NPASS Compound

Natural Product: NPC27650

Natural Product ID	NPC27650
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HWPZOSPUENCAFV-PZPVWFPISA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11968972
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 130136 0 0 0 0 0 0 0 0999 V2000 12.0610 0.0420 2.3786 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7449 -0.5547 1.9989 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6760 0.1869 1.7881 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8573 1.6691 1.9522 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3678 -0.3658 1.4124 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3660 0.3872 1.2203 N 0 0 0 0 0 0 0 0 0 0 0 0 6.0335 0.0782 0.8585 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8704 -0.5954 -0.4532 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0478 -1.7042 -0.5558 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8798 -2.3429 -1.7795 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5315 -1.8770 -2.9018 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3519 -0.7749 -2.8110 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5031 -0.1576 -1.5873 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2553 1.3899 0.8870 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8395 1.2386 0.5471 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4036 1.8072 -0.5246 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8796 0.5429 1.2508 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5821 0.4208 0.9082 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0602 -0.9715 0.5114 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3885 -0.8887 0.5914 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4525 -1.6193 -0.0405 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7070 -0.8938 -0.4755 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1876 0.4042 -0.0765 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8726 1.3708 -1.2847 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7066 0.5518 0.0034 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4965 -0.7041 0.0437 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0939 -1.5245 -1.0772 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6598 -1.9509 -0.9391 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8838 -1.9270 -2.4860 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8114 -0.8901 -2.2762 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6263 -3.2511 -0.5591 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8208 -3.9002 0.5906 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1196 -3.2586 1.6181 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6860 -5.4056 0.6707 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2679 1.3800 -0.9470 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0364 2.4122 -0.4487 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3994 2.4009 -1.1514 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7749 3.7877 -1.6033 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4921 4.7699 -0.4614 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0160 4.7130 -0.2145 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4485 3.6241 -0.8242 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9038 6.0445 -0.8398 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0865 3.7935 -2.0122 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2849 1.6170 -2.2994 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7217 1.2472 1.0132 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5193 2.1263 1.1933 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6725 1.6118 2.1109 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5868 0.7320 2.0417 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5916 1.2147 1.7489 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8986 2.5622 2.2109 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6043 -0.7616 2.0684 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4633 -1.3761 2.9235 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8422 -1.3569 2.6556 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5643 2.9627 2.2569 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0873 3.7981 3.1952 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7915 3.2605 4.0885 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8893 5.2604 3.2326 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8819 -2.3424 -1.1054 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5837 -3.6104 -1.3238 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8271 -4.3982 -0.3824 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0129 -4.0248 -2.5907 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1894 -3.1090 -3.6068 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7268 -3.4727 -4.8207 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0881 -4.7734 -5.0778 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8932 -5.6999 -4.0769 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3474 -5.3212 -2.8478 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5215 0.3253 -0.1757 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9109 2.2253 -0.0294 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2546 -1.7310 1.2723 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2187 -0.0335 3.4846 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1318 1.1117 2.1290 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9070 -0.4865 1.9074 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6789 -1.6161 1.8983 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8779 2.2079 1.8545 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2498 1.9097 2.9411 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5476 2.0628 1.1861 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5810 -0.5418 1.6776 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5380 -2.0772 0.2953 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2509 -3.2129 -1.9148 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3984 -2.3785 -3.8660 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8409 -0.4426 -3.7081 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1412 0.6961 -1.5381 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3574 1.8411 1.8835 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4861 0.9838 -0.0864 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4696 -1.2098 -0.5176 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5449 -1.7627 1.1368 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7932 -2.4123 0.6352 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2486 -0.6518 -1.5753 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3012 2.2388 -0.9937 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2806 0.8302 -2.0608 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7589 1.7080 -1.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0382 1.0600 0.9781 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5692 -0.3728 -0.1365 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5497 -1.1494 1.0522 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7565 -2.3874 -1.3107 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4144 -2.8071 -2.8699 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9895 -1.7031 -3.0437 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5188 -5.8255 1.2704 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7336 -5.6527 1.1687 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6824 -5.7720 -0.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1500 2.4442 0.6351 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1755 2.0260 -0.4718 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0638 4.0726 -2.4184 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0438 4.4585 0.4423 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5797 5.6265 -0.7157 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7559 4.8220 0.8552 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0134 6.6383 -0.0436 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1094 3.6123 -2.9909 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1462 1.5629 -2.7503 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2997 1.3093 2.9759 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0076 2.6219 2.2847 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6710 3.3712 1.4961 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5975 2.7787 3.2543 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1106 -1.3416 4.0036 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4585 -2.4681 2.6976 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4204 -0.9068 2.9776 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7601 -1.0875 3.7615 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7993 -0.9804 2.3821 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7359 -2.4627 2.6723 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6221 5.6309 2.2095 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8346 5.7357 3.5797 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1120 5.4923 3.9640 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0904 -2.0710 -3.4331 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8718 -2.7334 -5.5772 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5154 -5.0715 -6.0424 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1777 -6.7301 -4.2647 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2017 -6.0638 -2.0759 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1350 0.2160 -1.0435 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0303 3.1350 0.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4335 -2.2153 0.9471 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 3 5 1 0 5 6 2 0 6 7 1 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 2 0 11 12 1 0 12 13 2 0 7 14 1 0 14 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 6 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 1 31 32 1 0 32 33 2 0 32 34 1 0 25 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 38 43 1 0 37 44 1 0 23 45 1 0 45 46 2 0 45 47 1 0 47 48 1 0 48 49 2 0 49 50 1 0 48 51 1 0 51 52 1 0 51 53 1 0 47 54 1 0 54 55 1 0 55 56 2 0 55 57 1 0 21 58 1 0 58 59 1 0 59 60 2 0 59 61 1 0 61 62 2 0 62 63 1 0 63 64 2 0 64 65 1 0 65 66 2 0 20 67 1 6 14 68 1 0 5 69 1 0 13 8 1 0 49 18 1 0 66 61 1 0 51 20 1 0 28 22 1 0 41 36 1 0 30 27 1 0 1 70 1 0 1 71 1 0 1 72 1 0 2 73 1 0 4 74 1 0 4 75 1 0 4 76 1 0 7 77 1 0 9 78 1 0 10 79 1 0 11 80 1 0 12 81 1 0 13 82 1 0 14 83 1 0 18 84 1 6 19 85 1 0 19 86 1 0 21 87 1 0 22 88 1 0 24 89 1 0 24 90 1 0 24 91 1 0 25 92 1 1 26 93 1 0 26 94 1 0 27 95 1 6 29 96 1 0 29 97 1 0 34 98 1 0 34 99 1 0 34100 1 0 36101 1 1 37102 1 1 38103 1 6 39104 1 1 40105 1 0 40106 1 0 42107 1 0 43108 1 0 44109 1 0 47110 1 1 50111 1 0 50112 1 0 50113 1 0 52114 1 0 52115 1 0 52116 1 0 53117 1 0 53118 1 0 53119 1 0 57120 1 0 57121 1 0 57122 1 0 62123 1 0 63124 1 0 64125 1 0 65126 1 0 66127 1 0 67128 1 0 68129 1 0 69130 1 0 M END

Standard InCHIKey	HWPZOSPUENCAFV-PZPVWFPISA-N
Standard InCHI	InChI=1S/C50H61NO18/c1-9-24(2)43(59)51-35(28-16-12-10-13-17-28)37(56)45(61)66-31-21-50(62)42(68-44(60)29-18-14-11-15-19-29)40-48(8,41(58)39(65-26(4)52)34(25(31)3)47(50,6)7)32(20-33-49(40,23-64-33)69-27(5)53)67-46-38(57)36(55)30(54)22-63-46/h9-19,30-33,35-40,42,46,54-57,62H,20-23H2,1-8H3,(H,51,59)/b24-9+/t30-,31+,32+,33-,35?,36+,37?,38-,39-,40?,42?,46-,48-,49+,50-/m1/s1
SMILES	C/C=C(C)/C(=NC(c1ccccc1)C(C(=O)O[C@H]1C[C@]2(C(C3[C@@](C)([C@H](C[C@@H]4[C@]3(CO4)OC(=O)C)O[C@@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)C(=O)[C@@H](C(=C1C)C2(C)C)OC(=O)C)OC(=O)c1ccccc1)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO15125.2	Taxus wallichiana var. wallichiana	Varieties	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15125.2	Taxus wallichiana var. wallichiana	Varieties	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO15125.2	Taxus wallichiana var. wallichiana	Varieties	Taxaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC27650 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	9941
0.1-0.2	36092
0.2-0.3	3716
0.3-0.4	49
0.4-0.5	14
0.5-0.6	16
0.6-0.7	21
0.7-0.8	1
0.8-0.85	0
0.85-0.9	4
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC472391
0.8972	High Similarity	NPC479185
0.8807	High Similarity	NPC479184
0.8692	High Similarity	NPC116862
0.8532	High Similarity	NPC479173
0.7719	Intermediate Similarity	NPC479186
0.7586	Intermediate Similarity	NPC472375
0.7456	Intermediate Similarity	NPC289383
0.7364	Intermediate Similarity	NPC33372
0.7364	Intermediate Similarity	NPC67246
0.6852	Remote Similarity	NPC471493
0.6667	Remote Similarity	NPC472392
0.6609	Remote Similarity	NPC324251
0.6609	Remote Similarity	NPC206211
0.6552	Remote Similarity	NPC487360
0.6552	Remote Similarity	NPC479182
0.6552	Remote Similarity	NPC479180
0.6552	Remote Similarity	NPC471629
0.6552	Remote Similarity	NPC306001
0.6522	Remote Similarity	NPC453583
0.6471	Remote Similarity	NPC487361
0.6441	Remote Similarity	NPC275170
0.641	Remote Similarity	NPC478329
0.6387	Remote Similarity	NPC486061
0.6387	Remote Similarity	NPC486060
0.6379	Remote Similarity	NPC208553
0.6379	Remote Similarity	NPC181964
0.6379	Remote Similarity	NPC307628
0.6293	Remote Similarity	NPC473490
0.6293	Remote Similarity	NPC478328
0.6239	Remote Similarity	NPC471623
0.5785	Remote Similarity	NPC471754
0.5785	Remote Similarity	NPC479183
0.5785	Remote Similarity	NPC479181
0.575	Remote Similarity	NPC327699
0.562	Remote Similarity	NPC321072
0.562	Remote Similarity	NPC215892
0.562	Remote Similarity	NPC242662
0.5574	Remote Similarity	NPC453588
0.5492	Remote Similarity	NPC102167
0.5492	Remote Similarity	NPC488127
0.5447	Remote Similarity	NPC191193
0.5323	Remote Similarity	NPC473400
0.5254	Remote Similarity	NPC603140
0.5161	Remote Similarity	NPC36607
0.5091	Remote Similarity	NPC488128
0.5079	Remote Similarity	NPC603171

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC27650 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	3497
0.1-0.2	5500
0.2-0.3	140
0.3-0.4	0
0.4-0.5	4
0.5-0.6	5
0.6-0.7	2
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7117	Intermediate Similarity	NPD8435	Phase 4
0.6435	Remote Similarity	NPD8424	Phase 3
0.6379	Remote Similarity	NPD8485	Phase 4
0.5772	Remote Similarity	NPD8486	Phase 1
0.5492	Remote Similarity	NPD8360	Approved
0.5492	Remote Similarity	NPD8361	Phase 4
0.5194	Remote Similarity	NPD8470	Clinical (unspecified phase)
0.5036	Remote Similarity	NPD8462	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data