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED40 | = | 1.6 | mg kg-1 | PMID[10197959] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 96.5 | % | PMID[10197959] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 41.0 | % | PMID[6609233] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 34.0 | n.a. | PMID[6609233] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 15.4 | n.a. | PMID[6609233] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 60.0 | mg.kg-1 | PMID[9171873] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Potency | = | 1.0 | n.a. | PMID[6436487] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 2.8 | uM kg-1 | DOI[10.1016/S0960-894X(01)81260-9] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[10397507] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.1 | mg.kg-1 | PMID[10397507] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 1.5 | mg.kg-1 | PMID[10397507] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | DOI[10.1016/0960-894X(95)00564-A] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.1 | umol.kg-1 | PMID[2970549] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.84 | uM | PMID[7562922] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[12392741] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.0 | mg.kg-1 | PMID[12392741] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.4 | mg.kg-1 | PMID[12392741] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.2 | mg.kg-1 | PMID[12392741] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED25 | = | 5.0 | uM kg-1 | PMID[7359519] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 37.0 | % | PMID[7359519] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.0 | % | PMID[7359519] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 76.0 | % | PMID[7359519] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 75.0 | % | PMID[7359519] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 100.0 | % | PMID[7731014] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 18.0 | % | PMID[7731014] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 98.0 | n.a. | PMID[8627608] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 69.0 | % | PMID[3104589] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | > | 100000.0 | nM | PMID[3104589] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 80.0 | % | PMID[11597401] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 1.0 | mg kg-1 b.i.d. | PMID[9873604] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.0 | % | PMID[9873604] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 0.4 | mg kg-1 | DOI[10.1016/0960-894X(96)00101-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.0 | mg.kg-1 | DOI[10.1016/0960-894X(96)00101-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 5.0 | mg.kg-1 | PMID[7131493] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 6.0 | mg.kg-1 | PMID[7131493] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.1 | mg.kg-1 | PMID[7131493] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 320.0 | mg.kg-1 | PMID[7131493] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.6 | mg.kg-1 | PMID[10197960] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.6 | mg.kg-1 | PMID[10197960] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 13.36 | % | PMID[10197960] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 7.3 | n.a. | PMID[2113951] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | > | 100000.0 | nM | PMID[10821716] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 0.8 | mg kg-1 | PMID[10821716] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 0.06 | mg kg-1 | PMID[10821716] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.0058 | mg.kg-1 | PMID[10821716] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.0046 | mg.kg-1 | PMID[10821716] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.37 | mg.kg-1 | PMID[10821716] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.15 | mg.kg-1 | PMID[10821716] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 800.0 | nM | PMID[6502598] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 63.0 | % | PMID[6502598] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.4 | umol.kg-1 | PMID[6502598] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Potency | = | 20.0 | % | PMID[6502598] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 66.0 | % | DOI[10.1016/0960-894X(95)00131-C] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 994.7 | units ml-1 | PMID[1469696] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | < | 25.0 | % | PMID[1469696] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | < | 0.7 | ng ml-1 | PMID[1469696] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 97.0 | % | PMID[1469696] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.8 | % | PMID[1469696] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.6 | mg.kg-1 | PMID[11906292] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.13 | mg.kg-1 | PMID[11906292] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.4 | mg.kg-1 | PMID[11906292] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.1 | mg.kg-1 | PMID[11906292] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.0 | mg.kg-1 | PMID[3491210] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.3 | mg.kg-1 | PMID[3965711] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | > | 25.0 | mg.kg-1 | PMID[3965711] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.0 | umol.kg-1 | PMID[6827539] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Potency | = | 1.0 | n.a. | PMID[2115589] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.3 | mg.kg-1 | PMID[3875725] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 24.1 | % | PMID[11738562] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.8 | % | PMID[1875355] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[10406640] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.1 | mg.kg-1 | PMID[10406640] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.5 | mg.kg-1 | PMID[10406640] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.2 | mg.kg-1 | PMID[10406640] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[10465547] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.1 | mg.kg-1 | PMID[10465547] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.5 | mg.kg-1 | PMID[10465547] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.2 | mg.kg-1 | PMID[10465547] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[9873621] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.1 | mg.kg-1 | PMID[9873621] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 1.5 | mg.kg-1 | PMID[9873621] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 0.2 | mg kg-1 day-1 b.i.d. | PMID[9873621] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 100.0 | % | PMID[11591502] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.3 | mg.kg-1 | PMID[6982340] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.44 | mg.kg-1 | PMID[6982340] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.3 | mg.kg-1 | PMID[6982340] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.22 | mg.kg-1 | PMID[6982340] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | < | 45.0 | % | PMID[7205873] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.1 | mg.kg-1 | PMID[7205873] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | < | 25.0 | % | PMID[7205873] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | < | 19.0 | % | PMID[7205873] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.0 | % | PMID[2145433] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 24.0 | % | PMID[2145433] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 0.0 | % | PMID[2145433] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 100.0 | % | PMID[2145433] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 70.0 | % | PMID[2145433] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 88.0 | % | PMID[2145433] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.5 | mg.kg-1 | PMID[6965727] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | > | 6.0 | mg.kg-1 | PMID[6965727] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 6.5 | mg.kg-1 | PMID[6965727] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.6 | mg.kg-1 | PMID[6965727] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Mortality | = | 50.0 | % | PMID[15203134] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.0 | % | PMID[9873468] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 64.9 | % | PMID[9873468] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 72.8 | % | PMID[9873468] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 11.0 | umol.kg-1 | PMID[12565932] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.11 | mg.kg-1 | PMID[9135032] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.15 | mg.kg-1 | PMID[9135032] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.1 | mg.kg-1 | PMID[9135032] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.2 | mg.kg-1 | PMID[10649977] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.22 | mg.kg-1 | PMID[10649977] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.5 | mg.kg-1 | PMID[10649977] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 16.0 | mg kg-1 | PMID[3572970] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.0 | mg.kg-1 | PMID[3572970] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 7.0 | mg.kg-1 | PMID[3572970] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 16.0 | n.a. | PMID[3097317] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 33.0 | % | PMID[3488405] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.0 | % | PMID[3488405] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.0 | % | PMID[3488405] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 84.0 | % | PMID[1995900] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.0 | % | PMID[1995900] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.0 | % | PMID[1995900] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -123.8 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 11.3 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 1.7 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 4.0 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -1.7 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -22.2 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 41.8 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 40.2 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 40.0 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 29.5 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -57.1 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 26.2 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 55.5 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.7 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.2 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -28.3 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -7.9 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 4.4 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 16.9 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -8.1 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -3.0 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 10.0 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 1.6 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 7.5 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -21.2 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | -1.5 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 22.5 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 25.5 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 24.5 | % | PMID[8071938] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 63.0 | % | PMID[1732553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 34.0 | % | PMID[1732553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 71.0 | % | PMID[1732553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 61.0 | % | PMID[1732553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 83.0 | % | PMID[1732553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 69.0 | % | PMID[1732553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | IC50 | = | 60000.0 | nM | PMID[2547071] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[7332706] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.4 | mg.kg-1 | PMID[7332706] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 42.0 | % | PMID[15081007] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 4.2 | mg.kg-1 | PMID[15943479] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[16190766] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 53.9 | % | PMID[16309906] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 27.0 | % | PMID[16309906] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 50.0 | mm | PMID[17181159] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[17444626] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 95.3 | % | PMID[17079151] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[17052805] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 60.4 | % | PMID[17129641] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 71.1 | % | PMID[17267228] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 82.6 | % | PMID[17267228] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 66.4 | % | PMID[17267228] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.175 | ml | PMID[17267228] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.195 | ml | PMID[17267228] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.46 | ml | PMID[17267228] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.278 | ml | PMID[17267228] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 11.7 | umol.kg-1 | PMID[17509888] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 34.4 | n.a. | PMID[17509888] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[17604175] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 176.7 | % | PMID[17408809] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 286.6 | % | PMID[17408809] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 53.33 | % | PMID[17189665] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[17942306] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.0 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.0 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.22 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.8 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.15 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 13.33 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -0.39 | degrees C | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -1.03 | degrees C | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -0.11 | degrees C | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.02 | degrees C | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.3 | degrees C | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.35 | degrees C | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.55 | degrees C | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 37.5 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 43.94 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 46.48 | % | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 5.68 | g | PMID[17964781] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 95.0 | % | PMID[17994684] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 97.0 | % | PMID[17994684] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.0 | g | PMID[18072726] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 39.0 | mm2 | PMID[18072726] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 43.0 | % | PMID[18243692] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 56.0 | % | PMID[18243692] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 73.0 | % | PMID[17993277] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 16.0 | % | PMID[17993277] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 11.8 | umol.kg-1 | PMID[18314945] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 51.8 | % | PMID[18314945] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 67.6 | % | PMID[18314945] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 46.4 | % | PMID[18158248] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 42.6 | % | PMID[18158248] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.2 | % | PMID[18158248] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.9 | % | PMID[18158248] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.014 | mmol | PMID[1919590] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.0 | % | PMID[17689837] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 59.67 | % | PMID[17804121] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 9.58 | umol | PMID[17532544] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[17532544] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.25 | ml | PMID[17532544] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 74.4 | % | PMID[17532544] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 92.0 | % | PMID[17602797] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.5 | % | PMID[18242782] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 44.1 | % | PMID[18242782] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 52.7 | % | PMID[18242782] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 32.3 | % | PMID[18242782] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 20.5 | % | PMID[18242782] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 11.7 | % | PMID[18242782] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | PMID[18455272] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.6 | % | PMID[18455272] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.3 | % | PMID[18455272] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.5 | % | PMID[18455272] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 60.8 | % | PMID[18455273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 40.1 | % | PMID[18455273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 31.5 | % | PMID[18455273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.0 | % | PMID[18977557] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.0 | % | PMID[18977557] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.22 | % | PMID[18977557] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.8 | % | PMID[18977557] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.5 | % | PMID[19056146] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 98.33 | pg/ml | PMID[19056146] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 85.0 | % | PMID[15043416] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 9.7 | umol.kg-1 | PMID[18430576] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[18430576] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 74.4 | % | PMID[18430576] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 35.0 | % | PMID[17959273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 43.0 | % | PMID[17959273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 75.0 | % | PMID[17959273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 76.0 | % | PMID[17959273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 85.0 | % | PMID[17959273] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.6 | % | PMID[18242783] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.5 | % | PMID[18242783] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.2 | % | PMID[18242783] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.1 | % | PMID[18242783] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 38.1 | degrees C | PMID[18485539] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 37.9 | degrees C | PMID[18485539] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 37.8 | degrees C | PMID[18485539] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 37.7 | degrees C | PMID[18485539] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 37.5 | degrees C | PMID[18485539] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 62.9 | % | PMID[18579259] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | DOI[10.1021/np50099a009] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[18819796] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -35.48 | % | PMID[18783947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -39.79 | % | PMID[18783947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -33.33 | % | PMID[18783947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -41.12 | % | PMID[18783947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 52.2 | % | PMID[18063224] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 63.1 | % | PMID[18063224] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 93.2 | % | PMID[18063224] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | PMID[18045747] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 72.9 | % | PMID[18947903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 70.7 | % | PMID[18947903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 61.3 | % | PMID[18947903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.5 | % | PMID[18947903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.0 | % | PMID[18947903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.0 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.0 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.22 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.8 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.15 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 13.33 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -0.39 | degrees C | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -1.03 | degrees C | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -0.11 | degrees C | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.22 | degrees C | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.3 | degrees C | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.35 | degrees C | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.55 | degrees C | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 37.5 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 43.94 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 46.48 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 5.68 | % | PMID[17945398] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[19150597] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.307 | g | PMID[18063443] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.072 | g | PMID[18063443] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 21.8 | g | PMID[18063443] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.0 | % | PMID[19419861] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.09 | ml | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.158 | ml | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.18 | ml | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.227 | ml | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 56.5 | % | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 52.4 | % | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 65.4 | % | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 67.8 | % | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 98.33 | pg/ml | PMID[19027198] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[19232783] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.0 | % | PMID[18722034] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.0 | % | PMID[18722034] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 82.0 | % | PMID[18722034] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 46.38 | % | PMID[19321237] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.84 | % | PMID[19321237] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 52.63 | % | PMID[19321237] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 78.0 | % | PMID[19781823] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 50.0 | % | PMID[19781823] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[19781823] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -9.0 | g | PMID[19781823] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[19939514] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | PMID[19913952] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.2 | % | PMID[19628310] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 35.55 | % | PMID[19628310] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 30.95 | % | PMID[19628310] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 27.32 | % | PMID[19628310] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 72.0 | % | PMID[19744861] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.0 | % | PMID[19744861] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 76.0 | % | PMID[19744861] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 83.0 | % | PMID[19744861] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 61.0 | % | PMID[19699644] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[20138770] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 52.68 | % | PMID[19647903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.33 | % | PMID[19647903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.89 | % | PMID[19647903] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 24.8 | % | PMID[20153090] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 20.97 | % | PMID[20153090] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 26.29 | % | PMID[20153090] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 20.19 | % | PMID[20153090] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 49.8 | ml | PMID[20137837] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 42.9 | ml | PMID[20137837] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 45.9 | ml | PMID[20137837] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 46.9 | ml | PMID[20137837] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 43.4 | % | PMID[20172630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 26.0 | mm | PMID[20172630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[20609589] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.3 | % | PMID[20731361] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.1 | % | PMID[20731361] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 54.3 | % | PMID[20731361] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.0 | % | PMID[20727750] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.4 | % | PMID[20817324] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.3 | % | PMID[20817329] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 75.0 | % | PMID[20800934] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.0 | % | PMID[20800934] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 52.79 | % | PMID[20801553] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[21049954] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[21041094] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 47.0 | % | PMID[20888086] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 9.64 | umol | PMID[20970223] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 73.2 | % | PMID[20970223] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[20970223] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[21106277] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 11.7 | umol.kg-1 | PMID[21280601] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 90.2 | % | PMID[21284386] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4.9 | % | PMID[21284386] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.39 | % | PMID[21284386] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[21507662] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[21514701] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 38.4 | % | PMID[21608987] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 41.0 | % | PMID[21724403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.0 | % | PMID[21724403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 49.0 | % | PMID[21724403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 13.0 | % | PMID[21724403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.42 | cm | PMID[21724403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 11.48 | cm | PMID[21724403] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 66.89 | % | PMID[21724303] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 70.26 | % | PMID[21724303] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 69.81 | % | PMID[21724303] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 53.5 | % | PMID[21816516] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.9 | % | PMID[21816516] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.8 | % | PMID[21816516] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.6 | % | PMID[21816516] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 83.0 | % | PMID[22137931] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.0 | % | PMID[22137931] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 70.0 | % | PMID[22137931] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.0 | % | PMID[22137931] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 87.0 | % | PMID[22137931] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.0 | % | PMID[22189137] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 49.7 | % | PMID[22142423] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.74 | % | PMID[22318166] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.0 | mg.kg-1 | PMID[22318166] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 100.0 | % | PMID[22365409] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 76.9 | % | PMID[22365409] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.0 | % | PMID[22365409] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 64.8 | % | PMID[22365409] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 59.9 | % | PMID[22365409] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 62.8 | % | PMID[22365409] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 61.0 | % | PMID[22356737] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 38.3 | % | PMID[22148253] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 58.1 | % | PMID[22795833] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 65.8 | % | PMID[22795833] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 70.1 | % | PMID[22795833] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.1 | % | PMID[22633122] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.0 | % | PMID[22818041] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 39.0 | % | PMID[22818041] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[22818041] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | PMID[22818041] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 10.0 | % | PMID[22818041] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[22835720] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 48.8 | ml | PMID[22846796] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 43.6 | ml | PMID[22846796] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 46.4 | ml | PMID[22846796] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 47.8 | ml | PMID[22846796] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[22126405] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 70.2 | % | PMID[22981329] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.3 | % | PMID[22981329] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 87.26 | % | PMID[22981329] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 23.0 | % | PMID[23159805] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.0 | % | PMID[23159805] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 39.0 | % | PMID[23159805] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 34.0 | % | PMID[23159805] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 13.0 | % | PMID[23146282] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 49.0 | % | PMID[23146282] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.0 | % | PMID[23146282] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 41.0 | % | PMID[23146282] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.0 | % | DOI[10.1007/s00044-011-9853-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.0 | % | DOI[10.1007/s00044-011-9853-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 41.0 | % | DOI[10.1007/s00044-011-9853-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 20.0 | % | DOI[10.1007/s00044-011-9895-7] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 75.0 | % | DOI[10.1007/s00044-011-9898-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.0 | % | DOI[10.1007/s00044-011-9898-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 70.0 | % | DOI[10.1007/s00044-011-9898-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.84 | % | DOI[10.1007/s00044-011-9862-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 21.98 | nmol | DOI[10.1007/s00044-011-9901-0] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 77.21 | % | DOI[10.1007/s00044-011-9901-0] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.48 | % | DOI[10.1007/s00044-011-9901-0] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.35 | % | DOI[10.1007/s00044-012-9969-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 74.7 | % | DOI[10.1007/s00044-011-9823-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 77.2 | % | DOI[10.1007/s00044-011-9823-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 81.9 | % | DOI[10.1007/s00044-011-9823-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 69.6 | % | DOI[10.1007/s00044-011-9823-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | DOI[10.1007/s00044-012-9975-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.75 | mm | DOI[10.1007/s00044-012-9975-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.25 | mm | DOI[10.1007/s00044-012-9975-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.25 | mm | DOI[10.1007/s00044-012-9975-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.12 | mm | DOI[10.1007/s00044-012-9975-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 42.3 | mg | DOI[10.1007/s00044-011-9870-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 74.6 | % | DOI[10.1007/s00044-011-9870-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 77.3 | % | DOI[10.1007/s00044-011-9870-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.5 | % | DOI[10.1007/s00044-011-9870-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 62.6 | % | DOI[10.1007/s00044-011-9870-3] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.5 | % | DOI[10.1007/s00044-011-9847-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 13.86 | % | DOI[10.1007/s00044-011-9747-5] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 77.21 | % | DOI[10.1007/s00044-011-9552-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.48 | % | DOI[10.1007/s00044-011-9552-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 74.87 | % | DOI[10.1007/s00044-011-9589-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 57.39 | % | DOI[10.1007/s00044-011-9589-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 48.35 | % | DOI[10.1007/s00044-011-9589-1] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 0.113 | % | DOI[10.1007/s00044-010-9339-9] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 7.95 | nmol | DOI[10.1007/s00044-009-9281-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 66.87 | % | DOI[10.1007/s00044-009-9281-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.74 | % | DOI[10.1007/s00044-009-9281-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | DOI[10.1007/s00044-011-9726-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | -15.0 | g | DOI[10.1007/s00044-011-9726-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 80.0 | % | DOI[10.1007/s00044-011-9726-x] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 74.17 | % | DOI[10.1007/s00044-010-9363-9] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 57.39 | % | DOI[10.1007/s00044-010-9363-9] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 48.35 | % | DOI[10.1007/s00044-010-9363-9] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 12.88 | % | DOI[10.1007/s00044-009-9163-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 24.69 | % | DOI[10.1007/s00044-009-9163-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 21.84 | % | DOI[10.1007/s00044-009-9163-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 19.27 | % | DOI[10.1007/s00044-009-9163-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 30.88 | % | DOI[10.1007/s00044-009-9163-2] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.0 | % | DOI[10.1007/s00044-009-9174-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | DOI[10.1007/s00044-009-9174-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 50.0 | % | DOI[10.1007/s00044-009-9174-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 49.0 | % | DOI[10.1007/s00044-009-9174-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 9.29 | nmol | DOI[10.1007/s00044-009-9194-8] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 76.5 | % | DOI[10.1007/s00044-009-9194-8] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.15 | % | DOI[10.1007/s00044-009-9194-8] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | DOI[10.1007/s00044-009-9203-y] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 60.81 | % | DOI[10.1007/s00044-011-9691-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 40.13 | % | DOI[10.1007/s00044-011-9691-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 31.51 | % | DOI[10.1007/s00044-011-9691-4] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.43 | % | DOI[10.1007/s00044-007-9013-z] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.75 | % | DOI[10.1007/s00044-011-9819-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.2 | mg.kg-1 | DOI[10.1007/s00044-011-9819-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 19.4 | mm | DOI[10.1007/s00044-011-9819-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 20.22 | % | DOI[10.1007/s00044-012-9973-5] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 20.15 | % | DOI[10.1007/s00044-012-9973-5] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 21.12 | % | DOI[10.1007/s00044-012-9973-5] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 23.22 | % | DOI[10.1007/s00044-012-9973-5] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 28.56 | % | DOI[10.1007/s00044-012-9973-5] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 75.2 | % | DOI[10.1007/s00044-012-0046-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 78.3 | % | DOI[10.1007/s00044-012-0046-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 62.9 | % | DOI[10.1007/s00044-012-0097-8] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 84.0 | % | DOI[10.1007/s00044-013-0507-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 73.0 | % | DOI[10.1007/s00044-013-0507-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 52.0 | % | DOI[10.1007/s00044-013-0507-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 70.99 | % | DOI[10.1007/s00044-012-0321-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.52 | % | DOI[10.1007/s00044-012-0321-6] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.78 | ml | PMID[23290048] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.95 | ml | PMID[23290048] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.86 | ml | PMID[23290048] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[23291118] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 86.46 | % | PMID[23416192] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 80.94 | % | PMID[23416192] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 84.17 | % | PMID[23416192] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 94.37 | % | PMID[23416192] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.78 | ml | PMID[23357629] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.95 | ml | PMID[23357629] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.86 | ml | PMID[23357629] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 33.19 | % | PMID[23548704] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 47.0 | % | PMID[23567956] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EC50 | = | 1.0 | mg kg-1 | PMID[23687559] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 87.0 | % | PMID[23665142] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 83.0 | % | PMID[23665142] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 74.0 | % | PMID[23665142] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.0 | % | PMID[23665142] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | PMID[23665142] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 86.0 | % | PMID[23693150] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.0 | % | PMID[23693150] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 91.3 | % | PMID[23787438] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 75.5 | % | PMID[23787438] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.1 | % | PMID[23787438] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 10.5 | % | PMID[23787438] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 90.23 | % | PMID[23769654] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 84.97 | % | PMID[23769654] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 90.3 | % | PMID[23769654] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 95.95 | % | PMID[23769654] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.21 | % | PMID[23993677] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.22 | % | PMID[23993677] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 28.38 | % | PMID[23993677] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 19.24 | % | PMID[23993677] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 69.0 | % | PMID[24177361] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 75.0 | % | PMID[24177361] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 78.0 | % | PMID[24177361] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 74.0 | % | PMID[24177361] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.06 | % | PMID[24211633] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 82.25 | % | PMID[24211633] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.57 | mm | PMID[24361187] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.81 | mm | PMID[24361187] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.05 | mm | PMID[24361187] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 87.0 | % | PMID[24308998] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 83.0 | % | PMID[24308998] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 74.0 | % | PMID[24308998] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.0 | % | PMID[24308998] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | PMID[24308998] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 35.5 | % | PMID[423183] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.8 | mg.kg-1 | PMID[423183] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.3 | mg.kg-1 | PMID[423183] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 55.0 | % | PMID[24631895] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.0 | % | PMID[24631895] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.0 | % | PMID[24631895] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 81.0 | % | PMID[24631895] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 86.0 | % | PMID[24631895] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.0 | % | PMID[536992] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 23.5 | umol.kg-1 | PMID[671462] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.7 | mg.kg-1 | PMID[102794] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.27 | mg.kg-1 | PMID[102794] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.7 | mg | PMID[102794] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 17.0 | % | PMID[314983] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 83.0 | % | PMID[314983] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | < | 1.0 | mg.kg-1 | PMID[114655] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 3.0 | mg.kg-1 | PMID[114655] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 24.0 | % | PMID[533886] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.0 | % | PMID[533886] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.35 | mg.kg-1 | PMID[845879] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 1.8 | mg.kg-1 | PMID[845879] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 46.0 | % | PMID[533886] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 40.0 | % | PMID[533886] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 19.0 | % | PMID[533886] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 20.0 | % | PMID[533886] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.2 | mg.kg-1 | PMID[722756] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.2 | mg.kg-1 | PMID[309947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 1.8 | mg.kg-1 | PMID[309947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.27 | mg.kg-1 | PMID[309947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 5.2 | mg.kg-1 | PMID[309947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 5.4 | mg.kg-1 | PMID[309947] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.0 | % | PMID[24689881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.2 | mg.kg-1 | PMID[1255663] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED30 | = | 1.3 | mg kg-1 | PMID[1255663] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.35 | mg.kg-1 | PMID[833828] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.47 | mg.kg-1 | PMID[833828] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.27 | mg.kg-1 | PMID[833828] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 1.8 | mg.kg-1 | PMID[833828] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 98.5 | % | PMID[903922] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 106.8 | % | PMID[903922] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 4.4 | mg.kg-1 | PMID[915913] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 26.0 | % | PMID[940112] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.0 | % | PMID[940112] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 85.0 | % | PMID[940112] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ID50 | = | 8.4 | mg.kg-1 | PMID[940112] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.53 | mg kg-1 | PMID[940112] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 0.2 | mg.kg-1 | PMID[950647] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.144 | mm | PMID[24835630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.84 | % | PMID[24835630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.985 | mm | PMID[24835630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 75.98 | % | PMID[24835630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.83 | % | PMID[24835630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[24835630] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 54.0 | % | PMID[24983538] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 66.0 | % | PMID[24983538] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.0 | % | PMID[24983538] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 81.0 | % | PMID[24983538] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 84.0 | % | PMID[24983538] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[24983538] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 7.79 | umol | PMID[25462274] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 30.41 | nmol | PMID[25462274] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 85.2 | umol | PMID[25462274] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 67.6 | U/L | PMID[25462246] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 92.5 | U/L | PMID[25462246] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.1 | mg/L | PMID[25462246] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.6 | U/L | PMID[25462246] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 26.2 | umol/L | PMID[25462246] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.7 | nmol/ml | PMID[25462246] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.16 | ml | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 93.69 | % | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 88.42 | % | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 91.32 | % | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 91.48 | % | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.14 | ml | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.07 | ml | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.15 | ml | PMID[25702850] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 69.34 | % | PMID[25765910] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 68.11 | % | PMID[25765910] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 55.55 | % | PMID[25765910] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 6.73 | nmol | PMID[25522819] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Ratio | = | 1.0 | n.a. | PMID[25522819] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.8 | % | PMID[25522819] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.37 | % | PMID[25522819] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.608 | ml | PMID[25596479] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.54 | ml | PMID[25596479] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 72.05 | % | PMID[25596479] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 77.02 | % | PMID[25596479] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 61.3 | % | PMID[25937011] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 55.3 | % | PMID[25937011] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.3 | % | PMID[25937011] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 58.0 | % | PMID[25937011] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 0.0 | % | PMID[25937011] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 73.07 | % | PMID[26160113] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 80.0 | % | PMID[26160113] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 82.92 | % | PMID[26160113] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 84.52 | % | PMID[26160113] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.62 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 59.48 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 60.5 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 60.02 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 62.64 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 57.81 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 21.13 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 54.28 | mg | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 33.13 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 39.7 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 42.44 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 45.92 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 51.26 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 54.22 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.77 | % | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 121.56 | U/ml | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 52.83 | U/ml | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 26.24 | U | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.24 | g/dl | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.08 | g/dl | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.84 | mg/dl | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 62.74 | mg/dl | PMID[26117820] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 42.0 | % | PMID[26494261] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[26515039] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 8.3 | % | PMID[26546221] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 42.0 | % | PMID[26750253] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 76.31 | % | PMID[28089698] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 73.57 | % | PMID[28089698] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 66.23 | % | PMID[28089698] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 66.45 | % | PMID[28089698] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 19.4 | mm | PMID[28512025] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 75.0 | % | PMID[28512025] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 2.2 | mg.kg-1 | PMID[28512025] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.0 | % | PMID[29517911] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.0 | % | PMID[29517911] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 54.0 | % | PMID[29517911] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 48.0 | % | PMID[29517911] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.2 | % | PMID[29517911] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 90.0 | % | PMID[30017112] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 55.0 | % | PMID[30017112] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 74.49 | % | PMID[29031075] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 98.29 | % | PMID[29031075] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[29031075] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ED50 | = | 9.568 | umol | PMID[29031075] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.61 | mm | PMID[29751235] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.86 | mm | PMID[29751235] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.83 | mm | PMID[29751235] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 37.13 | % | PMID[29751235] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 41.64 | % | PMID[29751235] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 33.88 | % | PMID[29751235] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 39.7 | % | PMID[29751235] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.92 | % | PMID[29778893] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 63.53 | % | PMID[29778893] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 64.84 | % | PMID[29778893] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 63.58 | % | PMID[29778893] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[29207337] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.5 | % | PMID[29207337] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 32.3 | % | PMID[31655429] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 56.39 | % | PMID[31655429] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 80.96 | % | PMID[30469039] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 63.56 | % | PMID[30469039] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 49.1 | % | PMID[30826188] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.49 | mm | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.92 | mm | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 12.3 | % | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.85 | mm | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 10.3 | % | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.81 | mm | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 9.4 | % | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 3.73 | mm | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 8.0 | % | PMID[30904755] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 54.54 | % | PMID[31228811] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 80.2 | % | PMID[31803395] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 55.6 | % | PMID[31803395] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 62.5 | % | PMID[31803395] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 79.8 | % | PMID[31803395] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 65.2 | % | PMID[31803395] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.73 | % | PMID[31330449] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 47.0 | % | PMID[30715875] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 70.0 | % | PMID[31843462] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 34.7 | % | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 54.17 | % | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 63.7 | % | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 69.37 | % | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 78.83 | % | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 7.17 | cm | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 5.83 | cm | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 5.0 | cm | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4.67 | cm | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4.5 | cm | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 4.17 | cm | PMID[32127262] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.36 | mm | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 34.6 | % | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.1 | mm | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 66.4 | % | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.04 | mm | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 48.22 | % | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.12 | mm | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 46.7 | % | PMID[31982653] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.11 | mm | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 53.0 | % | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.85 | mm | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 59.0 | % | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.59 | mm | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 67.0 | % | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.18 | mm | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 87.0 | % | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.12 | mm | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 86.0 | % | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 100.0 | % | PMID[32311607] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 45.3 | % | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 86.7 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 80.98 | % | PMID[34029774] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.96 | mm | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 43.3 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 79.41 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 57.79 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | n.a. | n.a. | n.a. | PMID[36170566] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 47.0 | % | PMID[27494166] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2.06 | ml | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.121 | ng/ml | PMID[36170566] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 11.1 | % | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 40.19 | % | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 71.2 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 55.2 | % | PMID[33422907] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Inhibition | = | 81.9 | % | PMID[34029774] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 74.56 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 24.64 | % | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.55 | mm | PMID[34245948] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 100.0 | % | PMID[34245948] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.65 | ml | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 1.85 | ml | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 83.0 | % | PMID[34245948] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 85.9 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 33.15 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 80.32 | % | PMID[30119011] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 66.46 | % | PMID[34245948] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 28.89 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 50.81 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 30.95 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 74.82 | % | PMID[30119011] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 2620.0 | U/L | PMID[36170566] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 40.0 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 45.0 | % | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 31.6 | % | PMID[37043995] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | UI | = | 20.2 | n.a. | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 56.8 | % | PMID[32485533] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 0.42 | mm | PMID[34245948] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | Activity | = | 73.29 | % | PMID[34245948] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Homo sapiens | n.a. | T1/2 | = | 0.36 | hr | PMID[36170566] |
| n.a. | n.a. | LogD | = | 1.01 | n.a. | PMID[33569941] |
| n.a. | n.a. | LogP | = | 2.9 | n.a. | PMID[37859716] |
| n.a. | n.a. | LogD | = | 1.03 | n.a. | PMID[36270005] |
| n.a. | n.a. | LogP | = | 2.9 | n.a. | PMID[36495814] |
| n.a. | n.a. | LogP | = | 2.9 | n.a. | PMID[38389890] |
| Bacteroides thetaiotaomicron | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides stercoris | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Clostridium spiroforme | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides fragilis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Limosilactobacillus reuteri CF48-3A | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bifidobacterium breve | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Segatella copri | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides pectinophilus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Thomasclavelia ramosa | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides cellulosilyticus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Phocaeicola dorei | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Parabacteroides merdae | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides xylanisolvens | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Anaerotruncus colihominis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Dorea formicigenerans | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Roseburia intestinalis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Clostridioides difficile | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Marvinbryantia formatexigens | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Parabacteroides johnsonii | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides caccae | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides sp. WH2 | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Providencia rettgeri | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Collinsella aerofaciens | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides finegoldii | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Escherichia coli | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides coprophilus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides ovatus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Clostridium sporogenes | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Eubacterium rectale | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Clostridium scindens | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Enterobacter cancerogenus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Odoribacter splanchnicus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Homo sapiens | n.a. | Papp | = | 27.0 | 10^-6 cm/s | PMID[38389890] |
| Parabacteroides distasonis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Akkermansia muciniphila | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Eubacterium ventriosum | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Rattus norvegicus | Brain/Plasma | K(p,uu,brain) | = | 0.074 | n.a. | PMID[33619967] |
| Rattus norvegicus | Plasma | Fu | = | 0.008 | n.a. | PMID[33619967] |
| Bifidobacterium adolescentis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides uniformis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Proteus penneri | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Victivallis vadensis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bacteroides eggerthii | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Ruminococcus gnavus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Phocaeicola vulgatus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Homo sapiens | n.a. | Papp | = | 18.0 | 10^-6 cm/s | PMID[36495814] |
| Bifidobacterium longum subsp. Infantis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Anaerococcus hydrogenalis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Enterococcus faecalis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Bifidobacterium ruminantium | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Salmonella enterica subsp. enterica | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Ruminococcus torques | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Collinsella intestinalis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Rattus norvegicus | n.a. | T1/2 | = | 7.0 | hr | PMID[38516587] |
| Bacteroides intestinalis | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Clostridium symbiosum | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Blautia hansenii | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Anaerobutyricum hallii | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Blautia luti | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Clostridium hathewayi | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Anaerostipes sp. | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Alistipes indistinctus | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Eubacterium biforme | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Coprococcus comes | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Edwardsiella tarda | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Providencia stuartii | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Rattus norvegicus | Brain | Fu | = | 0.048 | n.a. | PMID[33619967] |
| Clostridium sp. | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Providencia alcalifaciens | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Clostridium bolteae | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
| Eggerthella lenta | n.a. | Biotransformation | n.a. | n.a. | n.a. | PMID[31158845] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Rattus norvegicus | LD50 | = | 18.9 | mg.kg-1 | PMID[940112] |
| - | Rattus norvegicus | LD50 | = | 12.0 | mg.kg-1 | PMID[6965727] |
| - | Rattus norvegicus | LD50 | = | 18.5 | mg.kg-1 | PMID[6982340] |
| - | Rattus norvegicus | LD50 | = | 12.0 | mg.kg-1 | PMID[3965711] |
| - | Rattus norvegicus | LD50 | = | 19.8 | mg.kg-1 | PMID[6620298] |
| - | Mus musculus | LD50 | = | 50.0 | mg.kg-1 | PMID[102794] |
| - | Mus musculus | LD50 | > | 300.0 | umol.kg-1 | PMID[20817324] |
| - | Mus musculus | LD50 | = | 33.0 | mg.kg-1 | PMID[18063443] |
| - | Mus musculus | LD50 | = | 25.0 | mg.kg-1 | PMID[17959273] |
| - | Mus musculus | LD50 | = | 15.0 | mg.kg-1 | PMID[17959273] |
| - | Mus musculus | LD50 | = | 50.0 | mg.kg-1 | PMID[18455273] |
| - | Mus musculus | LD50 | = | 160.0 | mg.kg-1 | PMID[6972450] |
| - | Mus musculus | LD50 | = | 24.3 | mg.kg-1 | PMID[6965727] |
| - | Mus musculus | LD50 | = | 20.0 | mg.kg-1 | PMID[6218302] |
| - | Mus musculus | LD50 | = | 15.0 | mg.kg-1 | PMID[11597401] |
| - | Mus musculus | LD50 | = | 23.0 | mg.kg-1 | PMID[2299620] |
| - | Mus musculus | LD50 | = | 19.9 | mg.kg-1 | PMID[6606043] |
| - | Canine coronavirus | LD50 | = | 550.0 | uM | PMID[34534839] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC331672 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| NPC |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC331672 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
